![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[VID]](/icons/movie.gif) | video.mp4 | 2022-06-30 09:36 | 450M | |
![[SND]](/icons/sound2.gif) | TOP 100 NEFFEX SONGS _ Best of NEFFEX.mp3 | 2022-07-12 20:05 | 399M | |
![[VID]](/icons/movie.gif) | MG-Mountiescare-IHC-RadioInterview-1080x1080px-FINAL.mp4 | 2022-07-13 02:14 | 388M | |
![[SND]](/icons/sound2.gif) | RAIM.mp3 | 2022-07-04 23:05 | 351M | |
![[SND]](/icons/sound2.gif) | It's raining, but we'll take you safely. 🚗🌂.mp3 | 2022-07-04 22:48 | 351M | |
![[SND]](/icons/sound2.gif) | lennoxssad2.mp3 | 2022-06-28 03:12 | 317M | |
![[SND]](/icons/sound2.gif) | gangsta3.mp3 | 2022-07-01 16:48 | 303M | |
![[SND]](/icons/sound2.gif) | jee5.mp3 | 2022-07-16 05:54 | 288M | |
![[SND]](/icons/sound2.gif) | Cozy Tavern - Music & Ambience.mp3 | 2022-07-01 02:27 | 280M | |
![[VID]](/icons/movie.gif) | Record_2022-07-13-17-26-35.mp4 | 2022-07-13 10:49 | 279M | |
![[SND]](/icons/sound2.gif) | O Segredo na Ilha ep2.m4a | 2022-07-15 12:28 | 276M | |
![[SND]](/icons/sound2.gif) | road1.mp3 | 2022-07-01 16:52 | 269M | |
![[SND]](/icons/sound2.gif) | 20220626_受苦與反抗.mp3 | 2022-07-03 08:23 | 264M | |
![[SND]](/icons/sound2.gif) | Y2Mate.is - ☕ 여유로움을 주는 감미로운 보사노바 재즈 한가득 🎹 카페, 매장음악 공부, 커피, 휴식, 수면, 독서, 병원, 태교, 힐링 Bossa nova Jazz 중간광고없음-RI1pk8MxhBQ-160k-1655263214994.mp3 | 2022-07-21 06:14 | 261M | |
![[SND]](/icons/sound2.gif) | barvixa.mp3 | 2022-07-12 18:42 | 242M | |
![[SND]](/icons/sound2.gif) | BusinessWithouttheBullsht49SecretsandShortcutsYouNeedtoKnow_ep6 (2).mp3 | 2022-07-02 14:53 | 242M | |
![[SND]](/icons/sound2.gif) | 36 - Prophets of Doom (1530-1536 CE).mp3 | 2022-07-05 03:34 | 238M | |
![[SND]](/icons/sound2.gif) | Wakno4.mp3 | 2022-07-04 17:13 | 223M | |
![[SND]](/icons/sound2.gif) | osjngogn.mp3 | 2022-07-15 17:03 | 217M | |
![[SND]](/icons/sound2.gif) | BetterMood.mp3 | 2022-06-29 16:24 | 216M | |
![[SND]](/icons/sound2.gif) | emenem.mp3 | 2022-07-08 04:23 | 216M | |
![[SND]](/icons/sound2.gif) | baka.mp3 | 2022-07-13 08:41 | 212M | |
![[SND]](/icons/sound2.gif) | GUSTIXA.mp3 | 2022-07-09 02:56 | 205M | |
![[SND]](/icons/sound2.gif) | traeger1.mp3 | 2022-07-21 20:07 | 201M | |
![[SND]](/icons/sound2.gif) | 1top1.mp3 | 2022-07-06 07:04 | 195M | |
![[SND]](/icons/sound2.gif) | mymix.mp3 | 2022-07-15 11:51 | 192M | |
![[SND]](/icons/sound2.gif) | disco1.mp3 | 2022-06-28 08:36 | 191M | |
![[SND]](/icons/sound2.gif) | beautiful_relaxing_music_with_rain_sounds_deep_sleep_music_insomnia_relaxing_music_-2576720887516849923.mp3 | 2022-06-27 16:16 | 189M | |
![[SND]](/icons/sound2.gif) | Lagu Dansa Timor Terbaru.mp3 | 2022-06-28 02:33 | 188M | |
![[SND]](/icons/sound2.gif) | cris.mp3 | 2022-07-01 16:46 | 186M | |
![[SND]](/icons/sound2.gif) | lennoxsberllinsad.mp3 | 2022-06-28 03:11 | 184M | |
![[SND]](/icons/sound2.gif) | Putra.mp3 | 2022-07-11 08:09 | 180M | |
![[SND]](/icons/sound2.gif) | FELIX IRWAN KOMPILASI MUSICA 2020.mp3 | 2022-06-28 02:28 | 179M | |
![[SND]](/icons/sound2.gif) | Wakno2.mp3 | 2022-07-04 16:50 | 179M | |
![[SND]](/icons/sound2.gif) | track.mp3 | 2022-07-07 06:34 | 175M | |
![[SND]](/icons/sound2.gif) | Unchained July Mix (1).mp3 | 2022-07-14 17:56 | 172M | |
![[SND]](/icons/sound2.gif) | album1.mp3 | 2022-07-10 23:36 | 172M | |
![[SND]](/icons/sound2.gif) | FULLGSX.mp3 | 2022-06-29 05:08 | 170M | |
![[SND]](/icons/sound2.gif) | lagusadzackob1.mp3 | 2022-07-11 17:18 | 169M | |
![[SND]](/icons/sound2.gif) | timur.mp3 | 2022-06-30 18:32 | 168M | |
![[SND]](/icons/sound2.gif) | DJ STANZ 2022 MIX 2.mp3 | 2022-07-08 07:33 | 168M | |
![[SND]](/icons/sound2.gif) | tami.mp3 | 2022-07-05 05:33 | 168M | |
![[SND]](/icons/sound2.gif) | tavern-music.mp3 | 2022-07-04 11:06 | 166M | |
![[SND]](/icons/sound2.gif) | 22a1-56c1-424e-a162-77ed16c0d98b.mp3 | 2022-07-13 16:14 | 164M | |
![[SND]](/icons/sound2.gif) | relaxing_sleep_music_rain_sounds_peaceful_piano_music_stress_relief_music_relaxing_music_5wCwBnMByoK-gucZSRBw.mp3 | 2022-06-27 16:16 | 163M | |
![[SND]](/icons/sound2.gif) | ClayCia4.mp3 | 2022-06-30 01:30 | 159M | |
![[SND]](/icons/sound2.gif) | Erlan3 .mp3 | 2022-07-09 08:57 | 157M | |
![[SND]](/icons/sound2.gif) | gtasa1.mp3 | 2022-07-01 16:44 | 157M | |
![[SND]](/icons/sound2.gif) | taxi edm.mp3 | 2022-07-03 07:46 | 156M | |
![[SND]](/icons/sound2.gif) | Lando5.mp3 | 2022-07-03 07:30 | 151M | |
![[SND]](/icons/sound2.gif) | Jus5.mp3 | 2022-07-01 06:21 | 150M | |
![[SND]](/icons/sound2.gif) | lagufull1.mp3 | 2022-07-06 06:59 | 149M | |
![[SND]](/icons/sound2.gif) | DJ TIKTOK TERBARU 2022 - DJ CAMPURAN FYP TIK TOK VIRAL 2022 JEDAG JEDUG FUL.mp3 | 2022-07-06 04:07 | 149M | |
![[SND]](/icons/sound2.gif) | free-test-data-1omb-mp3_XaFUWKqg.mp3 | 2022-07-01 07:06 | 149M | |
![[SND]](/icons/sound2.gif) | Y2mate.mx - STVOL.TV X RADUGA — CREAM SODA (320 kbps).mp3 | 2022-07-03 22:29 | 148M | |
![[SND]](/icons/sound2.gif) | BlackClover.mp3 | 2022-07-10 23:01 | 147M | |
![[SND]](/icons/sound2.gif) | Jungle Music & Tribal Music - Lost Rainforest (320 kbps).mp3 | 2022-07-13 02:52 | 145M | |
![[SND]](/icons/sound2.gif) | sadki1.mp3 | 2022-06-27 18:21 | 144M | |
![[SND]](/icons/sound2.gif) | MUSIK1.mp3 | 2022-07-05 14:04 | 143M | |
![[SND]](/icons/sound2.gif) | KUMPULAN LAGU TEMBANG KENANGAN Edwin Jandu.mp3 | 2022-06-28 02:26 | 142M | |
![[VID]](/icons/movie.gif) | [Otakumars]_Reimeiki_12_720p.mp4 | 2022-07-08 16:10 | 141M | |
![[SND]](/icons/sound2.gif) | siakol.mp3 | 2022-07-08 04:23 | 141M | |
![[SND]](/icons/sound2.gif) | Dugem3.mp3 | 2022-07-04 01:13 | 141M | |
![[SND]](/icons/sound2.gif) | CUESH_6_CYCLE_MIND_TOP_SONG_LI_(getmp3.pro).mp3 | 2022-07-13 13:52 | 140M | |
![[SND]](/icons/sound2.gif) | PHONK - 1 ЧАС ФОНКА _ PHONK _ ФОНК_.mp3 | 2022-07-09 11:13 | 138M | |
![[VID]](/icons/movie.gif) | [Otakumars]_Reimeiki_10_720p.mp4 | 2022-07-08 16:09 | 138M | |
![[SND]](/icons/sound2.gif) | m-MbsJhijJhn67WqsypdOvPQihOobypawFRFXZG8kJmND30JuhWGyJuqmTh9LNp1hosAFswNy_pvHYH1h3sxe28du-CwpYAyWwbJu7AqBuuftsJR8pBLDAmJ9Cpq1MNPGe_KfCryLvQF9wJDLlVHSE-TgF6c9GE6odqEOgm-AGAgO6LCOg.mp3 | 2022-07-01 01:57 | 138M | |
![[SND]](/icons/sound2.gif) | Топ Лучших Треков для Пробежки и Тренировок _ Музыка для бега _ Мотивация _ Тренажерный Зал.mp3 | 2022-07-13 13:41 | 138M | |
![[SND]](/icons/sound2.gif) | lennoxssad10.mp3 | 2022-06-28 03:08 | 138M | |
![[SND]](/icons/sound2.gif) | text to speech 2 hrs christian.mp3 | 2022-07-08 22:32 | 137M | |
![[SND]](/icons/sound2.gif) | text 2 speech.mp3 | 2022-07-12 19:39 | 137M | |
![[SND]](/icons/sound2.gif) | ge.mp3 | 2022-07-10 01:17 | 137M | |
![[SND]](/icons/sound2.gif) | tcuy4.mp3 | 2022-06-28 12:09 | 137M | |
![[VID]](/icons/movie.gif) | [Otakumars]_SMRTIRNDR_12_720p.mp4 | 2022-07-10 14:30 | 137M | |
![[SND]](/icons/sound2.gif) | Lando6.mp3 | 2022-07-03 09:06 | 136M | |
![[SND]](/icons/sound2.gif) | Isaac.mp3 | 2022-07-03 07:30 | 136M | |
![[VID]](/icons/movie.gif) | [Otakumars]_KONOHLR_11_720p.mp4 | 2022-07-09 12:24 | 136M | |
![[VID]](/icons/movie.gif) | [Otakumars]_KomiComdesuS2_12_720p.mp4 | 2022-07-08 14:51 | 134M | |
![[SND]](/icons/sound2.gif) | Bokzeb6.mp3 | 2022-07-10 03:27 | 134M | |
![[VID]](/icons/movie.gif) | ssstik.io_1656763085075.mp4 | 2022-07-03 05:54 | 133M | |
![[SND]](/icons/sound2.gif) | andrewE.mp3 | 2022-07-08 18:48 | 132M | |
![[SND]](/icons/sound2.gif) | Bokzeb3.mp3 | 2022-07-08 01:48 | 132M | |
![[SND]](/icons/sound2.gif) | lennoxsdj70.mp3 | 2022-06-28 03:09 | 132M | |
![[SND]](/icons/sound2.gif) | eschw.mp3 | 2022-07-01 01:48 | 131M | |
![[SND]](/icons/sound2.gif) | УВОЛЬНЯЮ ИГРОКОВ И УГАРАЮ НАД НИМИ на НУБО РП (6) (2).mp3 | 2022-07-08 16:42 | 131M | |
![[SND]](/icons/sound2.gif) | vedro9.mp3 | 2022-06-28 04:17 | 130M | |
![[SND]](/icons/sound2.gif) | Dj_ManaRooted_bullit_episode_mixtape.mp3 | 2022-07-08 06:28 | 130M | |
![[SND]](/icons/sound2.gif) | REVERB.mp3 | 2022-06-27 15:24 | 129M | |
![[SND]](/icons/sound2.gif) | nai nakraq neshto qko (1) (1).mp3 | 2022-07-07 09:36 | 129M | |
![[SND]](/icons/sound2.gif) | 【超好听】Vol.7 Vin3ent特辑 说说话 X 哎 X 光的方向 X交换余生 DJAQS 2022_02_11 MixTape (online-audio-converter.com).mp3 | 2022-07-13 07:18 | 129M | |
![[VID]](/icons/movie.gif) | [Otakumars]_ONIPAN_12_720p.mp4 | 2022-07-10 14:26 | 128M | |
![[SND]](/icons/sound2.gif) | _-__(getmp3.pro).mp3 | 2022-07-09 06:10 | 128M | |
![[SND]](/icons/sound2.gif) | local_media1573470726884406589.mp3 | 2022-06-30 04:28 | 125M | |
![[SND]](/icons/sound2.gif) | STATUE_-_LIL_EDDIE_-_Bagong_OPM_Cov_(getmp3.pro).mp3 | 2022-07-09 16:55 | 125M | |
![[VID]](/icons/movie.gif) | [Otakumars]_KomiComdesuS2_11_720p.mp4 | 2022-07-08 14:51 | 125M | |
![[SND]](/icons/sound2.gif) | Full Pokémon RB and GS Soundtracks (128 kbps) (www.youtube2mp3.biz).mp3 | 2022-07-04 20:18 | 125M | |
![[SND]](/icons/sound2.gif) | FULLEPISODE.mp3 | 2022-07-07 00:14 | 124M | |
![[SND]](/icons/sound2.gif) | Sweet Memories Song from Black Sweet.mp3 | 2022-06-28 02:25 | 124M | |
![[SND]](/icons/sound2.gif) | MANA-Greatest-Hits-Full-Abum-The-Best-Song-Of-MANAMP3-160K.mp3 | 2022-07-07 15:34 | 123M | |
![[SND]](/icons/sound2.gif) | China1.mp3 | 2022-07-04 01:03 | 123M | |
![[SND]](/icons/sound2.gif) | 내게능력주시는그리스도를통하여.m4a | 2022-07-06 03:34 | 122M | |
![[VID]](/icons/movie.gif) | DJ satu.mp4 | 2022-06-29 14:30 | 122M | |
![[VID]](/icons/movie.gif) | [Otakumars]_KONOHLR_12_720p.mp4 | 2022-07-09 12:26 | 121M | |
![[SND]](/icons/sound2.gif) | y2meta.com - DJ TIKTOK TERBARU 2022 - DJ SIKOK BAGI DUO PALEMBANG REMIX X BAJU HITAM X BENTO _ VIRAL FULL BASS (320 kbps).mp3 | 2022-07-11 22:27 | 120M | |
![[VID]](/icons/movie.gif) | y2mate.com - Best Imagine Dragons Never Broke Again Songs Of All Time Imagine Dragons Greatest Hits Album 2022_v720P.mp4 | 2022-07-15 11:29 | 120M | |
![[VID]](/icons/movie.gif) | PPP.mp4 | 2022-07-15 11:36 | 120M | |
![[SND]](/icons/sound2.gif) | New_OPM_Love_Songs_2022_New_Tagalo_(getmp3.pro) (1).mp3 | 2022-07-10 09:17 | 119M | |
![[SND]](/icons/sound2.gif) | Bokzeb1.mp3 | 2022-07-08 01:34 | 119M | |
![[SND]](/icons/sound2.gif) | New_OPM_Love_Songs_2022_New_Tagalo_(getmp3.pro).mp3 | 2022-07-10 09:19 | 119M | |
![[SND]](/icons/sound2.gif) | gerouz.mp3 | 2022-06-29 19:48 | 118M | |
![[SND]](/icons/sound2.gif) | New_Love_Songs_2021_-_Music_Travel_(getmp3.pro).mp3 | 2022-07-10 16:25 | 118M | |
![[VID]](/icons/movie.gif) | [Otakumars]_Reimeiki_11_720p.mp4 | 2022-07-08 16:09 | 118M | |
![[SND]](/icons/sound2.gif) | atom.mp3 | 2022-07-05 08:54 | 116M | |
![[SND]](/icons/sound2.gif) | Imahe_Balang_Araw_Nobela_Ikaw_At_(getmp3.pro).mp3 | 2022-07-08 17:39 | 116M | |
![[VID]](/icons/movie.gif) | [Otakumars]_SMRTIRNDR_10_720p.mp4 | 2022-07-10 14:30 | 116M | |
![[SND]](/icons/sound2.gif) | nfsmostwanted.mp3 | 2022-07-01 03:48 | 115M | |
![[SND]](/icons/sound2.gif) | Лучшая Фоновая Музыка _ No Commercial Music _ Hot party.mp3 | 2022-07-17 15:39 | 115M | |
![[SND]](/icons/sound2.gif) | HimigHeswitaBestCollection.mp3 | 2022-07-16 05:50 | 114M | |
![[SND]](/icons/sound2.gif) | Pasensya_Na_x_Beautiful_Scars_La_(getmp3.pro).mp3 | 2022-07-08 16:07 | 114M | |
![[SND]](/icons/sound2.gif) | et.mp3 | 2022-07-02 01:38 | 114M | |
![[VID]](/icons/movie.gif) | [Otakumars]_PermainanPertemanan_11_720p.mp4 | 2022-07-02 01:35 | 113M | |
![[SND]](/icons/sound2.gif) | SummerBeach Nintendo Music Mix.mp3 | 2022-07-14 19:21 | 113M | |
![[SND]](/icons/sound2.gif) | Bokzeb4.mp3 | 2022-07-08 01:53 | 113M | |
![[SND]](/icons/sound2.gif) | popsad.mp3 | 2022-07-04 17:59 | 113M | |
![[SND]](/icons/sound2.gif) | Bokzeb7.mp3 | 2022-07-10 03:37 | 113M | |
![[SND]](/icons/sound2.gif) | bb5.mp3 | 2022-07-08 19:57 | 113M | |
![[SND]](/icons/sound2.gif) | TitoDeib.mp3 | 2022-06-28 17:03 | 113M | |
![[SND]](/icons/sound2.gif) | san-juan-sounds-grand-theft-auto-iv-episodes-from-liberty-city-hosted-by-daddy-yankee.mp3 | 2022-06-30 12:40 | 113M | |
![[SND]](/icons/sound2.gif) | the-score-full-album-2022-the-score-greatest-hits-best-the-score-songs-playlist-2022.mp3 | 2022-07-14 08:49 | 113M | |
![[SND]](/icons/sound2.gif) | 2jam.mp3 | 2022-07-08 11:47 | 113M | |
![[SND]](/icons/sound2.gif) | phonky.mp3 | 2022-07-09 08:24 | 112M | |
![[SND]](/icons/sound2.gif) | Phonk_Music_Vol2_(getmp3.pro).mp3 | 2022-07-09 00:31 | 112M | |
![[SND]](/icons/sound2.gif) | bawX1.mp3 | 2022-07-04 12:05 | 112M | |
![[SND]](/icons/sound2.gif) | FULL ALBUM KENANGAN COVER KEYBOARD .mp3 | 2022-06-28 02:10 | 110M | |
![[SND]](/icons/sound2.gif) | jume.mp3 | 2022-07-03 14:46 | 110M | |
![[SND]](/icons/sound2.gif) | Kk3.mp3 | 2022-07-06 09:03 | 110M | |
![[SND]](/icons/sound2.gif) | old-school-rb-mix-ne-yo-chris-brown-usher-mario-1.mp3 | 2022-07-08 17:27 | 109M | |
![[VID]](/icons/movie.gif) | [Otakumars]_ONIPAN_11_720p.mp4 | 2022-07-09 12:26 | 109M | |
![[SND]](/icons/sound2.gif) | NCSAve.mp3 | 2022-07-08 09:51 | 109M | |
![[SND]](/icons/sound2.gif) | NEYO.mp3 | 2022-07-01 10:52 | 109M | |
![[SND]](/icons/sound2.gif) | anime-opening-music-mix.mp3 | 2022-06-29 14:50 | 109M | |
![[SND]](/icons/sound2.gif) | giradj2.mp3 | 2022-07-02 17:23 | 109M | |
![[SND]](/icons/sound2.gif) | Budots_Remix_Disco_Music_Nonstop_Vo_(getmp3.pro).mp3 | 2022-07-10 16:23 | 108M | |
![[SND]](/icons/sound2.gif) | Duoageng.mp3 | 2022-06-27 16:45 | 108M | |
![[SND]](/icons/sound2.gif) | 1_Hour_Jazz_Music_City_Jazz_Rel_(getmp3.pro).mp3 | 2022-07-21 08:03 | 108M | |
![[VID]](/icons/movie.gif) | [Otakumars]_ONIPAN_10_720p.mp4 | 2022-07-09 12:24 | 108M | |
![[SND]](/icons/sound2.gif) | 1_Hour_Jazz_Music_Coffee_Bar_In_(getmp3.pro).mp3 | 2022-07-21 06:59 | 108M | |
![[SND]](/icons/sound2.gif) | Latino_Songs_Music_2020_-_Nicky_Jam_(getmp3.pro).mp3 | 2022-07-11 02:03 | 108M | |
![[SND]](/icons/sound2.gif) | djter.mp3 | 2022-07-05 08:57 | 107M | |
![[SND]](/icons/sound2.gif) | March_Mood_Chill_Music_Palylist__(getmp3.pro).mp3 | 2022-07-14 11:45 | 107M | |
![[SND]](/icons/sound2.gif) | Undertale OST - His theme Collection (320 kbps) (https___youtube-to-mp3.id_).mp3 | 2022-06-30 15:05 | 107M | |
![[VID]](/icons/movie.gif) | clip4.mp4 | 2022-07-04 12:24 | 106M | |
![[SND]](/icons/sound2.gif) | FULLDJ.mp3 | 2022-06-29 05:46 | 106M | |
![[SND]](/icons/sound2.gif) | OPM_Mashup_2021_Playlist_-_Neil_Enr_(getmp3.pro).mp3 | 2022-07-08 15:31 | 105M | |
![[SND]](/icons/sound2.gif) | inbound940550879938929786.mp3 | 2022-06-27 15:43 | 105M | |
![[SND]](/icons/sound2.gif) | Dab_the_Sky_Said_the_Sky_Dabin_(getmp3.pro).mp3 | 2022-07-12 11:11 | 105M | |
![[SND]](/icons/sound2.gif) | DJ HOW U LIKE THAT X WHEN YOURE GONE BREAKBEAT TERENDULITA DI DUNIA JEDAG JEDUG BASSNYA .mp3 | 2022-06-30 10:57 | 105M | |
![[SND]](/icons/sound2.gif) | edmixrck2.mp3 | 2022-07-13 07:39 | 105M | |
![[SND]](/icons/sound2.gif) | Friday_Mood_Acoustic_Love_Songs_2_(getmp3.pro).mp3 | 2022-07-09 05:26 | 105M | |
![[SND]](/icons/sound2.gif) | mjgf.mp3 | 2022-07-14 07:01 | 105M | |
![[SND]](/icons/sound2.gif) | Hanz10.mp3 | 2022-06-28 11:28 | 103M | |
![[SND]](/icons/sound2.gif) | pp69.mp3 | 2022-06-30 13:28 | 103M | |
![[SND]](/icons/sound2.gif) | ANDREW_E_BEST_SONGS_ANDREW_E_NON_(getmp3.pro).mp3 | 2022-07-10 17:36 | 103M | |
![[SND]](/icons/sound2.gif) | Dugem4.mp3 | 2022-07-04 01:13 | 103M | |
![[VID]](/icons/movie.gif) | y2mate.com - 2pac Gansta Rap Old School Mix 2020New RapHip Hop Music Mix ft 2pac Eazy E Biggie Eminem_360p.mp4 | 2022-07-14 21:30 | 103M | |
![[SND]](/icons/sound2.gif) | ZomerseNotenkraker.mp3 | 2022-07-01 21:38 | 102M | |
![[SND]](/icons/sound2.gif) | Sunnyside mix-Prado de Dj.mp3 | 2022-07-10 10:11 | 102M | |
![[SND]](/icons/sound2.gif) | FSAD.mp3 | 2022-07-10 16:30 | 102M | |
![[SND]](/icons/sound2.gif) | ms13v6.mp3 | 2022-07-06 18:19 | 102M | |
![[SND]](/icons/sound2.gif) | N1NT3ND0.mp3 | 2022-07-05 01:55 | 101M | |
![[SND]](/icons/sound2.gif) | 06302022 definitive vol 2.mp3 | 2022-07-13 20:52 | 101M | |
![[SND]](/icons/sound2.gif) | sad20.mp3 | 2022-07-05 20:39 | 101M | |
![[SND]](/icons/sound2.gif) | Willsad.mp3 | 2022-07-01 10:02 | 101M | |
![[SND]](/icons/sound2.gif) | 07072022 - definitive vol 3.mp3 | 2022-07-13 20:53 | 100M | |
![[VID]](/icons/movie.gif) | [Otakumars]_SMRTIRNDR_11_720p.mp4 | 2022-07-10 14:28 | 100M | |
![[VID]](/icons/movie.gif) | [Otakumars]_YOUZITSU_S2_01_720p.mp4 | 2022-07-04 14:27 | 99M | |
![[SND]](/icons/sound2.gif) | Mashup.mp3 | 2022-06-27 15:06 | 99M | |
![[SND]](/icons/sound2.gif) | Bokzeb8.mp3 | 2022-07-10 03:45 | 99M | |
![[SND]](/icons/sound2.gif) | ambyar1.mp3 | 2022-07-05 19:50 | 98M | |
![[SND]](/icons/sound2.gif) | HIP HOP ESPAÑOL VARIOS RAP a la vieja escuela_192kbps.mp3 | 2022-06-29 20:28 | 97M | |
![[SND]](/icons/sound2.gif) | eki5.mp3 | 2022-07-02 06:03 | 97M | |
![[SND]](/icons/sound2.gif) | videoplayback (10) (online-audio-converter.com).mp3 | 2022-07-10 22:47 | 97M | |
![[SND]](/icons/sound2.gif) | Puscifer_ V Is for Vagina Full Album (256 kbps).mp3 | 2022-07-17 16:30 | 96M | |
![[SND]](/icons/sound2.gif) | DJ BREAKBEAT 2019 MELAYANG TINGGI BRO.mp3 | 2022-06-30 10:57 | 96M | |
![[SND]](/icons/sound2.gif) | AndrewEGloc9.mp3 | 2022-07-01 18:42 | 96M | |
![[SND]](/icons/sound2.gif) | 1nonstop2.mp3 | 2022-07-06 05:47 | 96M | |
![[SND]](/icons/sound2.gif) | NCS1.mp3 | 2022-07-04 01:22 | 95M | |
![[VID]](/icons/movie.gif) | [Playlist] songs that make you feel like a Peaky Blinder.mp4 | 2022-07-12 17:27 | 94M | |
![[SND]](/icons/sound2.gif) | Rk7.mp3 | 2022-07-17 06:24 | 94M | |
![[SND]](/icons/sound2.gif) | OPMAve.mp3 | 2022-07-08 09:39 | 93M | |
![[SND]](/icons/sound2.gif) | disco2.mp3 | 2022-06-28 08:35 | 93M | |
![[SND]](/icons/sound2.gif) | rock-2022-light-rock-alternative-gaming-music-streaming-music.mp3 | 2022-07-14 10:17 | 92M | |
![[SND]](/icons/sound2.gif) | poppunkcover.mp3 | 2022-07-09 22:43 | 92M | |
![[SND]](/icons/sound2.gif) | Frozen Tundra Campfire Exploration Ambience 1 Hour #dnd.mp3 | 2022-07-31 19:22 | 91M | |
![[SND]](/icons/sound2.gif) | Ernest3.m4a | 2022-07-06 17:02 | 91M | |
![[SND]](/icons/sound2.gif) | Mae.mp3 | 2022-07-11 10:50 | 91M | |
![[SND]](/icons/sound2.gif) | BKLYN No Loitering.mp3 | 2022-07-09 15:04 | 90M | |
![[SND]](/icons/sound2.gif) | CKOD1.mp3 | 2022-07-03 12:08 | 90M | |
![[SND]](/icons/sound2.gif) | free-test-data-1omb-mp3-xafuwkqg_j6OC1dv7.mp3 | 2022-07-01 07:22 | 89M | |
![[SND]](/icons/sound2.gif) | DJ BBHC PYRAMID SOUND DIRLYWELL JEDAG JEDUG MENGKANE VIRAL TIKTOK.mp3 | 2022-07-04 09:04 | 89M | |
![[SND]](/icons/sound2.gif) | nova7.mp3 | 2022-07-05 02:36 | 89M | |
![[VID]](/icons/movie.gif) | videoplayback (14).mp4 | 2022-07-11 20:06 | 89M | |
![[SND]](/icons/sound2.gif) | New_York_Jazz_Lounge_-_Bar_Jazz_Cla_(getmp3.pro).mp3 | 2022-07-21 04:36 | 88M | |
![[SND]](/icons/sound2.gif) | fort belan Actual.mp3 | 2022-06-28 21:14 | 88M | |
![[SND]](/icons/sound2.gif) | hight.mp3 | 2022-07-15 19:23 | 88M | |
![[SND]](/icons/sound2.gif) | IwanJGRP.mp3 | 2022-07-12 12:02 | 88M | |
![[SND]](/icons/sound2.gif) | 06252022 definitive vol 1.mp3 | 2022-07-13 20:50 | 88M | |
![[SND]](/icons/sound2.gif) | msk islam 1.m4a | 2022-07-13 10:29 | 88M | |
![[SND]](/icons/sound2.gif) | G.S.3.mp3 | 2022-07-19 14:14 | 88M | |
![[SND]](/icons/sound2.gif) | Ghofalos155.mp3 | 2022-06-28 02:29 | 87M | |
![[SND]](/icons/sound2.gif) | tsarmp3.mp3 | 2022-06-30 12:36 | 86M | |
![[SND]](/icons/sound2.gif) | BEST_MOST_POPULAR_MUSIC_BY_NEFFEX_(getmp3.pro).mp3 | 2022-07-24 15:30 | 86M | |
![[SND]](/icons/sound2.gif) | Kl.mp3 | 2022-07-03 20:33 | 86M | |
![[SND]](/icons/sound2.gif) | Playlist_of_songs_thatll_make_you_(getmp3.pro).mp3 | 2022-07-08 16:48 | 86M | |
![[SND]](/icons/sound2.gif) | Bokzeb5.mp3 | 2022-07-08 02:21 | 86M | |
![[SND]](/icons/sound2.gif) | jomar5.mp3 | 2022-07-11 03:08 | 86M | |
![[SND]](/icons/sound2.gif) | takbiran0122.mp3 | 2022-07-10 04:01 | 86M | |
![[SND]](/icons/sound2.gif) | Gusnigga.mp3 | 2022-06-27 16:31 | 86M | |
![[SND]](/icons/sound2.gif) | Joji_-_Nectar_Full_Album_(getmp3.pro).mp3 | 2022-06-29 20:01 | 86M | |
![[SND]](/icons/sound2.gif) | Lim.mp3 | 2022-07-04 22:36 | 86M | |
![[SND]](/icons/sound2.gif) | wawe70.mp3 | 2022-07-10 07:39 | 86M | |
![[SND]](/icons/sound2.gif) | nasidaria.mp3 | 2022-07-08 04:12 | 86M | |
![[SND]](/icons/sound2.gif) | Demetori - 愧人贖悪 ~ Evil People as the True Object of Salvation ~ (FULL SOUNDTRACK) (1).mp3 | 2022-07-11 16:01 | 85M | |
![[SND]](/icons/sound2.gif) | Música epica de fondo para videos _ epica, cinematográfica, acción, inspiracional..mp3 | 2022-07-01 15:06 | 84M | |
![[SND]](/icons/sound2.gif) | 1 Hour of Cop Killing.mp3 | 2022-07-09 05:18 | 83M | |
![[SND]](/icons/sound2.gif) | Korea_WUDC_2021_Open_Grand_Final_(getmp3.pro).mp3 | 2022-06-30 03:14 | 83M | |
![[SND]](/icons/sound2.gif) | IDUL.mp3 | 2022-07-09 17:10 | 83M | |
![[SND]](/icons/sound2.gif) | y2mate.com - The Beatles Guns N Roses Greatest Hits Full Album Update 2018 Best Classic Rock Songs Collection.mp3 | 2022-07-16 13:23 | 82M | |
![[SND]](/icons/sound2.gif) | Matt29.mp3 | 2022-07-13 03:03 | 82M | |
![[SND]](/icons/sound2.gif) | positive-energy-soft-music-with-ocean-waves-helps-relax-meditate-morning-relaxing-music.mp3 | 2022-07-14 09:50 | 82M | |
![[SND]](/icons/sound2.gif) | ms13v8.mp3 | 2022-07-06 18:19 | 82M | |
![[VID]](/icons/movie.gif) | joe.mp4 | 2022-07-15 00:14 | 81M | |
![[SND]](/icons/sound2.gif) | edmixrck1.mp3 | 2022-07-13 07:37 | 81M | |
![[SND]](/icons/sound2.gif) | jomar7.mp3 | 2022-07-11 06:31 | 81M | |
![[SND]](/icons/sound2.gif) | PaPuafull11.mp3 | 2022-07-11 22:46 | 80M | |
![[SND]](/icons/sound2.gif) | Falling_in_love_songs_playlist_To_(getmp3.pro).mp3 | 2022-08-01 07:57 | 80M | |
![[SND]](/icons/sound2.gif) | Kids1.mp3 | 2022-07-06 03:10 | 80M | |
![[SND]](/icons/sound2.gif) | arta17.mp3 | 2022-07-16 00:16 | 80M | |
![[SND]](/icons/sound2.gif) | dom92.mp3 | 2022-07-03 06:36 | 80M | |
![[VID]](/icons/movie.gif) | yt5s.io-DJ COCO SONG X I LIKE TO MOVE IT SOUND DANZZ_, DDZX REMIX BY DJ TOGOK MENGKANE-(480p).mp4 | 2022-06-29 12:21 | 80M | |
![[SND]](/icons/sound2.gif) | FLOWG.mp3 | 2022-07-04 06:18 | 79M | |
![[SND]](/icons/sound2.gif) | Matt28.mp3 | 2022-07-12 14:32 | 79M | |
![[SND]](/icons/sound2.gif) | audio_aleks.mp3 | 2022-07-01 11:50 | 79M | |
![[SND]](/icons/sound2.gif) | BALKAN MEGA HITOVI MIX 2021 200K SPECIAL DJ STOJAK.mp3 | 2022-07-03 11:22 | 79M | |
![[SND]](/icons/sound2.gif) | 101 - OUN-BAD.mp3 | 2022-07-03 03:05 | 79M | |
![[SND]](/icons/sound2.gif) | top20.mp3 | 2022-07-09 15:10 | 78M | |
![[SND]](/icons/sound2.gif) | RyderModeTakbir.mp3 | 2022-07-10 14:58 | 78M | |
![[SND]](/icons/sound2.gif) | DJJ25.mp3 | 2022-07-08 05:27 | 78M | |
![[SND]](/icons/sound2.gif) | DENNY CAKNAN.mp3 | 2022-07-13 12:11 | 78M | |
![[VID]](/icons/movie.gif) | [Otakumars]_ONIPAN_12_480p.mp4 | 2022-07-10 14:25 | 78M | |
![[SND]](/icons/sound2.gif) | bib.mp3 | 2022-06-30 11:47 | 78M | |
![[SND]](/icons/sound2.gif) | รวมเพลงไฮไลท RUOK.mp3 | 2022-06-30 11:37 | 78M | |
![[SND]](/icons/sound2.gif) | NCS2.mp3 | 2022-07-04 01:22 | 78M | |
![[VID]](/icons/movie.gif) | [Otakumars]_KONOHLR_11_480p.mp4 | 2022-07-09 12:20 | 78M | |
![[SND]](/icons/sound2.gif) | mochi.mp3 | 2022-07-10 15:52 | 78M | |
![[SND]](/icons/sound2.gif) | lennoxsdj170.mp3 | 2022-06-27 14:20 | 77M | |
![[SND]](/icons/sound2.gif) | หินเหล็กไฟ.mp3 | 2022-07-14 07:04 | 77M | |
![[SND]](/icons/sound2.gif) | REYNE.m4a | 2022-07-02 10:17 | 77M | |
![[VID]](/icons/movie.gif) | vuontam.mp4 | 2022-07-07 15:50 | 77M | |
![[VID]](/icons/movie.gif) | [Otakumars]_Reimeiki_12_480p.mp4 | 2022-07-08 16:09 | 77M | |
![[VID]](/icons/movie.gif) | [Otakumars]_KomiComdesuS2_12_480p.mp4 | 2022-07-08 14:48 | 77M | |
![[SND]](/icons/sound2.gif) | HH2.mp3 | 2022-07-14 07:37 | 77M | |
![[SND]](/icons/sound2.gif) | jack2.mp3 | 2022-07-06 10:04 | 77M | |
![[SND]](/icons/sound2.gif) | ho1.mp3 | 2022-07-10 18:58 | 77M | |
![[SND]](/icons/sound2.gif) | country-4.mp3 | 2022-06-28 09:52 | 76M | |
![[SND]](/icons/sound2.gif) | ExBattalionSkustaCleeFlowGKingBadger.mp3 | 2022-06-28 16:03 | 76M | |
![[SND]](/icons/sound2.gif) | giradangdut1.mp3 | 2022-07-04 17:36 | 76M | |
![[SND]](/icons/sound2.gif) | Initial_D_-_Night_Kids_Eurobeat_Mix(128k).mp3 | 2022-06-30 14:54 | 76M | |
![[SND]](/icons/sound2.gif) | QP.mp3 | 2022-07-02 15:55 | 76M | |
![[SND]](/icons/sound2.gif) | spotify.mp3 | 2022-07-24 17:43 | 76M | |
![[SND]](/icons/sound2.gif) | BestMusic.mp3 | 2022-06-28 16:02 | 76M | |
![[SND]](/icons/sound2.gif) | may.mp3 | 2022-07-06 00:20 | 76M | |
![[SND]](/icons/sound2.gif) | X2Download.com - SPOTIFY TOP HITS INDONESIA NOVEMBER 2021 (TANPA IKLAN) NO ADS 🌴🌴🌴 (128 kbps).mp3 | 2022-07-14 01:04 | 76M | |
![[SND]](/icons/sound2.gif) | OldSongDance.mp3 | 2022-07-02 08:32 | 75M | |
![[VID]](/icons/movie.gif) | [Otakumars]_SMRTIRNDR_12_480p.mp4 | 2022-07-10 14:27 | 75M | |
![[SND]](/icons/sound2.gif) | helman3.mp3 | 2022-06-30 07:17 | 75M | |
![[SND]](/icons/sound2.gif) | SILENT.mp3 | 2022-06-27 15:22 | 75M | |
![[SND]](/icons/sound2.gif) | NYCGANGSTER95.mp3 | 2022-07-11 02:20 | 75M | |
![[SND]](/icons/sound2.gif) | 1_hasyka_bop.mp3 | 2022-07-01 04:36 | 75M | |
![[SND]](/icons/sound2.gif) | lennoxsdj140.mp3 | 2022-06-28 02:53 | 75M | |
![[SND]](/icons/sound2.gif) | LBB.mp3 | 2022-07-08 12:26 | 75M | |
![[SND]](/icons/sound2.gif) | y2mate.com - عمر الزاهي 1982 الخلوي ساقي باقي يوم الجمعة خرجو الريام رأت عيني انا و المرسم ساعة الاخرة.mp3 | 2022-07-12 11:50 | 75M | |
![[SND]](/icons/sound2.gif) | phonkremix.mp3 | 2022-07-10 07:53 | 75M | |
![[SND]](/icons/sound2.gif) | msk islam 3.m4a | 2022-07-13 10:43 | 75M | |
![[SND]](/icons/sound2.gif) | cacicuceco.mp3 | 2022-07-24 02:51 | 75M | |
![[VID]](/icons/movie.gif) | Roki Vulovic - Panteri _ Mauzer ,English Lyrics.mp4 | 2022-07-09 10:22 | 74M | |
![[SND]](/icons/sound2.gif) | esckanefull.mp3 | 2022-07-05 04:16 | 74M | |
![[SND]](/icons/sound2.gif) | campuran.mp3 | 2022-08-02 16:10 | 74M | |
![[SND]](/icons/sound2.gif) | nayemoi.mp3 | 2022-07-08 00:43 | 74M | |
![[SND]](/icons/sound2.gif) | old songs but it's lofi remix _ I so sad.mp3 | 2022-06-28 01:13 | 74M | |
![[SND]](/icons/sound2.gif) | Lofimipota1.mp3 | 2022-06-28 02:11 | 74M | |
![[SND]](/icons/sound2.gif) | mats16.mp3 | 2022-07-09 04:14 | 74M | |
![[SND]](/icons/sound2.gif) | Nik1.mp3 | 2022-07-05 18:44 | 74M | |
![[SND]](/icons/sound2.gif) | SAMusic2.mp3 | 2022-07-02 18:19 | 74M | |
![[SND]](/icons/sound2.gif) | trungquoc.mp3 | 2022-07-10 04:26 | 74M | |
![[SND]](/icons/sound2.gif) | dugem.mp3 | 2022-07-25 10:58 | 73M | |
![[SND]](/icons/sound2.gif) | NhacEdmhay.mp3 | 2022-07-14 01:15 | 73M | |
![[SND]](/icons/sound2.gif) | One13.mp3 | 2022-07-12 13:18 | 73M | |
![[SND]](/icons/sound2.gif) | sdk7.mp3 | 2022-07-11 12:06 | 73M | |
![[SND]](/icons/sound2.gif) | videoplayback (11) (online-audio-converter.com).mp3 | 2022-07-11 12:53 | 73M | |
![[SND]](/icons/sound2.gif) | damcuoimientay.mp3 | 2022-07-06 19:23 | 73M | |
![[SND]](/icons/sound2.gif) | รวมเพลงฮิตเพราะๆที่สุด โป่ง ปฐมพงศ์ ศรัทธา ยอม...ธอ หลงกล ง่ายเกินไป ดีที่สุดแล้ว ฉันไม่ใช่.mp3 | 2022-07-11 10:39 | 73M | |
![[SND]](/icons/sound2.gif) | edgunnroses.mp3 | 2022-07-13 07:36 | 73M | |
![[SND]](/icons/sound2.gif) | Suresh - Party House Music 2016.mp3 | 2022-06-30 05:06 | 73M | |
![[SND]](/icons/sound2.gif) | huy9.mp3 | 2022-07-14 08:26 | 72M | |
![[SND]](/icons/sound2.gif) | song8.mp3 | 2022-06-29 20:31 | 72M | |
![[SND]](/icons/sound2.gif) | huy8.mp3 | 2022-07-09 08:52 | 72M | |
![[SND]](/icons/sound2.gif) | natural1.mp3 | 2022-07-12 18:13 | 72M | |
![[SND]](/icons/sound2.gif) | Wave IV - Adventure 3 - Free Flow 12.mp3 | 2022-07-04 23:09 | 72M | |
![[SND]](/icons/sound2.gif) | nhactre.mp3 | 2022-07-17 09:38 | 72M | |
![[SND]](/icons/sound2.gif) | NEW-GENERATION-ITALO-DISCO-BCR-DREAM-MIX_Pfgj-NTyWLI - Copy.mp3 | 2022-07-10 15:53 | 72M | |
![[SND]](/icons/sound2.gif) | spotifyy.mp3 | 2022-07-06 00:24 | 72M | |
![[SND]](/icons/sound2.gif) | Proverbs - Introduction 7-29-22.MP.mp3 | 2022-07-06 23:31 | 72M | |
![[SND]](/icons/sound2.gif) | GTW.mp3 | 2022-07-06 08:50 | 72M | |
![[SND]](/icons/sound2.gif) | MEMO.mp3 | 2022-06-27 15:08 | 71M | |
![[SND]](/icons/sound2.gif) | helman6.mp3 | 2022-07-13 18:32 | 71M | |
![[VID]](/icons/movie.gif) | [Otakumars]_KomiComdesuS2_11_480p.mp4 | 2022-07-08 14:48 | 71M | |
![[SND]](/icons/sound2.gif) | Rawr3.mp3 | 2022-07-02 03:04 | 71M | |
![[SND]](/icons/sound2.gif) | anhdz.mp3 | 2022-07-13 07:30 | 71M | |
![[VID]](/icons/movie.gif) | [Otakumars]_Reimeiki_10_480p.mp4 | 2022-07-08 16:07 | 71M | |
![[SND]](/icons/sound2.gif) | OPMCHILL2.mp3 | 2022-06-27 15:14 | 71M | |
![[SND]](/icons/sound2.gif) | lennoxsdj120.mp3 | 2022-06-28 02:51 | 71M | |
![[SND]](/icons/sound2.gif) | Interview_with_J_starr.mp3 | 2022-07-15 02:56 | 70M | |
![[SND]](/icons/sound2.gif) | Waknos1.mp3 | 2022-06-28 11:07 | 70M | |
![[VID]](/icons/movie.gif) | pov_ you're the villain everybody loves _ 𝐚 𝐩𝐥𝐚𝐲𝐥𝐢𝐬𝐭.mp4 | 2022-07-12 17:47 | 70M | |
![[SND]](/icons/sound2.gif) | bam.mp3 | 2022-07-05 12:14 | 70M | |
![[SND]](/icons/sound2.gif) | Jawa 2.mp3 | 2022-07-10 03:08 | 70M | |
![[VID]](/icons/movie.gif) | [Otakumars]_KONOHLR_12_480p.mp4 | 2022-07-09 12:18 | 70M | |
![[SND]](/icons/sound2.gif) | yamate.mp3 | 2022-07-08 21:46 | 70M | |
![[VID]](/icons/movie.gif) | Rz.mp4 | 2022-07-01 03:06 | 69M | |
![[SND]](/icons/sound2.gif) | Songs.mp3 | 2022-07-03 06:27 | 69M | |
![[SND]](/icons/sound2.gif) | OPM Songs.mp3 | 2022-07-03 01:11 | 69M | |
![[SND]](/icons/sound2.gif) | hiling1.mp3 | 2022-07-10 16:59 | 69M | |
![[SND]](/icons/sound2.gif) | Surya3.mp3 | 2022-07-11 18:09 | 69M | |
![[SND]](/icons/sound2.gif) | Guard_Dogs_Random_Barking_and_Gro_(getmp3.pro).mp3 | 2022-07-05 19:31 | 69M | |
![[SND]](/icons/sound2.gif) | BackMusic.mp3 | 2022-07-12 20:20 | 69M | |
![[SND]](/icons/sound2.gif) | FULLALB.mp3 | 2022-07-12 17:41 | 69M | |
![[SND]](/icons/sound2.gif) | CasaLoco mix from Lady Lane.mp3 | 2022-07-01 19:06 | 69M | |
![[SND]](/icons/sound2.gif) | lennoxsdj130.mp3 | 2022-06-28 02:50 | 69M | |
![[SND]](/icons/sound2.gif) | ucopbeban.mp3 | 2022-07-11 10:46 | 69M | |
![[SND]](/icons/sound2.gif) | asd1.mp3 | 2022-06-30 19:13 | 69M | |
![[SND]](/icons/sound2.gif) | Ucop2.mp3 | 2022-07-11 09:22 | 69M | |
![[SND]](/icons/sound2.gif) | Gustixa10.mp3 | 2022-06-30 08:19 | 69M | |
![[SND]](/icons/sound2.gif) | Gm69.mp3 | 2022-07-11 09:13 | 69M | |
![[SND]](/icons/sound2.gif) | Dijehasik.mp3 | 2022-07-07 03:53 | 69M | |
![[SND]](/icons/sound2.gif) | esckanefull1.mp3 | 2022-07-05 04:15 | 69M | |
![[SND]](/icons/sound2.gif) | Ezra2.mp3 | 2022-07-12 23:20 | 68M | |
![[SND]](/icons/sound2.gif) | album2.mp3 | 2022-07-15 12:24 | 68M | |
![[SND]](/icons/sound2.gif) | nhacfenthich.mp3 | 2022-07-03 16:29 | 68M | |
![[SND]](/icons/sound2.gif) | MbellSad.mp3 | 2022-07-02 18:11 | 68M | |
![[SND]](/icons/sound2.gif) | nhac hya.mp3 | 2022-06-30 14:18 | 68M | |
![[SND]](/icons/sound2.gif) | gaidiem.mp3 | 2022-07-03 17:15 | 68M | |
![[SND]](/icons/sound2.gif) | جميع موسيقى مسلسل المؤسس عثمان ألبوم كامل جودة عالية (192 kbps).mp3 | 2022-06-27 13:01 | 68M | |
![[SND]](/icons/sound2.gif) | Party Music 2000 to 2021 🥳 Best Songs that Make You Dance.mp3 | 2022-07-09 16:31 | 68M | |
![[SND]](/icons/sound2.gif) | brando.mp3 | 2022-07-09 02:41 | 68M | |
![[SND]](/icons/sound2.gif) | ฟังแบบยาวๆ Attack - HAWKCRY.mp3 | 2022-07-02 08:52 | 68M | |
![[SND]](/icons/sound2.gif) | strong1.mp3 | 2022-07-11 10:34 | 68M | |
![[VID]](/icons/movie.gif) | [Otakumars]_ONIPAN_11_480p.mp4 | 2022-07-09 12:24 | 67M | |
![[SND]](/icons/sound2.gif) | CR.mp3 | 2022-07-05 17:01 | 67M | |
![[SND]](/icons/sound2.gif) | juk.mp3 | 2022-07-02 05:25 | 67M | |
![[SND]](/icons/sound2.gif) | lor1jam.mp3 | 2022-07-08 09:39 | 67M | |
![[SND]](/icons/sound2.gif) | GEMATAKBIRR.mp3 | 2022-07-09 12:51 | 67M | |
![[SND]](/icons/sound2.gif) | lennoxsdj200.mp3 | 2022-06-27 14:20 | 66M | |
![[SND]](/icons/sound2.gif) | SaveTube.App - เพลงอังกฤษในtiktok2021! เพลงสากลในแอพtiktok! เพลง tik tok อังกฤษ 2021 (128 kbps).mp3 | 2022-07-03 20:30 | 66M | |
![[SND]](/icons/sound2.gif) | NR.mp3 | 2022-07-03 20:41 | 66M | |
![[SND]](/icons/sound2.gif) | Bokzeb2.mp3 | 2022-07-08 01:41 | 66M | |
![[VID]](/icons/movie.gif) | [Otakumars]_ONIPAN_10_480p.mp4 | 2022-07-09 12:23 | 66M | |
![[SND]](/icons/sound2.gif) | ling.mp3 | 2022-07-03 09:50 | 66M | |
![[SND]](/icons/sound2.gif) | huy5.mp3 | 2022-07-07 08:46 | 66M | |
![[SND]](/icons/sound2.gif) | VhongNavarro.mp3 | 2022-07-01 19:59 | 66M | |
![[SND]](/icons/sound2.gif) | เพลงติ๊กต๊อก2020! เพลงสากลในแอพtiktok! เพลง tik tok อังกฤษ!.mp3 | 2022-07-03 19:59 | 66M | |
![[SND]](/icons/sound2.gif) | quangdz.mp3 | 2022-07-12 13:02 | 66M | |
![[SND]](/icons/sound2.gif) | satuuntukberbagi.mp3 | 2022-07-08 13:51 | 65M | |
![[SND]](/icons/sound2.gif) | lennoxsdj80.mp3 | 2022-06-28 02:54 | 65M | |
![[SND]](/icons/sound2.gif) | sid.mp3 | 2022-07-06 19:08 | 65M | |
![[SND]](/icons/sound2.gif) | dije8.mp3 | 2022-07-01 14:43 | 65M | |
![[SND]](/icons/sound2.gif) | SPOTIFY.mp3 | 2022-07-14 11:26 | 65M | |
![[SND]](/icons/sound2.gif) | Hayzo.mp3 | 2022-07-15 03:27 | 65M | |
![[SND]](/icons/sound2.gif) | luckytheripper.mp3 | 2022-07-11 10:27 | 65M | |
![[SND]](/icons/sound2.gif) | dhijeremex.mp3 | 2022-07-10 04:41 | 65M | |
![[SND]](/icons/sound2.gif) | Djterbaru.mp3 | 2022-07-02 10:29 | 65M | |
![[SND]](/icons/sound2.gif) | lennoxsdj90.mp3 | 2022-06-28 02:46 | 65M | |
![[SND]](/icons/sound2.gif) | illslick.mp3 | 2022-06-29 17:03 | 64M | |
![[SND]](/icons/sound2.gif) | vedro13.mp3 | 2022-06-30 06:11 | 64M | |
![[SND]](/icons/sound2.gif) | eros13.mp3 | 2022-07-07 11:11 | 64M | |
![[VID]](/icons/movie.gif) | [Otakumars]_Reimeiki_11_480p.mp4 | 2022-07-08 16:06 | 64M | |
![[SND]](/icons/sound2.gif) | videoplayback (9) (online-audio-converter.com).mp3 | 2022-07-10 22:08 | 64M | |
![[VID]](/icons/movie.gif) | [Otakumars]_SMRTIRNDR_10_480p.mp4 | 2022-07-10 14:24 | 64M | |
![[SND]](/icons/sound2.gif) | locxaolol.mp3 | 2022-07-11 05:01 | 64M | |
![[SND]](/icons/sound2.gif) | morgenshtern-million-dollar-business-albom-mp3.mp3 | 2022-07-08 03:02 | 64M | |
![[SND]](/icons/sound2.gif) | soxo.mp3 | 2022-07-03 12:34 | 63M | |
![[SND]](/icons/sound2.gif) | Badri98.mp3 | 2022-07-16 09:10 | 63M | |
![[SND]](/icons/sound2.gif) | fn.mp3 | 2022-07-16 07:37 | 63M | |
![[SND]](/icons/sound2.gif) | SILLYFOOLS.mp3 | 2022-07-15 15:10 | 63M | |
![[SND]](/icons/sound2.gif) | silly.mp3 | 2022-06-29 17:09 | 63M | |
![[VID]](/icons/movie.gif) | sabri.3.mp4 | 2022-07-12 21:21 | 63M | |
![[VID]](/icons/movie.gif) | Blingos ft. Klay Bbj - Rbo3 Se3a _ ربع ساعة.mp4 | 2022-07-12 19:43 | 63M | |
![[SND]](/icons/sound2.gif) | rain_sounds_1_hours_sound_of_rain_meditation_autogenic_training_deep_sleep_relaxing_sounds_-95636237158839206.mp3 | 2022-06-27 16:12 | 63M | |
![[SND]](/icons/sound2.gif) | ЭТА МУЗЫКА УНЕСЕТ ВАС В КОСМОС 🌌 МУЗЫКА В МАШИНУ 🚔 ПОДБОРКА ПЕСЕН 🎵 ПЕСНИ БЕСПЛАТНО.mp3 | 2022-07-13 09:13 | 63M | |
![[SND]](/icons/sound2.gif) | hasyka_tony_q_rastafara_fullalbum.mp3 | 2022-07-04 00:07 | 63M | |
![[VID]](/icons/movie.gif) | [Otakumars]_PermainanPertemanan_12_480p.mp4 | 2022-07-02 01:34 | 63M | |
![[SND]](/icons/sound2.gif) | giradj1.mp3 | 2022-06-30 16:15 | 63M | |
![[SND]](/icons/sound2.gif) | disco3.mp3 | 2022-06-28 08:35 | 63M | |
![[SND]](/icons/sound2.gif) | TitoDeib2.mp3 | 2022-06-29 17:46 | 62M | |
![[SND]](/icons/sound2.gif) | X2Download.com - Vampyr Game Soundtrack (128 kbps).mp3 | 2022-07-10 22:06 | 62M | |
![[SND]](/icons/sound2.gif) | hex_stallbert-ganteng.mp3 | 2022-07-01 16:50 | 62M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Monday Mood Morning Chill Mix English songs chill music mix.mp3 | 2022-06-28 08:43 | 62M | |
![[SND]](/icons/sound2.gif) | MOOD15.mp3 | 2022-06-28 08:47 | 62M | |
![[SND]](/icons/sound2.gif) | GauTeddy1.mp3 | 2022-07-12 02:07 | 62M | |
![[SND]](/icons/sound2.gif) | rapsaykoji.mp3 | 2022-07-11 17:22 | 62M | |
![[SND]](/icons/sound2.gif) | GauTeddy3.mp3 | 2022-07-12 08:35 | 62M | |
![[SND]](/icons/sound2.gif) | รวมเพลงฮิตในTikTokล่าสุด รวมเพลงฮิตในแอพติ๊กต๊อกล่าสุด _ มีเพียงแค่เธอคนเดียวเท่านั้น.mp3 | 2022-07-08 17:57 | 62M | |
![[SND]](/icons/sound2.gif) | tommy1.mp3 | 2022-07-12 03:23 | 62M | |
![[SND]](/icons/sound2.gif) | ap1.mp3 | 2022-07-18 15:34 | 62M | |
![[SND]](/icons/sound2.gif) | รวมเพลงฮิตในTikTokล่าสุด รวมเพลงฮิตในแอพติ๊กต๊อกล่าสุด แค่มีเธอก็พอ.mp3 | 2022-07-16 05:44 | 62M | |
![[SND]](/icons/sound2.gif) | ARDJ4.mp3 | 2022-07-01 17:17 | 62M | |
![[SND]](/icons/sound2.gif) | tamswat.mp3 | 2022-07-02 02:29 | 62M | |
![[SND]](/icons/sound2.gif) | no_copyright_rap_music_mix_2021_1_hour_of_the_best_background_songs_for_live_streaming_and_gaming_1690815827175970632.mp3 | 2022-07-12 15:13 | 62M | |
![[SND]](/icons/sound2.gif) | MOLLBEN47.mp3 | 2022-06-30 20:24 | 62M | |
![[SND]](/icons/sound2.gif) | edgreenday.mp3 | 2022-07-13 07:34 | 62M | |
![[SND]](/icons/sound2.gif) | lennoxsdj150.mp3 | 2022-06-28 02:47 | 61M | |
![[SND]](/icons/sound2.gif) | Ya1.mp3 | 2022-07-10 11:32 | 61M | |
![[SND]](/icons/sound2.gif) | VIP2.mp3 | 2022-07-02 03:51 | 61M | |
![[SND]](/icons/sound2.gif) | AUUGHHH TikTok Sound 1 HOUR (1).mp3 | 2022-07-10 03:48 | 61M | |
![[SND]](/icons/sound2.gif) | djardi.mp3 | 2022-07-11 01:56 | 61M | |
![[SND]](/icons/sound2.gif) | SADPARAH.mp3 | 2022-07-14 04:43 | 61M | |
![[SND]](/icons/sound2.gif) | xen4.mp3 | 2022-07-04 09:50 | 61M | |
![[SND]](/icons/sound2.gif) | ditsad.mp3 | 2022-07-03 18:12 | 61M | |
![[SND]](/icons/sound2.gif) | rock taxi.mp3 | 2022-07-02 18:48 | 61M | |
![[SND]](/icons/sound2.gif) | ryan2.mp3 | 2022-07-02 10:32 | 61M | |
![[SND]](/icons/sound2.gif) | Volume 1.mp3 | 2022-07-03 18:07 | 61M | |
![[SND]](/icons/sound2.gif) | WIBOY9.mp3 | 2022-06-28 05:33 | 61M | |
![[SND]](/icons/sound2.gif) | modar.mp3 | 2022-07-06 22:37 | 61M | |
![[SND]](/icons/sound2.gif) | Remix dj johhn depper rap tunise.mp3 | 2022-07-10 13:21 | 60M | |
![[SND]](/icons/sound2.gif) | hasyka_bop_marley_fullalbum.mp3 | 2022-07-03 23:21 | 60M | |
![[VID]](/icons/movie.gif) | videoplayback_2.mp4 | 2022-07-14 17:04 | 60M | |
![[SND]](/icons/sound2.gif) | florentino.mp3 | 2022-07-05 09:10 | 60M | |
![[SND]](/icons/sound2.gif) | ilham21.mp3 | 2022-07-11 06:01 | 60M | |
![[SND]](/icons/sound2.gif) | TK.mp3 | 2022-07-02 05:33 | 60M | |
![[SND]](/icons/sound2.gif) | zcx.mp3 | 2022-06-28 13:35 | 60M | |
![[SND]](/icons/sound2.gif) | GamerPack.mp3 | 2022-06-29 17:32 | 60M | |
![[SND]](/icons/sound2.gif) | Dcfull.mp3 | 2022-07-03 05:09 | 60M | |
![[SND]](/icons/sound2.gif) | saran1.mp3 | 2022-06-27 15:42 | 60M | |
![[SND]](/icons/sound2.gif) | saran.mp3 | 2022-07-12 07:26 | 60M | |
![[SND]](/icons/sound2.gif) | Zzzz.mp3 | 2022-07-04 09:23 | 60M | |
![[SND]](/icons/sound2.gif) | Fm.mp3 | 2022-07-04 09:04 | 60M | |
![[SND]](/icons/sound2.gif) | DJKEREN.mp3 | 2022-07-05 23:07 | 60M | |
![[SND]](/icons/sound2.gif) | FiveM.mp3 | 2022-06-29 22:54 | 60M | |
![[VID]](/icons/movie.gif) | yt1s.com - Bankrol Hayden Cabo Official Music Video.mp4 | 2022-07-02 11:06 | 60M | |
![[SND]](/icons/sound2.gif) | lennoxsdj50.mp3 | 2022-06-28 03:04 | 60M | |
![[SND]](/icons/sound2.gif) | djc.mp3 | 2022-07-03 05:04 | 60M | |
![[SND]](/icons/sound2.gif) | Zzz.mp3 | 2022-07-30 19:43 | 60M | |
![[VID]](/icons/movie.gif) | Spanish Music.mp4 | 2022-07-11 01:56 | 59M | |
![[SND]](/icons/sound2.gif) | girambyar1.mp3 | 2022-07-12 04:23 | 59M | |
![[SND]](/icons/sound2.gif) | girambyar.mp3 | 2022-07-12 03:57 | 59M | |
![[SND]](/icons/sound2.gif) | Girambyar1.mp3 | 2022-07-12 13:14 | 59M | |
![[SND]](/icons/sound2.gif) | yuk_bersholawat_bop.mp3 | 2022-07-08 22:25 | 59M | |
![[SND]](/icons/sound2.gif) | STVOL.TV X RADUGA - CREAM SODA.mp3 | 2022-07-03 22:33 | 59M | |
![[SND]](/icons/sound2.gif) | Starla1.mp3 | 2022-07-06 13:37 | 59M | |
![[SND]](/icons/sound2.gif) | Trending Tiktok songs 2022 _ Viral songs latest _ New Tiktok songs 2022.mp3 | 2022-07-08 10:09 | 59M | |
![[SND]](/icons/sound2.gif) | 3W.mp3 | 2022-06-30 08:40 | 59M | |
![[SND]](/icons/sound2.gif) | lofi.mp3 | 2022-07-09 06:40 | 59M | |
![[SND]](/icons/sound2.gif) | siu1.mp3 | 2022-07-12 11:26 | 59M | |
![[SND]](/icons/sound2.gif) | hataw2.mp3 | 2022-06-28 22:00 | 59M | |
![[SND]](/icons/sound2.gif) | blls0.mp3 | 2022-07-02 19:15 | 59M | |
![[SND]](/icons/sound2.gif) | bawX.mp3 | 2022-07-04 11:51 | 59M | |
![[SND]](/icons/sound2.gif) | safd.mp3 | 2022-07-01 15:21 | 59M | |
![[SND]](/icons/sound2.gif) | รวมเพลงเศร้าในTikTokล่าสุด รวมเพลงSad Boy _ เพลงนี้ผมเขียนให้เธอ💔.mp3 | 2022-07-10 18:31 | 58M | |
![[VID]](/icons/movie.gif) | [Otakumars]_YOUZITSU_S2_01_480p.mp4 | 2022-07-04 14:24 | 58M | |
![[SND]](/icons/sound2.gif) | Dance1.mp3 | 2022-07-06 03:10 | 58M | |
![[SND]](/icons/sound2.gif) | ms13v2.mp3 | 2022-07-06 18:16 | 58M | |
![[SND]](/icons/sound2.gif) | inbound9047305271652840609.mp3 | 2022-06-30 10:04 | 58M | |
![[VID]](/icons/movie.gif) | [Otakumars]_PermainanPertemanan_11_480p.mp4 | 2022-07-02 01:34 | 58M | |
![[SND]](/icons/sound2.gif) | MUSIK2.mp3 | 2022-07-05 13:55 | 58M | |
![[SND]](/icons/sound2.gif) | Kai.mp3 | 2022-07-14 12:05 | 58M | |
![[SND]](/icons/sound2.gif) | JpopBest.mp3 | 2022-07-03 11:47 | 58M | |
![[SND]](/icons/sound2.gif) | lennoxssad.mp3 | 2022-06-28 03:14 | 58M | |
![[SND]](/icons/sound2.gif) | y2mate.com - monokrom tulus 1hour.mp3 | 2022-07-15 01:45 | 58M | |
![[SND]](/icons/sound2.gif) | monokrom.mp3 | 2022-07-15 02:01 | 58M | |
![[SND]](/icons/sound2.gif) | thailandstyle.mp3 | 2022-07-06 18:42 | 58M | |
![[SND]](/icons/sound2.gif) | Ts.mp3 | 2022-07-22 02:41 | 58M | |
![[SND]](/icons/sound2.gif) | maylofi.mp3 | 2022-07-06 00:19 | 58M | |
![[SND]](/icons/sound2.gif) | lennoxsdj100.mp3 | 2022-06-28 02:50 | 58M | |
![[SND]](/icons/sound2.gif) | nanhky.mp3 | 2022-07-11 11:51 | 57M | |
![[SND]](/icons/sound2.gif) | Звук ядерной сирены _ 10 ЧАСОВ! _ Ядерная сирена _ Воздушная тревога (256 kbps).mp3 | 2022-07-07 15:59 | 57M | |
![[SND]](/icons/sound2.gif) | videoplayback (16) (online-audio-converter.com).mp3 | 2022-07-13 20:22 | 57M | |
![[VID]](/icons/movie.gif) | y2mate.com - 2Pac Gangsta Rap Old School Mix July 2021 Best 2Pac Rap Hip Hop Music Mix ft Eminem Biggie_360p.mp4 | 2022-07-14 21:36 | 57M | |
![[SND]](/icons/sound2.gif) | Pol2.mp3 | 2022-07-07 07:55 | 57M | |
![[SND]](/icons/sound2.gif) | Irwan.mp3 | 2022-07-10 05:03 | 57M | |
![[SND]](/icons/sound2.gif) | EDWIN LAULAKA FULL ALBUM DJ TERBARU 2022.mp3 | 2022-06-27 13:22 | 57M | |
![[SND]](/icons/sound2.gif) | Chill1H.mp3 | 2022-06-30 09:11 | 57M | |
![[SND]](/icons/sound2.gif) | mayrock3.mp3 | 2022-07-06 00:19 | 57M | |
![[SND]](/icons/sound2.gif) | bajidor.mp3 | 2022-07-11 21:58 | 57M | |
![[SND]](/icons/sound2.gif) | videoplayback (4) (online-audio-converter.com).mp3 | 2022-07-05 19:10 | 57M | |
![[VID]](/icons/movie.gif) | y2mate.com - Rick Astley Never Gonna Give You Up Official Music Video_720p.mp4 | 2022-07-02 09:55 | 57M | |
![[SND]](/icons/sound2.gif) | 「 1 Hour 」DJ AKIMALAKU AKU BELUM MANDI TAPI MASIH GANTENG TAK TUNTUANG -- DJ VIRAL TIKTOK 2021 REMIX.mp3 | 2022-06-28 02:55 | 57M | |
![[SND]](/icons/sound2.gif) | lvtmrmix.mp3 | 2022-07-19 14:59 | 57M | |
![[SND]](/icons/sound2.gif) | lvtm.mp3.mp3 | 2022-07-05 05:06 | 57M | |
![[SND]](/icons/sound2.gif) | lvtm.mp3 | 2022-07-04 03:07 | 57M | |
![[SND]](/icons/sound2.gif) | demtan.mp3.mp3 | 2022-07-03 10:57 | 57M | |
![[SND]](/icons/sound2.gif) | lanngoc.mp3 | 2022-07-01 15:24 | 57M | |
![[SND]](/icons/sound2.gif) | Little Andy Stafford 14.07.2022.mp3 | 2022-07-14 21:18 | 57M | |
![[SND]](/icons/sound2.gif) | ple.mp3 | 2022-07-13 03:05 | 57M | |
![[SND]](/icons/sound2.gif) | muacontho.mp3 | 2022-07-07 06:46 | 57M | |
![[SND]](/icons/sound2.gif) | tamhihi.mp3 | 2022-07-02 14:02 | 57M | |
![[SND]](/icons/sound2.gif) | mix_24m42s (audio-joiner.com).mp3 | 2022-07-05 21:37 | 57M | |
![[SND]](/icons/sound2.gif) | nonrp.mp3 | 2022-07-12 02:20 | 57M | |
![[SND]](/icons/sound2.gif) | 10-May-2022-(Upa-Dr_L_Pulamte).mp3 | 2022-07-07 12:46 | 57M | |
![[SND]](/icons/sound2.gif) | saddam296.mp3.mp3 | 2022-07-03 06:44 | 56M | |
![[SND]](/icons/sound2.gif) | tiendz.mp3 | 2022-07-09 16:45 | 56M | |
![[SND]](/icons/sound2.gif) | lennoxsdj20.mp3 | 2022-06-28 03:13 | 56M | |
![[SND]](/icons/sound2.gif) | pheda.mp3 | 2022-07-11 02:26 | 56M | |
![[SND]](/icons/sound2.gif) | yt1s.com - Animal Crossing Relaxing Music with Soft Rain .mp3 | 2022-06-27 16:16 | 56M | |
![[SND]](/icons/sound2.gif) | tiktokremix123.mp3 | 2022-06-29 17:48 | 56M | |
![[SND]](/icons/sound2.gif) | gosi21.mp3 | 2022-07-03 07:47 | 56M | |
![[SND]](/icons/sound2.gif) | gosi21.m4a | 2022-07-03 01:38 | 56M | |
![[SND]](/icons/sound2.gif) | 69420.mp3 | 2022-07-03 04:24 | 56M | |
![[SND]](/icons/sound2.gif) | PepsiR10.mp3 | 2022-07-07 22:38 | 56M | |
![[SND]](/icons/sound2.gif) | Handes1.mp3 | 2022-07-19 13:52 | 56M | |
![[SND]](/icons/sound2.gif) | riseup.mp3 | 2022-07-11 08:32 | 56M | |
![[SND]](/icons/sound2.gif) | DJ SLOW 2022 NONSTOP - DJ KU BERLAYAR DI LAUTAN REMIX _ BERLAYAR TAK BERTEPIAN ELLA.mp3 | 2022-07-04 07:38 | 56M | |
![[SND]](/icons/sound2.gif) | linhh.mp3 | 2022-06-28 12:04 | 56M | |
![[SND]](/icons/sound2.gif) | KL.MP3.mp3 | 2022-07-03 09:47 | 56M | |
![[SND]](/icons/sound2.gif) | huy3.mp3 | 2022-06-29 10:04 | 56M | |
![[SND]](/icons/sound2.gif) | jijo2.mp3 | 2022-07-07 07:14 | 56M | |
![[SND]](/icons/sound2.gif) | hanzz.mp3 | 2022-07-04 01:42 | 56M | |
![[SND]](/icons/sound2.gif) | Saran2.mp3 | 2022-06-29 07:14 | 56M | |
![[SND]](/icons/sound2.gif) | Dewa.mp3 | 2022-07-05 00:50 | 56M | |
![[SND]](/icons/sound2.gif) | Kemenangan.mp3 | 2022-07-05 09:50 | 56M | |
![[SND]](/icons/sound2.gif) | VEE.mp3 | 2022-07-09 09:40 | 56M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Deus Ex Mankind Divided Hacking Ambient Mix 1 Hour of Music.mp3 | 2022-07-01 09:35 | 56M | |
![[VID]](/icons/movie.gif) | [Otakumars]_ONIPAN_12_360p.mp4 | 2022-07-10 14:23 | 55M | |
![[SND]](/icons/sound2.gif) | DimsPL5.mp3 | 2022-07-11 08:36 | 55M | |
![[SND]](/icons/sound2.gif) | huy10.mp3 | 2022-07-15 13:08 | 55M | |
![[SND]](/icons/sound2.gif) | ditzy3.mp3 | 2022-07-05 03:24 | 55M | |
![[SND]](/icons/sound2.gif) | NNSTP1.mp3 | 2022-07-06 10:00 | 55M | |
![[SND]](/icons/sound2.gif) | SAD SEHARI.mp3 | 2022-06-29 02:04 | 55M | |
![[SND]](/icons/sound2.gif) | ditzy1.mp3 | 2022-07-05 03:18 | 55M | |
![[SND]](/icons/sound2.gif) | cr7siu.mp3 | 2022-06-29 06:51 | 55M | |
![[SND]](/icons/sound2.gif) | djku.mp3 | 2022-07-11 01:59 | 55M | |
![[SND]](/icons/sound2.gif) | videoplayback (3) (online-audio-converter.com).mp3 | 2022-07-04 19:51 | 55M | |
![[SND]](/icons/sound2.gif) | Y2mate.mx - Medieval City _ Realistic Ambience _ 1 Hour #dnd (128 kbps).mp3 | 2022-07-01 21:33 | 55M | |
![[SND]](/icons/sound2.gif) | zrkundertale.mp3 | 2022-06-29 07:40 | 55M | |
![[SND]](/icons/sound2.gif) | zexy2.mp3 | 2022-07-07 10:33 | 55M | |
![[SND]](/icons/sound2.gif) | turu47.mp3 | 2022-07-10 18:04 | 55M | |
![[SND]](/icons/sound2.gif) | laguturu.mp3 | 2022-07-13 12:25 | 55M | |
![[SND]](/icons/sound2.gif) | kaget1.mp3 | 2022-07-04 06:11 | 55M | |
![[SND]](/icons/sound2.gif) | TuruDek.mp3 | 2022-07-02 21:59 | 55M | |
![[SND]](/icons/sound2.gif) | showtime.mp3 | 2022-06-30 07:18 | 55M | |
![[SND]](/icons/sound2.gif) | JA.mp3 | 2022-07-14 15:30 | 55M | |
![[SND]](/icons/sound2.gif) | YoungZ.mp3 | 2022-06-30 17:38 | 55M | |
![[SND]](/icons/sound2.gif) | Need for speed 2015.m4a | 2022-07-14 10:20 | 55M | |
![[SND]](/icons/sound2.gif) | lacchonhongtran.mp3 | 2022-07-16 06:46 | 55M | |
![[SND]](/icons/sound2.gif) | GauTeddy2.mp3 | 2022-07-12 02:26 | 55M | |
![[SND]](/icons/sound2.gif) | WIBOY3.mp3 | 2022-06-29 06:08 | 55M | |
![[SND]](/icons/sound2.gif) | VIP1.mp3 | 2022-07-02 03:50 | 55M | |
![[SND]](/icons/sound2.gif) | DJ KANE.mp3 | 2022-07-06 03:46 | 55M | |
![[SND]](/icons/sound2.gif) | Chillmusic.mp3 | 2022-07-12 14:47 | 55M | |
![[SND]](/icons/sound2.gif) | Steve's Country Road #313 26th June 2022.mp3 | 2022-06-28 09:53 | 55M | |
![[SND]](/icons/sound2.gif) | Yamete9.mp3 | 2022-07-13 02:00 | 55M | |
![[SND]](/icons/sound2.gif) | dragonking3.mp3 | 2022-07-07 12:42 | 54M | |
![[SND]](/icons/sound2.gif) | inbound3237559861927155384.mp3 | 2022-06-30 17:45 | 54M | |
![[SND]](/icons/sound2.gif) | inbound2767131597246385785.mp3 | 2022-06-29 15:19 | 54M | |
![[SND]](/icons/sound2.gif) | california.mp3 | 2022-07-13 20:35 | 54M | |
![[SND]](/icons/sound2.gif) | Dugem5.mp3 | 2022-07-04 01:11 | 54M | |
![[SND]](/icons/sound2.gif) | silit1.mp3 | 2022-07-02 18:39 | 54M | |
![[SND]](/icons/sound2.gif) | roblox_scp_3008_ost_friday_theme_1_hour_seamless_loop_-3973577088976657594.mp3 | 2022-06-29 03:55 | 54M | |
![[SND]](/icons/sound2.gif) | lennoxsdj60.mp3 | 2022-06-28 03:02 | 54M | |
![[SND]](/icons/sound2.gif) | Pamungkasfullalbum.mp3 | 2022-07-08 20:00 | 54M | |
![[SND]](/icons/sound2.gif) | DeX4.mp3 | 2022-07-02 15:27 | 54M | |
![[SND]](/icons/sound2.gif) | mill.mp3 | 2022-07-02 13:22 | 54M | |
![[SND]](/icons/sound2.gif) | ditzyrap.mp3 | 2022-07-01 10:50 | 54M | |
![[SND]](/icons/sound2.gif) | Pol1.mp3 | 2022-07-07 08:33 | 53M | |
![[SND]](/icons/sound2.gif) | achmadsamp3.mp3 | 2022-07-11 18:35 | 53M | |
![[VID]](/icons/movie.gif) | ygy.mp4 | 2022-06-30 14:24 | 53M | |
![[SND]](/icons/sound2.gif) | super.mp3 | 2022-07-07 10:57 | 53M | |
![[SND]](/icons/sound2.gif) | Tkbr2.mp3 | 2022-07-09 01:39 | 53M | |
![[SND]](/icons/sound2.gif) | Hexganteng1.m4a | 2022-07-02 05:34 | 53M | |
![[SND]](/icons/sound2.gif) | Hexganteng.mp3 | 2022-07-01 18:41 | 53M | |
![[SND]](/icons/sound2.gif) | Hexganteng+.mp3 | 2022-07-01 17:05 | 53M | |
![[VID]](/icons/movie.gif) | clip1.mp4 | 2022-07-04 12:26 | 53M | |
![[VID]](/icons/movie.gif) | [Otakumars]_SMRTIRNDR_11_480p.mp4 | 2022-07-10 14:25 | 53M | |
![[VID]](/icons/movie.gif) | XD.mp4 | 2022-07-04 14:26 | 53M | |
![[SND]](/icons/sound2.gif) | bmega8.mp3 | 2022-07-09 17:33 | 53M | |
![[SND]](/icons/sound2.gif) | atomm.mp3 | 2022-07-05 12:27 | 52M | |
![[SND]](/icons/sound2.gif) | esckanefull2.mp3 | 2022-07-05 04:15 | 52M | |
![[SND]](/icons/sound2.gif) | loli.mp3 | 2022-07-01 08:22 | 52M | |
![[SND]](/icons/sound2.gif) | Wave IV - Adventure 5 - NVC2.mp3 | 2022-07-04 23:09 | 52M | |
![[SND]](/icons/sound2.gif) | PJI.mp3 | 2022-07-16 16:20 | 52M | |
![[SND]](/icons/sound2.gif) | eXo Eventmusik.mp3 | 2022-07-08 17:37 | 52M | |
![[SND]](/icons/sound2.gif) | DhijeSID.mp3 | 2022-07-07 11:54 | 52M | |
![[SND]](/icons/sound2.gif) | bmega9.mp3 | 2022-07-09 17:33 | 52M | |
![[SND]](/icons/sound2.gif) | Foreman Unwilling.mp3 | 2022-07-16 01:12 | 52M | |
![[SND]](/icons/sound2.gif) | vale7.mp3 | 2022-07-14 01:10 | 52M | |
![[SND]](/icons/sound2.gif) | waliFA.mp3 | 2022-07-11 03:13 | 52M | |
![[SND]](/icons/sound2.gif) | Hindiafull26.mp3 | 2022-07-06 19:40 | 51M | |
![[SND]](/icons/sound2.gif) | anhky.mp3 | 2022-07-10 18:11 | 51M | |
![[SND]](/icons/sound2.gif) | BGD2021Fvck.mp3 | 2022-06-29 05:50 | 51M | |
![[SND]](/icons/sound2.gif) | Djleon17.mp3 | 2022-07-15 17:44 | 51M | |
![[VID]](/icons/movie.gif) | Coep.mp4 | 2022-07-10 15:03 | 51M | |
![[SND]](/icons/sound2.gif) | kiniem.mp3 | 2022-07-10 18:42 | 51M | |
![[SND]](/icons/sound2.gif) | chanhlonge.mp3 | 2022-07-16 06:21 | 51M | |
![[SND]](/icons/sound2.gif) | in.mp3 | 2022-07-10 11:13 | 50M | |
![[SND]](/icons/sound2.gif) | ciw.m4a | 2022-07-01 23:58 | 50M | |
![[SND]](/icons/sound2.gif) | chieminh.mp3 | 2022-07-09 14:54 | 50M | |
![[SND]](/icons/sound2.gif) | bgm_8_1_bgm_animal_crossing_new_leaf_pm_8_00_piano_rain_8108046806043477409.mp3 | 2022-06-27 16:12 | 50M | |
![[SND]](/icons/sound2.gif) | drake8.mp3 | 2022-07-06 19:12 | 50M | |
![[SND]](/icons/sound2.gif) | barkingmantledroitwich.mp3 | 2022-07-05 21:21 | 50M | |
![[SND]](/icons/sound2.gif) | Barking.mp3 | 2022-07-05 21:20 | 50M | |
![[SND]](/icons/sound2.gif) | mix1.mp3 | 2022-08-03 10:05 | 50M | |
![[SND]](/icons/sound2.gif) | djslowbas.mp3 | 2022-06-29 07:14 | 50M | |
![[SND]](/icons/sound2.gif) | payungteduh.mp3 | 2022-07-04 18:09 | 50M | |
![[SND]](/icons/sound2.gif) | Wave VI - Prospecting 3 - Null Point.mp3 | 2022-07-04 23:19 | 50M | |
![[SND]](/icons/sound2.gif) | vale4.mp3 | 2022-07-07 11:53 | 50M | |
![[SND]](/icons/sound2.gif) | [ เพลงใหมTikTok ] รวมเพลงฮตในTikTok รวมเพลงเพราะๆ เพลงฮตในแอพ TikTok.mp3 | 2022-07-03 19:43 | 50M | |
![[SND]](/icons/sound2.gif) | Djleon16.mp3 | 2022-07-15 17:43 | 50M | |
![[VID]](/icons/movie.gif) | [Otakumars]_ONIPAN_11_360p.mp4 | 2022-07-09 12:23 | 50M | |
![[SND]](/icons/sound2.gif) | noivoiemmotloi.mp3 | 2022-07-01 15:13 | 49M | |
![[SND]](/icons/sound2.gif) | nhacboyz.mp3 | 2022-07-06 13:23 | 49M | |
![[SND]](/icons/sound2.gif) | Wave V - Exploring 1 - Mission 10.mp3 | 2022-07-04 23:13 | 49M | |
![[SND]](/icons/sound2.gif) | kaalanpunjabi1.mp3 | 2022-07-06 18:51 | 49M | |
![[SND]](/icons/sound2.gif) | kz2.mp3 | 2022-07-04 14:00 | 49M | |
![[SND]](/icons/sound2.gif) | ae1.mp3 | 2022-07-13 14:13 | 49M | |
![[SND]](/icons/sound2.gif) | vale3.mp3 | 2022-07-05 04:51 | 49M | |
![[VID]](/icons/movie.gif) | DJ MENEKETEHE X STENDING MOTOR X BANGUN TIDUR SELFIE MENGKANE.mp4 | 2022-06-29 12:13 | 49M | |
![[SND]](/icons/sound2.gif) | leeyung19.mp3 | 2022-07-07 02:23 | 49M | |
![[SND]](/icons/sound2.gif) | G.S.6.mp3 | 2022-07-19 14:14 | 49M | |
![[SND]](/icons/sound2.gif) | vp6.mp3 | 2022-07-23 12:00 | 49M | |
![[VID]](/icons/movie.gif) | [Otakumars]_ONIPAN_10_360p.mp4 | 2022-07-09 12:19 | 49M | |
![[SND]](/icons/sound2.gif) | fmx.mp3 | 2022-07-14 13:00 | 48M | |
![[SND]](/icons/sound2.gif) | ggsih.mp3 | 2022-07-02 17:20 | 48M | |
![[SND]](/icons/sound2.gif) | mw_1.mp3 | 2022-07-20 15:06 | 48M | |
![[SND]](/icons/sound2.gif) | X2Download.com - DJ SLOW BASS FULL ALBUM __ JOKO TINGKIR NGOMBE DAWET SLOW BASS TERBARU 2022 (128 kbps).mp3 | 2022-06-28 17:33 | 48M | |
![[SND]](/icons/sound2.gif) | 10ngannam1h.mp3 | 2022-07-11 04:40 | 48M | |
![[SND]](/icons/sound2.gif) | GauTeddy5.mp3 | 2022-07-12 13:02 | 48M | |
![[SND]](/icons/sound2.gif) | dgm1.mp3 | 2022-07-07 12:27 | 48M | |
![[SND]](/icons/sound2.gif) | videoplayback (15) (online-audio-converter.com).mp3 | 2022-07-12 20:36 | 48M | |
![[SND]](/icons/sound2.gif) | ddctt1h.mp3 | 2022-07-10 08:49 | 48M | |
![[SND]](/icons/sound2.gif) | Wave VI - Prospecting 1 - Metamorphosite.mp3 | 2022-07-04 23:19 | 48M | |
![[SND]](/icons/sound2.gif) | videoplayback (7) (online-audio-converter.com).mp3 | 2022-07-06 19:58 | 48M | |
![[VID]](/icons/movie.gif) | let's watch the world burn together; villaincore playlist.mp4 | 2022-07-11 17:30 | 48M | |
![[SND]](/icons/sound2.gif) | Wave IV - Adventure 6 - Compoint 12.mp3 | 2022-07-04 23:09 | 48M | |
![[SND]](/icons/sound2.gif) | LOFI.mp3 | 2022-07-08 17:09 | 48M | |
![[SND]](/icons/sound2.gif) | Bygriz76432.mp3 | 2022-07-08 16:07 | 48M | |
![[SND]](/icons/sound2.gif) | BISAYA.mp3 | 2022-07-06 08:06 | 48M | |
![[SND]](/icons/sound2.gif) | KabakMuzlo.mp3 | 2022-07-20 14:53 | 48M | |
![[SND]](/icons/sound2.gif) | The Weeknd - 103.5 DAWN FM.mp3 | 2022-06-29 15:40 | 48M | |
![[SND]](/icons/sound2.gif) | dgm5.mp3 | 2022-07-08 08:59 | 48M | |
![[SND]](/icons/sound2.gif) | UT.mp3 | 2022-07-10 14:51 | 48M | |
![[SND]](/icons/sound2.gif) | Wave V - Exploring 4 - Mission Night.mp3 | 2022-07-04 23:13 | 48M | |
![[SND]](/icons/sound2.gif) | Rankw67.mp3 | 2022-06-28 17:19 | 48M | |
![[SND]](/icons/sound2.gif) | OpickFA.mp3 | 2022-07-11 10:32 | 48M | |
![[SND]](/icons/sound2.gif) | lofichill1.mp3 | 2022-06-29 14:59 | 48M | |
![[SND]](/icons/sound2.gif) | Justin_Bieber_Ed_Sheeran_Lauv_LA_(getmp3.pro).mp3 | 2022-07-09 13:19 | 47M | |
![[SND]](/icons/sound2.gif) | Jemon5.mp3 | 2022-07-02 14:49 | 47M | |
![[SND]](/icons/sound2.gif) | jiren.mp3 | 2022-07-23 09:12 | 47M | |
![[SND]](/icons/sound2.gif) | Yastami.mp3 | 2022-07-01 06:48 | 47M | |
![[SND]](/icons/sound2.gif) | nhac_dieu_lenh_nhac_dieu_binh_dieu_hanh_chuan_106_buoc_phut_-7442153899661517862.mp3 | 2022-07-13 13:23 | 47M | |
![[SND]](/icons/sound2.gif) | Mene.mp3 | 2022-07-04 13:16 | 47M | |
![[SND]](/icons/sound2.gif) | ky.mp3 | 2022-07-13 03:36 | 47M | |
![[SND]](/icons/sound2.gif) | GfAgFam21.mp3 | 2022-07-06 01:59 | 47M | |
![[SND]](/icons/sound2.gif) | K9.mp3 | 2022-06-27 13:54 | 47M | |
![[VID]](/icons/movie.gif) | 曖昧交往系列3_拆解情緒垃圾桶的死局.mp4 | 2022-07-26 03:21 | 47M | |
![[SND]](/icons/sound2.gif) | Angryboy14.mp3 | 2022-07-12 14:36 | 46M | |
![[SND]](/icons/sound2.gif) | lennoxs.mp3 | 2022-06-28 03:14 | 46M | |
![[SND]](/icons/sound2.gif) | hataw1.mp3 | 2022-06-27 22:49 | 46M | |
![[SND]](/icons/sound2.gif) | loli113.mp3 | 2022-07-01 08:22 | 46M | |
![[SND]](/icons/sound2.gif) | bab.mp3 | 2022-07-15 19:14 | 46M | |
![[SND]](/icons/sound2.gif) | Lecture 9e -MRI.mp3 | 2022-07-17 22:28 | 46M | |
![[SND]](/icons/sound2.gif) | Wave VII - Odyssey 6 - Free Flow In Focus 21.mp3 | 2022-07-04 23:24 | 46M | |
![[SND]](/icons/sound2.gif) | blackpink1_bop.mp3 | 2022-07-02 00:22 | 46M | |
![[SND]](/icons/sound2.gif) | LOFINDO.mp3 | 2022-07-01 02:34 | 46M | |
![[SND]](/icons/sound2.gif) | loso.mp3 | 2022-07-02 07:19 | 45M | |
![[SND]](/icons/sound2.gif) | The Piano Guys - CHILL (Full Album)1.m4a | 2022-07-15 11:39 | 45M | |
![[SND]](/icons/sound2.gif) | hantu.mp3 | 2022-07-19 15:56 | 45M | |
![[SND]](/icons/sound2.gif) | Playlist of songs that'll make you dance _ Feeling good playlist.mp3 | 2022-07-08 10:14 | 45M | |
![[SND]](/icons/sound2.gif) | Sahal.mp3 | 2022-07-30 15:30 | 45M | |
![[SND]](/icons/sound2.gif) | concc.mp3 | 2022-07-03 02:43 | 45M | |
![[SND]](/icons/sound2.gif) | lennoxsdj190.mp3 | 2022-06-27 14:22 | 45M | |
![[SND]](/icons/sound2.gif) | Fdrda.mp3 | 2022-07-16 02:33 | 45M | |
![[SND]](/icons/sound2.gif) | lennoxs1.mp3 | 2022-06-28 03:14 | 45M | |
![[SND]](/icons/sound2.gif) | bayphong.mp3 | 2022-07-10 03:59 | 45M | |
![[SND]](/icons/sound2.gif) | dhejikyy3.mp3 | 2022-07-11 09:25 | 45M | |
![[SND]](/icons/sound2.gif) | zensad.mp3 | 2022-06-30 13:57 | 45M | |
![[SND]](/icons/sound2.gif) | Kay34.mp3 | 2022-07-03 08:22 | 45M | |
![[VID]](/icons/movie.gif) | Coep_001_001.mp4 | 2022-07-13 11:33 | 45M | |
![[VID]](/icons/movie.gif) | Hasby.mp4 | 2022-07-05 07:26 | 45M | |
![[SND]](/icons/sound2.gif) | Sc2.mp3 | 2022-07-03 13:20 | 45M | |
![[SND]](/icons/sound2.gif) | tamdz.mp3 | 2022-07-05 12:36 | 45M | |
![[SND]](/icons/sound2.gif) | anhky26.mp3 | 2022-07-14 03:24 | 45M | |
![[VID]](/icons/movie.gif) | Cinta Tak Mungkin Berhenti - Tangga (cover)_Full-HD.mp4 | 2022-07-03 17:12 | 45M | |
![[SND]](/icons/sound2.gif) | y2mate.com - 3 PEMUDA BERBAHAYA FEAT SALLSA BINTAN FULL ALBUM COVER TERBARU.mp3 | 2022-06-30 10:55 | 44M | |
![[SND]](/icons/sound2.gif) | s4.mp3 | 2022-06-30 16:37 | 44M | |
![[SND]](/icons/sound2.gif) | MySong3.mp3 | 2022-06-28 17:15 | 44M | |
![[SND]](/icons/sound2.gif) | alfian3.mp3 | 2022-07-05 07:27 | 44M | |
![[SND]](/icons/sound2.gif) | DJ VIRAL TIK TOK TERBARU 2022 - DJ ANGEL BABY JEDAG JEDUG FULL BEAT VIRAL TIKTOK TERBARU 2022.mp3 | 2022-07-05 02:56 | 44M | |
![[SND]](/icons/sound2.gif) | lennoxsdj10.mp3 | 2022-06-28 03:12 | 44M | |
![[VID]](/icons/movie.gif) | 2022-06-30-192801658.mp4 | 2022-07-01 08:16 | 44M | |
![[SND]](/icons/sound2.gif) | G.S.10.mp3 | 2022-07-19 14:14 | 44M | |
![[SND]](/icons/sound2.gif) | bocbatho.mp3 | 2022-07-10 03:48 | 44M | |
![[SND]](/icons/sound2.gif) | Wave VI - Prospecting 2 - Bio-Body.mp3 | 2022-07-04 23:19 | 44M | |
![[SND]](/icons/sound2.gif) | Relaxingnight.mp3 | 2022-07-01 22:02 | 44M | |
![[SND]](/icons/sound2.gif) | SaveTube.App - ฮิตtiktok!! เธอมากับผัว+ชอบหม...้คนนี้ เจน เจ้าค่ะ & ออย ไทรถแห่ งานบ้านบึง ชลบุรี (128 kbps).mp3 | 2022-06-27 12:24 | 44M | |
![[SND]](/icons/sound2.gif) | GNGSTA2021.mp3 | 2022-07-05 12:36 | 43M | |
![[VID]](/icons/movie.gif) | [Otakumars]_Reimeiki_12_360p.mp4 | 2022-07-08 16:06 | 43M | |
![[SND]](/icons/sound2.gif) | fossa_3_piloto.mp3 | 2022-07-31 05:20 | 43M | |
![[SND]](/icons/sound2.gif) | gsw.mp3 | 2022-07-01 11:27 | 43M | |
![[SND]](/icons/sound2.gif) | Zie.mp3 | 2022-07-06 09:48 | 43M | |
![[SND]](/icons/sound2.gif) | mahubiri ya mwaka wa 2020 (mp3cut.net).mp3 | 2022-07-06 12:09 | 43M | |
![[SND]](/icons/sound2.gif) | esckanefull3.mp3 | 2022-07-05 04:15 | 43M | |
![[SND]](/icons/sound2.gif) | djkane1.mp3 | 2022-07-05 12:55 | 43M | |
![[SND]](/icons/sound2.gif) | orgen.mp3 | 2022-07-11 23:51 | 43M | |
![[VID]](/icons/movie.gif) | y2mate.com - 𝕲𝖆𝖓𝖌𝖘𝖙𝖆 PHONK MIX_480p.mp4 | 2022-07-04 21:39 | 43M | |
![[SND]](/icons/sound2.gif) | Blues.mp3 | 2022-07-04 08:00 | 43M | |
![[SND]](/icons/sound2.gif) | bh.mp3 | 2022-08-05 20:43 | 43M | |
![[SND]](/icons/sound2.gif) | gungun2.mp3 | 2022-06-29 03:25 | 43M | |
![[SND]](/icons/sound2.gif) | quran.mp3 | 2022-06-27 21:55 | 43M | |
![[SND]](/icons/sound2.gif) | ThomasSad2.mp3 | 2022-07-12 13:56 | 43M | |
![[SND]](/icons/sound2.gif) | sd.mp3 | 2022-07-30 05:09 | 43M | |
![[SND]](/icons/sound2.gif) | Ma32.mp3 | 2022-07-03 03:01 | 43M | |
![[SND]](/icons/sound2.gif) | DimsPL4.mp3 | 2022-07-11 08:34 | 42M | |
![[SND]](/icons/sound2.gif) | Wave I - Discovery 2 - Introduction to Focus 10.mp3 | 2022-07-04 22:54 | 42M | |
![[SND]](/icons/sound2.gif) | RizzDj2.mp3 | 2022-06-28 17:12 | 42M | |
![[SND]](/icons/sound2.gif) | Wave I - Discovery 5 - Exploration,Sleep.mp3 | 2022-07-04 22:54 | 42M | |
![[SND]](/icons/sound2.gif) | Wave VI - Prospecting 6 - Far Reaches.mp3 | 2022-07-04 23:19 | 42M | |
![[SND]](/icons/sound2.gif) | Dj46.mp3 | 2022-07-14 05:33 | 42M | |
![[SND]](/icons/sound2.gif) | DJ TIKTOK TERBARU 2022 - DJ DIA GADIS BERKERUDUNG MERAH X DJ MENEKETEHE X DJ HARGA DIRIKU VIRAL 2022.mp3 | 2022-07-04 14:38 | 42M | |
![[SND]](/icons/sound2.gif) | Doofull.mp3 | 2022-07-04 17:20 | 42M | |
![[SND]](/icons/sound2.gif) | AllSongSad.mp3 | 2022-07-17 05:10 | 42M | |
![[SND]](/icons/sound2.gif) | opan0.mp3 | 2022-07-04 19:01 | 42M | |
![[SND]](/icons/sound2.gif) | DISCO2022.mp3 | 2022-07-03 18:21 | 42M | |
![[SND]](/icons/sound2.gif) | Lee.mp3 | 2022-06-28 23:35 | 42M | |
![[SND]](/icons/sound2.gif) | รวมเพลง FiveM มันๆ ได้ฟิล.mp3 | 2022-07-03 05:53 | 42M | |
![[SND]](/icons/sound2.gif) | vale5.mp3 | 2022-07-07 11:53 | 42M | |
![[SND]](/icons/sound2.gif) | epe.mp3 | 2022-07-02 11:12 | 42M | |
![[SND]](/icons/sound2.gif) | MVP.mp3 | 2022-07-12 15:04 | 42M | |
![[SND]](/icons/sound2.gif) | pidi.mp3 | 2022-07-23 09:33 | 42M | |
![[SND]](/icons/sound2.gif) | Kaly-feat-Keli-Csillagok-csillagok-Prgs-mulats-dalok-teljes-album_VYONtPoUU9k.mp3 | 2022-07-10 15:53 | 42M | |
![[SND]](/icons/sound2.gif) | Kaly-feat-Keli-Csillagok-csillagok-Prgs-mulats-dalok-teljes-album_VYONtPoUU9k - Copy.mp3 | 2022-07-10 15:53 | 42M | |
![[SND]](/icons/sound2.gif) | Nhacbaylac.mp3 | 2022-07-24 17:26 | 42M | |
![[SND]](/icons/sound2.gif) | playlist.mp3 | 2022-07-18 10:11 | 41M | |
![[SND]](/icons/sound2.gif) | nhacchill.mp3.mp3 | 2022-07-03 09:25 | 41M | |
![[SND]](/icons/sound2.gif) | DJviral.mp3 | 2022-07-06 17:39 | 41M | |
![[SND]](/icons/sound2.gif) | konnyireyd.mp3 | 2022-07-05 13:17 | 41M | |
![[SND]](/icons/sound2.gif) | 9157.mp3 | 2022-06-30 11:51 | 41M | |
![[SND]](/icons/sound2.gif) | botol.mp3 | 2022-06-29 22:29 | 41M | |
![[SND]](/icons/sound2.gif) | Wave I - Discovery 3 - Advanced Focus 10.mp3 | 2022-07-04 22:54 | 41M | |
![[SND]](/icons/sound2.gif) | leeyung16 (1).mp3 | 2022-07-09 04:13 | 41M | |
![[SND]](/icons/sound2.gif) | jeksfer2.mp3 | 2022-07-03 13:03 | 41M | |
![[SND]](/icons/sound2.gif) | ANDAI TAK SEDALAM INI.m4a | 2022-07-09 15:56 | 41M | |
![[SND]](/icons/sound2.gif) | Wave VII - Odyssey 4 - Nonphysical Friends.mp3 | 2022-07-04 23:24 | 41M | |
![[SND]](/icons/sound2.gif) | nhacsan.mp3 | 2022-07-10 04:05 | 41M | |
![[SND]](/icons/sound2.gif) | cxcx.mp3 | 2022-07-01 17:28 | 41M | |
![[VID]](/icons/movie.gif) | [Otakumars]_KONOHLR_12_360p.mp4 | 2022-07-09 12:16 | 41M | |
![[SND]](/icons/sound2.gif) | meimei.mp3 | 2022-07-11 16:54 | 41M | |
![[SND]](/icons/sound2.gif) | Ceramah.mp3 | 2022-07-01 14:41 | 41M | |
![[SND]](/icons/sound2.gif) | zeon6.mp3 | 2022-07-09 15:46 | 41M | |
![[VID]](/icons/movie.gif) | [Otakumars]_Reimeiki_10_360p.mp4 | 2022-07-08 16:03 | 41M | |
![[SND]](/icons/sound2.gif) | satriadi1.mp3 | 2022-07-04 13:04 | 41M | |
![[SND]](/icons/sound2.gif) | djgeno.mp3 | 2022-07-03 14:37 | 41M | |
![[SND]](/icons/sound2.gif) | Wave I - Discovery 4 - Release and Recharge.mp3 | 2022-07-04 22:54 | 41M | |
![[VID]](/icons/movie.gif) | [Otakumars]_PermainanPertemanan_12_360p.mp4 | 2022-07-02 01:33 | 41M | |
![[SND]](/icons/sound2.gif) | Wave IV - Adventure 2 - Five Messages.mp3 | 2022-07-04 23:09 | 41M | |
![[SND]](/icons/sound2.gif) | 1W.mp3 | 2022-07-02 07:16 | 41M | |
![[SND]](/icons/sound2.gif) | Rayn7.mp3 | 2022-07-16 03:35 | 40M | |
![[SND]](/icons/sound2.gif) | Kon.mp3 | 2022-07-28 04:49 | 40M | |
![[SND]](/icons/sound2.gif) | y2mate.com - IWAN FALS FOR INDONESIA Album Terbaik dan Terpopuler Sepanjang Masa TANPA IKLAN.mp3 | 2022-06-27 12:05 | 40M | |
![[SND]](/icons/sound2.gif) | MypvFdr.mp3 | 2022-07-21 12:21 | 40M | |
![[SND]](/icons/sound2.gif) | nnm31.mp3 | 2022-07-30 09:07 | 40M | |
![[SND]](/icons/sound2.gif) | 4K.mp3 | 2022-07-16 05:12 | 40M | |
![[VID]](/icons/movie.gif) | [Otakumars]_KomiComdesuS2_12_360p.mp4 | 2022-07-08 14:45 | 40M | |
![[SND]](/icons/sound2.gif) | jupe.mp3 | 2022-07-11 05:14 | 40M | |
![[SND]](/icons/sound2.gif) | Basti.mp3 | 2022-07-06 05:30 | 40M | |
![[SND]](/icons/sound2.gif) | Wave VII - Odyssey 1 - Sensing Locale One.mp3 | 2022-07-04 23:24 | 40M | |
![[SND]](/icons/sound2.gif) | ThomasSad1.mp3 | 2022-07-12 03:57 | 40M | |
![[SND]](/icons/sound2.gif) | ComeOn.mp3 | 2022-07-13 06:21 | 40M | |
![[SND]](/icons/sound2.gif) | Wave VII - Odyssey 3 - Point of Departure.mp3 | 2022-07-04 23:24 | 40M | |
![[SND]](/icons/sound2.gif) | Ö1-Journal 8.7.1992.mp3 | 2022-07-08 04:57 | 40M | |
![[SND]](/icons/sound2.gif) | Remix2.mp3 | 2022-06-30 08:32 | 40M | |
![[SND]](/icons/sound2.gif) | dheje2.mp3 | 2022-07-07 04:20 | 40M | |
![[VID]](/icons/movie.gif) | DJ LO MATI GUE PARTY COY SAMPE BAWAH SOUND KANE FYP TIKTOK JEDAG JEDUG FULLBASS 2022.mp4 | 2022-07-14 07:59 | 40M | |
![[SND]](/icons/sound2.gif) | JerryS.mp3 | 2022-07-02 20:24 | 40M | |
![[SND]](/icons/sound2.gif) | Djfanny1.mp3 | 2022-07-01 20:02 | 40M | |
![[SND]](/icons/sound2.gif) | BY ALI.mp3 | 2022-07-02 04:07 | 40M | |
![[SND]](/icons/sound2.gif) | Wave IV - Adventure 1 - One Year Patterning.mp3 | 2022-07-04 23:08 | 40M | |
![[SND]](/icons/sound2.gif) | dgm3.mp3 | 2022-07-07 12:34 | 39M | |
![[SND]](/icons/sound2.gif) | Riz10.mp3 | 2022-07-15 03:20 | 39M | |
![[SND]](/icons/sound2.gif) | dj_dugem_paling_enak_sedunia_2022_dj_breakbeat_melody_full_bass_terbaru_2022_-5821234675106628913.mp3 | 2022-06-27 12:18 | 39M | |
![[SND]](/icons/sound2.gif) | lofichill.mp3 | 2022-07-21 10:24 | 39M | |
![[SND]](/icons/sound2.gif) | mix_86m34s (audio-joiner.mp3 | 2022-06-28 22:17 | 39M | |
![[SND]](/icons/sound2.gif) | s4.m4a | 2022-07-15 04:48 | 39M | |
![[SND]](/icons/sound2.gif) | CBRPPURGE.mp3 | 2022-06-30 02:33 | 39M | |
![[SND]](/icons/sound2.gif) | Wave VII - Odyssey 2 - Expansion In Locale 1.mp3 | 2022-07-04 23:24 | 39M | |
![[SND]](/icons/sound2.gif) | Timo11.mp3 | 2022-07-22 11:05 | 39M | |
![[SND]](/icons/sound2.gif) | AnimalCrossingmusictocalmyoudown_1658338363983.mp3 | 2022-07-24 17:55 | 39M | |
![[SND]](/icons/sound2.gif) | GustixaRemix.mp3 | 2022-07-16 05:14 | 39M | |
![[SND]](/icons/sound2.gif) | opickFA.mp3 | 2022-07-10 16:39 | 39M | |
![[SND]](/icons/sound2.gif) | G.S.9.mp3 | 2022-07-19 14:14 | 39M | |
![[SND]](/icons/sound2.gif) | vedro11.mp3 | 2022-06-29 04:54 | 39M | |
![[SND]](/icons/sound2.gif) | eros11.mp3 | 2022-07-07 11:14 | 39M | |
![[SND]](/icons/sound2.gif) | nova5.mp3 | 2022-07-05 02:34 | 39M | |
![[SND]](/icons/sound2.gif) | Wave VII - Odyssey 5 - Movement to Locale Two Intro Focus 21.mp3 | 2022-07-04 23:24 | 38M | |
![[SND]](/icons/sound2.gif) | Velyn13.mp3 | 2022-07-01 15:02 | 38M | |
![[VID]](/icons/movie.gif) | [Otakumars]_Reimeiki_11_360p.mp4 | 2022-07-08 16:04 | 38M | |
![[SND]](/icons/sound2.gif) | dhujee.mp3.mp3 | 2022-07-16 09:15 | 38M | |
![[SND]](/icons/sound2.gif) | undertele.mp3 | 2022-07-25 11:00 | 38M | |
![[SND]](/icons/sound2.gif) | 86.mp3 | 2022-07-03 01:55 | 38M | |
![[SND]](/icons/sound2.gif) | zerelli1.mp3 | 2022-07-07 07:35 | 38M | |
![[SND]](/icons/sound2.gif) | valedj2.mp3 | 2022-07-08 00:02 | 38M | |
![[SND]](/icons/sound2.gif) | Rayn5.mp3 | 2022-07-06 10:03 | 38M | |
![[SND]](/icons/sound2.gif) | NNSTP2.mp3 | 2022-07-06 10:02 | 38M | |
![[SND]](/icons/sound2.gif) | pv9.mp3 | 2022-07-10 12:00 | 38M | |
![[SND]](/icons/sound2.gif) | kb.mp3 | 2022-07-15 15:00 | 38M | |
![[SND]](/icons/sound2.gif) | Don’t Bring Me Down 1 Hour.mp3 | 2022-07-15 14:55 | 38M | |
![[SND]](/icons/sound2.gif) | link.mp3 | 2022-07-03 06:14 | 38M | |
![[SND]](/icons/sound2.gif) | tatthu.mp3 | 2022-07-12 01:55 | 38M | |
![[VID]](/icons/movie.gif) | Az.mp4 | 2022-06-29 04:01 | 38M | |
![[SND]](/icons/sound2.gif) | nova6.mp3 | 2022-07-05 02:35 | 38M | |
![[SND]](/icons/sound2.gif) | moona.mp3 | 2022-07-06 17:43 | 38M | |
![[SND]](/icons/sound2.gif) | Lxx45.mp3 | 2022-07-03 05:45 | 38M | |
![[SND]](/icons/sound2.gif) | Zakk2.mp3 | 2022-06-30 06:07 | 38M | |
![[SND]](/icons/sound2.gif) | cos.mp3 | 2022-07-01 19:00 | 38M | |
![[SND]](/icons/sound2.gif) | Best of Trap Nation Mix 2021.mp3 | 2022-07-01 18:41 | 38M | |
![[SND]](/icons/sound2.gif) | videoplayback_2-[onlinevideoconverter.com].mp3 | 2022-08-08 06:31 | 38M | |
![[VID]](/icons/movie.gif) | [Otakumars]_SMRTIRNDR_12_360p.mp4 | 2022-07-10 14:25 | 38M | |
![[SND]](/icons/sound2.gif) | risma.mp3 | 2022-07-15 03:44 | 38M | |
![[SND]](/icons/sound2.gif) | RGG.m4a | 2022-07-13 08:56 | 38M | |
![[SND]](/icons/sound2.gif) | fullllll.mp3 | 2022-06-30 14:35 | 38M | |
![[SND]](/icons/sound2.gif) | Dance2.mp3 | 2022-07-06 03:10 | 38M | |
![[SND]](/icons/sound2.gif) | local-media1573470726884406589.mp3 | 2022-06-30 04:40 | 38M | |
![[SND]](/icons/sound2.gif) | mechanic.mp3 | 2022-07-02 05:02 | 38M | |
![[VID]](/icons/movie.gif) | More Plastic & VinDon - Patience [NCS Release].mp4 | 2022-06-27 23:03 | 38M | |
![[SND]](/icons/sound2.gif) | almero3.mp3 | 2022-07-01 03:29 | 38M | |
![[SND]](/icons/sound2.gif) | Hades1.mp3 | 2022-07-03 07:31 | 38M | |
![[VID]](/icons/movie.gif) | [Otakumars]_PermainanPertemanan_11_360p.mp4 | 2022-07-02 01:33 | 38M | |
![[SND]](/icons/sound2.gif) | ms13v7.mp3 | 2022-07-06 18:17 | 38M | |
![[SND]](/icons/sound2.gif) | song6.mp3 | 2022-07-07 01:02 | 37M | |
![[SND]](/icons/sound2.gif) | ttp.mp3 | 2022-07-05 16:50 | 37M | |
![[SND]](/icons/sound2.gif) | Guells6.mp3 | 2022-07-12 22:56 | 37M | |
![[SND]](/icons/sound2.gif) | 040305.mp3 | 2022-07-16 07:15 | 37M | |
![[SND]](/icons/sound2.gif) | Kane2.mp3 | 2022-07-09 06:48 | 37M | |
![[SND]](/icons/sound2.gif) | story-celtic-fantasy.mp3 | 2022-07-04 11:03 | 37M | |
![[SND]](/icons/sound2.gif) | vale1.mp3 | 2022-07-05 04:40 | 37M | |
![[SND]](/icons/sound2.gif) | Riz3.mp3 | 2022-06-30 15:36 | 37M | |
![[SND]](/icons/sound2.gif) | 31072.mp3 | 2022-07-05 09:01 | 37M | |
![[SND]](/icons/sound2.gif) | tung.mp3 | 2022-07-10 11:54 | 37M | |
![[SND]](/icons/sound2.gif) | Undertale OST - Home (Music Box) Extended (320 kbps) (https___youtube-to-mp3.id_).mp3 | 2022-06-30 17:56 | 37M | |
![[SND]](/icons/sound2.gif) | raak5.mp3 | 2022-06-30 17:22 | 37M | |
![[SND]](/icons/sound2.gif) | Ruhr in Love 2022 (DJ Cannabis Coffeeshops Deutschland).mp3 | 2022-07-02 11:18 | 37M | |
![[SND]](/icons/sound2.gif) | تعديل ريما22_1.mp3 | 2022-07-30 18:02 | 37M | |
![[SND]](/icons/sound2.gif) | andhika1.mp3 | 2022-07-05 03:26 | 37M | |
![[SND]](/icons/sound2.gif) | total.mp3 | 2022-08-08 15:33 | 37M | |
![[SND]](/icons/sound2.gif) | DJ Joe Hollywood megamix.mp3 | 2022-07-06 10:03 | 37M | |
![[VID]](/icons/movie.gif) | lv_7113354654741761281_20220714121705.mp4 | 2022-07-15 12:21 | 36M | |
![[SND]](/icons/sound2.gif) | chill song.mp3 | 2022-07-14 16:28 | 36M | |
![[SND]](/icons/sound2.gif) | chill song.m4a | 2022-07-14 16:19 | 36M | |
![[SND]](/icons/sound2.gif) | chil.mp3 | 2022-07-14 19:17 | 36M | |
![[SND]](/icons/sound2.gif) | DANYX2.mp3 | 2022-07-02 03:55 | 36M | |
![[SND]](/icons/sound2.gif) | almero2.mp3 | 2022-06-30 15:50 | 36M | |
![[VID]](/icons/movie.gif) | 441.mp4 | 2022-07-04 14:47 | 36M | |
![[SND]](/icons/sound2.gif) | videoplayback (8) (online-audio-converter.com).mp3 | 2022-07-10 21:27 | 36M | |
![[SND]](/icons/sound2.gif) | Dhije123.mp3 | 2022-07-03 11:30 | 36M | |
![[SND]](/icons/sound2.gif) | 1981_DC101_Xmas.mp3 | 2022-07-05 06:40 | 36M | |
![[SND]](/icons/sound2.gif) | Vaskovic1.mp3 | 2022-06-29 08:56 | 36M | |
![[SND]](/icons/sound2.gif) | baguswirata.mp3 | 2022-07-13 16:58 | 36M | |
![[VID]](/icons/movie.gif) | Djrindusemalam.mp4 | 2022-07-12 16:55 | 36M | |
![[SND]](/icons/sound2.gif) | ilham1.mp3 | 2022-07-07 07:38 | 36M | |
![[SND]](/icons/sound2.gif) | [BTCLOD.COM] Undertale OST - Bergentrückung (Intro) + ASGORE Extended-320k.mp3 | 2022-07-12 09:49 | 36M | |
![[SND]](/icons/sound2.gif) | papadudut1.mp3 | 2022-07-12 02:37 | 36M | |
![[SND]](/icons/sound2.gif) | NNSTP3.mp3 | 2022-07-06 10:08 | 36M | |
![[SND]](/icons/sound2.gif) | Mentol14.mp3 | 2022-06-29 04:07 | 36M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ BREAKBEAT REMIX 2021 LAGU BARAT PALING TERBARU FULLBASS BIKIN SUGES.mp3 | 2022-06-27 20:58 | 36M | |
![[SND]](/icons/sound2.gif) | JackTAKBIR.mp3 | 2022-07-09 09:10 | 36M | |
![[SND]](/icons/sound2.gif) | susu2.mp3 | 2022-06-30 05:04 | 36M | |
![[SND]](/icons/sound2.gif) | djlong.mp3 | 2022-07-05 07:52 | 36M | |
![[SND]](/icons/sound2.gif) | vend3.mp3 | 2022-07-07 14:52 | 36M | |
![[SND]](/icons/sound2.gif) | Lah29.mp3 | 2022-07-06 08:55 | 36M | |
![[SND]](/icons/sound2.gif) | Rankw46.mp3 | 2022-06-28 17:19 | 36M | |
![[SND]](/icons/sound2.gif) | Enakniam8.mp3 | 2022-07-15 07:10 | 36M | |
![[SND]](/icons/sound2.gif) | NNSTP5.mp3 | 2022-07-06 10:13 | 36M | |
![[SND]](/icons/sound2.gif) | reyhan1.mp3 | 2022-07-13 13:59 | 36M | |
![[SND]](/icons/sound2.gif) | DCYxYZX.mp3 | 2022-07-09 10:44 | 36M | |
![[SND]](/icons/sound2.gif) | rnr9.mp3 | 2022-07-02 11:01 | 36M | |
![[SND]](/icons/sound2.gif) | kobofull.mp3 | 2022-07-15 04:24 | 36M | |
![[SND]](/icons/sound2.gif) | ms13v5.mp3 | 2022-07-06 18:17 | 36M | |
![[SND]](/icons/sound2.gif) | MoxxMoss.mp3 | 2022-06-29 06:11 | 36M | |
![[SND]](/icons/sound2.gif) | Isco7.mp3 | 2022-07-02 18:15 | 36M | |
![[SND]](/icons/sound2.gif) | Mbell2.mp3 | 2022-07-03 18:49 | 36M | |
![[SND]](/icons/sound2.gif) | tam11.mp3 | 2022-07-01 15:33 | 36M | |
![[SND]](/icons/sound2.gif) | uje_takbiran_bop.mp3 | 2022-07-09 18:54 | 35M | |
![[SND]](/icons/sound2.gif) | takbir1.mp3 | 2022-07-09 11:18 | 35M | |
![[SND]](/icons/sound2.gif) | code003.mp3 | 2022-07-06 07:34 | 35M | |
![[SND]](/icons/sound2.gif) | Axton0.mp3 | 2022-07-03 17:40 | 35M | |
![[SND]](/icons/sound2.gif) | Wave II - Threshold 3 - One Month Patterning.mp3 | 2022-07-04 22:59 | 35M | |
![[SND]](/icons/sound2.gif) | bloca.mp3 | 2022-07-06 17:43 | 35M | |
![[SND]](/icons/sound2.gif) | Lando4.mp3 | 2022-07-03 05:23 | 35M | |
![[SND]](/icons/sound2.gif) | Guells2.mp3 | 2022-07-12 05:31 | 35M | |
![[SND]](/icons/sound2.gif) | ช.mp3 | 2022-06-29 11:53 | 35M | |
![[SND]](/icons/sound2.gif) | ansonnnnn.mp3 | 2022-07-04 23:26 | 35M | |
![[SND]](/icons/sound2.gif) | Lando3.mp3 | 2022-07-03 05:22 | 35M | |
![[SND]](/icons/sound2.gif) | DimsPL1.mp3 | 2022-07-11 08:27 | 35M | |
![[SND]](/icons/sound2.gif) | tiktokbhdbff2021.mp3 | 2022-06-29 05:41 | 35M | |
![[VID]](/icons/movie.gif) | ppp.mp4 | 2022-07-25 21:06 | 35M | |
![[SND]](/icons/sound2.gif) | onedirec.mp3 | 2022-06-28 06:38 | 35M | |
![[SND]](/icons/sound2.gif) | Wave V - Exploring 6 - Pathways.mp3 | 2022-07-04 23:13 | 35M | |
![[SND]](/icons/sound2.gif) | rifa23.mp3 | 2022-07-10 09:37 | 35M | |
![[SND]](/icons/sound2.gif) | Wave V - Exploring 5 - Horizons.mp3 | 2022-07-04 23:13 | 35M | |
![[SND]](/icons/sound2.gif) | Rayn4.mp3 | 2022-07-06 05:27 | 34M | |
![[SND]](/icons/sound2.gif) | gusx.mp3 | 2022-07-06 16:23 | 34M | |
![[SND]](/icons/sound2.gif) | windah.m4a | 2022-06-29 04:33 | 34M | |
![[SND]](/icons/sound2.gif) | leeyung15.mp3 | 2022-07-05 09:09 | 34M | |
![[SND]](/icons/sound2.gif) | mbuhh.mp3 | 2022-07-03 11:21 | 34M | |
![[SND]](/icons/sound2.gif) | DjWannaFileLike19870.mp3 | 2022-07-05 14:48 | 34M | |
![[SND]](/icons/sound2.gif) | lofichill2.mp3 | 2022-07-03 06:57 | 34M | |
![[SND]](/icons/sound2.gif) | Wave V - Exploring 2 - Mission12.mp3 | 2022-07-04 23:13 | 34M | |
![[SND]](/icons/sound2.gif) | drake9.mp3 | 2022-07-06 18:36 | 34M | |
![[SND]](/icons/sound2.gif) | Wave VI - Prospecting 5 - Near Reaches.mp3 | 2022-07-04 23:18 | 34M | |
![[SND]](/icons/sound2.gif) | vale2.mp3 | 2022-07-05 04:49 | 34M | |
![[SND]](/icons/sound2.gif) | kuyagoods1.mp3 | 2022-07-30 18:59 | 34M | |
![[SND]](/icons/sound2.gif) | Wave VI - Prospecting 4 - Plus Polarity.mp3 | 2022-07-04 23:18 | 34M | |
![[SND]](/icons/sound2.gif) | highgeno1.mp3 | 2022-06-28 06:33 | 34M | |
![[SND]](/icons/sound2.gif) | PHOTO.mp3 | 2022-07-06 09:34 | 34M | |
![[SND]](/icons/sound2.gif) | Эш на 4 трека.mp3 | 2022-07-14 10:43 | 34M | |
![[SND]](/icons/sound2.gif) | Wave II - Threshold 2 - Problem Solving.mp3 | 2022-07-04 22:59 | 34M | |
![[SND]](/icons/sound2.gif) | Wave II - Threshold 6 - Intro Living Body Map.mp3 | 2022-07-04 22:59 | 34M | |
![[SND]](/icons/sound2.gif) | JerryRg.mp3 | 2022-07-05 20:06 | 34M | |
![[SND]](/icons/sound2.gif) | Hex2.mp3 | 2022-07-02 05:28 | 34M | |
![[SND]](/icons/sound2.gif) | lennoxsdj160.mp3 | 2022-06-27 14:17 | 34M | |
![[SND]](/icons/sound2.gif) | เศร้า.mp3 | 2022-07-19 13:48 | 34M | |
![[SND]](/icons/sound2.gif) | Rhey45.mp3 | 2022-06-29 11:13 | 34M | |
![[SND]](/icons/sound2.gif) | tiktokbhdbff20212.mp3 | 2022-06-29 05:46 | 34M | |
![[SND]](/icons/sound2.gif) | Reyzremix.mp3 | 2022-07-07 12:49 | 33M | |
![[SND]](/icons/sound2.gif) | nochnoyrazgovor.mp3 | 2022-07-05 14:42 | 33M | |
![[SND]](/icons/sound2.gif) | papadudut2.mp3 | 2022-07-12 02:37 | 33M | |
![[SND]](/icons/sound2.gif) | Qimzy9.mp3 | 2022-07-04 08:05 | 33M | |
![[SND]](/icons/sound2.gif) | Yami.mp3 | 2022-07-08 19:31 | 33M | |
![[SND]](/icons/sound2.gif) | garth_brooks_george_strait_alan_jackson_greatest_hits_best_classic_country_songs_of_all_time_-4105854347802561170.mp3 | 2022-07-17 18:43 | 33M | |
![[SND]](/icons/sound2.gif) | IL.mp3 | 2022-07-11 06:55 | 33M | |
![[SND]](/icons/sound2.gif) | Yowis Ben Full Album Yowis Ben 2021 Lagu Yowis Ben 123.mp3 | 2022-06-29 12:01 | 33M | |
![[SND]](/icons/sound2.gif) | SKK.mp3 | 2022-07-31 07:18 | 33M | |
![[SND]](/icons/sound2.gif) | tkbrn.mp3 | 2022-07-09 15:49 | 33M | |
![[SND]](/icons/sound2.gif) | Wave III - Freedom 4 - Five Questions.mp3 | 2022-07-04 23:03 | 33M | |
![[SND]](/icons/sound2.gif) | Wave IV - Adventure 4 - Nvc I.mp3 | 2022-07-04 23:08 | 33M | |
![[SND]](/icons/sound2.gif) | y2meta.com - FULL ALBUM ADE ASTRID TERBARU 2022 -- GALA GALA -- PECAH SERIBU -- VERSI KUDA RENGGONG (320 kbps).mp3 | 2022-07-05 08:50 | 33M | |
![[SND]](/icons/sound2.gif) | jaipong.mp3 | 2022-07-05 22:04 | 33M | |
![[SND]](/icons/sound2.gif) | Vaskovic3 .mp3 | 2022-06-30 07:28 | 33M | |
![[SND]](/icons/sound2.gif) | joe22.mp3 | 2022-07-15 04:10 | 33M | |
![[SND]](/icons/sound2.gif) | Joko20.mp3 | 2022-06-30 03:02 | 33M | |
![[SND]](/icons/sound2.gif) | Tarhim Subuh Termerdu FULL 18 Menit.mp3 | 2022-07-12 00:52 | 33M | |
![[SND]](/icons/sound2.gif) | RdV9.mp3 | 2022-07-17 05:59 | 33M | |
![[SND]](/icons/sound2.gif) | night1.mp3 | 2022-07-03 11:27 | 32M | |
![[SND]](/icons/sound2.gif) | JAWA1.mp3 | 2022-06-29 08:51 | 32M | |
![[SND]](/icons/sound2.gif) | djgapi2.mp3 | 2022-07-09 18:53 | 32M | |
![[VID]](/icons/movie.gif) | [Otakumars]_SMRTIRNDR_10_360p.mp4 | 2022-07-10 14:22 | 32M | |
![[SND]](/icons/sound2.gif) | Wave III - Freedom 6 - First Stage Seperation.mp3 | 2022-07-04 23:03 | 32M | |
![[SND]](/icons/sound2.gif) | Wave II - Threshold 5 - Energy Bar Tool.mp3 | 2022-07-04 22:59 | 32M | |
![[SND]](/icons/sound2.gif) | CUESHE_Nonstop_Songs_2020_-_CUESHE_(getmp3.pro).mp3 | 2022-07-13 14:38 | 32M | |
![[SND]](/icons/sound2.gif) | Wave II - Threshold 1 - Intro Focus 12.mp3 | 2022-07-04 22:59 | 32M | |
![[SND]](/icons/sound2.gif) | acho9.mp3 | 2022-06-29 06:02 | 32M | |
![[SND]](/icons/sound2.gif) | Wave III - Freedom 2 - Remote Viewing.mp3 | 2022-07-04 23:03 | 32M | |
![[SND]](/icons/sound2.gif) | msk islam 2.m4a | 2022-07-13 10:35 | 32M | |
![[SND]](/icons/sound2.gif) | Sea Of Trees Work Mix - 12:3:21, 8.03 PM.mp3 | 2022-07-14 01:49 | 32M | |
![[SND]](/icons/sound2.gif) | DJTIDTOD.mp3 | 2022-07-09 22:22 | 32M | |
![[SND]](/icons/sound2.gif) | saker15.mp3 | 2022-07-20 01:01 | 32M | |
![[SND]](/icons/sound2.gif) | MAN O WAR FEDPOFFA 25TH ANNIVERSARY (BOTTLE).mp3 | 2022-07-10 19:20 | 32M | |
![[VID]](/icons/movie.gif) | ABP cover.mp4 | 2022-06-29 03:20 | 32M | |
![[SND]](/icons/sound2.gif) | Rayn3.mp3 | 2022-07-06 02:55 | 32M | |
![[SND]](/icons/sound2.gif) | gabutcuyy.mp3 | 2022-06-27 12:43 | 32M | |
![[SND]](/icons/sound2.gif) | zexy3.mp3 | 2022-07-11 07:39 | 32M | |
![[SND]](/icons/sound2.gif) | ZExW.mp3 | 2022-07-11 00:24 | 32M | |
![[SND]](/icons/sound2.gif) | Aryadej45.mp3 | 2022-07-10 02:34 | 32M | |
![[SND]](/icons/sound2.gif) | obr.mp3 | 2022-07-17 06:48 | 32M | |
![[SND]](/icons/sound2.gif) | col.mp3 | 2022-07-14 19:17 | 32M | |
![[SND]](/icons/sound2.gif) | chill song 2.m4a | 2022-07-14 16:20 | 32M | |
![[SND]](/icons/sound2.gif) | DJ Tiktok Terbaru 2021 Jedag Jedug Full Bass Wilfexborrrrr Viral.mp3.mp3 | 2022-06-30 09:57 | 32M | |
![[SND]](/icons/sound2.gif) | BK1 editerad.mp3 | 2022-07-05 07:20 | 32M | |
![[SND]](/icons/sound2.gif) | Ryder12.mp3 | 2022-06-30 04:45 | 32M | |
![[SND]](/icons/sound2.gif) | lennoxsdj40.mp3 | 2022-06-28 03:07 | 32M | |
![[SND]](/icons/sound2.gif) | fatur1.mp3 | 2022-07-04 19:12 | 32M | |
![[SND]](/icons/sound2.gif) | djsteel.mp3 | 2022-06-28 16:12 | 32M | |
![[SND]](/icons/sound2.gif) | DJMY.mp3 | 2022-07-01 13:25 | 31M | |
![[SND]](/icons/sound2.gif) | Lando1.mp3 | 2022-07-03 05:22 | 31M | |
![[SND]](/icons/sound2.gif) | takbiran910.mp3 | 2022-07-09 12:43 | 31M | |
![[SND]](/icons/sound2.gif) | byhycal.mp3 | 2022-07-12 06:24 | 31M | |
![[SND]](/icons/sound2.gif) | FanzMahesa1.mp3 | 2022-07-09 07:47 | 31M | |
![[SND]](/icons/sound2.gif) | Gaga & Mateo! - Welcome To The Dark Side Vol. 1.m4a | 2022-07-11 11:07 | 31M | |
![[SND]](/icons/sound2.gif) | Ds31.mp3 | 2022-07-01 07:49 | 31M | |
![[SND]](/icons/sound2.gif) | y2mate.com - JANGAN KHAWATIR DENGAN REZEKIMU MOTIVASI HIDUP Ustadz Abdul Somad Lc MA.mp3 | 2022-07-07 17:18 | 31M | |
![[SND]](/icons/sound2.gif) | dhijee4.mp3 | 2022-06-28 06:18 | 31M | |
![[SND]](/icons/sound2.gif) | 1981-Xmas.mp3 | 2022-07-05 06:40 | 31M | |
![[SND]](/icons/sound2.gif) | Febri.mp3 | 2022-07-12 04:38 | 31M | |
![[SND]](/icons/sound2.gif) | jdi.mp3 | 2022-07-14 12:15 | 31M | |
![[SND]](/icons/sound2.gif) | bilaaa1.mp3 | 2022-07-09 02:04 | 31M | |
![[SND]](/icons/sound2.gif) | hataw3.mp3 | 2022-06-29 20:26 | 31M | |
![[SND]](/icons/sound2.gif) | jembut.mp3 | 2022-08-02 12:29 | 31M | |
![[SND]](/icons/sound2.gif) | leon11.mp3 | 2022-07-02 17:10 | 31M | |
![[SND]](/icons/sound2.gif) | djaca.mp3 | 2022-07-02 18:00 | 31M | |
![[SND]](/icons/sound2.gif) | cucul131.mp3 | 2022-07-05 08:28 | 31M | |
![[SND]](/icons/sound2.gif) | Djenk3.m4a | 2022-07-01 13:35 | 31M | |
![[SND]](/icons/sound2.gif) | DJ CAMPURAN VIRAL TIKTOK 2022 JEDAG JEDUG FULL BASS TERBARU (1).mp3 | 2022-07-05 07:22 | 31M | |
![[SND]](/icons/sound2.gif) | gesamtwerk.mp3 | 2022-07-15 21:41 | 31M | |
![[SND]](/icons/sound2.gif) | leeyung14.mp3 | 2022-07-05 04:23 | 31M | |
![[SND]](/icons/sound2.gif) | asik4.mp3 | 2022-07-10 05:01 | 31M | |
![[SND]](/icons/sound2.gif) | Brik3.mp3 | 2022-07-05 08:02 | 31M | |
![[SND]](/icons/sound2.gif) | wpue72.mp3 | 2022-06-28 22:13 | 31M | |
![[SND]](/icons/sound2.gif) | jerrykoplo.mp3 | 2022-07-01 03:44 | 31M | |
![[SND]](/icons/sound2.gif) | Wave I - Discovery 6 - Free Flow.mp3 | 2022-07-04 22:53 | 31M | |
![[SND]](/icons/sound2.gif) | Suraj Beera-Walking in Times Square-kissvk.com.mp3 | 2022-07-12 21:41 | 31M | |
![[SND]](/icons/sound2.gif) | vio.mp3 | 2022-07-07 06:12 | 31M | |
![[SND]](/icons/sound2.gif) | Dapa.mp3 | 2022-07-09 01:27 | 31M | |
![[SND]](/icons/sound2.gif) | New Recording.m4a | 2022-07-12 23:37 | 31M | |
![[SND]](/icons/sound2.gif) | satzz1.mp3 | 2022-07-04 11:25 | 31M | |
![[SND]](/icons/sound2.gif) | djkece2.mp3 | 2022-07-03 23:56 | 31M | |
![[SND]](/icons/sound2.gif) | dj1_hasyka_bop.mp3 | 2022-06-27 18:02 | 31M | |
![[SND]](/icons/sound2.gif) | dj1_bop.mp3 | 2022-07-05 19:16 | 31M | |
![[SND]](/icons/sound2.gif) | Volod_Zelens1.mp3 | 2022-07-03 14:50 | 31M | |
![[SND]](/icons/sound2.gif) | GabDj3.mp3 | 2022-07-07 02:33 | 31M | |
![[SND]](/icons/sound2.gif) | hajat.mp3 | 2022-06-28 05:15 | 31M | |
![[SND]](/icons/sound2.gif) | FF1.mp3 | 2022-07-05 05:03 | 31M | |
![[SND]](/icons/sound2.gif) | kumpulan lagu country terbaik.mp3 | 2022-06-28 02:21 | 31M | |
![[SND]](/icons/sound2.gif) | RT.mp3 | 2022-07-16 04:16 | 31M | |
![[SND]](/icons/sound2.gif) | Abstraktionsniveau (DJ Cannabis Coffeeshops Deutschland).mp3 | 2022-07-05 12:06 | 31M | |
![[SND]](/icons/sound2.gif) | Tempik.mp3 | 2022-06-28 17:19 | 31M | |
![[SND]](/icons/sound2.gif) | zeon10.mp3 | 2022-06-30 07:00 | 30M | |
![[SND]](/icons/sound2.gif) | nhaccuari.mp3 | 2022-07-16 06:39 | 30M | |
![[SND]](/icons/sound2.gif) | djgapi1.mp3 | 2022-07-09 18:28 | 30M | |
![[SND]](/icons/sound2.gif) | s3.mp3 | 2022-06-30 16:29 | 30M | |
![[SND]](/icons/sound2.gif) | jokie2.mp3 | 2022-07-16 03:11 | 30M | |
![[SND]](/icons/sound2.gif) | RPG Combat Playlist - 30 Minute Mix of Fantasy RPG Music for D&D Fights (128 kbps).mp3 | 2022-07-12 12:28 | 30M | |
![[SND]](/icons/sound2.gif) | Wave I - Discovery 1 - Orientation.mp3 | 2022-07-04 22:53 | 30M | |
![[SND]](/icons/sound2.gif) | anjay.mp3 | 2022-08-05 20:35 | 30M | |
![[SND]](/icons/sound2.gif) | Josh A - Fearless (Full Album).mp3 | 2022-07-09 09:53 | 30M | |
![[SND]](/icons/sound2.gif) | dudut1.mp3 | 2022-07-16 07:49 | 30M | |
![[SND]](/icons/sound2.gif) | I Just CouldnaÌÂÂt Save You Tonight - Ardhito Pramono ft. Aurelie Moeremans (Lirik Lagu Terjemahan) (mp3cut.net).mp3 | 2022-07-13 06:12 | 30M | |
![[SND]](/icons/sound2.gif) | REMIX8.mp3 | 2022-07-09 08:36 | 30M | |
![[SND]](/icons/sound2.gif) | sha1.mp3 | 2022-07-13 01:52 | 30M | |
![[SND]](/icons/sound2.gif) | cleongalau1.mp3 | 2022-07-08 13:52 | 30M | |
![[SND]](/icons/sound2.gif) | Wave III - Freedom 5 - Energy Food.mp3 | 2022-07-04 23:03 | 30M | |
![[SND]](/icons/sound2.gif) | ryu1.mp3 | 2022-07-02 14:46 | 30M | |
![[SND]](/icons/sound2.gif) | Lah39.mp3 | 2022-07-06 16:22 | 30M | |
![[SND]](/icons/sound2.gif) | mc.pm3.mp3 | 2022-07-08 17:51 | 30M | |
![[SND]](/icons/sound2.gif) | darkb.mp3 | 2022-07-09 13:20 | 30M | |
![[SND]](/icons/sound2.gif) | ammu21.mp3 | 2022-07-09 11:28 | 30M | |
![[SND]](/icons/sound2.gif) | LM.mp3 | 2022-07-10 18:01 | 30M | |
![[SND]](/icons/sound2.gif) | ms13v16.mp3 | 2022-07-06 18:20 | 30M | |
![[SND]](/icons/sound2.gif) | Wave III - Freedom 3 - Vectors.mp3 | 2022-07-04 23:03 | 30M | |
![[SND]](/icons/sound2.gif) | Dj1rKtDk.mp3 | 2022-07-01 03:11 | 30M | |
![[SND]](/icons/sound2.gif) | peace_soundtrack_long.mp3 | 2022-07-04 06:36 | 30M | |
![[SND]](/icons/sound2.gif) | Dudung2.mp3 | 2022-06-29 05:34 | 30M | |
![[SND]](/icons/sound2.gif) | ditzy2.mp3 | 2022-07-05 03:19 | 30M | |
![[SND]](/icons/sound2.gif) | Projeto_top-BKP - 04:07:2022 17.mp3 | 2022-07-04 20:20 | 30M | |
![[SND]](/icons/sound2.gif) | Ensaio-Cine-S-Baixo - 05:07:2022 10.mp3 | 2022-07-05 13:23 | 30M | |
![[SND]](/icons/sound2.gif) | - 04:07:2022 18.mp3 | 2022-07-04 21:37 | 30M | |
![[SND]](/icons/sound2.gif) | DimsPL3.mp3 | 2022-07-11 08:29 | 30M | |
![[SND]](/icons/sound2.gif) | gangster.mp3 | 2022-06-29 15:57 | 30M | |
![[SND]](/icons/sound2.gif) | prm3.mp3 | 2022-07-04 07:50 | 30M | |
![[SND]](/icons/sound2.gif) | Loss2.mp3 | 2022-07-16 02:59 | 30M | |
![[VID]](/icons/movie.gif) | Bosnian Folk Song - Bosanska Artiljerija.mp4 | 2022-07-09 10:23 | 30M | |
![[SND]](/icons/sound2.gif) | WAHYU.mp3 | 2022-07-03 17:27 | 30M | |
![[VID]](/icons/movie.gif) | [Otakumars]_YOUZITSU_S2_01_360p.mp4 | 2022-07-04 14:21 | 30M | |
![[SND]](/icons/sound2.gif) | y2mate.com - ALL LAGU BADSIDE INDOPRIDE ROLEPLAY FULL FRAKSI V2.mp3 | 2022-07-12 02:39 | 29M | |
![[SND]](/icons/sound2.gif) | lagubedsed.mp3 | 2022-07-12 02:57 | 29M | |
![[SND]](/icons/sound2.gif) | indopride.mp3 | 2022-07-08 15:23 | 29M | |
![[SND]](/icons/sound2.gif) | badsideidp.mp3 | 2022-07-14 16:29 | 29M | |
![[SND]](/icons/sound2.gif) | BadSide.mp3 | 2022-07-15 12:20 | 29M | |
![[SND]](/icons/sound2.gif) | PDB1.mp3 | 2022-07-05 11:10 | 29M | |
![[SND]](/icons/sound2.gif) | Velyn12.mp3 | 2022-07-01 15:02 | 29M | |
![[VID]](/icons/movie.gif) | lv_0_20220709233614.mp4 | 2022-07-09 16:40 | 29M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ KEKASIH HALAL DIA GADIS BERKERUDUNG MERAH JEDAG JEDUG MENGKANE VIRAL TIKTOK BY RAKA REMIXER.mp3 | 2022-07-25 19:11 | 29M | |
![[SND]](/icons/sound2.gif) | rifa26.mp3 | 2022-07-13 10:22 | 29M | |
![[SND]](/icons/sound2.gif) | lm.mp3 | 2022-06-30 18:11 | 29M | |
![[SND]](/icons/sound2.gif) | djki02.mp3 | 2022-06-27 18:31 | 29M | |
![[SND]](/icons/sound2.gif) | boba25.mp3 | 2022-07-16 09:05 | 29M | |
![[SND]](/icons/sound2.gif) | ads7.mp3 | 2022-07-02 20:31 | 29M | |
![[SND]](/icons/sound2.gif) | ZexX3.mp3 | 2022-07-06 11:47 | 29M | |
![[SND]](/icons/sound2.gif) | Yamete.mp3 | 2022-07-02 10:41 | 29M | |
![[SND]](/icons/sound2.gif) | Rayn1.mp3 | 2022-07-01 09:00 | 29M | |
![[SND]](/icons/sound2.gif) | Isco11.mp3 | 2022-06-30 05:39 | 29M | |
![[SND]](/icons/sound2.gif) | GabDj1.mp3 | 2022-07-07 02:34 | 29M | |
![[SND]](/icons/sound2.gif) | LH.mp3 | 2022-07-08 12:28 | 29M | |
![[SND]](/icons/sound2.gif) | Vaskovic2.mp3 | 2022-06-29 10:53 | 29M | |
![[SND]](/icons/sound2.gif) | Irsad.mp3 | 2022-06-28 12:03 | 29M | |
![[SND]](/icons/sound2.gif) | 001cf2a6294f4a06a67ffe082722482b_140.mp3 | 2022-06-28 11:54 | 29M | |
![[SND]](/icons/sound2.gif) | djnur2.mp3 | 2022-07-16 08:04 | 29M | |
![[SND]](/icons/sound2.gif) | 记忆雨.MP4.mp3 | 2022-06-27 16:11 | 29M | |
![[SND]](/icons/sound2.gif) | Dugem1.mp3 | 2022-07-06 14:05 | 29M | |
![[SND]](/icons/sound2.gif) | raak11.mp3 | 2022-07-07 05:50 | 29M | |
![[SND]](/icons/sound2.gif) | Guells5.mp3 | 2022-07-12 12:00 | 29M | |
![[SND]](/icons/sound2.gif) | aett.mp3 | 2022-07-10 13:28 | 29M | |
![[SND]](/icons/sound2.gif) | vall8.mp3 | 2022-07-05 08:29 | 29M | |
![[SND]](/icons/sound2.gif) | X2Download.com - DJ CAMPURAN TIK TOK VIRAL 2022 JEDAG JEDUG FULL BASS TERBARU (128 kbps).mp3 | 2022-06-29 13:21 | 29M | |
![[SND]](/icons/sound2.gif) | cameron.mp3 | 2022-07-09 06:27 | 29M | |
![[SND]](/icons/sound2.gif) | Rayn8.mp3 | 2022-07-16 03:46 | 29M | |
![[SND]](/icons/sound2.gif) | y2mate.com - NonStop Malayalam Melody Songs To Sleep Vol2 TopNotch Playlist_v240P-mc.m4a | 2022-06-28 12:11 | 29M | |
![[SND]](/icons/sound2.gif) | ttt.mp3 | 2022-07-05 16:50 | 29M | |
![[SND]](/icons/sound2.gif) | videoplayback (13) (online-audio-converter.com).mp3 | 2022-07-11 20:02 | 29M | |
![[SND]](/icons/sound2.gif) | ♛⃤⃤𝐌 𝐈 𝐋 𝐀 𝐑 𝐆 𝐎♛⃤⃤ (1).mp3 | 2022-07-01 01:57 | 29M | |
![[SND]](/icons/sound2.gif) | Rizz16.mp3 | 2022-06-28 17:11 | 29M | |
![[SND]](/icons/sound2.gif) | CROT.mp3 | 2022-07-31 09:33 | 29M | |
![[SND]](/icons/sound2.gif) | kontol (1).mp3 | 2022-06-28 05:24 | 29M | |
![[SND]](/icons/sound2.gif) | nana17.mp3 | 2022-08-02 15:24 | 29M | |
![[SND]](/icons/sound2.gif) | 2_5296471253299763012.mp3 | 2022-07-15 01:15 | 29M | |
![[SND]](/icons/sound2.gif) | asik8.mp3 | 2022-07-17 01:36 | 29M | |
![[SND]](/icons/sound2.gif) | nelsondjnt5.mp3 | 2022-07-07 06:08 | 28M | |
![[VID]](/icons/movie.gif) | y2mate.com - Lugowo lagu China versi Dangdut Sibay Classic_720pFHR.mp4 | 2022-07-08 10:56 | 28M | |
![[SND]](/icons/sound2.gif) | kz.mp3 | 2022-07-04 13:49 | 28M | |
![[SND]](/icons/sound2.gif) | KKidolrain.mp3 | 2022-06-27 16:11 | 28M | |
![[SND]](/icons/sound2.gif) | 15_lagu_terbaik_fourtwnty_(full_album).m4a | 2022-07-20 14:58 | 28M | |
![[SND]](/icons/sound2.gif) | lennoxsb.mp3 | 2022-06-28 02:57 | 28M | |
![[SND]](/icons/sound2.gif) | Sadmomen.mp3 | 2022-07-16 21:14 | 28M | |
![[SND]](/icons/sound2.gif) | Nintendo DSi Shop Theme Extended.mp3 | 2022-07-13 20:26 | 28M | |
![[SND]](/icons/sound2.gif) | Robert2.mp3 | 2022-07-13 18:42 | 28M | |
![[SND]](/icons/sound2.gif) | BlocCalito.mp3 | 2022-07-09 07:45 | 28M | |
![[SND]](/icons/sound2.gif) | Pursuit Variation.mp3 | 2022-07-07 19:44 | 28M | |
![[SND]](/icons/sound2.gif) | mn.mp3 | 2022-06-29 17:00 | 28M | |
![[SND]](/icons/sound2.gif) | Isco03.mp3 | 2022-06-28 06:01 | 28M | |
![[VID]](/icons/movie.gif) | Dream Land (Road Trip).mp4 | 2022-07-06 01:32 | 28M | |
![[SND]](/icons/sound2.gif) | nana16.mp3 | 2022-08-02 15:23 | 28M | |
![[SND]](/icons/sound2.gif) | maspam.mp3 | 2022-07-06 00:18 | 28M | |
![[SND]](/icons/sound2.gif) | ajg.mp3 | 2022-07-31 05:59 | 28M | |
![[SND]](/icons/sound2.gif) | abil7.mp3 | 2022-07-12 01:02 | 28M | |
![[SND]](/icons/sound2.gif) | video-output-D2829C5A-8152-4C31-85B5-ABA4EB5964C4.MP4.mp3 | 2022-06-27 16:18 | 28M | |
![[SND]](/icons/sound2.gif) | zrkluloelektron.mp3 | 2022-07-14 17:30 | 27M | |
![[SND]](/icons/sound2.gif) | mayrock2.mp3 | 2022-07-06 00:19 | 27M | |
![[SND]](/icons/sound2.gif) | Wave II - Threshold 4 - Color Breathing.mp3 | 2022-07-04 22:59 | 27M | |
![[SND]](/icons/sound2.gif) | demo_bop.mp3 | 2022-07-02 18:35 | 27M | |
![[SND]](/icons/sound2.gif) | DEMO2.mp3 | 2022-07-13 11:38 | 27M | |
![[SND]](/icons/sound2.gif) | fatur3.mp3 | 2022-07-05 03:40 | 27M | |
![[VID]](/icons/movie.gif) | lv_7115628789815627010_20220703162835.mp4 | 2022-07-03 17:31 | 27M | |
![[SND]](/icons/sound2.gif) | Bb.mp3 | 2022-06-28 05:16 | 27M | |
![[SND]](/icons/sound2.gif) | arta16.mp3 | 2022-07-15 13:21 | 27M | |
![[SND]](/icons/sound2.gif) | Siudinbertanya.mp3 | 2022-07-12 11:18 | 27M | |
![[SND]](/icons/sound2.gif) | Wave III - Freedom 1 - Lift Off.mp3 | 2022-07-04 23:03 | 27M | |
![[SND]](/icons/sound2.gif) | Pursuit.mp3 | 2022-07-07 19:45 | 27M | |
![[VID]](/icons/movie.gif) | Untitled (1).mp4 | 2022-06-30 10:53 | 27M | |
![[SND]](/icons/sound2.gif) | HmzfSA0k8Rf3.128.mp3 | 2022-07-09 09:50 | 27M | |
![[SND]](/icons/sound2.gif) | asking.mp3 | 2022-07-06 00:18 | 27M | |
![[SND]](/icons/sound2.gif) | ryu3.mp3 | 2022-07-02 14:47 | 27M | |
![[SND]](/icons/sound2.gif) | kane2.mp3 | 2022-07-12 02:27 | 27M | |
![[VID]](/icons/movie.gif) | video_2022-07-04_01-08-25.mp4 | 2022-07-03 17:17 | 27M | |
![[VID]](/icons/movie.gif) | Project Number 22_1080p.mp4 | 2022-07-07 10:10 | 27M | |
![[SND]](/icons/sound2.gif) | Folgestrukturen (DJ Cannabis Coffeeshops Deutschland).mp3 | 2022-07-07 15:42 | 27M | |
![[SND]](/icons/sound2.gif) | koplo1.m4a | 2022-06-27 16:11 | 27M | |
![[SND]](/icons/sound2.gif) | Dorian Styles .mp3 | 2022-07-14 01:48 | 27M | |
![[SND]](/icons/sound2.gif) | AlexJumpz RetroPop Folk Extended Pack.mp3 | 2022-07-07 18:51 | 27M | |
![[SND]](/icons/sound2.gif) | turn.mp3 | 2022-06-30 19:35 | 27M | |
![[SND]](/icons/sound2.gif) | djcampur1.mp3 | 2022-06-30 18:59 | 27M | |
![[SND]](/icons/sound2.gif) | deni2.mp3 | 2022-06-30 13:51 | 27M | |
![[SND]](/icons/sound2.gif) | Bima.mp3 | 2022-06-30 17:58 | 27M | |
![[SND]](/icons/sound2.gif) | aljkp.mp3 | 2022-06-28 11:27 | 27M | |
![[VID]](/icons/movie.gif) | [Otakumars]_SMRTIRNDR_11_360p.mp4 | 2022-07-10 14:23 | 27M | |
![[SND]](/icons/sound2.gif) | kgf2fs.mp3 | 2022-07-02 10:17 | 26M | |
![[SND]](/icons/sound2.gif) | lagumrizkyanja.mp3 | 2022-07-15 20:54 | 26M | |
![[SND]](/icons/sound2.gif) | REMIX11.mp3 | 2022-07-16 09:24 | 26M | |
![[SND]](/icons/sound2.gif) | jaryodd.mp3 | 2022-06-30 08:00 | 26M | |
![[SND]](/icons/sound2.gif) | SaveTube.App - อาจารย์ยอด _ ไม่มีวาสนา [กรรม] (128 kbps).mp3 | 2022-06-30 07:54 | 26M | |
![[SND]](/icons/sound2.gif) | arta2.mp3 | 2022-07-03 15:17 | 26M | |
![[SND]](/icons/sound2.gif) | smooky.mp3 | 2022-07-08 06:57 | 26M | |
![[SND]](/icons/sound2.gif) | ikmal.mp3 | 2022-07-03 23:59 | 26M | |
![[SND]](/icons/sound2.gif) | volds0.mp3 | 2022-06-29 16:31 | 26M | |
![[SND]](/icons/sound2.gif) | anas12.mp3 | 2022-07-14 18:19 | 26M | |
![[SND]](/icons/sound2.gif) | Isco01.mp3 | 2022-06-27 17:28 | 26M | |
![[SND]](/icons/sound2.gif) | Joe7.mp3 | 2022-06-28 05:46 | 26M | |
![[SND]](/icons/sound2.gif) | ubay 1.mp3 | 2022-07-02 07:17 | 26M | |
![[SND]](/icons/sound2.gif) | scrt23.mp3 | 2022-07-10 18:12 | 26M | |
![[SND]](/icons/sound2.gif) | nikiganss.mp3 | 2022-06-30 23:08 | 26M | |
![[SND]](/icons/sound2.gif) | djcampuranzackob.mp3 | 2022-07-12 12:28 | 26M | |
![[SND]](/icons/sound2.gif) | dikaslebew.mp3 | 2022-07-01 11:07 | 26M | |
![[SND]](/icons/sound2.gif) | dheje1.mp3 | 2022-07-06 19:19 | 26M | |
![[SND]](/icons/sound2.gif) | danzz.mp3 | 2022-06-27 20:05 | 26M | |
![[SND]](/icons/sound2.gif) | ampe.mp3 | 2022-07-03 02:55 | 26M | |
![[SND]](/icons/sound2.gif) | agoy.mp3 | 2022-06-30 15:31 | 26M | |
![[SND]](/icons/sound2.gif) | Yamete1.mp3 | 2022-07-02 11:25 | 26M | |
![[SND]](/icons/sound2.gif) | Vodca6.mp3 | 2022-06-28 14:14 | 26M | |
![[SND]](/icons/sound2.gif) | Mengkane009.mp3 | 2022-07-01 03:13 | 26M | |
![[SND]](/icons/sound2.gif) | Guells.mp3 | 2022-07-12 04:25 | 26M | |
![[SND]](/icons/sound2.gif) | FaizGblg.mp3 | 2022-06-29 07:16 | 26M | |
![[SND]](/icons/sound2.gif) | Dhijujedug1.mp3 | 2022-07-14 03:20 | 26M | |
![[SND]](/icons/sound2.gif) | DJKECE.mp3 | 2022-07-05 23:19 | 26M | |
![[SND]](/icons/sound2.gif) | DJCAMPURAN.mp3 | 2022-07-03 12:35 | 26M | |
![[SND]](/icons/sound2.gif) | B_GanD.mp3 | 2022-07-12 01:05 | 26M | |
![[SND]](/icons/sound2.gif) | B_GanD'.mp3 | 2022-07-12 00:59 | 26M | |
![[SND]](/icons/sound2.gif) | Alboy.mp3 | 2022-07-14 16:29 | 26M | |
![[SND]](/icons/sound2.gif) | Alboy.1.mp3 | 2022-07-14 16:40 | 26M | |
![[SND]](/icons/sound2.gif) | anas.mp3 | 2022-07-25 00:17 | 26M | |
![[SND]](/icons/sound2.gif) | pauswlxx_-28062022-0002.mp3 | 2022-06-28 15:46 | 26M | |
![[SND]](/icons/sound2.gif) | mhgg.mp3 | 2022-06-28 15:47 | 26M | |
![[SND]](/icons/sound2.gif) | Rainie2.mp3 | 2022-07-09 11:34 | 26M | |
![[SND]](/icons/sound2.gif) | You are my life God.mp3 | 2022-07-31 01:13 | 26M | |
![[SND]](/icons/sound2.gif) | wizz3.mp3 | 2022-07-04 17:10 | 26M | |
![[SND]](/icons/sound2.gif) | ffp.mp3 | 2022-07-01 13:32 | 26M | |
![[SND]](/icons/sound2.gif) | 23campuran.mp3 | 2022-07-15 09:23 | 26M | |
![[SND]](/icons/sound2.gif) | mendi.mp3 | 2022-07-14 09:18 | 26M | |
![[SND]](/icons/sound2.gif) | antum.mp3 | 2022-07-11 08:17 | 26M | |
![[SND]](/icons/sound2.gif) | Timo6.mp3 | 2022-07-22 11:01 | 26M | |
![[SND]](/icons/sound2.gif) | Mj.mp3 | 2022-07-12 06:08 | 26M | |
![[SND]](/icons/sound2.gif) | Djmj.mp3 | 2022-07-11 21:58 | 26M | |
![[SND]](/icons/sound2.gif) | The_Haunted_Mansion_Full_Attractio_(getmp3.pro).mp3 | 2022-07-11 04:41 | 26M | |
![[SND]](/icons/sound2.gif) | WIBOY16.mp3 | 2022-07-20 03:13 | 26M | |
![[SND]](/icons/sound2.gif) | Stranger_Things_Season_4_EMOTIONAL_(getmp3.pro).mp3 | 2022-07-09 04:50 | 26M | |
![[VID]](/icons/movie.gif) | Perturbator - Technoir (feat. Noir Deco).mp4 | 2022-06-30 05:15 | 26M | |
![[VID]](/icons/movie.gif) | y2mate.com - Sexual Mix 𝘴𝘭𝘰𝘸𝘦𝘥 𝘵𝘰 𝘱𝘦𝘳𝘧𝘦𝘤𝘵𝘪𝘰𝘯 _360p.mp4 | 2022-07-15 20:19 | 26M | |
![[SND]](/icons/sound2.gif) | Riq4.mp3 | 2022-07-03 00:30 | 25M | |
![[SND]](/icons/sound2.gif) | TRIALS WEBSITE AUDIO.mp3 | 2022-07-07 00:40 | 25M | |
![[SND]](/icons/sound2.gif) | MIN3.mp3 | 2022-07-02 11:58 | 25M | |
![[SND]](/icons/sound2.gif) | ms13v15.mp3 | 2022-07-06 18:19 | 25M | |
![[SND]](/icons/sound2.gif) | 2022_TIKTOK_VIRUS_SOUND_MIXTAPE-ArtistDJ_TOBZY_IMOLE_GIWA.mp3 | 2022-06-30 19:07 | 25M | |
![[SND]](/icons/sound2.gif) | BANDANA - ПОЛНЫЙ АЛЬБОМ (mp3cut.net).mp3 | 2022-07-10 22:51 | 25M | |
![[SND]](/icons/sound2.gif) | y2mate.com - SATU ROOM PASTI MELAYANG TINGGI DJ CINTA TEGARKAN HATIKU X NEW JUNGLE DUTCH 2021 FULL BASS.mp3 | 2022-07-02 17:34 | 25M | |
![[SND]](/icons/sound2.gif) | lagu di taxi.mp3 | 2022-07-02 17:48 | 25M | |
![[SND]](/icons/sound2.gif) | Jawson2.mp3 | 2022-07-03 08:33 | 25M | |
![[SND]](/icons/sound2.gif) | Angryboy13.mp3 | 2022-07-12 14:35 | 25M | |
![[SND]](/icons/sound2.gif) | Ade.mp3 | 2022-07-02 13:52 | 25M | |
![[SND]](/icons/sound2.gif) | sumpas.mp3 | 2022-06-29 09:55 | 25M | |
![[SND]](/icons/sound2.gif) | vedro4.mp3 | 2022-06-28 04:06 | 25M | |
![[SND]](/icons/sound2.gif) | eros4.mp3 | 2022-07-08 08:46 | 25M | |
![[SND]](/icons/sound2.gif) | Rayn6.mp3 | 2022-07-16 03:32 | 24M | |
![[SND]](/icons/sound2.gif) | DeX6.mp3 | 2022-07-02 15:21 | 24M | |
![[SND]](/icons/sound2.gif) | ThomDJ1.mp3 | 2022-07-08 13:26 | 24M | |
![[SND]](/icons/sound2.gif) | s2.mp3 | 2022-07-08 08:02 | 24M | |
![[SND]](/icons/sound2.gif) | fullk.mp3 | 2022-07-14 19:26 | 24M | |
![[SND]](/icons/sound2.gif) | kasih.mp3 | 2022-06-30 05:27 | 24M | |
![[SND]](/icons/sound2.gif) | 1HOURJojosBizarreAdventureGiornosThemeTrapRemix.mp3 | 2022-06-30 04:16 | 24M | |
![[VID]](/icons/movie.gif) | lv_0_20220515191905.mp4 | 2022-07-06 09:40 | 24M | |
![[SND]](/icons/sound2.gif) | RyderModeMabok.mp3 | 2022-06-28 17:31 | 24M | |
![[SND]](/icons/sound2.gif) | #กำลังฮิตในTikTok ( รวมเพลงแดนซ์สุดฮิต - Nonstop ) เปิดดังๆ รำไม่หยุด Vol 1. _ DJ MOS.mp3 | 2022-06-30 01:12 | 24M | |
![[SND]](/icons/sound2.gif) | RyderModeDugem.mp3 | 2022-06-29 05:35 | 24M | |
![[SND]](/icons/sound2.gif) | fgh.mp3 | 2022-07-06 19:20 | 24M | |
![[SND]](/icons/sound2.gif) | Andresad.mp3 | 2022-07-05 16:45 | 24M | |
![[SND]](/icons/sound2.gif) | Dj Campuran Fypシ Viral Tik Tok 2022 Sound Kane Jedag Jedug Fullbass Terbaru.mp3 | 2022-07-14 04:58 | 24M | |
![[SND]](/icons/sound2.gif) | Erlan5.mp3 | 2022-07-09 08:52 | 24M | |
![[SND]](/icons/sound2.gif) | Erlan4.mp3 | 2022-07-09 08:52 | 24M | |
![[SND]](/icons/sound2.gif) | Ansteigenden Flanke (30.06.2022) DJ Cannabis Coffeeshops Deutschland).mp3 | 2022-06-30 13:19 | 24M | |
![[SND]](/icons/sound2.gif) | Raid - FOII _ كفاحي.mp3 | 2022-07-12 18:02 | 24M | |
![[SND]](/icons/sound2.gif) | fala fesso 62 - Igreja Católica no Brasil.mp3 | 2022-07-01 13:41 | 24M | |
![[SND]](/icons/sound2.gif) | 100gecs.mp3 | 2022-07-10 05:43 | 24M | |
![[SND]](/icons/sound2.gif) | 2022_Nonstop_Love_Mashup_Sunix_T_(getmp3.pro) (1).mp3 | 2022-06-28 07:04 | 24M | |
![[VID]](/icons/movie.gif) | anhnhoem.mp3.mp4 | 2022-07-16 07:29 | 24M | |
![[VID]](/icons/movie.gif) | anhnhoem.mp3 (2).mp4 | 2022-07-16 07:32 | 24M | |
![[SND]](/icons/sound2.gif) | X2Download.com - DWP.mp3 | 2022-07-13 16:50 | 24M | |
![[SND]](/icons/sound2.gif) | DWP.mp3 | 2022-07-13 16:53 | 24M | |
![[SND]](/icons/sound2.gif) | bablakan.mp3 | 2022-07-15 23:13 | 24M | |
![[SND]](/icons/sound2.gif) | Pler.mp3 | 2022-07-04 14:58 | 24M | |
![[SND]](/icons/sound2.gif) | (gudanglagu123.metrolagu.site) - DJ GLIMPSE OF US JOJI REMIX VIRAL TIKTOK FULL BASS TERBARU 2022.mp3 | 2022-07-04 14:56 | 24M | |
![[SND]](/icons/sound2.gif) | Lando2.mp3 | 2022-07-03 05:22 | 24M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ JEDAG JEDUG FULL BASS Lagu tik tok viral 2021 WilfexBor Terbaru.mp3 | 2022-07-03 20:30 | 24M | |
![[SND]](/icons/sound2.gif) | wilfex.mp3 | 2022-06-27 20:02 | 24M | |
![[SND]](/icons/sound2.gif) | dj2_hasyka_bop.mp3 | 2022-06-27 18:04 | 24M | |
![[SND]](/icons/sound2.gif) | dj2_bop.mp3 | 2022-07-05 19:16 | 24M | |
![[SND]](/icons/sound2.gif) | DeX2.mp3 | 2022-07-02 15:25 | 24M | |
![[SND]](/icons/sound2.gif) | GabDj4.mp3 | 2022-07-07 02:34 | 23M | |
![[SND]](/icons/sound2.gif) | IDUL ADHA 2022.m4a | 2022-07-09 16:31 | 23M | |
![[VID]](/icons/movie.gif) | y2mate.com - Baby You Kiss Me Ở Sâu Trong Tâm TríLac Vao Trong Mo Simon C ft Wuy Jena Remix_v720P (2).mp4 | 2022-06-29 03:04 | 23M | |
![[SND]](/icons/sound2.gif) | DG1.mp3 | 2022-07-02 02:58 | 23M | |
![[SND]](/icons/sound2.gif) | pndo6.mp3 | 2022-06-28 16:05 | 23M | |
![[SND]](/icons/sound2.gif) | wizz6.mp3 | 2022-07-04 17:14 | 23M | |
![[SND]](/icons/sound2.gif) | yed.mp3 | 2022-07-19 02:10 | 23M | |
![[SND]](/icons/sound2.gif) | ryu5.mp3 | 2022-07-02 14:49 | 23M | |
![[SND]](/icons/sound2.gif) | iyeh.mp3 | 2022-06-30 16:38 | 23M | |
![[SND]](/icons/sound2.gif) | Programmierparadigmen (DJ Cannabis Coffeeshops Deutschland).mp3 | 2022-07-06 16:25 | 23M | |
![[VID]](/icons/movie.gif) | vivi_basith.mp4 | 2022-06-29 05:55 | 23M | |
![[SND]](/icons/sound2.gif) | WARNING.mp3 | 2022-06-27 14:26 | 23M | |
![[SND]](/icons/sound2.gif) | tegar1.mp3 | 2022-07-05 20:13 | 23M | |
![[SND]](/icons/sound2.gif) | mulet.mp3 | 2022-07-07 19:47 | 23M | |
![[SND]](/icons/sound2.gif) | Ghostemane.mp3 | 2022-07-05 18:29 | 23M | |
![[SND]](/icons/sound2.gif) | DezzChinese.mp3 | 2022-07-04 09:21 | 23M | |
![[SND]](/icons/sound2.gif) | SIKOK3.mp3 | 2022-07-09 20:18 | 23M | |
![[SND]](/icons/sound2.gif) | cemara.mp3 | 2022-06-29 22:36 | 23M | |
![[SND]](/icons/sound2.gif) | Brik2.mp3 | 2022-07-05 07:54 | 23M | |
![[SND]](/icons/sound2.gif) | Anas2.mp3 | 2022-07-15 23:49 | 23M | |
![[SND]](/icons/sound2.gif) | Asw5.mp3 | 2022-07-15 08:36 | 23M | |
![[SND]](/icons/sound2.gif) | xxk.mp3 | 2022-07-08 23:28 | 23M | |
![[SND]](/icons/sound2.gif) | bruceleeremix.mp3 | 2022-07-08 21:11 | 23M | |
![[SND]](/icons/sound2.gif) | WIBOY6.mp3 | 2022-06-29 06:10 | 23M | |
![[SND]](/icons/sound2.gif) | bmega7.mp3 | 2022-07-09 16:56 | 23M | |
![[SND]](/icons/sound2.gif) | Dugem2.mp3 | 2022-07-06 14:33 | 23M | |
![[SND]](/icons/sound2.gif) | RdV12.mp3 | 2022-07-17 05:59 | 23M | |
![[SND]](/icons/sound2.gif) | Gesti10.mp3 | 2022-07-03 06:21 | 23M | |
![[VID]](/icons/movie.gif) | Twenty_One_Pilots_-_Ride_live_Lollapalooza_Brasil_2016.mp4 | 2022-07-11 07:39 | 23M | |
![[SND]](/icons/sound2.gif) | djwili.mp3 | 2022-06-28 22:41 | 23M | |
![[SND]](/icons/sound2.gif) | jomar9.mp3 | 2022-07-17 06:53 | 23M | |
![[SND]](/icons/sound2.gif) | 1985-xx-xx_INC.mp3 | 2022-07-05 06:41 | 23M | |
![[VID]](/icons/movie.gif) | lv_0_20220707233058.mp4 | 2022-07-07 16:33 | 23M | |
![[SND]](/icons/sound2.gif) | dj taxi fulbass.mp3 | 2022-07-02 18:21 | 23M | |
![[SND]](/icons/sound2.gif) | cuki.mp3 | 2022-07-07 18:24 | 23M | |
![[SND]](/icons/sound2.gif) | saassads.mp3 | 2022-07-01 18:24 | 23M | |
![[SND]](/icons/sound2.gif) | Safeaudiokit.com_dsdsdsdsds (mp3cut.mp3 | 2022-07-01 18:23 | 23M | |
![[SND]](/icons/sound2.gif) | 1. Sen z delfinami - wizualizacja.mp3 | 2022-07-13 23:29 | 23M | |
![[SND]](/icons/sound2.gif) | Start Bit (DJ Cannabis Coffeeshops Deutschland).mp3 | 2022-06-29 07:41 | 23M | |
![[SND]](/icons/sound2.gif) | KARYA.mp3 | 2022-07-04 01:55 | 23M | |
![[SND]](/icons/sound2.gif) | DJJ10.mp3 | 2022-07-02 03:28 | 22M | |
![[SND]](/icons/sound2.gif) | Heilung - Traust.mp3 | 2022-07-06 07:30 | 22M | |
![[SND]](/icons/sound2.gif) | kitil.mp3 | 2022-08-02 12:28 | 22M | |
![[SND]](/icons/sound2.gif) | Terraria Calamity Mod - Devourer of Gods Nonstop Mix (Remake).mp3 | 2022-07-05 02:42 | 22M | |
![[VID]](/icons/movie.gif) | lv_7086408831852350722_20220630022208.mp4 | 2022-06-30 08:45 | 22M | |
![[SND]](/icons/sound2.gif) | Casey_Edwards_feat_Victor_Borba_-_Bury_The_Light_70995637.mp3 | 2022-07-14 17:07 | 22M | |
![[SND]](/icons/sound2.gif) | willson.mp3 | 2022-07-01 13:55 | 22M | |
![[SND]](/icons/sound2.gif) | Ywillson.mp3 | 2022-07-02 06:36 | 22M | |
![[SND]](/icons/sound2.gif) | Willson.mp3 | 2022-07-02 05:22 | 22M | |
![[SND]](/icons/sound2.gif) | Dudung6.mp3 | 2022-06-29 05:34 | 22M | |
![[SND]](/icons/sound2.gif) | hgf.mp3 | 2022-07-06 19:20 | 22M | |
![[SND]](/icons/sound2.gif) | casey-edwards-ft.-victor-borba-bury-the-light_456239252.mp3 | 2022-07-16 13:47 | 22M | |
![[SND]](/icons/sound2.gif) | Central.mp3 | 2022-07-29 07:39 | 22M | |
![[SND]](/icons/sound2.gif) | j82xkw.mp3 | 2022-06-28 22:19 | 22M | |
![[SND]](/icons/sound2.gif) | Mentol12.mp3 | 2022-06-28 15:14 | 22M | |
![[SND]](/icons/sound2.gif) | Guells3.mp3 | 2022-07-12 06:54 | 22M | |
![[SND]](/icons/sound2.gif) | DJENK.m4a | 2022-07-01 13:30 | 22M | |
![[SND]](/icons/sound2.gif) | DimsPL2.mp3 | 2022-07-11 08:28 | 22M | |
![[SND]](/icons/sound2.gif) | Ayatkursi1.mp3 | 2022-07-09 11:24 | 22M | |
![[SND]](/icons/sound2.gif) | 14. Noon o Panir o Sabzi - Dariush & Ebi.mp3 | 2022-06-28 13:53 | 22M | |
![[SND]](/icons/sound2.gif) | Kiyo.mp3 | 2022-07-11 04:27 | 22M | |
![[SND]](/icons/sound2.gif) | Janji Ga janji.mp3 | 2022-07-03 08:53 | 22M | |
![[SND]](/icons/sound2.gif) | Oniwok1.mp3 | 2022-06-28 12:44 | 22M | |
![[SND]](/icons/sound2.gif) | kuyagoods.mp3 | 2022-07-30 18:59 | 22M | |
![[SND]](/icons/sound2.gif) | code005.mp3 | 2022-07-09 09:31 | 22M | |
![[SND]](/icons/sound2.gif) | code001.mp3 | 2022-07-05 10:33 | 22M | |
![[SND]](/icons/sound2.gif) | viral2.mp3 | 2022-07-07 01:24 | 22M | |
![[SND]](/icons/sound2.gif) | eros24.mp3 | 2022-07-14 17:11 | 22M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ CAMPURAN TIK TOK 2022 JEDAG JEDUG FULL BASS YANG LAGI VIRAL_2.mp3 | 2022-06-27 20:57 | 22M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ CAMPURAN TIK TOK 2022 JEDAG JEDUG FULL BASS YANG LAGI VIRAL.mp3 | 2022-06-27 20:57 | 22M | |
![[SND]](/icons/sound2.gif) | 1326.mp3 | 2022-07-07 06:24 | 22M | |
![[SND]](/icons/sound2.gif) | listrap1.mp3 | 2022-07-05 10:08 | 22M | |
![[SND]](/icons/sound2.gif) | andoy.mp3 | 2022-06-27 20:07 | 22M | |
![[SND]](/icons/sound2.gif) | Badri45.mp3 | 2022-07-16 04:39 | 22M | |
![[SND]](/icons/sound2.gif) | DJ PALING ENAK.mp3 | 2022-06-29 12:12 | 22M | |
![[SND]](/icons/sound2.gif) | djasik.mp3 | 2022-07-04 08:06 | 22M | |
![[SND]](/icons/sound2.gif) | nzr1.mp3 | 2022-07-01 09:36 | 22M | |
![[SND]](/icons/sound2.gif) | takbiran1.mp3 | 2022-07-09 18:16 | 22M | |
![[SND]](/icons/sound2.gif) | graduatecodrp.mp3 | 2022-07-02 14:43 | 21M | |
![[SND]](/icons/sound2.gif) | nhacvaic.mp3 | 2022-07-11 02:15 | 21M | |
![[SND]](/icons/sound2.gif) | ryu11.mp3 | 2022-07-02 14:52 | 21M | |
![[SND]](/icons/sound2.gif) | 4 T-Zyklen (DJ Cannabis Coffeeshops Deutschland (01.07.2022).mp3 | 2022-07-01 13:34 | 21M | |
![[SND]](/icons/sound2.gif) | kaalan7.mp3 | 2022-07-09 19:20 | 21M | |
![[SND]](/icons/sound2.gif) | djwili1.mp3 | 2022-06-28 23:09 | 21M | |
![[SND]](/icons/sound2.gif) | REVERB2.mp3 | 2022-06-27 15:22 | 21M | |
![[SND]](/icons/sound2.gif) | 4BitDaten (DJ Cannabis Coffeeshops Deutschland).mp3 | 2022-06-28 10:53 | 21M | |
![[SND]](/icons/sound2.gif) | interview.mp3 | 2022-07-10 18:04 | 21M | |
![[SND]](/icons/sound2.gif) | broo.mp3 | 2022-07-13 08:46 | 21M | |
![[SND]](/icons/sound2.gif) | djraher1.mp3 | 2022-07-08 13:45 | 21M | |
![[SND]](/icons/sound2.gif) | traktor.mp3 | 2022-07-28 07:51 | 21M | |
![[SND]](/icons/sound2.gif) | pakna1.mp3 | 2022-07-11 14:52 | 21M | |
![[SND]](/icons/sound2.gif) | nexians1.mp3 | 2022-07-11 15:22 | 21M | |
![[SND]](/icons/sound2.gif) | lermut7.mp3 | 2022-07-21 12:02 | 21M | |
![[SND]](/icons/sound2.gif) | botmmk.mp3 | 2022-07-13 14:42 | 21M | |
![[SND]](/icons/sound2.gif) | RWQ.mp3 | 2022-07-06 14:21 | 21M | |
![[SND]](/icons/sound2.gif) | Manakutehe Campuran.mp3 | 2022-07-07 10:47 | 21M | |
![[SND]](/icons/sound2.gif) | HA23.mp3 | 2022-06-29 14:26 | 21M | |
![[SND]](/icons/sound2.gif) | Guells1.mp3 | 2022-07-12 04:58 | 21M | |
![[SND]](/icons/sound2.gif) | Dhaff2.mp3 | 2022-07-09 12:41 | 21M | |
![[SND]](/icons/sound2.gif) | Campur.mp3 | 2022-07-06 19:27 | 21M | |
![[SND]](/icons/sound2.gif) | siu.mp3 | 2022-07-06 03:29 | 21M | |
![[SND]](/icons/sound2.gif) | djfullbass_1.mp3 | 2022-07-10 12:42 | 21M | |
![[SND]](/icons/sound2.gif) | djfullbass.mp3 | 2022-06-27 15:39 | 21M | |
![[SND]](/icons/sound2.gif) | campur.mp3 | 2022-07-16 07:30 | 21M | |
![[SND]](/icons/sound2.gif) | DJ CAMPURAN FYP TIKTOK VIRAL TERBARU JEDAG JEDUG FULL BASS MENGKANE 2022.mp3 | 2022-07-17 05:23 | 21M | |
![[SND]](/icons/sound2.gif) | 198x-xx-xx WNBC.mp3 | 2022-07-05 06:40 | 21M | |
![[VID]](/icons/movie.gif) | Michael’s first therapy session [PS4].mp4 | 2022-07-06 15:55 | 21M | |
![[SND]](/icons/sound2.gif) | jack3.mp3 | 2022-07-06 10:12 | 21M | |
![[SND]](/icons/sound2.gif) | ciperi.mp3 | 2022-07-01 17:27 | 21M | |
![[SND]](/icons/sound2.gif) | Molekulare Computer (DJ Cannabis Coffeeshops Deutschland).mp3 | 2022-07-03 16:03 | 21M | |
![[SND]](/icons/sound2.gif) | YoungOhm.mp3 | 2022-07-21 06:58 | 21M | |
![[SND]](/icons/sound2.gif) | ms13v18.mp3 | 2022-07-06 18:21 | 21M | |
![[SND]](/icons/sound2.gif) | vinky.mp3 | 2022-07-09 11:10 | 21M | |
![[SND]](/icons/sound2.gif) | Stained, Brutal Calamity.mp3 | 2022-07-05 02:25 | 21M | |
![[SND]](/icons/sound2.gif) | Hubbo_Janah.MP.mp3 | 2022-07-07 06:17 | 21M | |
![[SND]](/icons/sound2.gif) | Vip18.mp3 | 2022-07-19 12:38 | 21M | |
![[SND]](/icons/sound2.gif) | prm6.mp3 | 2022-07-15 11:46 | 21M | |
![[SND]](/icons/sound2.gif) | RizzDj1.mp3 | 2022-06-28 17:09 | 21M | |
![[SND]](/icons/sound2.gif) | bizarre.mp3 | 2022-07-14 16:40 | 21M | |
![[SND]](/icons/sound2.gif) | TitoDeib6.mp3 | 2022-06-29 18:00 | 21M | |
![[SND]](/icons/sound2.gif) | ryan1.mp3 | 2022-07-02 09:56 | 21M | |
![[SND]](/icons/sound2.gif) | Dudung5.mp3 | 2022-06-29 05:33 | 21M | |
![[SND]](/icons/sound2.gif) | zeon11.mp3 | 2022-07-09 16:09 | 21M | |
![[SND]](/icons/sound2.gif) | code004.mp3 | 2022-07-06 07:35 | 21M | |
![[SND]](/icons/sound2.gif) | CKOD2.mp3 | 2022-07-03 12:08 | 20M | |
![[SND]](/icons/sound2.gif) | vend7.mp3 | 2022-07-10 14:26 | 20M | |
![[SND]](/icons/sound2.gif) | 1982 Summer (Monday after Robin left DC101).mp3 | 2022-07-05 06:40 | 20M | |
![[SND]](/icons/sound2.gif) | DJ NISSA MUSIK BREAKBEAT TERBARU djmatalelaki.mp3 | 2022-06-30 10:54 | 20M | |
![[SND]](/icons/sound2.gif) | basta.mp3 | 2022-07-22 11:01 | 20M | |
![[SND]](/icons/sound2.gif) | Djcampuran.mp3 | 2022-07-15 00:12 | 20M | |
![[SND]](/icons/sound2.gif) | Jamie Christopherson - It Has To Be This Way .mp3 | 2022-07-01 10:35 | 20M | |
![[SND]](/icons/sound2.gif) | Don_Songs_Tamil_Audio_Jukebox(256k).mp3 | 2022-06-28 15:08 | 20M | |
![[SND]](/icons/sound2.gif) | ACBC_-_You_Shook_Me_All_Night_Long_.mp3 | 2022-07-05 07:25 | 20M | |
![[SND]](/icons/sound2.gif) | Haruskah Berakhir.mp3 | 2022-07-03 08:48 | 20M | |
![[SND]](/icons/sound2.gif) | zrkdjcalma.mp3 | 2022-06-29 07:46 | 20M | |
![[SND]](/icons/sound2.gif) | zacky1.mp3 | 2022-06-28 20:25 | 20M | |
![[SND]](/icons/sound2.gif) | campuranold.mp3 | 2022-06-27 15:53 | 20M | |
![[SND]](/icons/sound2.gif) | DJ CAMPURAN OLD SLOW BASS VIRAL TIK TOK 2022.mp3 | 2022-07-15 12:33 | 20M | |
![[SND]](/icons/sound2.gif) | Rustam Abrekov - Убойная лезгинка 2020_(audiohunter.ru).mp3 | 2022-06-27 15:01 | 20M | |
![[SND]](/icons/sound2.gif) | ♛ «𝐌 𝐈 𝐋 𝐀 𝐑 𝐆 𝐎» ♛.mp3 | 2022-07-01 01:23 | 20M | |
![[SND]](/icons/sound2.gif) | LP.mp3 | 2022-07-03 06:00 | 20M | |
![[SND]](/icons/sound2.gif) | BM1.mp3 | 2022-07-14 12:01 | 20M | |
![[VID]](/icons/movie.gif) | Snaptik_7116070148997500187_fans-kang-dedimulyadi93.mp4 | 2022-07-16 08:24 | 20M | |
![[SND]](/icons/sound2.gif) | Warm Up Mix Episode 1 (UYR93.4FM).mp3 | 2022-07-16 22:46 | 20M | |
![[SND]](/icons/sound2.gif) | STICKY FINGERS.mp3 | 2022-07-20 19:39 | 20M | |
![[SND]](/icons/sound2.gif) | JoJo's Bizarre Adventure_ Golden Wind - nella cerniera 【Intense Symphonic Metal Cover】.mp3 | 2022-07-15 02:26 | 20M | |
![[SND]](/icons/sound2.gif) | bilaaa.mp3 | 2022-07-09 02:03 | 20M | |
![[SND]](/icons/sound2.gif) | bilturu.mp3 | 2022-07-02 18:45 | 20M | |
![[SND]](/icons/sound2.gif) | TomoDacHi Life OST - Day Theme.mp3 | 2022-07-09 00:41 | 20M | |
![[SND]](/icons/sound2.gif) | Flixx8.mp3 | 2022-07-01 08:55 | 19M | |
![[SND]](/icons/sound2.gif) | antup.mp3 | 2022-07-11 09:04 | 19M | |
![[SND]](/icons/sound2.gif) | Guells4.mp3 | 2022-07-12 11:43 | 19M | |
![[SND]](/icons/sound2.gif) | GabDj5.mp3 | 2022-07-07 02:33 | 19M | |
![[SND]](/icons/sound2.gif) | CDE.mp3 | 2022-07-16 05:02 | 19M | |
![[SND]](/icons/sound2.gif) | technicalpiano.mp3 | 2022-07-05 10:30 | 19M | |
![[SND]](/icons/sound2.gif) | hanz2.mp3 | 2022-07-06 05:50 | 19M | |
![[SND]](/icons/sound2.gif) | 1985-09-24 WNBC.mp3 | 2022-07-05 06:41 | 19M | |
![[SND]](/icons/sound2.gif) | CD2.mp3 | 2022-07-09 01:15 | 19M | |
![[SND]](/icons/sound2.gif) | 1984-xx-xx - 1st naked woman_INC.mp3 | 2022-07-05 06:41 | 19M | |
![[SND]](/icons/sound2.gif) | [YT2mp3.info] - Mick Gordon - 11. BFG Division (320kbps).mp3 | 2022-07-15 21:10 | 19M | |
![[SND]](/icons/sound2.gif) | dgm2.mp3 | 2022-07-07 12:31 | 19M | |
![[SND]](/icons/sound2.gif) | PPP.mp3 | 2022-07-29 15:43 | 19M | |
![[SND]](/icons/sound2.gif) | Hull.mp3 | 2022-07-20 00:04 | 19M | |
![[SND]](/icons/sound2.gif) | 13. Flak - In den Strassen von Paris.mp3 | 2022-07-06 18:24 | 19M | |
![[SND]](/icons/sound2.gif) | 1984 NBC.mp3 | 2022-07-05 06:41 | 19M | |
![[SND]](/icons/sound2.gif) | djA.mp3 | 2022-07-02 12:39 | 19M | |
![[SND]](/icons/sound2.gif) | akusayangkamu01.mp3 | 2022-06-28 02:52 | 19M | |
![[SND]](/icons/sound2.gif) | ZexX6.mp3 | 2022-07-06 12:19 | 19M | |
![[SND]](/icons/sound2.gif) | Menekethe.mp3 | 2022-07-02 21:33 | 19M | |
![[SND]](/icons/sound2.gif) | X2Download.com - Ori And The Will Of The Wisps OST - Separated by the Storm (Extended Version) (128 kbps).mp3 | 2022-07-10 22:07 | 19M | |
![[SND]](/icons/sound2.gif) | 11. Bad Boys Blue - A Train To Nowhere (RDC Remix).mp3 | 2022-07-15 19:42 | 19M | |
![[SND]](/icons/sound2.gif) | ttn.mp3 | 2022-07-05 16:49 | 19M | |
![[SND]](/icons/sound2.gif) | yearly.mp3 | 2022-07-08 04:07 | 19M | |
![[SND]](/icons/sound2.gif) | remix2.mp3 | 2022-06-29 17:41 | 19M | |
![[SND]](/icons/sound2.gif) | listrap.mp3 | 2022-07-05 10:08 | 19M | |
![[SND]](/icons/sound2.gif) | valedj1.mp3 | 2022-07-07 23:59 | 19M | |
![[VID]](/icons/movie.gif) | VID-20220709-WA0036.mp4 | 2022-07-10 02:19 | 19M | |
![[SND]](/icons/sound2.gif) | iro4.mp3 | 2022-08-04 09:42 | 19M | |
![[SND]](/icons/sound2.gif) | Аукцыон - Самолёт.mp3 | 2022-07-07 08:09 | 19M | |
![[VID]](/icons/movie.gif) | httpswww.mp4 | 2022-07-10 08:12 | 19M | |
![[SND]](/icons/sound2.gif) | fatur5.mp3 | 2022-07-10 07:18 | 19M | |
![[SND]](/icons/sound2.gif) | Kklo.mp3 | 2022-07-08 18:56 | 19M | |
![[SND]](/icons/sound2.gif) | y2mate.com - CINTA TERBAIK X AKU KAU DAN KENANGAN DJ BABY CHIA.mp3 | 2022-06-30 10:54 | 19M | |
![[SND]](/icons/sound2.gif) | DeX5.mp3 | 2022-07-02 15:23 | 19M | |
![[SND]](/icons/sound2.gif) | fatur6.mp3 | 2022-07-05 11:29 | 19M | |
![[SND]](/icons/sound2.gif) | zx.mp3 | 2022-07-11 06:53 | 19M | |
![[SND]](/icons/sound2.gif) | lennoxsdj30.mp3 | 2022-06-28 03:06 | 19M | |
![[SND]](/icons/sound2.gif) | acho11.mp3 | 2022-06-29 06:01 | 19M | |
![[SND]](/icons/sound2.gif) | Marko korjaa!.mp3 | 2022-07-16 16:15 | 19M | |
![[SND]](/icons/sound2.gif) | X2Download.com - penoreri - Monochrome and Vivid (320 kbps).mp3 | 2022-07-13 02:54 | 19M | |
![[SND]](/icons/sound2.gif) | sun-araw-deep-cover.mp3 | 2022-07-05 18:57 | 19M | |
![[SND]](/icons/sound2.gif) | Griscc4.mp3 | 2022-07-07 04:57 | 18M | |
![[SND]](/icons/sound2.gif) | mc1.pm3.mp3 | 2022-07-08 17:50 | 18M | |
![[SND]](/icons/sound2.gif) | Lag39.mp3 | 2022-06-30 19:01 | 18M | |
![[SND]](/icons/sound2.gif) | Ali Nadem - Electro Champion (V1 Final).mp3 | 2022-07-04 17:41 | 18M | |
![[VID]](/icons/movie.gif) | lv_7111690396354301186_20220711171555.mp4 | 2022-07-13 05:50 | 18M | |
![[SND]](/icons/sound2.gif) | ll2.mp3 | 2022-07-12 09:27 | 18M | |
![[SND]](/icons/sound2.gif) | yazin.mp3 | 2022-07-25 17:11 | 18M | |
![[SND]](/icons/sound2.gif) | Wave V - Exploring 3 - Mission Day.mp3 | 2022-07-04 23:12 | 18M | |
![[SND]](/icons/sound2.gif) | Mora1.mp3 | 2022-07-05 22:37 | 18M | |
![[SND]](/icons/sound2.gif) | goblok4.mp3 | 2022-07-04 09:12 | 18M | |
![[SND]](/icons/sound2.gif) | DJMAMAAFRIKA.mp3 | 2022-07-12 18:25 | 18M | |
![[SND]](/icons/sound2.gif) | tp8.mp3 | 2022-06-28 02:08 | 18M | |
![[SND]](/icons/sound2.gif) | acho6.mp3 | 2022-06-29 06:00 | 18M | |
![[SND]](/icons/sound2.gif) | revrin.mp3 | 2022-06-27 20:02 | 18M | |
![[SND]](/icons/sound2.gif) | Badri9.mp3 | 2022-07-15 14:57 | 18M | |
![[SND]](/icons/sound2.gif) | Essere-opera_completa.mp3 | 2022-07-01 06:14 | 18M | |
![[SND]](/icons/sound2.gif) | brikbet2.mp3 | 2022-07-08 13:40 | 18M | |
![[SND]](/icons/sound2.gif) | 6月25日 爱的誓言2.mp3 | 2022-07-10 09:38 | 18M | |
![[VID]](/icons/movie.gif) | Bj-rk-Play-Dead-Maxima.mp4 | 2022-07-05 15:30 | 18M | |
![[SND]](/icons/sound2.gif) | Fluoreszenzquantenausbeute (DJ Cannabis Coffeeshops Deutschland).mp3 | 2022-07-04 13:45 | 18M | |
![[SND]](/icons/sound2.gif) | Наум14- Руфо88- Маккуин- Паша Тэйзер- Миша Бамберг- МаркусПравда- Юрастос- Курсфэйк- Девиантный диалект-Славяне в панамах-kissvk.com.mp3 | 2022-07-13 17:58 | 18M | |
![[SND]](/icons/sound2.gif) | 1983 - Robin's Last Day on DC101.mp3 | 2022-07-05 06:40 | 18M | |
![[SND]](/icons/sound2.gif) | Björk - Play Dead Maxima.mp3 | 2022-07-05 15:36 | 18M | |
![[SND]](/icons/sound2.gif) | animemix.mp3 | 2022-07-17 22:26 | 18M | |
![[SND]](/icons/sound2.gif) | creedence-clearwater-revival-i-heard-it-through-the-grapevine-1_1.mp3 | 2022-08-05 14:47 | 18M | |
![[SND]](/icons/sound2.gif) | rafa.mp3 | 2022-07-14 06:05 | 18M | |
![[SND]](/icons/sound2.gif) | Napo2.mp3 | 2022-07-02 19:54 | 18M | |
![[SND]](/icons/sound2.gif) | drake10.mp3 | 2022-07-06 18:35 | 18M | |
![[SND]](/icons/sound2.gif) | Nivel.mp3 | 2022-06-28 08:46 | 18M | |
![[SND]](/icons/sound2.gif) | Flixx2.mp3 | 2022-07-01 08:55 | 18M | |
![[SND]](/icons/sound2.gif) | BawX2.mp3 | 2022-07-04 11:55 | 18M | |
![[SND]](/icons/sound2.gif) | PAB2.mp3 | 2022-07-14 09:10 | 18M | |
![[SND]](/icons/sound2.gif) | sadbgt.mp3 | 2022-06-27 16:03 | 18M | |
![[SND]](/icons/sound2.gif) | DisclaimerAlbum.mp3 | 2022-07-11 14:07 | 18M | |
![[SND]](/icons/sound2.gif) | req134.mp3 | 2022-07-19 01:04 | 18M | |
![[SND]](/icons/sound2.gif) | BAB.mp3 | 2022-08-02 20:56 | 18M | |
![[SND]](/icons/sound2.gif) | ch3bi.mp3 | 2022-07-06 11:37 | 18M | |
![[SND]](/icons/sound2.gif) | raak6.mp3 | 2022-06-30 17:20 | 18M | |
![[SND]](/icons/sound2.gif) | zannn.mp3 | 2022-07-02 03:44 | 18M | |
![[SND]](/icons/sound2.gif) | AUDIO MOTIVACION.mp3 | 2022-06-28 00:28 | 18M | |
![[SND]](/icons/sound2.gif) | zrkdjside.mp3 | 2022-06-29 07:46 | 18M | |
![[SND]](/icons/sound2.gif) | HerruSanew YELLOW 2022.mp3 | 2022-07-14 11:35 | 18M | |
![[SND]](/icons/sound2.gif) | jempol.mp3 | 2022-06-30 06:58 | 18M | |
![[SND]](/icons/sound2.gif) | PieceHeaven.mp3 | 2022-06-29 04:27 | 18M | |
![[SND]](/icons/sound2.gif) | wawe11.mp3 | 2022-07-05 23:12 | 18M | |
![[SND]](/icons/sound2.gif) | eros22.mp3 | 2022-07-14 16:35 | 18M | |
![[SND]](/icons/sound2.gif) | 93697503.mp3 | 2022-07-01 01:57 | 18M | |
![[SND]](/icons/sound2.gif) | sampe.mp3 | 2022-07-15 14:02 | 18M | |
![[SND]](/icons/sound2.gif) | DATPoke (DJ Cannabis Coffeeshops Deutschland).mp3 | 2022-07-08 15:30 | 18M | |
![[SND]](/icons/sound2.gif) | DeX3.mp3 | 2022-07-02 15:23 | 18M | |
![[SND]](/icons/sound2.gif) | daru.mp3 | 2022-07-12 14:58 | 18M | |
![[SND]](/icons/sound2.gif) | 02.mp3 | 2022-08-07 15:58 | 18M | |
![[SND]](/icons/sound2.gif) | pv1.mp3 | 2022-07-10 09:47 | 18M | |
![[SND]](/icons/sound2.gif) | ER.mp3 | 2022-07-25 13:09 | 18M | |
![[SND]](/icons/sound2.gif) | Sat.mp3 | 2022-06-28 16:00 | 18M | |
![[SND]](/icons/sound2.gif) | 7473.mp3 | 2022-07-01 22:48 | 18M | |
![[SND]](/icons/sound2.gif) | แดนซ์มัน ๆ.mp3 | 2022-07-07 17:00 | 18M | |
![[SND]](/icons/sound2.gif) | Elang12s.mp3 | 2022-07-21 07:12 | 17M | |
![[SND]](/icons/sound2.gif) | tha2.mp3 | 2022-07-08 07:19 | 17M | |
![[SND]](/icons/sound2.gif) | TKB.mp3 | 2022-07-09 11:32 | 17M | |
![[SND]](/icons/sound2.gif) | 228.mp3 | 2022-07-02 06:39 | 17M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ TERBARU VIRAL HANYA SATU PERSINGGAHAN FULL BASS.mp3 | 2022-06-27 21:00 | 17M | |
![[SND]](/icons/sound2.gif) | Flixx3.mp3 | 2022-07-01 08:55 | 17M | |
![[SND]](/icons/sound2.gif) | mix_18m50s (audio-joiner.com).mp3 | 2022-07-01 02:33 | 17M | |
![[SND]](/icons/sound2.gif) | VA.mp3 | 2022-07-10 02:09 | 17M | |
![[VID]](/icons/movie.gif) | BAON CIKIDAP - LAGU jorok ( official lirik video).mp4 | 2022-07-14 07:55 | 17M | |
![[SND]](/icons/sound2.gif) | Rox3.mp3 | 2022-07-09 21:14 | 17M | |
![[SND]](/icons/sound2.gif) | Best_Of_Romantic_Bollywood_Love_Mas_(getmp3.pro).mp3 | 2022-06-28 07:02 | 17M | |
![[SND]](/icons/sound2.gif) | Pam Monday_Sojojin Yesu[st.blingsmusic].mp3 | 2022-07-04 22:22 | 17M | |
![[SND]](/icons/sound2.gif) | Rhey41.mp3 | 2022-06-29 11:10 | 17M | |
![[SND]](/icons/sound2.gif) | 82908010.mp3 | 2022-07-01 01:57 | 17M | |
![[VID]](/icons/movie.gif) | Gift #2.mp4 | 2022-07-09 11:58 | 17M | |
![[SND]](/icons/sound2.gif) | andreana_eki_dva_galeba_live_mix_2_-3507836267716250081.mp3 | 2022-07-29 23:39 | 17M | |
![[SND]](/icons/sound2.gif) | BEST_TIKTOK_MASHUP_2022_PHILIPPINE_(getmp3.pro).mp3 | 2022-07-08 15:29 | 17M | |
![[SND]](/icons/sound2.gif) | Guells8.mp3 | 2022-07-15 03:57 | 17M | |
![[SND]](/icons/sound2.gif) | Last jam refmix 5-20.mp3 | 2022-07-14 01:48 | 17M | |
![[SND]](/icons/sound2.gif) | Bass4.mp3 | 2022-07-17 02:01 | 17M | |
![[SND]](/icons/sound2.gif) | Ma13.mp3 | 2022-07-16 04:01 | 17M | |
![[SND]](/icons/sound2.gif) | The Audio Unit - Make A Move.mp3 | 2022-07-05 00:08 | 17M | |
![[SND]](/icons/sound2.gif) | mw_2.mp3 | 2022-07-20 15:00 | 17M | |
![[SND]](/icons/sound2.gif) | inbound2805119587487991076.mp3 | 2022-06-29 10:46 | 17M | |
![[SND]](/icons/sound2.gif) | 10เพลงฮิต #เพลงแดนซ์มาแรง (ตื๊ดฮิตตลอดกาล!!) ★คัดมาแล้ว ★Set.20★ _ Dancetamjai Station🚀.mp3 | 2022-07-12 05:41 | 17M | |
![[VID]](/icons/movie.gif) | y2mate.com - 2Pac Fat Joe Plata o Plomo Hustle Corp Remix_360p.mp4 | 2022-07-15 00:01 | 17M | |
![[SND]](/icons/sound2.gif) | SampeBawahNgabJacky.mp3 | 2022-07-05 01:10 | 17M | |
![[SND]](/icons/sound2.gif) | Non-Stop Road Trip Jukebox _ SICKVED _ Best Travelling Songs _ Bollywood.mp3 | 2022-07-04 13:20 | 17M | |
![[SND]](/icons/sound2.gif) | TitoDeib25.mp3 | 2022-06-29 19:33 | 17M | |
![[SND]](/icons/sound2.gif) | lermut1.mp3 | 2022-07-04 13:03 | 17M | |
![[SND]](/icons/sound2.gif) | umay3.mp3 | 2022-07-24 17:46 | 17M | |
![[SND]](/icons/sound2.gif) | Memek.mp3 | 2022-07-04 07:34 | 17M | |
![[SND]](/icons/sound2.gif) | Dudung1.mp3 | 2022-06-29 05:33 | 17M | |
![[SND]](/icons/sound2.gif) | vall7.mp3 | 2022-07-02 23:08 | 17M | |
![[SND]](/icons/sound2.gif) | lowrp.mp3 | 2022-06-30 23:17 | 17M | |
![[SND]](/icons/sound2.gif) | Yamete3.mp3 | 2022-07-03 10:20 | 17M | |
![[SND]](/icons/sound2.gif) | Timo10.mp3 | 2022-07-22 10:53 | 17M | |
![[SND]](/icons/sound2.gif) | Raymore.mp3 | 2022-07-15 11:45 | 17M | |
![[SND]](/icons/sound2.gif) | DSD.mp3 | 2022-07-05 02:28 | 17M | |
![[SND]](/icons/sound2.gif) | DJC.mp3 | 2022-07-05 12:32 | 17M | |
![[SND]](/icons/sound2.gif) | waweped.mp3 | 2022-07-05 23:12 | 17M | |
![[SND]](/icons/sound2.gif) | arta3.mp3 | 2022-07-03 15:15 | 17M | |
![[SND]](/icons/sound2.gif) | Riz4.mp3 | 2022-07-02 15:10 | 17M | |
![[SND]](/icons/sound2.gif) | Yoga05.mp3 | 2022-07-06 06:26 | 17M | |
![[SND]](/icons/sound2.gif) | DragonForce_-_Through_The_Fire_And_Flames_(musmore.com).mp3 | 2022-06-30 20:28 | 17M | |
![[SND]](/icons/sound2.gif) | dije13.mp3 | 2022-07-01 14:43 | 17M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ LISA MONEY VIRAL TIKTOK DJ MONEY LISA VIRAL TIKTOK TERBARU 2021.mp3 | 2022-06-27 20:59 | 17M | |
![[SND]](/icons/sound2.gif) | SID SRIRAM BEST SONG COLLECTION 2022.mp3 | 2022-07-21 13:36 | 17M | |
![[SND]](/icons/sound2.gif) | P5.mp3 | 2022-07-01 08:06 | 17M | |
![[SND]](/icons/sound2.gif) | DjYaCumaKamu.mp3 | 2022-07-12 06:26 | 17M | |
![[SND]](/icons/sound2.gif) | blackpink0_bop.mp3 | 2022-07-02 00:21 | 17M | |
![[SND]](/icons/sound2.gif) | NNSTP4.mp3 | 2022-07-06 10:12 | 17M | |
![[SND]](/icons/sound2.gif) | djthai1.mp3 | 2022-07-12 07:14 | 17M | |
![[SND]](/icons/sound2.gif) | 92450334.mp3 | 2022-07-01 01:57 | 17M | |
![[SND]](/icons/sound2.gif) | dwz2.mp3 | 2022-07-01 01:50 | 17M | |
![[SND]](/icons/sound2.gif) | 1985-11-18_First Day on WXRK).mp3 | 2022-07-05 06:41 | 17M | |
![[SND]](/icons/sound2.gif) | vedi66.mp3 | 2022-06-29 12:16 | 17M | |
![[SND]](/icons/sound2.gif) | Кипелов - Я свободен.mp3 | 2022-06-29 18:41 | 17M | |
![[SND]](/icons/sound2.gif) | 14. C.C. Catch - Cause You Are Young (Dimka's Everlasting Youth Mix 2005).mp3 | 2022-07-15 19:43 | 17M | |
![[SND]](/icons/sound2.gif) | ryu2.mp3 | 2022-07-02 14:46 | 17M | |
![[SND]](/icons/sound2.gif) | eid.mp3 | 2022-07-09 03:01 | 17M | |
![[SND]](/icons/sound2.gif) | Suprabhatham.mp3 | 2022-07-30 06:11 | 16M | |
![[SND]](/icons/sound2.gif) | _.•♫•♬•MILARGO•♬•♫•.mp3 | 2022-07-15 04:34 | 16M | |
![[SND]](/icons/sound2.gif) | Praduk.mp3 | 2022-07-04 18:42 | 16M | |
![[SND]](/icons/sound2.gif) | alone1.mp3 | 2022-07-04 04:46 | 16M | |
![[SND]](/icons/sound2.gif) | iro6.mp3 | 2022-08-04 09:41 | 16M | |
![[SND]](/icons/sound2.gif) | Banyoq.mp3 | 2022-06-29 16:03 | 16M | |
![[SND]](/icons/sound2.gif) | koncol.mp3 | 2022-07-05 13:17 | 16M | |
![[SND]](/icons/sound2.gif) | dj aja.mp3 | 2022-06-28 17:37 | 16M | |
![[SND]](/icons/sound2.gif) | Brik4.mp3 | 2022-07-13 12:39 | 16M | |
![[SND]](/icons/sound2.gif) | iro2.mp3 | 2022-08-04 09:42 | 16M | |
![[VID]](/icons/movie.gif) | dbe757a0f55fc76c63b0fa085dd3ac00.mp4 | 2022-07-15 07:49 | 16M | |
![[SND]](/icons/sound2.gif) | classymix.mp3 | 2022-07-15 07:26 | 16M | |
![[SND]](/icons/sound2.gif) | papip.mp3 | 2022-06-30 12:27 | 16M | |
![[SND]](/icons/sound2.gif) | Valentin_Strykalo_-_Bespolezno_(musmore.com).mp3 | 2022-07-02 23:16 | 16M | |
![[SND]](/icons/sound2.gif) | One8.mp3 | 2022-07-14 06:24 | 16M | |
![[SND]](/icons/sound2.gif) | udinsutejo.mp3 | 2022-07-06 08:50 | 16M | |
![[SND]](/icons/sound2.gif) | Hamss003.mp3 | 2022-07-06 04:36 | 16M | |
![[SND]](/icons/sound2.gif) | Surf Western .mp3 | 2022-07-14 01:48 | 16M | |
![[SND]](/icons/sound2.gif) | kamudankenangan.mp3 | 2022-07-07 16:20 | 16M | |
![[SND]](/icons/sound2.gif) | Ikhysad1.mp3 | 2022-07-08 12:33 | 16M | |
![[SND]](/icons/sound2.gif) | 01 Yellow Line.mp3 | 2022-07-04 22:19 | 16M | |
![[SND]](/icons/sound2.gif) | Madness Combat 10 OST - Remastered.mp3 | 2022-07-05 02:57 | 16M | |
![[SND]](/icons/sound2.gif) | اطلاعات دوره.mp3 | 2022-07-21 12:36 | 16M | |
![[SND]](/icons/sound2.gif) | Wakno13.mp3 | 2022-07-04 22:41 | 16M | |
![[SND]](/icons/sound2.gif) | napagod.mp3 | 2022-06-28 05:18 | 16M | |
![[SND]](/icons/sound2.gif) | Yamete7.mp3 | 2022-07-06 13:24 | 16M | |
![[SND]](/icons/sound2.gif) | vedro12.mp3 | 2022-06-30 06:09 | 16M | |
![[SND]](/icons/sound2.gif) | eros12.mp3 | 2022-07-07 11:12 | 16M | |
![[SND]](/icons/sound2.gif) | 03. Derakht - Ebi.mp3 | 2022-06-28 13:53 | 16M | |
![[SND]](/icons/sound2.gif) | muslim.mp3 | 2022-07-07 13:47 | 16M | |
![[SND]](/icons/sound2.gif) | BUDOTS.mp3 | 2022-07-06 17:59 | 16M | |
![[SND]](/icons/sound2.gif) | bilaaa4.mp3 | 2022-07-09 02:06 | 16M | |
![[SND]](/icons/sound2.gif) | DjKane2.mp3 | 2022-06-29 05:33 | 16M | |
![[SND]](/icons/sound2.gif) | bayuseno.mp3 | 2022-07-02 07:39 | 16M | |
![[SND]](/icons/sound2.gif) | sad songs for sad people .mp3 | 2022-06-29 09:54 | 16M | |
![[SND]](/icons/sound2.gif) | sadsongs.mp3 | 2022-06-29 11:11 | 16M | |
![[SND]](/icons/sound2.gif) | lagu15.mp3 | 2022-07-13 06:34 | 16M | |
![[SND]](/icons/sound2.gif) | LIFE14.mp3 | 2022-07-09 02:57 | 16M | |
![[SND]](/icons/sound2.gif) | PDH.mp3 | 2022-07-17 01:54 | 16M | |
![[SND]](/icons/sound2.gif) | Bass2.mp3 | 2022-07-17 01:59 | 16M | |
![[SND]](/icons/sound2.gif) | Da1.mp3 | 2022-07-04 17:14 | 16M | |
![[SND]](/icons/sound2.gif) | กำลังฮิตTikTok วอเอ๊ะๆ โอเคอายูเรดี้ เพลงแดนซ์มันส์ๆ ดีเจ เอก รีมิกซ์.mp3 | 2022-07-16 05:26 | 16M | |
![[SND]](/icons/sound2.gif) | Nangdumatingka.mp3 | 2022-07-07 16:03 | 16M | |
![[SND]](/icons/sound2.gif) | sborka_iz_8_pesen.mp3 | 2022-07-20 19:09 | 16M | |
![[SND]](/icons/sound2.gif) | paka.mp3 | 2022-07-14 02:15 | 16M | |
![[SND]](/icons/sound2.gif) | CHAABI.mp3 | 2022-07-03 04:47 | 16M | |
![[SND]](/icons/sound2.gif) | jojorea.mp3 | 2022-07-28 07:04 | 16M | |
![[SND]](/icons/sound2.gif) | Порнофильмы - Я так соскучился.mp3 | 2022-07-01 22:02 | 16M | |
![[SND]](/icons/sound2.gif) | cold case .mp3 | 2022-07-05 10:31 | 16M | |
![[SND]](/icons/sound2.gif) | mikekosa.mp3 | 2022-06-27 16:21 | 16M | |
![[SND]](/icons/sound2.gif) | DjTrumpet.mp3 | 2022-07-12 08:27 | 15M | |
![[SND]](/icons/sound2.gif) | djalex7.mp3 | 2022-07-04 10:54 | 15M | |
![[SND]](/icons/sound2.gif) | Juggduct.mp3 | 2022-07-04 17:27 | 15M | |
![[SND]](/icons/sound2.gif) | hfz8.mp3 | 2022-07-03 13:10 | 15M | |
![[SND]](/icons/sound2.gif) | 29. Gazebo - I like chopin (Dj Yela Dance Remix).mp3 | 2022-07-15 19:43 | 15M | |
![[SND]](/icons/sound2.gif) | dom110.mp3 | 2022-07-03 06:28 | 15M | |
![[VID]](/icons/movie.gif) | idana.mp4 | 2022-07-29 11:18 | 15M | |
![[SND]](/icons/sound2.gif) | valesenam.mp3 | 2022-07-05 03:21 | 15M | |
![[SND]](/icons/sound2.gif) | vinkyyt.mp3 | 2022-07-16 16:23 | 15M | |
![[SND]](/icons/sound2.gif) | Adapokemon.mp3 | 2022-06-28 02:47 | 15M | |
![[SND]](/icons/sound2.gif) | Heartremix.mp3 | 2022-07-02 00:44 | 15M | |
![[SND]](/icons/sound2.gif) | vedi65.mp3 | 2022-06-29 12:16 | 15M | |
![[VID]](/icons/movie.gif) | VID-20220504-WA0009.mp4 | 2022-06-30 10:50 | 15M | |
![[SND]](/icons/sound2.gif) | leon7.mp3 | 2022-07-05 21:06 | 15M | |
![[SND]](/icons/sound2.gif) | 63flowg.mp3 | 2022-06-28 06:34 | 15M | |
![[SND]](/icons/sound2.gif) | filosofi.mp3 | 2022-07-06 00:18 | 15M | |
![[SND]](/icons/sound2.gif) | hanz3.mp3 | 2022-07-06 05:55 | 15M | |
![[SND]](/icons/sound2.gif) | dj3_hasyka_bop.mp3 | 2022-06-27 18:05 | 15M | |
![[SND]](/icons/sound2.gif) | dj3_bop.mp3 | 2022-07-05 19:16 | 15M | |
![[SND]](/icons/sound2.gif) | Rhey44.mp3 | 2022-06-29 11:11 | 15M | |
![[SND]](/icons/sound2.gif) | fathi.mp3 | 2022-07-05 16:17 | 15M | |
![[SND]](/icons/sound2.gif) | Jerryxdj9.mp3 | 2022-07-05 20:07 | 15M | |
![[SND]](/icons/sound2.gif) | Bass5.mp3 | 2022-07-17 02:01 | 15M | |
![[SND]](/icons/sound2.gif) | br4.mp3 | 2022-07-05 08:57 | 15M | |
![[SND]](/icons/sound2.gif) | Marsromusha.mp3 | 2022-07-04 01:20 | 15M | |
![[SND]](/icons/sound2.gif) | Ho.mp3 | 2022-06-28 07:22 | 15M | |
![[SND]](/icons/sound2.gif) | TS3 Meeting.mp3 | 2022-06-28 23:44 | 15M | |
![[SND]](/icons/sound2.gif) | snte15.mp3 | 2022-06-28 16:09 | 15M | |
![[SND]](/icons/sound2.gif) | G.S.11.mp3 | 2022-07-19 14:13 | 15M | |
![[SND]](/icons/sound2.gif) | drake7.mp3 | 2022-07-06 18:29 | 15M | |
![[SND]](/icons/sound2.gif) | Кино - Кукушка.mp3 | 2022-07-10 13:05 | 15M | |
![[SND]](/icons/sound2.gif) | Sz90.mp3 | 2022-06-28 02:09 | 15M | |
![[SND]](/icons/sound2.gif) | 92895320.mp3 | 2022-07-01 01:57 | 15M | |
![[SND]](/icons/sound2.gif) | bat15.mp3 | 2022-07-12 02:24 | 15M | |
![[SND]](/icons/sound2.gif) | X2Download.com - Love Remembered (128 kbps).mp3 | 2022-07-10 22:06 | 15M | |
![[SND]](/icons/sound2.gif) | cuki4.mp3 | 2022-06-28 16:06 | 15M | |
![[SND]](/icons/sound2.gif) | idana.mp3 | 2022-07-29 11:24 | 15M | |
![[SND]](/icons/sound2.gif) | 30. Haddaway - What Is Love (Patch Safari Remix).mp3 | 2022-07-15 19:43 | 15M | |
![[SND]](/icons/sound2.gif) | huesos.mp3 | 2022-07-06 03:35 | 15M | |
![[SND]](/icons/sound2.gif) | bener.mp3 | 2022-06-30 05:26 | 15M | |
![[SND]](/icons/sound2.gif) | rs2.mp3 | 2022-07-15 21:48 | 15M | |
![[SND]](/icons/sound2.gif) | แดร์33.mp3 | 2022-07-12 15:00 | 15M | |
![[SND]](/icons/sound2.gif) | yon1.mp3 | 2022-07-09 06:22 | 15M | |
![[SND]](/icons/sound2.gif) | DjIWannaFeelLike.mp3 | 2022-07-12 08:17 | 15M | |
![[SND]](/icons/sound2.gif) | AUD-20220122-WA0083.mp3 | 2022-07-09 03:32 | 15M | |
![[SND]](/icons/sound2.gif) | Dj asik.mp3 | 2022-07-04 05:18 | 15M | |
![[SND]](/icons/sound2.gif) | iduladha.mp3 | 2022-07-08 12:07 | 15M | |
![[SND]](/icons/sound2.gif) | [201] Звуки для видео - Эпичная музыка 2.mp3 | 2022-07-08 04:10 | 15M | |
![[SND]](/icons/sound2.gif) | 1982-04-01 WWDC.mp3 | 2022-07-05 06:40 | 15M | |
![[SND]](/icons/sound2.gif) | Wakno10.mp3 | 2022-07-07 21:35 | 15M | |
![[SND]](/icons/sound2.gif) | ugun12.mp3 | 2022-07-07 18:08 | 15M | |
![[SND]](/icons/sound2.gif) | Exbt.mp3 | 2022-07-01 08:42 | 15M | |
![[SND]](/icons/sound2.gif) | Muse - Exogenesis Symphony Full.mp3 | 2022-07-06 22:07 | 15M | |
![[SND]](/icons/sound2.gif) | EdwardSad05.mp3 | 2022-07-10 12:21 | 15M | |
![[SND]](/icons/sound2.gif) | HH1.mp3 | 2022-07-14 06:52 | 15M | |
![[SND]](/icons/sound2.gif) | tn.mp3 | 2022-07-04 06:59 | 15M | |
![[SND]](/icons/sound2.gif) | peradaban.mp3 | 2022-06-29 12:29 | 15M | |
![[SND]](/icons/sound2.gif) | dj4_bop.mp3 | 2022-07-05 19:18 | 15M | |
![[SND]](/icons/sound2.gif) | kkuu.mp3 | 2022-07-14 06:38 | 15M | |
![[SND]](/icons/sound2.gif) | njaluckimbuh.mp3 | 2022-07-16 09:20 | 15M | |
![[SND]](/icons/sound2.gif) | tagmp3_Tell_your_friends_ft_Kanye_West_D_(getmp3.pro).mp3 | 2022-07-16 02:02 | 15M | |
![[SND]](/icons/sound2.gif) | DjSikokBagiDuo.mp3 | 2022-07-31 01:29 | 15M | |
![[VID]](/icons/movie.gif) | TW1.mp4 | 2022-07-12 09:47 | 15M | |
![[SND]](/icons/sound2.gif) | wizz22.mp3 | 2022-07-04 17:16 | 15M | |
![[SND]](/icons/sound2.gif) | setadiumakhir.mp3 | 2022-07-02 04:30 | 15M | |
![[SND]](/icons/sound2.gif) | 07. PRICE OF FAME.mp3 | 2022-07-06 08:26 | 15M | |
![[SND]](/icons/sound2.gif) | 357.mp3 | 2022-06-28 08:47 | 15M | |
![[SND]](/icons/sound2.gif) | piki.mp3 | 2022-06-30 07:07 | 15M | |
![[SND]](/icons/sound2.gif) | djalex10.mp3 | 2022-07-09 19:14 | 15M | |
![[SND]](/icons/sound2.gif) | bandang1.mp3 | 2022-06-28 05:13 | 15M | |
![[SND]](/icons/sound2.gif) | Deib0.mp3 | 2022-06-28 18:01 | 15M | |
![[SND]](/icons/sound2.gif) | Stranger_Things_S4_-_Eddie_Munson_G_(getmp3.pro).mp3 | 2022-07-07 04:51 | 15M | |
![[SND]](/icons/sound2.gif) | Kino.mp3 | 2022-07-01 11:48 | 15M | |
![[SND]](/icons/sound2.gif) | vedi82.mp3 | 2022-06-29 12:19 | 15M | |
![[SND]](/icons/sound2.gif) | Tool_-_The_Pot_(ru.soundmax.me).mp3 | 2022-06-27 18:22 | 15M | |
![[SND]](/icons/sound2.gif) | sunrise.mp3 | 2022-07-15 23:49 | 15M | |
![[SND]](/icons/sound2.gif) | 1985-11-26_CF-INC.m4a | 2022-07-05 06:41 | 15M | |
![[SND]](/icons/sound2.gif) | В. Цой, Кино - Спокойная ночь.mp3 | 2022-07-10 18:11 | 15M | |
![[SND]](/icons/sound2.gif) | snoop-dogg-feat-the-doors-riders-on-the-storm-fredwreck-remix.mp3 | 2022-06-30 16:54 | 15M | |
![[SND]](/icons/sound2.gif) | mad9.mp3 | 2022-07-05 13:29 | 15M | |
![[SND]](/icons/sound2.gif) | •.•.mp3 | 2022-07-15 10:02 | 15M | |
![[VID]](/icons/movie.gif) | Sexualizer (feat. Flash Arnold).mp4 | 2022-06-30 05:15 | 15M | |
![[SND]](/icons/sound2.gif) | gio5.mp3 | 2022-07-01 06:49 | 15M | |
![[SND]](/icons/sound2.gif) | G.S.4.mp3 | 2022-07-19 14:13 | 15M | |
![[SND]](/icons/sound2.gif) | Terraria Calamity Mod Music - _Roar of The Jungle Dragon_ - Theme of Jungle Dragon, Yharon (Phase 2).mp3 | 2022-07-05 02:42 | 15M | |
![[SND]](/icons/sound2.gif) | Busigo (BlackFathersSA,feat_442 +27761236907).mp3 | 2022-07-11 19:59 | 15M | |
![[SND]](/icons/sound2.gif) | nwa2.mp3 | 2022-07-16 01:50 | 15M | |
![[SND]](/icons/sound2.gif) | AWS Seminar presentation by mayank .mp3 | 2022-07-16 12:50 | 15M | |
![[SND]](/icons/sound2.gif) | DCYxPHONKV2.mp3 | 2022-07-10 11:07 | 15M | |
![[SND]](/icons/sound2.gif) | Diegoo43.mp3 | 2022-07-01 16:18 | 14M | |
![[VID]](/icons/movie.gif) | how to open.mp4 | 2022-07-14 21:52 | 14M | |
![[SND]](/icons/sound2.gif) | Lpetricio2.mp3 | 2022-07-01 09:41 | 14M | |
![[SND]](/icons/sound2.gif) | emangenak.mp3 | 2022-07-01 17:27 | 14M | |
![[SND]](/icons/sound2.gif) | pinggal.mp3 | 2022-07-02 01:32 | 14M | |
![[SND]](/icons/sound2.gif) | BadutRaavfy.mp3 | 2022-06-29 22:31 | 14M | |
![[SND]](/icons/sound2.gif) | Badut Raavfy.mp3 | 2022-06-29 09:53 | 14M | |
![[SND]](/icons/sound2.gif) | Byte4 (DJ Cannabis Coffeeshops Deutschland) .mp3 | 2022-07-15 13:29 | 14M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ NDOO LIFE WOLFGANG DANCE V2 SOUND BABY SHARK VIRAL TIKTOK 2022.mp3 | 2022-07-10 17:49 | 14M | |
![[SND]](/icons/sound2.gif) | ryu4.mp3 | 2022-07-02 14:48 | 14M | |
![[SND]](/icons/sound2.gif) | srk2.mp3 | 2022-07-16 01:27 | 14M | |
![[SND]](/icons/sound2.gif) | The Doors - Riders On The Storm (Fredwreck ft. Snoop Dogg remix).mp3 | 2022-06-29 13:22 | 14M | |
![[SND]](/icons/sound2.gif) | Sepele.mp3 | 2022-07-03 06:28 | 14M | |
![[SND]](/icons/sound2.gif) | Logic Redux A.mp3 | 2022-07-07 19:44 | 14M | |
![[SND]](/icons/sound2.gif) | Kioshi20.mp3 | 2022-06-30 04:43 | 14M | |
![[SND]](/icons/sound2.gif) | Eminem ft. Dido - Stan intro (1 Hour).mp3 | 2022-07-16 04:54 | 14M | |
![[SND]](/icons/sound2.gif) | Redsuninthesky.mp3 | 2022-07-04 01:30 | 14M | |
![[SND]](/icons/sound2.gif) | mix_15m36s (audio-joiner.com).mp3 | 2022-07-09 12:00 | 14M | |
![[SND]](/icons/sound2.gif) | adletamejr.mp3 | 2022-07-09 19:21 | 14M | |
![[SND]](/icons/sound2.gif) | adletamejr(2).mp3 | 2022-07-10 14:13 | 14M | |
![[SND]](/icons/sound2.gif) | Скриптонит - Polozhenie.mp3 | 2022-07-06 20:11 | 14M | |
![[VID]](/icons/movie.gif) | WhatsApp Audio 2022-07-09 at 8.17.39 AM.mp4 | 2022-07-17 03:51 | 14M | |
![[SND]](/icons/sound2.gif) | vedi71.mp3 | 2022-06-29 12:17 | 14M | |
![[SND]](/icons/sound2.gif) | budots.mp3 | 2022-07-19 12:10 | 14M | |
![[SND]](/icons/sound2.gif) | ThomasSad.mp3 | 2022-07-12 06:34 | 14M | |
![[SND]](/icons/sound2.gif) | 01 Black Fathers (Magezi feat_ M60_442_Dj Pheczen_) Malome.mp3 | 2022-07-11 20:00 | 14M | |
![[SND]](/icons/sound2.gif) | сбобильно - 196K.mp3 | 2022-07-06 16:33 | 14M | |
![[SND]](/icons/sound2.gif) | сбобильно📞 - 196K.mp3 | 2022-07-06 16:26 | 14M | |
![[SND]](/icons/sound2.gif) | 11. Lay Your Hands On Me (12'' Version).mp3 | 2022-07-04 00:40 | 14M | |
![[SND]](/icons/sound2.gif) | Ak6.mp3 | 2022-07-26 06:48 | 14M | |
![[SND]](/icons/sound2.gif) | daft-punk-get-lucky-ft-pharrell-williams.mp3 | 2022-07-15 09:30 | 14M | |
![[SND]](/icons/sound2.gif) | Rivermaya - Umaaraw Umuulan.mp3 | 2022-07-09 10:07 | 14M | |
![[SND]](/icons/sound2.gif) | akhsanjamet.mp3 | 2022-07-13 20:34 | 14M | |
![[SND]](/icons/sound2.gif) | Rapgod.mp3 | 2022-07-04 01:30 | 14M | |
![[VID]](/icons/movie.gif) | bhula na sakoge mujhe bhulkar tum_ भुला ना सकोगे मुझे भूलकर तुम। DJ Bollywood song dj omveer yadav(P_HD).mp4 | 2022-07-30 05:23 | 14M | |
![[SND]](/icons/sound2.gif) | 7月2日 爱的委身1何西阿书.mp3 | 2022-07-10 09:38 | 14M | |
![[SND]](/icons/sound2.gif) | yt5s.mp3 | 2022-07-10 13:12 | 14M | |
![[SND]](/icons/sound2.gif) | 10 Black Fathers (Magezi feat_ Lenox) Hiwena Mani.mp3 | 2022-07-11 20:00 | 14M | |
![[SND]](/icons/sound2.gif) | 100 BPM edit three - 7:29:21, 10.13 AM.mp3 | 2022-07-14 01:56 | 14M | |
![[SND]](/icons/sound2.gif) | ywm.mp3 | 2022-07-25 13:01 | 14M | |
![[SND]](/icons/sound2.gif) | Rull1.mp3 | 2022-06-30 14:15 | 14M | |
![[SND]](/icons/sound2.gif) | BryanDominic1.mp3 | 2022-06-28 12:28 | 14M | |
![[SND]](/icons/sound2.gif) | oh39.mp3 | 2022-06-30 18:53 | 14M | |
![[SND]](/icons/sound2.gif) | hendy6.mp3 | 2022-07-12 16:38 | 14M | |
![[SND]](/icons/sound2.gif) | djraher2.mp3 | 2022-07-10 17:36 | 14M | |
![[SND]](/icons/sound2.gif) | Zen1.mp3 | 2022-07-09 13:20 | 14M | |
![[SND]](/icons/sound2.gif) | RyderModeRemix.mp3 | 2022-06-28 18:32 | 14M | |
![[SND]](/icons/sound2.gif) | Rimter12.mp3 | 2022-07-09 01:20 | 14M | |
![[SND]](/icons/sound2.gif) | DJJ17.mp3 | 2022-07-04 06:40 | 14M | |
![[SND]](/icons/sound2.gif) | djj3.mp3 | 2022-06-29 06:02 | 14M | |
![[SND]](/icons/sound2.gif) | X2Download.com - To The Bone - Pamungkas 🇮🇩🇮🇩 (Lyrics video dan terjemahan) (320 kbps).mp3 | 2022-06-30 04:02 | 14M | |
![[SND]](/icons/sound2.gif) | Rhey42.mp3 | 2022-06-29 11:08 | 14M | |
![[SND]](/icons/sound2.gif) | 1981-12-XX Christmas Show.mp3 | 2022-07-05 06:40 | 14M | |
![[SND]](/icons/sound2.gif) | Logic Redux C.mp3 | 2022-07-07 19:43 | 14M | |
![[SND]](/icons/sound2.gif) | WakChak3.mp3 | 2022-07-07 21:33 | 14M | |
![[SND]](/icons/sound2.gif) | Dschinghis Khan-Moskau -1979--kissvk.com.mp3 | 2022-06-30 17:36 | 14M | |
![[SND]](/icons/sound2.gif) | filipino OPM rap_rnb playlist to listen after a tiring class.mp3 | 2022-07-11 18:42 | 14M | |
![[SND]](/icons/sound2.gif) | Logic Prep A.mp3 | 2022-07-07 19:44 | 14M | |
![[SND]](/icons/sound2.gif) | Risky.mp3 | 2022-07-01 16:54 | 14M | |
![[SND]](/icons/sound2.gif) | cuki3.mp3 | 2022-06-28 16:06 | 14M | |
![[SND]](/icons/sound2.gif) | Caknan.mp3 | 2022-08-04 09:41 | 14M | |
![[SND]](/icons/sound2.gif) | dazzle.mp3 | 2022-07-11 01:53 | 14M | |
![[SND]](/icons/sound2.gif) | Stating the Facts.mp3 | 2022-07-07 19:44 | 14M | |
![[SND]](/icons/sound2.gif) | Tiyara.mp3 | 2022-07-12 02:45 | 14M | |
![[SND]](/icons/sound2.gif) | vffgrgbybddt.mp3 | 2022-07-03 03:58 | 14M | |
![[SND]](/icons/sound2.gif) | Logic Redux B.mp3 | 2022-07-07 19:44 | 14M | |
![[SND]](/icons/sound2.gif) | Tiny.mp3 | 2022-07-14 01:55 | 14M | |
![[SND]](/icons/sound2.gif) | DjKekasihHalal.mp3 | 2022-07-12 08:21 | 14M | |
![[SND]](/icons/sound2.gif) | DjTangkisDang.mp3 | 2022-07-13 09:49 | 14M | |
![[SND]](/icons/sound2.gif) | 005. Boris Zhivago - For The Love In Your Eyes.mp3 | 2022-07-09 10:57 | 14M | |
![[SND]](/icons/sound2.gif) | danz1.mp3 | 2022-07-03 23:05 | 14M | |
![[SND]](/icons/sound2.gif) | NEW Malayalam nonstop (2020) Dj Mix [BASS BOOSTED] ------(MP3_70K).mp3 | 2022-07-04 09:02 | 14M | |
![[SND]](/icons/sound2.gif) | hendy1.mp3 | 2022-07-12 04:44 | 14M | |
![[SND]](/icons/sound2.gif) | SIO.mp3 | 2022-07-03 13:21 | 14M | |
![[SND]](/icons/sound2.gif) | Badri32.mp3 | 2022-07-15 16:52 | 14M | |
![[SND]](/icons/sound2.gif) | Hand Bell Sound Effect.mp3 | 2022-07-09 11:33 | 14M | |
![[SND]](/icons/sound2.gif) | laila.mp3 | 2022-07-14 21:29 | 14M | |
![[SND]](/icons/sound2.gif) | Bigenough.mp3 | 2022-07-04 01:01 | 14M | |
![[SND]](/icons/sound2.gif) | zrkdjdevil.mp3 | 2022-06-29 07:43 | 14M | |
![[SND]](/icons/sound2.gif) | dj15m.mp3 | 2022-07-02 03:53 | 14M | |
![[SND]](/icons/sound2.gif) | Xdrpi1.mp3 | 2022-07-10 17:36 | 14M | |
![[SND]](/icons/sound2.gif) | Rimter15.mp3 | 2022-07-09 01:19 | 14M | |
![[SND]](/icons/sound2.gif) | Rimter10.mp3 | 2022-07-09 01:18 | 14M | |
![[SND]](/icons/sound2.gif) | Beethoven.mp3 | 2022-07-15 10:28 | 14M | |
![[SND]](/icons/sound2.gif) | Labyrinth - Hallucination-As The World Falls Down (Film Version) (256 kbps).mp3 | 2022-07-04 20:25 | 14M | |
![[SND]](/icons/sound2.gif) | [Detective Conan OST] Main Theme (Extended).mp3 | 2022-07-25 15:40 | 14M | |
![[SND]](/icons/sound2.gif) | bimbo.mp3 | 2022-07-04 08:29 | 14M | |
![[SND]](/icons/sound2.gif) | Myrill.mp3 | 2022-06-28 04:30 | 14M | |
![[SND]](/icons/sound2.gif) | only69.mp3 | 2022-06-29 08:25 | 14M | |
![[SND]](/icons/sound2.gif) | AaronFerry1.mp3 | 2022-07-03 08:01 | 14M | |
![[SND]](/icons/sound2.gif) | Alex.mp3 | 2022-07-16 00:13 | 14M | |
![[SND]](/icons/sound2.gif) | 13. Boney M - Daddy Cool (The Velvet Stripes Rework).mp3 | 2022-07-15 19:43 | 14M | |
![[SND]](/icons/sound2.gif) | Metro2033Background_mixage final.mp3 | 2022-06-28 12:51 | 14M | |
![[SND]](/icons/sound2.gif) | AWQ.mp3 | 2022-07-06 14:12 | 14M | |
![[SND]](/icons/sound2.gif) | Bohemian.mp3 | 2022-07-04 01:01 | 14M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Unstoppable Lyric Mix Sia Jaymes Young Shawn Mendes Ruth B.mp3 | 2022-07-04 06:20 | 14M | |
![[SND]](/icons/sound2.gif) | Logic Prep C.mp3 | 2022-07-07 19:44 | 14M | |
![[SND]](/icons/sound2.gif) | Muslum-Gurses-Yillar-Utansin.mp3 | 2022-07-16 08:46 | 14M | |
![[SND]](/icons/sound2.gif) | vedi81.mp3 | 2022-06-29 12:19 | 14M | |
![[SND]](/icons/sound2.gif) | DjKane7.mp3 | 2022-06-29 06:23 | 14M | |
![[SND]](/icons/sound2.gif) | RS01.mp3 | 2022-06-29 14:57 | 14M | |
![[SND]](/icons/sound2.gif) | LDJ.mp3 | 2022-07-14 17:28 | 14M | |
![[SND]](/icons/sound2.gif) | pndo11.mp3 | 2022-06-28 16:05 | 14M | |
![[SND]](/icons/sound2.gif) | Nick9.mp3 | 2022-06-30 11:19 | 14M | |
![[SND]](/icons/sound2.gif) | Nintendo Wii - Shop Channel Music (Extended) HQ.mp3 | 2022-07-13 11:44 | 14M | |
![[SND]](/icons/sound2.gif) | Ds6.mp3 | 2022-06-27 17:52 | 14M | |
![[SND]](/icons/sound2.gif) | Most_Epic_Battle_Music_Warriors.mp3 | 2022-07-06 23:13 | 14M | |
![[SND]](/icons/sound2.gif) | 04. In Den Straßen Von Paris.mp3 | 2022-07-06 16:54 | 14M | |
![[SND]](/icons/sound2.gif) | Mungkinkah.mp3 | 2022-07-04 01:20 | 14M | |
![[SND]](/icons/sound2.gif) | StevenRaymon3.mp3 | 2022-07-02 05:20 | 14M | |
![[SND]](/icons/sound2.gif) | CHizh_Co_-_antom_(musmore.com).mp3 | 2022-06-29 08:41 | 14M | |
![[VID]](/icons/movie.gif) | FABIO ASHER - RUMAH SINGGAH (OFFICIAL MUSIC VIDEO).mp4 | 2022-07-06 17:31 | 14M | |
![[SND]](/icons/sound2.gif) | Stringfunktion (DJ Cannabis Coffeeshops Deutschland).mp3 | 2022-07-14 15:06 | 14M | |
![[SND]](/icons/sound2.gif) | skriptonit-polozhenie-izzamuzzic-remix.mp3 | 2022-06-30 09:04 | 14M | |
![[SND]](/icons/sound2.gif) | pagmama.mp3 | 2022-07-08 04:05 | 14M | |
![[SND]](/icons/sound2.gif) | jack98.mp3 | 2022-07-13 08:49 | 14M | |
![[SND]](/icons/sound2.gif) | bimbo69.mp3 | 2022-07-02 14:38 | 14M | |
![[SND]](/icons/sound2.gif) | Russian National Orchestra, Mikhail Pletnev - Shchedrin- Carmen Suite after Bizet's Opera - 6. Scene.mp3 | 2022-07-10 19:06 | 14M | |
![[SND]](/icons/sound2.gif) | DjRinduSemalam.mp3 | 2022-07-12 08:13 | 14M | |
![[SND]](/icons/sound2.gif) | Falmengkane1.mp3 | 2022-07-03 18:35 | 14M | |
![[SND]](/icons/sound2.gif) | dhije02.mp3 | 2022-07-10 08:00 | 14M | |
![[SND]](/icons/sound2.gif) | br1.mp3 | 2022-07-05 08:32 | 13M | |
![[SND]](/icons/sound2.gif) | Zenn DJ V2.mp3 | 2022-07-03 07:08 | 13M | |
![[SND]](/icons/sound2.gif) | byUpii.mp3 | 2022-07-09 21:07 | 13M | |
![[SND]](/icons/sound2.gif) | bb8.mp3 | 2022-07-09 18:09 | 13M | |
![[SND]](/icons/sound2.gif) | Mixa_G.mp3 | 2022-07-08 03:40 | 13M | |
![[SND]](/icons/sound2.gif) | still1.mp3 | 2022-06-27 15:39 | 13M | |
![[SND]](/icons/sound2.gif) | Kungtayo.mp3 | 2022-07-02 00:44 | 13M | |
![[SND]](/icons/sound2.gif) | Zeb1.mp3 | 2022-07-07 01:54 | 13M | |
![[SND]](/icons/sound2.gif) | Takbiran.mp3 | 2022-07-09 17:02 | 13M | |
![[SND]](/icons/sound2.gif) | Takbiran.m4a | 2022-07-08 11:39 | 13M | |
![[VID]](/icons/movie.gif) | KS.mp4 | 2022-07-06 13:00 | 13M | |
![[SND]](/icons/sound2.gif) | djalex2.mp3 | 2022-07-03 10:43 | 13M | |
![[SND]](/icons/sound2.gif) | DjOpus82.mp3 | 2022-07-12 09:42 | 13M | |
![[SND]](/icons/sound2.gif) | Battle_Tapes_-_Dreamboat_(rum.muzikavsem.org).mp3 | 2022-06-29 12:43 | 13M | |
![[SND]](/icons/sound2.gif) | mamno3.mp3 | 2022-07-04 07:29 | 13M | |
![[SND]](/icons/sound2.gif) | ngab2.mp3 | 2022-07-15 11:16 | 13M | |
![[SND]](/icons/sound2.gif) | cuki1.mp3 | 2022-06-28 16:06 | 13M | |
![[SND]](/icons/sound2.gif) | Takusa1.mp3 | 2022-07-06 08:00 | 13M | |
![[SND]](/icons/sound2.gif) | blueboys.mp3 | 2022-07-15 10:24 | 13M | |
![[SND]](/icons/sound2.gif) | Pinky Swear(MP3_320K).mp3 | 2022-07-13 00:33 | 13M | |
![[SND]](/icons/sound2.gif) | djweflix.mp3 | 2022-07-03 09:26 | 13M | |
![[VID]](/icons/movie.gif) | lv_0_20220727091856.mp4 | 2022-07-29 12:55 | 13M | |
![[SND]](/icons/sound2.gif) | Bass3.mp3 | 2022-07-17 02:00 | 13M | |
![[SND]](/icons/sound2.gif) | y2mate.com - ULTRA HEISEI Opening Mashup Lyrics.mp3 | 2022-06-30 10:07 | 13M | |
![[SND]](/icons/sound2.gif) | opuh.mp3 | 2022-06-30 10:16 | 13M | |
![[VID]](/icons/movie.gif) | lv_0_20220709141142.mp4 | 2022-07-09 07:14 | 13M | |
![[SND]](/icons/sound2.gif) | zerelli4.mp3 | 2022-07-16 01:31 | 13M | |
![[SND]](/icons/sound2.gif) | mobstaz.mp3 | 2022-07-04 16:45 | 13M | |
![[SND]](/icons/sound2.gif) | 187.mp3 | 2022-08-05 03:53 | 13M | |
![[SND]](/icons/sound2.gif) | Brik5.mp3 | 2022-07-06 13:10 | 13M | |
![[SND]](/icons/sound2.gif) | Battle Tapes - Dreamboat.mp3 | 2022-06-29 00:21 | 13M | |
![[SND]](/icons/sound2.gif) | [BTCLOD.COM] Mind Power ... Ki - Dragon Ball Z-320k.mp3 | 2022-07-02 05:16 | 13M | |
![[SND]](/icons/sound2.gif) | pauwi.mp3 | 2022-06-27 17:24 | 13M | |
![[SND]](/icons/sound2.gif) | Rimter13.mp3 | 2022-07-09 01:20 | 13M | |
![[SND]](/icons/sound2.gif) | elsakane2.mp3 | 2022-07-16 18:12 | 13M | |
![[SND]](/icons/sound2.gif) | Bass6.mp3 | 2022-07-17 02:02 | 13M | |
![[SND]](/icons/sound2.gif) | 2A - 130 - 徐誉滕-等一分钟 (DJ酷博Extended Mix)2020.mp3 | 2022-07-09 06:30 | 13M | |
![[SND]](/icons/sound2.gif) | 1-19 Aria (Bariton)_ Ihr werdet mich.mp3 | 2022-07-13 07:23 | 13M | |
![[SND]](/icons/sound2.gif) | Blackmores_Night_-_Ghost_Of_A_Rose_47956379.mp3 | 2022-07-06 11:01 | 13M | |
![[SND]](/icons/sound2.gif) | enakuen.mp3 | 2022-07-04 20:43 | 13M | |
![[SND]](/icons/sound2.gif) | DJ_TAKBIRAN_terbaru_THAILAND_STYLE_-_(O.id_remix)(256k).mp3 | 2022-07-09 18:52 | 13M | |
![[SND]](/icons/sound2.gif) | senggol1.mp3 | 2022-06-27 20:59 | 13M | |
![[SND]](/icons/sound2.gif) | Slow 1.mp3 | 2022-07-14 12:44 | 13M | |
![[VID]](/icons/movie.gif) | dem.mp4 | 2022-06-30 01:47 | 13M | |
![[VID]](/icons/movie.gif) | Tian.mp4 | 2022-06-29 04:54 | 13M | |
![[SND]](/icons/sound2.gif) | iro3.mp3 | 2022-08-04 09:42 | 13M | |
![[SND]](/icons/sound2.gif) | SK_SO.mp3 | 2022-07-02 02:47 | 13M | |
![[SND]](/icons/sound2.gif) | hppy.mp3 | 2022-06-28 04:19 | 13M | |
![[SND]](/icons/sound2.gif) | Magkunwari.mp3 | 2022-07-04 22:29 | 13M | |
![[SND]](/icons/sound2.gif) | Честный - Боже просвети путь(1).mp3 | 2022-07-13 11:24 | 13M | |
![[SND]](/icons/sound2.gif) | Честный - Боже просвети путь(1)(1).mp3 | 2022-07-13 11:28 | 13M | |
![[VID]](/icons/movie.gif) | Miami Disco.mp4 | 2022-06-30 05:14 | 13M | |
![[SND]](/icons/sound2.gif) | Gugun Blues Shelter – Basa - Basi.mp3 | 2022-07-06 15:13 | 13M | |
![[SND]](/icons/sound2.gif) | Basa-basi.mp3 | 2022-07-06 15:15 | 13M | |
![[SND]](/icons/sound2.gif) | H24.mp3 | 2022-06-30 13:41 | 13M | |
![[SND]](/icons/sound2.gif) | motley-crue-ten-second-to-love.mp3 | 2022-07-02 19:42 | 13M | |
![[SND]](/icons/sound2.gif) | Ajjdamir_Mugu_-_CHjornye_glaza_48004167.mp3 | 2022-08-04 16:41 | 13M | |
![[SND]](/icons/sound2.gif) | Yamete11.mp3 | 2022-07-14 03:07 | 13M | |
![[SND]](/icons/sound2.gif) | Rimter14.mp3 | 2022-07-09 01:20 | 13M | |
![[SND]](/icons/sound2.gif) | hayukk.mp3 | 2022-07-10 20:29 | 13M | |
![[VID]](/icons/movie.gif) | victor-e-leo-recuerdos-de-amor-video-clipe_bhLhDHtr.mp4 | 2022-07-06 16:12 | 13M | |
![[SND]](/icons/sound2.gif) | gal2.mp3 | 2022-06-29 13:05 | 13M | |
![[SND]](/icons/sound2.gif) | Айдамир Мугу - Чёрные глаза.mp3 | 2022-07-03 05:04 | 13M | |
![[SND]](/icons/sound2.gif) | dec1.mp3 | 2022-07-08 04:05 | 13M | |
![[SND]](/icons/sound2.gif) | Wakno8.mp3 | 2022-07-04 21:57 | 13M | |
![[SND]](/icons/sound2.gif) | pepsiL2.mp3 | 2022-06-29 07:49 | 13M | |
![[SND]](/icons/sound2.gif) | G.S.7.mp3 | 2022-07-19 14:13 | 13M | |
![[SND]](/icons/sound2.gif) | nana8.mp3 | 2022-06-28 16:01 | 13M | |
![[SND]](/icons/sound2.gif) | sweetbyme.mp3 | 2022-06-28 11:50 | 13M | |
![[SND]](/icons/sound2.gif) | pior8.mp3 | 2022-07-06 02:55 | 13M | |
![[SND]](/icons/sound2.gif) | Piste 20.mp3 | 2022-07-05 12:50 | 13M | |
![[SND]](/icons/sound2.gif) | YUrijj_SHatunov_-_Belye_rozy_49909527.mp3 | 2022-07-31 12:06 | 13M | |
![[SND]](/icons/sound2.gif) | ugun6.mp3 | 2022-07-02 03:58 | 13M | |
![[SND]](/icons/sound2.gif) | togok.mp3 | 2022-07-01 19:39 | 13M | |
![[SND]](/icons/sound2.gif) | Dapaa1.mp3 | 2022-07-01 03:06 | 13M | |
![[SND]](/icons/sound2.gif) | zeon8.mp3 | 2022-06-30 07:00 | 13M | |
![[SND]](/icons/sound2.gif) | shotoutremix.mp3 | 2022-07-29 10:22 | 13M | |
![[SND]](/icons/sound2.gif) | indahtiara.mp3 | 2022-07-30 04:55 | 13M | |
![[SND]](/icons/sound2.gif) | saging.mp3 | 2022-07-15 10:30 | 13M | |
![[SND]](/icons/sound2.gif) | botakkuning1.mp3 | 2022-07-13 08:17 | 13M | |
![[SND]](/icons/sound2.gif) | bandang3.mp3 | 2022-06-28 05:14 | 13M | |
![[SND]](/icons/sound2.gif) | chestnyy_-_bozhe-prosveti-put.mp3 | 2022-07-13 12:05 | 13M | |
![[SND]](/icons/sound2.gif) | SSONDELA TTRACK.mp3 | 2022-07-14 00:53 | 13M | |
![[SND]](/icons/sound2.gif) | DJ DIAMONDS RIHANNA REMIX FULL BASS TERBARU 2019(MP3_320K).mp3 | 2022-07-14 16:17 | 13M | |
![[SND]](/icons/sound2.gif) | Wakno3.mp3 | 2022-07-04 16:01 | 13M | |
![[SND]](/icons/sound2.gif) | Taeko_Onuki_-_400_AM_73431771.mp3 | 2022-07-14 18:35 | 13M | |
![[SND]](/icons/sound2.gif) | Madonna_-_Hung_Up_48002108.mp3 | 2022-06-30 09:27 | 13M | |
![[SND]](/icons/sound2.gif) | Piste 19.mp3 | 2022-07-05 12:50 | 13M | |
![[SND]](/icons/sound2.gif) | imron4.mp3 | 2022-07-13 21:25 | 13M | |
![[SND]](/icons/sound2.gif) | MCRP4.mp3 | 2022-07-21 09:48 | 13M | |
![[SND]](/icons/sound2.gif) | RS15.mp3 | 2022-07-04 18:31 | 13M | |
![[SND]](/icons/sound2.gif) | Agar.mp3 | 2022-07-08 10:40 | 13M | |
![[SND]](/icons/sound2.gif) | awts.mp3 | 2022-07-02 09:12 | 13M | |
![[SND]](/icons/sound2.gif) | sound1.mp3 | 2022-07-31 01:12 | 13M | |
![[SND]](/icons/sound2.gif) | Mazzy Star - Into Dust (So Tonight That I Might See).mp3 | 2022-07-03 18:13 | 13M | |
![[SND]](/icons/sound2.gif) | 10 Fredericus Rex.mp3 | 2022-07-05 15:40 | 13M | |
![[SND]](/icons/sound2.gif) | 22. Dobareh Misazamat Vatan - Dariush.mp3 | 2022-06-28 13:54 | 13M | |
![[SND]](/icons/sound2.gif) | mix6.mp3 | 2022-07-01 23:50 | 13M | |
![[SND]](/icons/sound2.gif) | DhijEMB.mp3 | 2022-07-15 13:10 | 13M | |
![[SND]](/icons/sound2.gif) | Haikal1.mp3 | 2022-07-16 06:14 | 13M | |
![[SND]](/icons/sound2.gif) | Jhon08.mp3 | 2022-07-15 01:52 | 13M | |
![[SND]](/icons/sound2.gif) | сосасоla.mp3 | 2022-07-23 09:26 | 13M | |
![[SND]](/icons/sound2.gif) | xwan100.mp3 | 2022-07-13 07:27 | 13M | |
![[SND]](/icons/sound2.gif) | gragru1.mp3 | 2022-07-12 13:57 | 13M | |
![[SND]](/icons/sound2.gif) | Svendt - Irgendwann Im Sommer.mp3 | 2022-07-13 00:50 | 13M | |
![[SND]](/icons/sound2.gif) | Spacesong.mp3 | 2022-07-04 01:31 | 13M | |
![[SND]](/icons/sound2.gif) | Юрий Шатунов - Седая Ночь.mp3 | 2022-07-03 16:37 | 13M | |
![[SND]](/icons/sound2.gif) | MiyaGi, Эндшпиль, 9 Грамм - Рапапам.mp3 | 2022-07-08 11:09 | 13M | |
![[SND]](/icons/sound2.gif) | ceramah1.mp3 | 2022-07-07 06:02 | 13M | |
![[SND]](/icons/sound2.gif) | rendi.mp3 | 2022-08-03 15:02 | 13M | |
![[SND]](/icons/sound2.gif) | 15-Kingdom of Wessex.mp3 | 2022-07-13 19:30 | 13M | |
![[SND]](/icons/sound2.gif) | gira2.mp3 | 2022-06-30 13:31 | 13M | |
![[SND]](/icons/sound2.gif) | MengkaneGasi2.mp3 | 2022-06-30 00:09 | 13M | |
![[SND]](/icons/sound2.gif) | Infinity Ink - Infinity [BASSBOOSTED].mp3 | 2022-07-09 08:45 | 13M | |
![[SND]](/icons/sound2.gif) | Mr_Credo_-_CHudnaya_Dolina_(musmore.com).mp3 | 2022-06-29 08:44 | 13M | |
![[SND]](/icons/sound2.gif) | Korol_i_SHut_-_Otrazhenie_(musmore.com).mp3 | 2022-06-28 12:56 | 13M | |
![[SND]](/icons/sound2.gif) | adi103.mp3 | 2022-06-27 17:34 | 13M | |
![[SND]](/icons/sound2.gif) | adi101.mp3 | 2022-06-27 17:31 | 13M | |
![[SND]](/icons/sound2.gif) | 03. Alphaville - Big in Japan (Andry Makarov Ext.RMX).mp3 | 2022-07-15 19:43 | 13M | |
![[SND]](/icons/sound2.gif) | 2 pecah seribu.mp3 | 2022-07-01 04:26 | 13M | |
![[SND]](/icons/sound2.gif) | ARDJ1.mp3 | 2022-06-30 16:40 | 13M | |
![[SND]](/icons/sound2.gif) | Wakno15.mp3 | 2022-07-04 22:42 | 13M | |
![[SND]](/icons/sound2.gif) | Robert.mp3 | 2022-07-12 02:28 | 13M | |
![[SND]](/icons/sound2.gif) | Bola_Tinibu_Ne_Zabina_2023,_Sabuwar_Waka(128k).m4a | 2022-07-13 22:15 | 13M | |
![[SND]](/icons/sound2.gif) | SPN.mp3 | 2022-07-13 08:56 | 13M | |
![[SND]](/icons/sound2.gif) | mix5.mp3 | 2022-07-02 05:48 | 13M | |
![[SND]](/icons/sound2.gif) | غزوان_الفهد_ودو_كوامه_دي_جي_مابيسترو.mp3 | 2022-07-14 16:24 | 13M | |
![[SND]](/icons/sound2.gif) | Wal.mp3 | 2022-07-13 04:33 | 13M | |
![[SND]](/icons/sound2.gif) | DjIWannaFeelLike2.mp3 | 2022-07-13 10:03 | 13M | |
![[SND]](/icons/sound2.gif) | RUS_34_-_Policaj_sex_remix_(Gybka.com).mp3 | 2022-07-14 12:48 | 13M | |
![[SND]](/icons/sound2.gif) | bandang2.mp3 | 2022-06-28 05:17 | 13M | |
![[SND]](/icons/sound2.gif) | Сектор Газа - Частушки.mp3 | 2022-07-06 17:57 | 13M | |
![[SND]](/icons/sound2.gif) | Trixster8.mp3 | 2022-07-01 01:38 | 13M | |
![[SND]](/icons/sound2.gif) | Kid Rock - Only God Knows Why.mp3 | 2022-07-04 01:08 | 13M | |
![[SND]](/icons/sound2.gif) | ngab9.mp3 | 2022-07-15 11:16 | 13M | |
![[SND]](/icons/sound2.gif) | gangsta2.mp3 | 2022-07-01 16:40 | 13M | |
![[SND]](/icons/sound2.gif) | soa.mp3 | 2022-07-15 21:11 | 13M | |
![[SND]](/icons/sound2.gif) | Sons of Anarchy Kota Kita(MP3_320K).mp3 | 2022-07-15 20:59 | 13M | |
![[SND]](/icons/sound2.gif) | Show Up Like Wolf - Damn Mommy.mp3 | 2022-07-05 13:59 | 13M | |
![[SND]](/icons/sound2.gif) | lennoxsdj110.mp3 | 2022-06-28 02:46 | 13M | |
![[SND]](/icons/sound2.gif) | 1985_XMAS.MP.mp3 | 2022-07-05 06:41 | 13M | |
![[SND]](/icons/sound2.gif) | flowg.mp3 | 2022-07-18 16:24 | 13M | |
![[SND]](/icons/sound2.gif) | 102697353.mp3 | 2022-07-01 01:57 | 13M | |
![[SND]](/icons/sound2.gif) | 102697353 (1).mp3 | 2022-07-01 01:57 | 13M | |
![[SND]](/icons/sound2.gif) | 07. Habs - Ebi.mp3 | 2022-06-28 13:52 | 13M | |
![[SND]](/icons/sound2.gif) | Air.mp3 | 2022-06-27 13:11 | 13M | |
![[SND]](/icons/sound2.gif) | zrkhalhebat.mp3 | 2022-06-29 07:48 | 13M | |
![[SND]](/icons/sound2.gif) | 24-Wanderer of Lands.mp3 | 2022-07-13 19:32 | 13M | |
![[SND]](/icons/sound2.gif) | cumakamu.mp3 | 2022-07-01 21:25 | 13M | |
![[SND]](/icons/sound2.gif) | paved-with-good-intentions (3).mp3 | 2022-07-06 20:51 | 13M | |
![[SND]](/icons/sound2.gif) | paved-with-good-intentions (1).mp3 | 2022-07-06 20:38 | 13M | |
![[SND]](/icons/sound2.gif) | selamat_menikmati.mp3 | 2022-07-02 17:19 | 13M | |
![[SND]](/icons/sound2.gif) | Fav1.mp3 | 2022-07-16 08:18 | 13M | |
![[SND]](/icons/sound2.gif) | PUN_FEAT_99 POINT_( dalie ).mp3 | 2022-07-14 00:54 | 13M | |
![[SND]](/icons/sound2.gif) | perahulayar.mp3 | 2022-07-02 04:30 | 12M | |
![[SND]](/icons/sound2.gif) | mscc.mp3 | 2022-07-06 11:50 | 12M | |
![[SND]](/icons/sound2.gif) | Avana.mp3 | 2022-08-05 15:58 | 12M | |
![[SND]](/icons/sound2.gif) | djdapin.mp3 | 2022-06-30 19:36 | 12M | |
![[SND]](/icons/sound2.gif) | Demolition_Lovers_(getmp3.pro).mp3 | 2022-06-28 04:23 | 12M | |
![[SND]](/icons/sound2.gif) | summer.mp3 | 2022-07-29 08:59 | 12M | |
![[SND]](/icons/sound2.gif) | kanta.mp3 | 2022-07-03 22:58 | 12M | |
![[SND]](/icons/sound2.gif) | 0_Eminem – Lose Yourself.mp3 | 2022-07-10 10:24 | 12M | |
![[SND]](/icons/sound2.gif) | cari.mp3 | 2022-07-05 11:31 | 12M | |
![[SND]](/icons/sound2.gif) | paved-with-good-intentions.mp3 | 2022-07-08 22:20 | 12M | |
![[SND]](/icons/sound2.gif) | OLD.mp3 | 2022-07-13 11:51 | 12M | |
![[SND]](/icons/sound2.gif) | Гражданская оборона - Долгая счастливая жизнь.mp3 | 2022-07-08 08:33 | 12M | |
![[SND]](/icons/sound2.gif) | x2.mp3 | 2022-07-12 11:50 | 12M | |
![[SND]](/icons/sound2.gif) | DjComeOnComeOn.mp3 | 2022-07-12 08:06 | 12M | |
![[SND]](/icons/sound2.gif) | blackbear-fashion-week-it-s-different-remix-mp3.mp3 | 2022-07-19 18:58 | 12M | |
![[SND]](/icons/sound2.gif) | djcomeon.mp3 | 2022-06-30 09:32 | 12M | |
![[SND]](/icons/sound2.gif) | vinsz1.mp3 | 2022-06-29 06:21 | 12M | |
![[SND]](/icons/sound2.gif) | Enakeunn+V4.mp3 | 2022-07-15 03:27 | 12M | |
![[SND]](/icons/sound2.gif) | 09. Sisters Of Mercy [7' Version].mp3 | 2022-07-04 00:39 | 12M | |
![[SND]](/icons/sound2.gif) | Eminem_-_Stan_Lyrics_[audio](256k).mp3 | 2022-07-15 18:06 | 12M | |
![[SND]](/icons/sound2.gif) | escdj.mp3 | 2022-07-05 04:09 | 12M | |
![[SND]](/icons/sound2.gif) | airsupply.mp3 | 2022-07-10 18:27 | 12M | |
![[SND]](/icons/sound2.gif) | 1 raja meksiko.mp3 | 2022-07-01 04:24 | 12M | |
![[SND]](/icons/sound2.gif) | TikTok.mp3 | 2022-07-10 14:04 | 12M | |
![[SND]](/icons/sound2.gif) | zrkdjmontage.mp3 | 2022-06-29 07:45 | 12M | |
![[SND]](/icons/sound2.gif) | Pol3.mp3 | 2022-07-07 07:55 | 12M | |
![[SND]](/icons/sound2.gif) | Selamat tinggal Virgoun.mp3 | 2022-06-30 04:02 | 12M | |
![[SND]](/icons/sound2.gif) | Rimter16.mp3 | 2022-07-09 01:19 | 12M | |
![[SND]](/icons/sound2.gif) | PyramidDj.mp3 | 2022-07-05 02:30 | 12M | |
![[SND]](/icons/sound2.gif) | trails.mp3 | 2022-07-07 03:28 | 12M | |
![[SND]](/icons/sound2.gif) | cahayabidadari.mp3 | 2022-07-11 16:25 | 12M | |
![[SND]](/icons/sound2.gif) | Jhon04.mp3 | 2022-07-14 01:51 | 12M | |
![[SND]](/icons/sound2.gif) | lagu17.mp3 | 2022-07-13 06:33 | 12M | |
![[SND]](/icons/sound2.gif) | xomchua1.mp3 | 2022-07-12 13:55 | 12M | |
![[SND]](/icons/sound2.gif) | Matrix5.mp3 | 2022-06-28 05:10 | 12M | |
![[SND]](/icons/sound2.gif) | dom106.mp3 | 2022-07-03 06:27 | 12M | |
![[SND]](/icons/sound2.gif) | ggdv.mp3 | 2022-07-14 07:04 | 12M | |
![[SND]](/icons/sound2.gif) | arthurnery001.mp3 | 2022-07-11 05:52 | 12M | |
![[SND]](/icons/sound2.gif) | malang.mp3 | 2022-07-04 02:12 | 12M | |
![[SND]](/icons/sound2.gif) | WakChak14.mp3 | 2022-07-07 21:37 | 12M | |
![[SND]](/icons/sound2.gif) | VKCOM.mp3 | 2022-07-07 12:36 | 12M | |
![[SND]](/icons/sound2.gif) | anton5.mp3 | 2022-07-08 13:05 | 12M | |
![[SND]](/icons/sound2.gif) | moneytrees.mp3 | 2022-07-08 18:52 | 12M | |
![[SND]](/icons/sound2.gif) | gungun1.mp3 | 2022-06-29 03:25 | 12M | |
![[SND]](/icons/sound2.gif) | NOMA - Brain Power.mp3 | 2022-07-09 00:45 | 12M | |
![[SND]](/icons/sound2.gif) | Swinglynn.mp3 | 2022-07-04 01:31 | 12M | |
![[SND]](/icons/sound2.gif) | kirill-weltfremd-proshhai-metro.mp3 | 2022-07-13 18:40 | 12M | |
![[SND]](/icons/sound2.gif) | iro8.mp3 | 2022-07-03 06:23 | 12M | |
![[SND]](/icons/sound2.gif) | DjCloseYourEye.mp3 | 2022-07-13 09:52 | 12M | |
![[SND]](/icons/sound2.gif) | 𝐀𝐏𝐄𝐋𝐒𝐈𝐍 𝐂𝐇𝐀𝐓.mp3 | 2022-07-15 04:35 | 12M | |
![[SND]](/icons/sound2.gif) | YASIN.mp3 | 2022-06-28 06:01 | 12M | |
![[SND]](/icons/sound2.gif) | SIN.mp3 | 2022-06-28 06:03 | 12M | |
![[SND]](/icons/sound2.gif) | Rhey34.mp3 | 2022-06-28 12:20 | 12M | |
![[SND]](/icons/sound2.gif) | 102697354.mp3 | 2022-07-01 01:56 | 12M | |
![[SND]](/icons/sound2.gif) | Kal2.mp3 | 2022-07-15 19:01 | 12M | |
![[SND]](/icons/sound2.gif) | 12. Mardom Hamishe Mardom - Aref.mp3 | 2022-06-28 13:53 | 12M | |
![[SND]](/icons/sound2.gif) | bohemianrapsody.mp3 | 2022-07-07 21:14 | 12M | |
![[SND]](/icons/sound2.gif) | happyars2.mp3 | 2022-07-15 07:31 | 12M | |
![[SND]](/icons/sound2.gif) | MengkaneGasi6.mp3 | 2022-06-30 00:13 | 12M | |
![[SND]](/icons/sound2.gif) | sejedewe.mp3 | 2022-07-06 00:18 | 12M | |
![[SND]](/icons/sound2.gif) | Alexis2.mp3 | 2022-07-12 00:43 | 12M | |
![[SND]](/icons/sound2.gif) | AUD-20220708-WA0031.mp3 | 2022-07-08 18:03 | 12M | |
![[SND]](/icons/sound2.gif) | Yamete12.mp3 | 2022-07-16 15:22 | 12M | |
![[SND]](/icons/sound2.gif) | Chiquitita.mp3 | 2022-07-04 01:01 | 12M | |
![[SND]](/icons/sound2.gif) | Ngamen3.mp3 | 2022-07-14 05:24 | 12M | |
![[SND]](/icons/sound2.gif) | Oswine.mp3 | 2022-07-12 09:32 | 12M | |
![[SND]](/icons/sound2.gif) | RS14.mp3 | 2022-07-04 16:05 | 12M | |
![[SND]](/icons/sound2.gif) | SAMPDJ3.mp3 | 2022-07-02 17:14 | 12M | |
![[SND]](/icons/sound2.gif) | jms2.mp3 | 2022-07-07 16:06 | 12M | |
![[SND]](/icons/sound2.gif) | west.mp3 | 2022-07-18 17:50 | 12M | |
![[SND]](/icons/sound2.gif) | jee4.mp3 | 2022-07-11 12:07 | 12M | |
![[SND]](/icons/sound2.gif) | writethisdown.mp3 | 2022-07-16 00:06 | 12M | |
![[SND]](/icons/sound2.gif) | atin.mp3 | 2022-06-29 01:31 | 12M | |
![[SND]](/icons/sound2.gif) | АК-47 - Russian Paradise (feat. Ноггано).mp3 | 2022-07-12 14:15 | 12M | |
![[SND]](/icons/sound2.gif) | bertaut sad.mp3 | 2022-07-05 22:05 | 12M | |
![[SND]](/icons/sound2.gif) | bertaut.mp3 | 2022-07-05 22:58 | 12M | |
![[SND]](/icons/sound2.gif) | kalamoata.mp3 | 2022-07-25 05:58 | 12M | |
![[SND]](/icons/sound2.gif) | Miyagi & Эндшпиль feat. Sимптом - Люби меня.mp3 | 2022-07-11 20:11 | 12M | |
![[SND]](/icons/sound2.gif) | lennoxsj.mp3 | 2022-06-28 02:51 | 12M | |
![[SND]](/icons/sound2.gif) | Hapier.mp3 | 2022-07-08 07:11 | 12M | |
![[SND]](/icons/sound2.gif) | 1985-12-31_CF-INC.MP.mp3 | 2022-07-05 06:41 | 12M | |
![[SND]](/icons/sound2.gif) | 03-boston-foreplay-long_time.mp3 | 2022-07-04 00:48 | 12M | |
![[SND]](/icons/sound2.gif) | Jrngplng.mp3 | 2022-06-28 01:07 | 12M | |
![[SND]](/icons/sound2.gif) | Nicole.mp3 | 2022-06-30 13:00 | 12M | |
![[VID]](/icons/movie.gif) | PRESTIGE WORLD ROLEPLAY - Prod.By MANGBORIS (Official Audio).mp4 | 2022-07-06 15:19 | 12M | |
![[SND]](/icons/sound2.gif) | avictor.mp3 | 2022-07-17 13:49 | 12M | |
![[SND]](/icons/sound2.gif) | SurahYasin.mp3 | 2022-07-03 11:45 | 12M | |
![[SND]](/icons/sound2.gif) | rifa.mp3 | 2022-07-10 12:09 | 12M | |
![[SND]](/icons/sound2.gif) | 2pac2.mp3 | 2022-07-15 13:53 | 12M | |
![[SND]](/icons/sound2.gif) | 03 Black Fathers (Magezi feat_ M60_442_) shukuma.mp3 | 2022-07-11 19:59 | 12M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ CUMA MANTAN RAHMAT TAHALU SOUND 𝘼𝟳 𝙃𝙄𝙍𝙊𝙒𝘼𝙉𝙂𝙂𝙔 VIRAL FYP TIKTOK TERBARU 2022.mp3 | 2022-07-07 07:17 | 12M | |
![[SND]](/icons/sound2.gif) | gra2.mp3 | 2022-07-07 07:19 | 12M | |
![[SND]](/icons/sound2.gif) | [TR]Ganz_Trickters.mp3 | 2022-07-09 10:11 | 12M | |
![[SND]](/icons/sound2.gif) | DMGE_-_Time_2_set_the_record_straight_Redub (mp3cut.net).mp3 | 2022-07-04 11:35 | 12M | |
![[SND]](/icons/sound2.gif) | CODEDANY.mp3 | 2022-07-02 03:53 | 12M | |
![[SND]](/icons/sound2.gif) | Rezi.mp3 | 2022-07-04 20:32 | 12M | |
![[SND]](/icons/sound2.gif) | INI YANG KALIAN CARI___ YANG MINTA FULLNYA NI SOUND JJ ZERZ_SOFTBOY X Ijul RMX(MP3_320K).mp3 | 2022-07-04 19:07 | 12M | |
![[SND]](/icons/sound2.gif) | Notre Dame de Paris - 13 La corte dei miracoli (Live Arena di Verona) (320 kbps).mp3 | 2022-06-28 19:47 | 12M | |
![[SND]](/icons/sound2.gif) | Empire of Angels.mp3 | 2022-06-27 13:45 | 12M | |
![[SND]](/icons/sound2.gif) | noprob.mp3 | 2022-07-15 10:29 | 12M | |
![[SND]](/icons/sound2.gif) | ROG11.mp3 | 2022-07-15 10:27 | 12M | |
![[SND]](/icons/sound2.gif) | REDDY8.mp3 | 2022-06-29 06:02 | 12M | |
![[SND]](/icons/sound2.gif) | ska.mp3 | 2022-08-06 21:26 | 12M | |
![[SND]](/icons/sound2.gif) | ska sayang.mp3 | 2022-07-05 22:02 | 12M | |
![[SND]](/icons/sound2.gif) | SKA 86 - SAYANG 2 (DanSKA Clip Video).mp3 | 2022-07-05 09:01 | 12M | |
![[SND]](/icons/sound2.gif) | esckane1.mp3 | 2022-07-05 04:12 | 12M | |
![[SND]](/icons/sound2.gif) | Би-2 - Большие Города.mp3 | 2022-07-05 17:24 | 12M | |
![[SND]](/icons/sound2.gif) | zerelli3.mp3 | 2022-07-16 01:23 | 12M | |
![[SND]](/icons/sound2.gif) | Fuckthapolice.mp3 | 2022-07-04 01:16 | 12M | |
![[SND]](/icons/sound2.gif) | Big Boi-Kryptonite -Dr. Fresch x Tendra Remix- -bass.prod by Golds--kissvk.com.mp3 | 2022-07-05 14:18 | 12M | |
![[VID]](/icons/movie.gif) | httpsww.mp4 | 2022-07-08 08:56 | 12M | |
![[SND]](/icons/sound2.gif) | escengkol.mp3 | 2022-07-08 07:39 | 12M | |
![[SND]](/icons/sound2.gif) | fck.mp3 | 2022-07-06 05:42 | 12M | |
![[SND]](/icons/sound2.gif) | Nathan_Imanuel.mp3 | 2022-07-01 15:53 | 12M | |
![[SND]](/icons/sound2.gif) | Hasan_Udin.mp3 | 2022-07-01 10:25 | 12M | |
![[SND]](/icons/sound2.gif) | 4 orange 7.mp3 | 2022-07-01 04:27 | 12M | |
![[SND]](/icons/sound2.gif) | Mikhail_Krug_-_Kupola_48114217.mp3 | 2022-06-27 17:06 | 12M | |
![[SND]](/icons/sound2.gif) | superhero.mp3 | 2022-06-28 05:18 | 12M | |
![[SND]](/icons/sound2.gif) | bukan12.mp3 | 2022-07-17 13:48 | 12M | |
![[SND]](/icons/sound2.gif) | 2pachitp.mp3 | 2022-06-30 14:06 | 12M | |
![[SND]](/icons/sound2.gif) | djzer.mp3 | 2022-06-28 19:24 | 12M | |
![[SND]](/icons/sound2.gif) | Djleon7.mp3 | 2022-07-14 10:05 | 12M | |
![[SND]](/icons/sound2.gif) | DjKane5.mp3 | 2022-06-29 05:34 | 12M | |
![[SND]](/icons/sound2.gif) | Ragil2.mp3 | 2022-07-13 13:14 | 12M | |
![[SND]](/icons/sound2.gif) | INI YANG KALIAN CARI!!! YANG MINTA FULLNYA NI SOUND JJ ZERZ’SOFTBOY X Ijul RMX.mp3 | 2022-07-04 15:00 | 12M | |
![[SND]](/icons/sound2.gif) | Gorillaz - My Ego.mp3 | 2022-07-06 21:13 | 12M | |
![[SND]](/icons/sound2.gif) | yt5s.com - A$AP Mob - Yamborghini High (Official Video - Explicit) ft. Juicy J (320 kbps).mp3 | 2022-07-09 06:41 | 12M | |
![[SND]](/icons/sound2.gif) | pimpin.mp3 | 2022-07-09 07:40 | 12M | |
![[SND]](/icons/sound2.gif) | zrkparjamban.mp3 | 2022-06-29 07:52 | 12M | |
![[SND]](/icons/sound2.gif) | kal1.mp3 | 2022-07-16 16:05 | 12M | |
![[VID]](/icons/movie.gif) | c895103a36ff04d0f1664c6b1bacfb65.mp4 | 2022-07-12 00:34 | 12M | |
![[SND]](/icons/sound2.gif) | kaalan6.mp3 | 2022-07-09 19:10 | 12M | |
![[SND]](/icons/sound2.gif) | dkl2.mp3 | 2022-07-15 02:30 | 12M | |
![[SND]](/icons/sound2.gif) | snt9.mp3 | 2022-06-28 02:10 | 12M | |
![[SND]](/icons/sound2.gif) | Rimter11.mp3 | 2022-07-09 01:19 | 12M | |
![[SND]](/icons/sound2.gif) | 109472169.mp3 | 2022-07-01 01:57 | 12M | |
![[SND]](/icons/sound2.gif) | Kikuo_ft_Hatsune_Miku_-_Hole-Dwell_(getmp3.pro).mp3 | 2022-07-13 01:49 | 12M | |
![[SND]](/icons/sound2.gif) | d7j.mp3 | 2022-07-14 13:31 | 12M | |
![[SND]](/icons/sound2.gif) | ugun11.mp3 | 2022-07-02 04:00 | 12M | |
![[SND]](/icons/sound2.gif) | Koy.mp3 | 2022-07-14 02:57 | 12M | |
![[SND]](/icons/sound2.gif) | zrkdjdapatkah.mp3 | 2022-06-29 07:54 | 12M | |
![[SND]](/icons/sound2.gif) | Twostep.mp3 | 2022-07-09 15:03 | 12M | |
![[SND]](/icons/sound2.gif) | MGMT.mp3 | 2022-07-04 01:20 | 12M | |
![[SND]](/icons/sound2.gif) | s̴e̴x̴s̴o̴v̴s̴k̴i̴e̴🍇🥴 - я по уши в тебя влюблён.(remix).mp3 | 2022-07-02 19:45 | 12M | |
![[SND]](/icons/sound2.gif) | DJTAI.mp3 | 2022-07-05 00:45 | 12M | |
![[SND]](/icons/sound2.gif) | MOLLBEN46.mp3 | 2022-06-30 20:20 | 12M | |
![[SND]](/icons/sound2.gif) | Amanateman.mp3 | 2022-06-29 14:44 | 12M | |
![[SND]](/icons/sound2.gif) | Dj Chechen - Бешеная Чеченская Лезгинка.mp3 | 2022-06-29 22:02 | 12M | |
![[SND]](/icons/sound2.gif) | Любэ-Солдат-kissvk.com.mp3 | 2022-06-30 22:04 | 12M | |
![[SND]](/icons/sound2.gif) | g-eazy-halsey-him-and-i-slowed.mp3 | 2022-07-05 00:41 | 12M | |
![[SND]](/icons/sound2.gif) | wakas.mp3 | 2022-07-08 19:58 | 12M | |
![[SND]](/icons/sound2.gif) | bold.mp3 | 2022-07-11 17:49 | 12M | |
![[SND]](/icons/sound2.gif) | r5.mp3 | 2022-07-13 11:27 | 12M | |
![[SND]](/icons/sound2.gif) | msc4.mp3 | 2022-06-28 07:25 | 12M | |
![[SND]](/icons/sound2.gif) | DijehGalau.mp3 | 2022-07-05 20:56 | 12M | |
![[SND]](/icons/sound2.gif) | Aufnehmen-010.mp3 | 2022-07-09 17:22 | 12M | |
![[SND]](/icons/sound2.gif) | happyars1.mp3 | 2022-07-15 07:32 | 12M | |
![[SND]](/icons/sound2.gif) | xwan4.mp3 | 2022-06-27 15:46 | 12M | |
![[SND]](/icons/sound2.gif) | X2Download.com - Solas Theme (Extended) - Dragon Age 4 #TheDreadWolfRises (128 kbps).mp3 | 2022-07-10 22:07 | 12M | |
![[SND]](/icons/sound2.gif) | Valentin_Strykalo_-_Uskolzaet_47844599.mp3 | 2022-07-05 22:57 | 12M | |
![[SND]](/icons/sound2.gif) | mobi19.mp3 | 2022-06-30 04:49 | 12M | |
![[SND]](/icons/sound2.gif) | 09. WASTING TIME (feat. Drake & The Neptunes).mp3 | 2022-07-06 08:26 | 12M | |
![[SND]](/icons/sound2.gif) | rus43 - Закон каменных джунглей (1).mp3 | 2022-07-12 04:51 | 12M | |
![[SND]](/icons/sound2.gif) | vedi79.mp3 | 2022-06-29 12:18 | 12M | |
![[SND]](/icons/sound2.gif) | Hilang.mp3 | 2022-06-28 19:03 | 12M | |
![[SND]](/icons/sound2.gif) | DjKane9.mp3 | 2022-06-29 06:23 | 12M | |
![[SND]](/icons/sound2.gif) | Monplaisir_-_06_-_The_sickness.mp3 | 2022-07-06 08:22 | 12M | |
![[SND]](/icons/sound2.gif) | The_Toxic_Avenger_-_Adrenaline_Fe_(getmp3.pro).mp3 | 2022-07-03 02:32 | 12M | |
![[SND]](/icons/sound2.gif) | Roblox_3008_OST-Blood_Night_Theme.mp3 | 2022-07-06 01:13 | 12M | |
![[SND]](/icons/sound2.gif) | Roblox 3008 OST - Blood Night Theme.mp3 | 2022-07-06 00:59 | 12M | |
![[SND]](/icons/sound2.gif) | trend.mp3 | 2022-06-27 15:57 | 12M | |
![[SND]](/icons/sound2.gif) | The Cranberries - Zombie.mp3 | 2022-07-01 10:04 | 12M | |
![[SND]](/icons/sound2.gif) | djalex6.mp3 | 2022-07-03 10:55 | 12M | |
![[SND]](/icons/sound2.gif) | WakChak6.mp3 | 2022-07-07 21:33 | 12M | |
![[SND]](/icons/sound2.gif) | WakChak21.mp3 | 2022-07-07 21:40 | 12M | |
![[SND]](/icons/sound2.gif) | zrkdjkomangsekali.mp3 | 2022-06-29 07:49 | 12M | |
![[SND]](/icons/sound2.gif) | Bandoleros - Don Omar.mp3 | 2022-07-06 15:24 | 12M | |
![[SND]](/icons/sound2.gif) | DJ_BBHC_PYRAMID_ARNOLD.mp3 | 2022-07-13 18:50 | 12M | |
![[SND]](/icons/sound2.gif) | pb5.mp3 | 2022-06-28 16:08 | 12M | |
![[SND]](/icons/sound2.gif) | 16. Roll Over.mp3 | 2022-07-04 00:40 | 12M | |
![[SND]](/icons/sound2.gif) | pndo13.mp3 | 2022-06-28 16:05 | 12M | |
![[VID]](/icons/movie.gif) | 293708743_178244504610327_646599149767067178_n.mp4 | 2022-07-13 18:50 | 12M | |
![[SND]](/icons/sound2.gif) | iro5.mp3 | 2022-08-04 09:42 | 12M | |
![[SND]](/icons/sound2.gif) | khongcodieukien.mp3 | 2022-07-10 03:33 | 12M | |
![[SND]](/icons/sound2.gif) | ini.mp3 | 2022-07-12 05:33 | 12M | |
![[SND]](/icons/sound2.gif) | dgm4.mp3 | 2022-07-08 08:58 | 12M | |
![[SND]](/icons/sound2.gif) | saker4.mp3 | 2022-07-15 21:16 | 12M | |
![[SND]](/icons/sound2.gif) | X2Download.com - The Witcher 3 Blood and Wine - The Slopes of the Blessure (extended) (128 kbps).mp3 | 2022-07-10 22:06 | 12M | |
![[VID]](/icons/movie.gif) | Zaki.mp4 | 2022-07-04 17:56 | 12M | |
![[SND]](/icons/sound2.gif) | Poothiri1.mp3 | 2022-06-28 02:29 | 12M | |
![[SND]](/icons/sound2.gif) | ugh.mp3 | 2022-07-02 09:10 | 12M | |
![[SND]](/icons/sound2.gif) | dies-irae.mp3 | 2022-07-05 16:25 | 12M | |
![[SND]](/icons/sound2.gif) | doom_11. Bfg Division.mp3 | 2022-07-16 13:46 | 12M | |
![[SND]](/icons/sound2.gif) | Sirotkin - Выше домов.mp3 | 2022-07-10 18:44 | 12M | |
![[SND]](/icons/sound2.gif) | zrkbukanjodohnya.mp3 | 2022-06-29 07:45 | 12M | |
![[SND]](/icons/sound2.gif) | Mentol1.mp3 | 2022-06-28 14:02 | 12M | |
![[SND]](/icons/sound2.gif) | Mick Gordon - 11. BFG Division.mp3 | 2022-07-08 00:27 | 12M | |
![[SND]](/icons/sound2.gif) | Sementarapaps.mp3 | 2022-06-29 05:07 | 12M | |
![[SND]](/icons/sound2.gif) | tuhan.mp3 | 2022-07-04 20:38 | 12M | |
![[SND]](/icons/sound2.gif) | Riko.mp3 | 2022-06-27 23:37 | 12M | |
![[SND]](/icons/sound2.gif) | hycalsad.mp3 | 2022-07-24 02:06 | 12M | |
![[SND]](/icons/sound2.gif) | yt5s.io - ASMR besando tus Orejitas_ Mouth sounds-ASMR EAR EATING con 3dio (128 kbps).mp3 | 2022-07-05 19:17 | 12M | |
![[SND]](/icons/sound2.gif) | warp.mp3 | 2022-07-30 18:33 | 12M | |
![[SND]](/icons/sound2.gif) | Hurt - The New Shining.mp3 | 2022-07-12 07:06 | 12M | |
![[SND]](/icons/sound2.gif) | escslow.mp3 | 2022-07-05 04:14 | 12M | |
![[SND]](/icons/sound2.gif) | y2meta.com - Kate Bush - Running Up That Hill (Stranger Things Version) (320 kbps).mp3 | 2022-07-10 18:18 | 12M | |
![[SND]](/icons/sound2.gif) | ghostslow.mp3 | 2022-07-15 03:56 | 12M | |
![[SND]](/icons/sound2.gif) | y2mate.com - First date but its so relaxing.mp3 | 2022-07-12 06:51 | 12M | |
![[SND]](/icons/sound2.gif) | QimzySad.mp3 | 2022-06-28 05:57 | 12M | |
![[SND]](/icons/sound2.gif) | The Phone Files - Part 4.mp3 | 2022-07-10 23:28 | 12M | |
![[SND]](/icons/sound2.gif) | zbida1.mp3 | 2022-07-08 01:32 | 12M | |
![[SND]](/icons/sound2.gif) | Portwave - Shadow Lady.mp3 | 2022-07-08 19:50 | 12M | |
![[SND]](/icons/sound2.gif) | Zeb2.mp3 | 2022-07-07 01:56 | 12M | |
![[SND]](/icons/sound2.gif) | Pags.mp3 | 2022-07-01 02:31 | 12M | |
![[SND]](/icons/sound2.gif) | 3H LIVE STEAM _ Lofi Hip Hop _ NCM _ Non-Copyrighted Music _ Relax _ Chill study (64K).mp3 | 2022-07-05 10:31 | 12M | |
![[SND]](/icons/sound2.gif) | NETO10.mp3 | 2022-07-01 12:08 | 11M | |
![[SND]](/icons/sound2.gif) | 6090.mp3 | 2022-07-08 11:52 | 11M | |
![[SND]](/icons/sound2.gif) | faisal2.mp3 | 2022-07-13 22:53 | 11M | |
![[SND]](/icons/sound2.gif) | 1983-10-08_CF-INC.mp3 | 2022-07-05 06:40 | 11M | |
![[SND]](/icons/sound2.gif) | If In The Winter Of Your Life.mp3 | 2022-07-25 20:54 | 11M | |
![[SND]](/icons/sound2.gif) | Juice_WRLD_-_Dirty_Soda_No_Coaster_Ft_Polo_G_Extended_All_Verses_320_kbps.mp3 | 2022-07-01 00:39 | 11M | |
![[SND]](/icons/sound2.gif) | TT1.mp3 | 2022-07-09 18:52 | 11M | |
![[SND]](/icons/sound2.gif) | seniorita.mp3 | 2022-06-28 05:18 | 11M | |
![[SND]](/icons/sound2.gif) | - ϝⲁⲓʀⲩ ⲧⲁⳑⲉ 🎈.mp3 | 2022-07-13 16:12 | 11M | |
![[SND]](/icons/sound2.gif) | Extazy. - не грусти солнце`.mp3 | 2022-07-12 05:05 | 11M | |
![[SND]](/icons/sound2.gif) | anto3.mp3 | 2022-07-12 07:02 | 11M | |
![[VID]](/icons/movie.gif) | httpswwww.mp4 | 2022-07-08 09:53 | 11M | |
![[SND]](/icons/sound2.gif) | dgm7.mp3 | 2022-07-08 08:59 | 11M | |
![[SND]](/icons/sound2.gif) | vedi60.mp3 | 2022-06-29 12:14 | 11M | |
![[SND]](/icons/sound2.gif) | ####Ramu Music .mp3 | 2022-06-28 10:52 | 11M | |
![[SND]](/icons/sound2.gif) | kal7.mp3 | 2022-07-16 16:06 | 11M | |
![[SND]](/icons/sound2.gif) | djtambotu.mp3 | 2022-07-02 03:32 | 11M | |
![[SND]](/icons/sound2.gif) | LkLbWH1.mp3 | 2022-07-06 01:54 | 11M | |
![[SND]](/icons/sound2.gif) | Bojoku.mp3 | 2022-06-27 23:33 | 11M | |
![[SND]](/icons/sound2.gif) | djalex4.mp3 | 2022-07-03 10:46 | 11M | |
![[SND]](/icons/sound2.gif) | sadars1.mp3 | 2022-07-15 07:32 | 11M | |
![[SND]](/icons/sound2.gif) | snoop2.mp3 | 2022-07-16 01:54 | 11M | |
![[SND]](/icons/sound2.gif) | Viktor_Cojj_KHochu_peremen_47828893.mp3 | 2022-06-28 16:22 | 11M | |
![[SND]](/icons/sound2.gif) | Viktor_Cojj_KHochu_peremen.mp3 | 2022-06-28 22:00 | 11M | |
![[SND]](/icons/sound2.gif) | Viktor_Cojj_-_KHochu_peremen_47828893.mp3 | 2022-07-18 23:01 | 11M | |
![[SND]](/icons/sound2.gif) | 1hamaba.mp3 | 2022-07-15 22:53 | 11M | |
![[SND]](/icons/sound2.gif) | VOC.mp3 | 2022-07-06 08:03 | 11M | |
![[SND]](/icons/sound2.gif) | Motivaciya-muzyka_dlya_trenirovok_BassBoosted_By_Dryunya_(RU.MUSIC-LORD.COM).mp3 | 2022-07-05 08:24 | 11M | |
![[VID]](/icons/movie.gif) | AMV!!!สุดท้ายก็กลับไป (ปริศนาความทรงจํา).mp4 | 2022-06-28 12:04 | 11M | |
![[SND]](/icons/sound2.gif) | zrkdjbreak.mp3 | 2022-06-29 07:46 | 11M | |
![[SND]](/icons/sound2.gif) | WakChak18.mp3 | 2022-07-07 21:39 | 11M | |
![[SND]](/icons/sound2.gif) | rapver.mp3 | 2022-07-08 04:06 | 11M | |
![[SND]](/icons/sound2.gif) | Jaa.mp3 | 2022-07-08 10:40 | 11M | |
![[VID]](/icons/movie.gif) | 9c28d02fdb64d333b5618386c2532984.mp4 | 2022-07-02 11:30 | 11M | |
![[SND]](/icons/sound2.gif) | toji E.mp3 | 2022-07-05 09:14 | 11M | |
![[SND]](/icons/sound2.gif) | tatu — Нас не догонят (AXIUS LINK REMIX) (www.lightaudio.ru).mp3 | 2022-07-18 14:43 | 11M | |
![[SND]](/icons/sound2.gif) | nyod2.mp3 | 2022-08-05 15:56 | 11M | |
![[SND]](/icons/sound2.gif) | zack8.mp3 | 2022-06-28 06:40 | 11M | |
![[SND]](/icons/sound2.gif) | aikid.mp3 | 2022-06-27 15:52 | 11M | |
![[SND]](/icons/sound2.gif) | djalex3.mp3 | 2022-07-03 10:45 | 11M | |
![[SND]](/icons/sound2.gif) | bergoyang.mp3 | 2022-07-08 02:58 | 11M | |
![[SND]](/icons/sound2.gif) | WIBOY14.mp3 | 2022-07-13 19:53 | 11M | |
![[SND]](/icons/sound2.gif) | unit.mp3 | 2022-06-28 05:18 | 11M | |
![[SND]](/icons/sound2.gif) | RBL.mp3 | 2022-07-12 02:59 | 11M | |
![[SND]](/icons/sound2.gif) | EdwardSad11.mp3 | 2022-07-14 13:10 | 11M | |
![[SND]](/icons/sound2.gif) | Pentakill - Lightbringer.mp3 | 2022-07-06 16:50 | 11M | |
![[SND]](/icons/sound2.gif) | SRRY.mp3 | 2022-06-27 15:27 | 11M | |
![[SND]](/icons/sound2.gif) | vedi62.mp3 | 2022-06-29 12:15 | 11M | |
![[SND]](/icons/sound2.gif) | Muse_-_Knights_Of_Cydonia_47894341.mp3 | 2022-07-12 22:34 | 11M | |
![[SND]](/icons/sound2.gif) | ISO-7-bit-Code (DJ Cannabis Coffeeshops Deuschland).mp3 | 2022-07-10 15:37 | 11M | |
![[SND]](/icons/sound2.gif) | ЗАМАЙ, Слава КПСС - Дискотека Овсянкин.mp3 | 2022-07-02 19:26 | 11M | |
![[SND]](/icons/sound2.gif) | Виктор Цой - Хочу перемен.mp3 | 2022-07-12 07:52 | 11M | |
![[SND]](/icons/sound2.gif) | 06. Hold Me Now.mp3 | 2022-07-04 00:39 | 11M | |
![[SND]](/icons/sound2.gif) | noiz 2.mp3 | 2022-07-14 23:11 | 11M | |
![[SND]](/icons/sound2.gif) | xen1.mp3 | 2022-06-29 11:32 | 11M | |
![[SND]](/icons/sound2.gif) | mobi63.mp3 | 2022-07-06 05:29 | 11M | |
![[SND]](/icons/sound2.gif) | Denny Caknan - SATRU 2 (Official Music Video).mp3 | 2022-06-29 11:25 | 11M | |
![[SND]](/icons/sound2.gif) | Saglit.mp3 | 2022-07-05 00:14 | 11M | |
![[SND]](/icons/sound2.gif) | escnight.mp3 | 2022-07-05 04:13 | 11M | |
![[SND]](/icons/sound2.gif) | rs1.mp3 | 2022-07-15 21:48 | 11M | |
![[SND]](/icons/sound2.gif) | Michael_Jackson_-_Billie_Jean_47829972.mp3 | 2022-07-09 19:06 | 11M | |
![[SND]](/icons/sound2.gif) | Avenged Sevenfold - A Little Piece Of Heaven [Official Music Video].mp3 | 2022-07-03 02:18 | 11M | |
![[SND]](/icons/sound2.gif) | Valentin18.mp3 | 2022-06-29 14:29 | 11M | |
![[SND]](/icons/sound2.gif) | Кино - Хочу перемен.mp3 | 2022-07-10 13:05 | 11M | |
![[SND]](/icons/sound2.gif) | Кино, В. Цой - Перемен.mp3 | 2022-07-06 10:47 | 11M | |
![[SND]](/icons/sound2.gif) | AC-DC - Thunderstruck.mp3 | 2022-07-01 08:42 | 11M | |
![[SND]](/icons/sound2.gif) | Adik3.mp3 | 2022-07-11 19:07 | 11M | |
![[SND]](/icons/sound2.gif) | LUGOWO.mp3 | 2022-07-29 16:05 | 11M | |
![[SND]](/icons/sound2.gif) | Insomnia - can`t be touch.mp3 | 2022-07-06 16:33 | 11M | |
![[SND]](/icons/sound2.gif) | Depeche Mode - Personal Jesus.mp3 | 2022-07-04 17:41 | 11M | |
![[SND]](/icons/sound2.gif) | Lumpuhkaningatanku.mp3 | 2022-07-08 14:17 | 11M | |
![[SND]](/icons/sound2.gif) | dor.mp3 | 2022-06-30 15:30 | 11M | |
![[SND]](/icons/sound2.gif) | vedi31.mp3 | 2022-06-29 12:29 | 11M | |
![[SND]](/icons/sound2.gif) | Happywu.mp3 | 2022-07-01 09:25 | 11M | |
![[SND]](/icons/sound2.gif) | your.mp3 | 2022-06-27 17:14 | 11M | |
![[SND]](/icons/sound2.gif) | SQUARE ENIX - Final Fantasy Crystal Chronicles Echoes of Time Disc 1 (5).mp3 | 2022-07-10 14:18 | 11M | |
![[SND]](/icons/sound2.gif) | remin.mp3 | 2022-07-13 09:12 | 11M | |
![[SND]](/icons/sound2.gif) | Fixyou.mp3 | 2022-07-04 01:10 | 11M | |
![[SND]](/icons/sound2.gif) | riplove.mp3 | 2022-07-01 20:40 | 11M | |
![[SND]](/icons/sound2.gif) | Smieszne Rozmowy Telefoniczne - Nitro vs Telefon Zaufania [Ostatetczny pojedynek] (1).mp3 | 2022-06-30 20:45 | 11M | |
![[SND]](/icons/sound2.gif) | BR1.mp3 | 2022-07-12 02:59 | 11M | |
![[SND]](/icons/sound2.gif) | Virgoun - Surat Cinta Untuk Starla (Official Lyric Video).mp3 | 2022-07-12 15:32 | 11M | |
![[SND]](/icons/sound2.gif) | Waknos2.mp3 | 2022-06-28 00:57 | 11M | |
![[SND]](/icons/sound2.gif) | Eminem_-_Without_Me_47829431.mp3 | 2022-06-27 17:40 | 11M | |
![[SND]](/icons/sound2.gif) | yahanana.mp3 | 2022-06-29 05:02 | 11M | |
![[SND]](/icons/sound2.gif) | ريمكس_ردح_نور_الزين_محمد_السالم_اطك_كلبي_دي_جي_مايسترو.mp3 | 2022-07-14 16:23 | 11M | |
![[SND]](/icons/sound2.gif) | djalex14.mp3 | 2022-07-13 16:13 | 11M | |
![[SND]](/icons/sound2.gif) | 1chirumiru.mp3 | 2022-07-06 19:20 | 11M | |
![[SND]](/icons/sound2.gif) | zbida5.mp3 | 2022-07-08 02:21 | 11M | |
![[SND]](/icons/sound2.gif) | mad1.mp3 | 2022-07-04 18:53 | 11M | |
![[SND]](/icons/sound2.gif) | WLT.mp3 | 2022-07-05 18:15 | 11M | |
![[SND]](/icons/sound2.gif) | fatur7.mp3 | 2022-07-07 13:48 | 11M | |
![[SND]](/icons/sound2.gif) | oneinamillion.mp3 | 2022-06-29 05:01 | 11M | |
![[SND]](/icons/sound2.gif) | Kanye West - POWER (1).mp3 | 2022-07-09 19:06 | 11M | |
![[SND]](/icons/sound2.gif) | music (2).mp3 | 2022-06-30 18:09 | 11M | |
![[SND]](/icons/sound2.gif) | Би-2 - Полковнику никто не пишет.mp3 | 2022-07-05 06:30 | 11M | |
![[SND]](/icons/sound2.gif) | em.mp3 | 2022-07-15 10:27 | 11M | |
![[SND]](/icons/sound2.gif) | rusuhdong3.mp3 | 2022-07-06 00:17 | 11M | |
![[SND]](/icons/sound2.gif) | BAHAGIA.mp3 | 2022-07-06 14:15 | 11M | |
![[SND]](/icons/sound2.gif) | eros21.mp3 | 2022-07-05 15:39 | 11M | |
![[SND]](/icons/sound2.gif) | y2mate.com - spice_and_wolf_op_1_full_with_lyrics_W6q1AWnjNiU_320kbps.mp3 | 2022-07-09 11:23 | 11M | |
![[SND]](/icons/sound2.gif) | zrkidontlike.mp3 | 2022-06-29 07:49 | 11M | |
![[SND]](/icons/sound2.gif) | 05. Heimwärts.mp3 | 2022-07-06 16:55 | 11M | |
![[SND]](/icons/sound2.gif) | Kid Rock - I am the Bullgod.mp3 | 2022-07-04 01:07 | 11M | |
![[SND]](/icons/sound2.gif) | 28. Gregorian - Voyage,Voyage (DJ Da Vinci Remix).mp3 | 2022-07-15 19:43 | 11M | |
![[SND]](/icons/sound2.gif) | vedi33.mp3 | 2022-06-29 12:29 | 11M | |
![[SND]](/icons/sound2.gif) | Mascarpone - Golden Blood.mp3 | 2022-07-05 16:32 | 11M | |
![[SND]](/icons/sound2.gif) | Lutherrr1.mp3 | 2022-06-29 00:32 | 11M | |
![[SND]](/icons/sound2.gif) | Boli (Guns Up) (DJJOhAL.Com).mp3 | 2022-07-13 03:19 | 11M | |
![[SND]](/icons/sound2.gif) | 4 TAFSIR AL QURAN SURAH INFITAR - Abu Ali.mp3 | 2022-07-08 14:11 | 11M | |
![[SND]](/icons/sound2.gif) | Snoop_Dogg_50_Cent_-_PIMP_48195349.mp3 | 2022-07-01 05:47 | 11M | |
![[SND]](/icons/sound2.gif) | empi11.mp3 | 2022-07-17 13:50 | 11M | |
![[SND]](/icons/sound2.gif) | Frankie Ruiz (Mi Libertad) - (Salsa Boricua) (Salsa Clasica) (Salsa '70, '80, '90) (320 kbps).mp3 | 2022-07-20 04:34 | 11M | |
![[SND]](/icons/sound2.gif) | 2016 Alan Walker - Faded.mp3 | 2022-07-12 23:51 | 11M | |
![[SND]](/icons/sound2.gif) | Kisahkasihdisekolah.mp3 | 2022-07-04 01:18 | 11M | |
![[SND]](/icons/sound2.gif) | Bone.mp3 | 2022-07-08 02:09 | 11M | |
![[SND]](/icons/sound2.gif) | tecno.mp3 | 2022-07-15 11:14 | 11M | |
![[SND]](/icons/sound2.gif) | Piste 17.mp3 | 2022-07-05 12:50 | 11M | |
![[SND]](/icons/sound2.gif) | Jarak2013.mp3 | 2022-07-04 07:50 | 11M | |
![[SND]](/icons/sound2.gif) | kekasihhalal.mp3 | 2022-07-15 00:14 | 11M | |
![[SND]](/icons/sound2.gif) | DJ_KEKASIH_HALAL_(_DIA_GADIS_BERKRUDUNG_MERAH_)_BOOTLEG_VIRAL_TIKTOK_TERBARU_2022_!_RAKA_REMIXER(256k).mp3 | 2022-07-15 00:10 | 11M | |
![[SND]](/icons/sound2.gif) | WakChak20.mp3 | 2022-07-07 21:39 | 11M | |
![[SND]](/icons/sound2.gif) | rit90.mp3 | 2022-07-01 12:28 | 11M | |
![[SND]](/icons/sound2.gif) | Initial D - Running in The 90s.mp3 | 2022-07-01 12:27 | 11M | |
![[SND]](/icons/sound2.gif) | negara.mp3 | 2022-06-28 14:47 | 11M | |
![[SND]](/icons/sound2.gif) | jon4.mp3 | 2022-06-28 00:45 | 11M | |
![[SND]](/icons/sound2.gif) | escsoft.mp3 | 2022-07-05 04:14 | 11M | |
![[SND]](/icons/sound2.gif) | Pentakill feat. Jorn Lande - Edge of Night.mp3 | 2022-07-06 16:50 | 11M | |
![[SND]](/icons/sound2.gif) | Metal - The Kraken.mp3 | 2022-06-29 13:05 | 11M | |
![[SND]](/icons/sound2.gif) | YGL.mp3 | 2022-07-03 13:15 | 11M | |
![[SND]](/icons/sound2.gif) | Capone-N-Noreaga - L.A., L.A. (Feat. Mobb Deep & Tragedy Khadafi).mp3 | 2022-07-11 18:22 | 11M | |
![[SND]](/icons/sound2.gif) | hale.mp3 | 2022-06-27 16:26 | 11M | |
![[SND]](/icons/sound2.gif) | goodnight.mp3 | 2022-07-07 15:37 | 11M | |
![[SND]](/icons/sound2.gif) | Kino_-_Gruppa_krovi_47829944.mp3 | 2022-07-05 18:03 | 11M | |
![[SND]](/icons/sound2.gif) | ordinary.mp3 | 2022-07-01 22:49 | 11M | |
![[SND]](/icons/sound2.gif) | Jorge Ben jor alô alô w Brasil! (320 kbps).mp3 | 2022-07-16 03:29 | 11M | |
![[SND]](/icons/sound2.gif) | Gang0.mp3 | 2022-07-04 04:17 | 11M | |
![[SND]](/icons/sound2.gif) | DAFT_PUNK_-_ROBOT_ROCK_BASSBOOSTED_(iPlayer.fm).mp3 | 2022-07-10 15:43 | 11M | |
![[SND]](/icons/sound2.gif) | DJBABYSHARK.mp3 | 2022-07-07 21:06 | 11M | |
![[SND]](/icons/sound2.gif) | leo5.mp3 | 2022-07-01 17:30 | 11M | |
![[SND]](/icons/sound2.gif) | EdwardSad06.mp3 | 2022-07-12 08:56 | 11M | |
![[SND]](/icons/sound2.gif) | 05. Doost O Doshman - Martik.mp3 | 2022-06-28 13:52 | 11M | |
![[SND]](/icons/sound2.gif) | Jhon03.mp3 | 2022-07-05 00:06 | 11M | |
![[SND]](/icons/sound2.gif) | alawnix2.mp3 | 2022-07-17 13:48 | 11M | |
![[SND]](/icons/sound2.gif) | Rudh.mp3 | 2022-07-13 15:16 | 11M | |
![[SND]](/icons/sound2.gif) | rnr4.mp3 | 2022-07-02 01:14 | 11M | |
![[SND]](/icons/sound2.gif) | Falmengkane3.mp3 | 2022-07-03 18:37 | 11M | |
![[SND]](/icons/sound2.gif) | valle1.mp3 | 2022-07-02 20:45 | 11M | |
![[SND]](/icons/sound2.gif) | rhea5.mp3 | 2022-07-02 20:42 | 11M | |
![[SND]](/icons/sound2.gif) | It Feel So Good (Dread's acapella).mp3 | 2022-07-10 14:24 | 11M | |
![[SND]](/icons/sound2.gif) | DJSiko1.mp3 | 2022-07-16 08:40 | 11M | |
![[SND]](/icons/sound2.gif) | Sambomaster - Seishun Kyousoukyoku(MP3_320K).mp3 | 2022-07-11 12:24 | 11M | |
![[SND]](/icons/sound2.gif) | miracles.mp3 | 2022-06-29 05:01 | 11M | |
![[SND]](/icons/sound2.gif) | sempurna — andra and the backbone ( slowed _ tiktok version ). (320K).mp3 | 2022-06-30 00:49 | 11M | |
![[SND]](/icons/sound2.gif) | xwan7.mp3 | 2022-06-27 15:45 | 11M | |
![[SND]](/icons/sound2.gif) | perturbator-electric-dreams.mp3 | 2022-07-07 18:32 | 11M | |
![[SND]](/icons/sound2.gif) | lenka.mp3 | 2022-07-03 16:54 | 11M | |
![[SND]](/icons/sound2.gif) | zrkbread.mp3 | 2022-06-29 07:51 | 11M | |
![[SND]](/icons/sound2.gif) | Eminem_-_The_Real_Slim_Shady_47965346.mp3 | 2022-06-29 07:50 | 11M | |
![[SND]](/icons/sound2.gif) | [YT2mp3.info] - Bodyslam ft. 1Mill, Fiixd, Ben Bizzy, & Younggu - __คิดฮอด__ (7ZGT REMIX) (320kbps).mp3 | 2022-08-03 17:31 | 11M | |
![[SND]](/icons/sound2.gif) | Mr. Bond - Camps A Make em Lamps.mp3 | 2022-07-01 19:09 | 11M | |
![[SND]](/icons/sound2.gif) | Liam19.mp3 | 2022-07-31 14:13 | 11M | |
![[SND]](/icons/sound2.gif) | eisbrecher-this-is-deutsch-sitd-remix.mp3 | 2022-07-09 14:40 | 11M | |
![[SND]](/icons/sound2.gif) | SadAe3.mp3 | 2022-07-11 10:33 | 11M | |
![[SND]](/icons/sound2.gif) | SadAe.mp3 | 2022-07-11 10:20 | 11M | |
![[SND]](/icons/sound2.gif) | ugun8.mp3 | 2022-07-02 03:59 | 11M | |
![[VID]](/icons/movie.gif) | 2_5377776899768457427.mp4 | 2022-07-17 07:22 | 11M | |
![[SND]](/icons/sound2.gif) | Wakno11.mp3 | 2022-07-04 21:58 | 11M | |
![[SND]](/icons/sound2.gif) | mp3mohito-wmond-alors-on-phonk.mp3 | 2022-07-14 12:59 | 11M | |
![[SND]](/icons/sound2.gif) | vedi53.mp3 | 2022-06-29 12:13 | 11M | |
![[SND]](/icons/sound2.gif) | DjPapali.mp3 | 2022-07-14 10:08 | 11M | |
![[SND]](/icons/sound2.gif) | funkot3.mp3 | 2022-07-05 16:29 | 11M | |
![[SND]](/icons/sound2.gif) | DJ _ KANAN KIRI KANAN KIRI (1).mp3 | 2022-06-30 06:04 | 11M | |
![[SND]](/icons/sound2.gif) | Len2.mp3 | 2022-07-05 05:26 | 11M | |
![[SND]](/icons/sound2.gif) | DjKane6.mp3 | 2022-06-29 05:34 | 11M | |
![[SND]](/icons/sound2.gif) | 17. Bepakhizid - Dariush.mp3 | 2022-06-28 13:53 | 11M | |
![[SND]](/icons/sound2.gif) | Eminem - The Real Slim Shady.mp3 | 2022-07-14 12:52 | 11M | |
![[SND]](/icons/sound2.gif) | BadLiar.mp3 | 2022-07-06 15:54 | 11M | |
![[SND]](/icons/sound2.gif) | Максим - Отпускаю [Torn Remix].mp3 | 2022-07-01 20:36 | 11M | |
![[VID]](/icons/movie.gif) | Old Sharlayan Night Theme _The Nautilus Knoweth_ - FFXIV OST.mp4 | 2022-07-16 06:35 | 11M | |
![[SND]](/icons/sound2.gif) | akon.mp3 | 2022-07-07 12:47 | 11M | |
![[SND]](/icons/sound2.gif) | vedi70.mp3 | 2022-06-29 12:16 | 11M | |
![[SND]](/icons/sound2.gif) | aktor_2_-_Krasavica_48267053.mp3 | 2022-07-01 05:46 | 11M | |
![[SND]](/icons/sound2.gif) | bish100.mp3 | 2022-06-29 19:53 | 11M | |
![[SND]](/icons/sound2.gif) | 14. Soul Sanctum.mp3 | 2022-07-21 09:59 | 11M | |
![[SND]](/icons/sound2.gif) | Crystal_Castles_-_Vietnam_(getmp3.pro).mp3 | 2022-07-03 08:09 | 11M | |
![[SND]](/icons/sound2.gif) | glimps.mp3 | 2022-07-01 22:46 | 11M | |
![[SND]](/icons/sound2.gif) | nana10.mp3 | 2022-06-28 16:01 | 11M | |
![[SND]](/icons/sound2.gif) | sting-shape-of-my-heart-mp3.mp3 | 2022-07-09 12:04 | 11M | |
![[SND]](/icons/sound2.gif) | Witing Tresno.mp3 | 2022-07-20 14:53 | 11M | |
![[SND]](/icons/sound2.gif) | achmadsamp7.mp3 | 2022-07-16 16:12 | 11M | |
![[SND]](/icons/sound2.gif) | sunshine.mp3 | 2022-06-29 12:24 | 11M | |
![[SND]](/icons/sound2.gif) | msc3.mp3 | 2022-06-28 07:22 | 11M | |
![[SND]](/icons/sound2.gif) | leon9.mp3 | 2022-07-05 21:05 | 11M | |
![[SND]](/icons/sound2.gif) | OE9.mp3 | 2022-07-07 04:25 | 11M | |
![[SND]](/icons/sound2.gif) | KEI.mp3 | 2022-07-11 03:37 | 11M | |
![[SND]](/icons/sound2.gif) | Pergilahkasih.mp3 | 2022-07-04 01:27 | 11M | |
![[SND]](/icons/sound2.gif) | TOTTO14.mp3 | 2022-07-15 16:37 | 11M | |
![[SND]](/icons/sound2.gif) | Eiffel 65 Blue (Da Ba Dee).mp3 | 2022-07-10 12:57 | 11M | |
![[SND]](/icons/sound2.gif) | 22. Dr. Alban - It's My Life (TARANTINO ReFresh).mp3 | 2022-07-15 19:43 | 11M | |
![[SND]](/icons/sound2.gif) | INPUT (DJ Cannabis Coffeeshops Deutschland).mp3 | 2022-07-13 15:04 | 11M | |
![[SND]](/icons/sound2.gif) | 1bamandi.mp3 | 2022-07-13 17:36 | 11M | |
![[SND]](/icons/sound2.gif) | vedi67.mp3 | 2022-06-29 12:16 | 11M | |
![[SND]](/icons/sound2.gif) | nsfw gf audio.mp3 | 2022-07-07 01:57 | 11M | |
![[SND]](/icons/sound2.gif) | YUrijj_SHatunov_-_A_leto_cveta_50996004.mp3 | 2022-07-02 11:08 | 11M | |
![[SND]](/icons/sound2.gif) | Peluk Cium.mp3 | 2022-07-05 03:47 | 11M | |
![[SND]](/icons/sound2.gif) | Dj Santuy.mp3 | 2022-07-08 12:06 | 11M | |
![[SND]](/icons/sound2.gif) | Skriptonit_-_Polozhenie_(musmore.com).mp3 | 2022-06-30 16:49 | 11M | |
![[SND]](/icons/sound2.gif) | Mai.mp3 | 2022-07-08 10:40 | 11M | |
![[SND]](/icons/sound2.gif) | popok.mp3 | 2022-07-05 16:48 | 11M | |
![[SND]](/icons/sound2.gif) | ♠『sʜʀᴋ』•ᴮᴬᴰʙᴏʏツ♠ - Группа Крови (remix).mp3 | 2022-07-05 19:24 | 11M | |
![[SND]](/icons/sound2.gif) | Janet Jackson - We Go Deep.mp3 | 2022-07-04 00:58 | 11M | |
![[SND]](/icons/sound2.gif) | TOTTO69.mp3 | 2022-07-15 16:31 | 11M | |
![[SND]](/icons/sound2.gif) | WakChak23.mp3 | 2022-07-07 21:42 | 11M | |
![[SND]](/icons/sound2.gif) | 陈亦洺, 喧笑lirz, 镜予歌 - 晚夜微雨问海棠.mp3 | 2022-07-12 06:14 | 11M | |
![[VID]](/icons/movie.gif) | Sajan Mere Satrangiya Song Video Ft. Priyanka Chopra Jonas - Ek Dana _ Daler Mehndi _ Punjabi Hits (1).mp4 | 2022-07-10 03:51 | 11M | |
![[SND]](/icons/sound2.gif) | monyet3.mp3 | 2022-07-02 13:34 | 11M | |
![[SND]](/icons/sound2.gif) | D.K1.mp3 | 2022-07-12 13:37 | 11M | |
![[SND]](/icons/sound2.gif) | RUS.mp3 | 2022-07-08 23:18 | 11M | |
![[SND]](/icons/sound2.gif) | dom120.mp3 | 2022-07-03 06:54 | 11M | |
![[SND]](/icons/sound2.gif) | OxxxymironPrizNak.mp3 | 2022-07-09 10:33 | 11M | |
![[SND]](/icons/sound2.gif) | Badda Boo - Важна лишь степень искренности.mp3 | 2022-06-28 19:41 | 11M | |
![[SND]](/icons/sound2.gif) | 07. Doctor! Doctor!.mp3 | 2022-07-04 00:39 | 11M | |
![[SND]](/icons/sound2.gif) | dsc2.mp3 | 2022-07-19 18:46 | 11M | |
![[SND]](/icons/sound2.gif) | mobi42.mp3 | 2022-07-01 02:18 | 11M | |
![[SND]](/icons/sound2.gif) | Grazhdanskaya_oborona_-_Solnce_vzojjdjot_(musmore.com).mp3 | 2022-07-04 12:04 | 11M | |
![[SND]](/icons/sound2.gif) | Гепарда - Мы бежим с тобой как будто от Гепарда.mp3 | 2022-07-09 11:42 | 11M | |
![[SND]](/icons/sound2.gif) | Rico Blanco - Yugto.mp3 | 2022-07-09 10:07 | 11M | |
![[SND]](/icons/sound2.gif) | P R Â D A - Angetenar.mp3 | 2022-07-16 17:04 | 11M | |
![[SND]](/icons/sound2.gif) | siouxsie-sioux-brian-reitzell-love-crime.mp3 | 2022-06-30 22:34 | 11M | |
![[SND]](/icons/sound2.gif) | DJJ12.mp3 | 2022-07-02 09:55 | 11M | |
![[SND]](/icons/sound2.gif) | leo7.mp3 | 2022-07-01 17:44 | 11M | |
![[SND]](/icons/sound2.gif) | ugun3.mp3 | 2022-07-02 10:43 | 11M | |
![[SND]](/icons/sound2.gif) | kompeng.mp3 | 2022-06-29 21:35 | 11M | |
![[SND]](/icons/sound2.gif) | JONROETULOGNA.mp3 | 2022-06-28 16:30 | 11M | |
![[SND]](/icons/sound2.gif) | Цой x TUPOERYLO-Группа крови -Phonk Remix--kissvk.com.mp3 | 2022-07-04 16:50 | 11M | |
![[SND]](/icons/sound2.gif) | xwan8.mp3 | 2022-06-27 15:45 | 11M | |
![[SND]](/icons/sound2.gif) | DJHOHOU.mp3 | 2022-07-14 10:39 | 11M | |
![[SND]](/icons/sound2.gif) | boombox3.mp3 | 2022-06-28 11:21 | 11M | |
![[SND]](/icons/sound2.gif) | Slot_Krugi_na_vode.mp3 | 2022-07-01 09:36 | 11M | |
![[SND]](/icons/sound2.gif) | st12.mp3 | 2022-07-24 01:56 | 11M | |
![[SND]](/icons/sound2.gif) | 2Pac - Old School (mp3store.cc).mp3 | 2022-07-02 00:37 | 11M | |
![[SND]](/icons/sound2.gif) | เพลงแดนซ์สากลมันส์ๆ เบสแน่นๆ 2020 (Mini Nonstop Mix) Vol.13 - ( Dj.MingReMix ) (1).mp3 | 2022-07-03 23:46 | 11M | |
![[SND]](/icons/sound2.gif) | YoU.mp3 | 2022-07-15 02:32 | 11M | |
![[SND]](/icons/sound2.gif) | NGAPHESHEYA.mp3 | 2022-07-14 00:56 | 11M | |
![[SND]](/icons/sound2.gif) | Sati Akura & Karol Suchecki - It's Not Like I Like You.mp3 | 2022-07-10 13:35 | 11M | |
![[SND]](/icons/sound2.gif) | 3107.mp3 | 2022-07-08 15:38 | 11M | |
![[SND]](/icons/sound2.gif) | LokiSei.mp3 | 2022-07-01 12:26 | 11M | |
![[SND]](/icons/sound2.gif) | cc10.mp3 | 2022-06-29 23:59 | 11M | |
![[SND]](/icons/sound2.gif) | Макс Корж - Балконы.mp3 | 2022-07-12 04:44 | 11M | |
![[SND]](/icons/sound2.gif) | Love Tonight + Paraclisul Maicii Domnului.mp3 | 2022-07-14 00:37 | 11M | |
![[SND]](/icons/sound2.gif) | eric.mp3 | 2022-06-27 16:41 | 11M | |
![[SND]](/icons/sound2.gif) | Rammstein_-_RADIO_63782865.mp3 | 2022-06-30 13:10 | 11M | |
![[SND]](/icons/sound2.gif) | ookan19.mp3 | 2022-07-09 05:42 | 11M | |
![[SND]](/icons/sound2.gif) | 13. Heimwärts.mp3 | 2022-07-07 10:42 | 11M | |
![[SND]](/icons/sound2.gif) | dungdat1.mp3 | 2022-07-13 14:41 | 11M | |
![[SND]](/icons/sound2.gif) | sephirothrain.mp3 | 2022-06-27 16:11 | 11M | |
![[SND]](/icons/sound2.gif) | dom117.mp3 | 2022-07-03 06:24 | 11M | |
![[SND]](/icons/sound2.gif) | Gang1.mp3 | 2022-07-04 04:17 | 11M | |
![[SND]](/icons/sound2.gif) | Eisbrecher - Noch zu retten.mp3 | 2022-07-11 14:42 | 11M | |
![[SND]](/icons/sound2.gif) | Xix.mp3 | 2022-06-29 09:16 | 11M | |
![[SND]](/icons/sound2.gif) | dkl15.mp3 | 2022-07-15 02:31 | 11M | |
![[SND]](/icons/sound2.gif) | Miyagi_Rem_Digga_-_I_Got_Love_47828425.mp3 | 2022-06-27 17:36 | 11M | |
![[VID]](/icons/movie.gif) | y2mate.com - DJ PELUK CIUM PELUK CIUM BOLAK BALIK VIRAL TIKTOK JEDAG JEDUG TERBARU_v720P.mp4 | 2022-07-06 01:30 | 11M | |
![[SND]](/icons/sound2.gif) | 08. Tora! Tora! Tora!.mp3 | 2022-07-16 10:30 | 11M | |
![[SND]](/icons/sound2.gif) | sabunmandi.mp3 | 2022-06-29 12:39 | 11M | |
![[SND]](/icons/sound2.gif) | fadli.mp3 | 2022-07-01 04:28 | 11M | |
![[SND]](/icons/sound2.gif) | 02. Ballade Für Deutschland.mp3 | 2022-07-06 16:54 | 11M | |
![[SND]](/icons/sound2.gif) | НиКаКаКуя Пророк Санбой.mp3 | 2022-07-14 20:24 | 11M | |
![[SND]](/icons/sound2.gif) | zrkhajatan.mp3 | 2022-06-29 07:45 | 11M | |
![[SND]](/icons/sound2.gif) | Sektor_Gaza_-_YAva_(musmore.com).mp3 | 2022-06-29 08:47 | 11M | |
![[SND]](/icons/sound2.gif) | hfz7.mp3 | 2022-07-03 12:13 | 11M | |
![[SND]](/icons/sound2.gif) | HA4.mp3 | 2022-07-13 07:46 | 11M | |
![[SND]](/icons/sound2.gif) | 1Lang.mp3 | 2022-07-01 09:25 | 11M | |
![[SND]](/icons/sound2.gif) | miyagi-jendshpil-feat.-amigo-be-my-sky.mp3 | 2022-07-03 20:40 | 11M | |
![[SND]](/icons/sound2.gif) | Bitam.mp3 | 2022-07-03 21:04 | 11M | |
![[SND]](/icons/sound2.gif) | LightSkies.mp3 | 2022-07-15 16:26 | 11M | |
![[SND]](/icons/sound2.gif) | Wakno1.mp3 | 2022-07-04 15:17 | 11M | |
![[SND]](/icons/sound2.gif) | Lana_Del_Rey_-_Love_(musmore.com).mp3 | 2022-07-06 18:04 | 11M | |
![[SND]](/icons/sound2.gif) | IsaLang155.mp3 | 2022-07-01 02:31 | 11M | |
![[SND]](/icons/sound2.gif) | Dudung23.mp3 | 2022-07-09 09:24 | 11M | |
![[SND]](/icons/sound2.gif) | skriptonit-tancujj-sama.mp3 | 2022-06-28 17:02 | 11M | |
![[SND]](/icons/sound2.gif) | djalex5.mp3 | 2022-07-03 10:47 | 11M | |
![[SND]](/icons/sound2.gif) | NDX2.mp3 | 2022-07-12 09:59 | 11M | |
![[SND]](/icons/sound2.gif) | hanz6.mp3 | 2022-07-06 11:32 | 11M | |
![[SND]](/icons/sound2.gif) | ngab8.mp3 | 2022-07-15 11:16 | 11M | |
![[SND]](/icons/sound2.gif) | Feder feat. Alex Aiono - Lordly (feat. Alex Aiono) (MDZN Remix) (MDZN Remix).mp3 | 2022-07-12 23:51 | 11M | |
![[SND]](/icons/sound2.gif) | moira.mp3 | 2022-06-27 15:47 | 11M | |
![[SND]](/icons/sound2.gif) | Rammstein - Radio.mp3 | 2022-07-06 09:03 | 11M | |
![[SND]](/icons/sound2.gif) | miyagi-amp-jendshpil-feat.-rem-digga-i-got-love.mp3 | 2022-07-09 18:19 | 11M | |
![[SND]](/icons/sound2.gif) | ace67.mp3 | 2022-07-05 07:46 | 11M | |
![[SND]](/icons/sound2.gif) | тихо.mp3 | 2022-07-14 09:47 | 11M | |
![[SND]](/icons/sound2.gif) | Pentakill feat. Jorn Lande, Noora Louhimo, Jose Atlan Aranda - Gathering Storm.mp3 | 2022-07-06 18:36 | 11M | |
![[SND]](/icons/sound2.gif) | xen2.mp3 | 2022-06-29 11:48 | 11M | |
![[SND]](/icons/sound2.gif) | zrkdjmbon.mp3 | 2022-06-29 07:50 | 11M | |
![[SND]](/icons/sound2.gif) | Has.mp3 | 2022-07-08 10:40 | 11M | |
![[SND]](/icons/sound2.gif) | wk3.mp3 | 2022-06-29 23:13 | 11M | |
![[SND]](/icons/sound2.gif) | damasgratis.mp3 | 2022-07-15 06:52 | 11M | |
![[SND]](/icons/sound2.gif) | DuenosPabellonDamasGratis.mp3 | 2022-07-15 21:36 | 11M | |
![[SND]](/icons/sound2.gif) | Damas Gratis - Los dueños del pabellon │ Video Lyric 2020.mp3 | 2022-07-15 06:50 | 11M | |
![[SND]](/icons/sound2.gif) | DjGlimpse.mp3 | 2022-07-01 05:18 | 11M | |
![[SND]](/icons/sound2.gif) | anto9.mp3 | 2022-07-12 07:02 | 11M | |
![[SND]](/icons/sound2.gif) | raply1.mp3 | 2022-07-08 15:15 | 11M | |
![[SND]](/icons/sound2.gif) | BRUTTO_-_Voiny_sveta_(musmore.com).mp3 | 2022-06-27 14:58 | 11M | |
![[SND]](/icons/sound2.gif) | Miyagi__Endshpil_feat._Rem_Digga_I_Got_Love.mp3 | 2022-07-15 20:17 | 11M | |
![[SND]](/icons/sound2.gif) | tiesto_seavolution.mp3 | 2022-07-02 10:06 | 11M | |
![[SND]](/icons/sound2.gif) | ache.mp3 | 2022-07-14 17:18 | 11M | |
![[SND]](/icons/sound2.gif) | DJ_BAD_LIAR.mp3 | 2022-07-13 18:50 | 11M | |
![[SND]](/icons/sound2.gif) | HA3.mp3 | 2022-07-13 07:46 | 11M | |
![[SND]](/icons/sound2.gif) | djalex12.mp3 | 2022-07-09 19:16 | 11M | |
![[SND]](/icons/sound2.gif) | Disturbed_-_Stupify_47829312.mp3 | 2022-07-12 19:27 | 11M | |
![[SND]](/icons/sound2.gif) | 7月9日 爱的委身2-2.mp3 | 2022-07-12 06:33 | 11M | |
![[VID]](/icons/movie.gif) | love countdown nayeon twice.mp4 | 2022-06-30 05:49 | 11M | |
![[SND]](/icons/sound2.gif) | 05 my tears ricochet.mp3 | 2022-07-08 22:50 | 11M | |
![[SND]](/icons/sound2.gif) | FEDUK_x_MSB4x4_-_Rashin_huligan_(Dydki.info).mp3 | 2022-06-30 23:48 | 11M | |
![[SND]](/icons/sound2.gif) | Asw1.mp3 | 2022-07-15 08:30 | 11M | |
![[SND]](/icons/sound2.gif) | LSP_PHARAOH_-_Pornozvezda_(musmore.com).mp3 | 2022-07-04 22:20 | 11M | |
![[SND]](/icons/sound2.gif) | aisyah.mp3 | 2022-07-10 11:06 | 11M | |
![[SND]](/icons/sound2.gif) | Jokting.mp3 | 2022-07-11 21:45 | 11M | |
![[SND]](/icons/sound2.gif) | Jhon10.mp3 | 2022-07-15 01:51 | 11M | |
![[SND]](/icons/sound2.gif) | Andre9.mp3 | 2022-07-04 14:06 | 11M | |
![[SND]](/icons/sound2.gif) | mad5.mp3 | 2022-07-04 18:53 | 11M | |
![[SND]](/icons/sound2.gif) | Kinestetika - The Ocean of Love.mp3 | 2022-07-11 10:11 | 11M | |
![[SND]](/icons/sound2.gif) | bugoy6.mp3 | 2022-06-28 06:36 | 11M | |
![[SND]](/icons/sound2.gif) | Qimzy7.mp3 | 2022-06-28 13:14 | 11M | |
![[SND]](/icons/sound2.gif) | duocvl.mp3 | 2022-07-12 16:10 | 11M | |
![[SND]](/icons/sound2.gif) | Titanic1.mp3 | 2022-07-04 01:33 | 11M | |
![[SND]](/icons/sound2.gif) | doob.mp3 | 2022-07-14 12:40 | 11M | |
![[SND]](/icons/sound2.gif) | dom93.mp3 | 2022-07-03 06:31 | 11M | |
![[SND]](/icons/sound2.gif) | 星野源+–+喜劇+Official+Video.mp3 | 2022-06-28 03:06 | 11M | |
![[SND]](/icons/sound2.gif) | শরতের শেষ থেকে (বিশাল কবির).mp3 | 2022-07-06 08:47 | 10M | |
![[SND]](/icons/sound2.gif) | kaalan5.mp3 | 2022-07-09 19:10 | 10M | |
![[SND]](/icons/sound2.gif) | SlipknotPshyco.mp3 | 2022-06-29 04:23 | 10M | |
![[SND]](/icons/sound2.gif) | Едем - едем в соседнее село.mp3 | 2022-07-08 19:23 | 10M | |
![[SND]](/icons/sound2.gif) | bumpin.mp3 | 2022-07-15 14:06 | 10M | |
![[SND]](/icons/sound2.gif) | mobi30.mp3 | 2022-06-30 04:58 | 10M | |
![[SND]](/icons/sound2.gif) | Malamini.mp3 | 2022-07-04 01:18 | 10M | |
![[SND]](/icons/sound2.gif) | [YT2mp3.info] - MANTAN - Fresly Nikijuluw (Official Music Video) (320kbps).mp3 | 2022-07-05 16:51 | 10M | |
![[SND]](/icons/sound2.gif) | The Akathist hymn.mp3 | 2022-07-07 21:16 | 10M | |
![[SND]](/icons/sound2.gif) | Nezhnaya.mp3 | 2022-06-29 08:27 | 10M | |
![[SND]](/icons/sound2.gif) | zrkdjthenight.mp3 | 2022-06-29 07:43 | 10M | |
![[SND]](/icons/sound2.gif) | WakChak13.mp3 | 2022-07-07 21:36 | 10M | |
![[SND]](/icons/sound2.gif) | pluto.mp3 | 2022-07-06 15:06 | 10M | |
![[VID]](/icons/movie.gif) | X2Download.com-PRINCEFIEND - _เพียงคุณเปิด โลกก็เปลี่ยน_ Feat. YZFLOW x M3-5 【Official Audio Lyrics】-(720p).mp4 | 2022-07-07 03:37 | 10M | |
![[SND]](/icons/sound2.gif) | PSY.mp3 | 2022-07-06 08:02 | 10M | |
![[SND]](/icons/sound2.gif) | Dask.mp3 | 2022-07-08 02:43 | 10M | |
![[SND]](/icons/sound2.gif) | bl fetra instrumental.mp3 | 2022-07-06 22:36 | 10M | |
![[SND]](/icons/sound2.gif) | bel fetra.mp3 | 2022-07-06 22:35 | 10M | |
![[SND]](/icons/sound2.gif) | Djleon8.mp3 | 2022-07-14 10:05 | 10M | |
![[SND]](/icons/sound2.gif) | viktor_korolev_-_murka_(z2.fm).mp3 | 2022-07-05 20:19 | 10M | |
![[SND]](/icons/sound2.gif) | zbida7.mp3 | 2022-07-08 11:25 | 10M | |
![[SND]](/icons/sound2.gif) | Kid_Rock_-_Devil_Without_A_Cause_(getmp3.pro).mp3 | 2022-07-04 00:34 | 10M | |
![[SND]](/icons/sound2.gif) | kerudung merah.mp3 | 2022-07-04 20:42 | 10M | |
![[SND]](/icons/sound2.gif) | 𝟙_𝔼𝕊𝔸𝔼𝕍 - ♣.mp3 | 2022-07-06 16:26 | 10M | |
![[SND]](/icons/sound2.gif) | соска.mp3 | 2022-07-06 16:33 | 10M | |
![[SND]](/icons/sound2.gif) | X2Download.com - #กำลังฮิตใน TikTok Salting - Mai Serak Remix แดนซ์เทคโนโจ้ะๆ [ ดีเจตังส์ รีมิกซ์ ♪ ] (320 kbps).mp3 | 2022-07-14 06:15 | 10M | |
![[SND]](/icons/sound2.gif) | Suratcintauntukstarla.mp3 | 2022-07-04 01:31 | 10M | |
![[SND]](/icons/sound2.gif) | apa kabar sayang.mp3 | 2022-07-05 22:06 | 10M | |
![[SND]](/icons/sound2.gif) | apakabar.mp3 | 2022-07-05 22:59 | 10M | |
![[SND]](/icons/sound2.gif) | Armada - Apa Kabar Sayang (lirik).mp3 | 2022-07-05 09:15 | 10M | |
![[SND]](/icons/sound2.gif) | Once - Karena Ku Cinta Kau.mp3 | 2022-07-04 18:51 | 10M | |
![[SND]](/icons/sound2.gif) | ELW.mp3 | 2022-07-05 03:44 | 10M | |
![[SND]](/icons/sound2.gif) | BD1.mp3 | 2022-07-11 07:17 | 10M | |
![[SND]](/icons/sound2.gif) | Black Star Mafia - В щепки.mp3 | 2022-07-08 04:10 | 10M | |
![[SND]](/icons/sound2.gif) | TOTTO46.mp3 | 2022-07-15 16:32 | 10M | |
![[SND]](/icons/sound2.gif) | Dimension&SharleneHector-Saviour(ExtendedMix).mp3 | 2022-08-05 20:14 | 10M | |
![[SND]](/icons/sound2.gif) | zrkacaaca.mp3 | 2022-06-29 07:44 | 10M | |
![[SND]](/icons/sound2.gif) | Stereo.mp3 | 2022-07-01 11:54 | 10M | |
![[SND]](/icons/sound2.gif) | Vinn.mp3 | 2022-07-18 05:50 | 10M | |
![[SND]](/icons/sound2.gif) | Kiss_-_I_Was_Made_For_Lovin_You_47872611.mp3 | 2022-06-28 15:27 | 10M | |
![[SND]](/icons/sound2.gif) | nwa4.mp3 | 2022-07-16 01:50 | 10M | |
![[VID]](/icons/movie.gif) | mao zedong propaganda music Red Sun in the Sky.mp4 | 2022-07-06 21:30 | 10M | |
![[SND]](/icons/sound2.gif) | jomar3.mp3 | 2022-07-10 12:06 | 10M | |
![[SND]](/icons/sound2.gif) | Мельница - Невеста Полоза.mp3 | 2022-07-31 19:08 | 10M | |
![[SND]](/icons/sound2.gif) | travis-scott-sicko-mode-ft-drake.mp3 | 2022-07-11 20:02 | 10M | |
![[SND]](/icons/sound2.gif) | ᅠ - старая.mp3 | 2022-07-06 16:33 | 10M | |
![[SND]](/icons/sound2.gif) | Travis_Scott_-_SICKO_MODE_ft_Drake_(getmp3.pro).mp3 | 2022-07-05 06:57 | 10M | |
![[SND]](/icons/sound2.gif) | Grigorijj_Leps_-_Samyjj_luchshijj_den_48213703.mp3 | 2022-06-29 21:00 | 10M | |
![[SND]](/icons/sound2.gif) | ɢᴀᴅᴊɪᴇᴠ ོ - на исполнениях.mp3 | 2022-07-06 16:33 | 10M | |
![[SND]](/icons/sound2.gif) | ugun9.mp3 | 2022-07-02 03:59 | 10M | |
![[SND]](/icons/sound2.gif) | bugoy7.mp3 | 2022-06-28 06:36 | 10M | |
![[SND]](/icons/sound2.gif) | TOTTO40.mp3 | 2022-07-15 16:32 | 10M | |
![[SND]](/icons/sound2.gif) | Habang Buhay.mp3 | 2022-07-05 00:14 | 10M | |
![[SND]](/icons/sound2.gif) | mix8.mp3 | 2022-07-01 23:52 | 10M | |
![[SND]](/icons/sound2.gif) | Still D.R.E.mp3 | 2022-07-01 06:42 | 10M | |
![[SND]](/icons/sound2.gif) | Poly1.mp3 | 2022-07-30 09:07 | 10M | |
![[SND]](/icons/sound2.gif) | snte2.mp3 | 2022-06-28 16:09 | 10M | |
![[SND]](/icons/sound2.gif) | Rhey26.mp3 | 2022-06-28 12:03 | 10M | |
![[SND]](/icons/sound2.gif) | WakChak4.mp3 | 2022-07-07 21:32 | 10M | |
![[SND]](/icons/sound2.gif) | Safar.mp3 | 2022-07-08 10:40 | 10M | |
![[SND]](/icons/sound2.gif) | 08. You Take Me Up.mp3 | 2022-07-04 00:39 | 10M | |
![[SND]](/icons/sound2.gif) | Rhey28.mp3 | 2022-06-28 12:03 | 10M | |
![[SND]](/icons/sound2.gif) | zrkadauntukmu.mp3 | 2022-06-29 07:42 | 10M | |
![[SND]](/icons/sound2.gif) | dr.-dre-feat.-snoop-dogg-still-d.r.e..mp3 | 2022-07-11 22:47 | 10M | |
![[SND]](/icons/sound2.gif) | Ludacris-Act A Fool-kissvk.com.mp3 | 2022-07-14 10:19 | 10M | |
![[SND]](/icons/sound2.gif) | Rock Privet - Выдыхай (Cover Noize MC _ Linkin Park).mp3 | 2022-07-15 08:03 | 10M | |
![[SND]](/icons/sound2.gif) | djalex13.mp3 | 2022-07-09 19:17 | 10M | |
![[SND]](/icons/sound2.gif) | jms6.mp3 | 2022-07-07 16:16 | 10M | |
![[SND]](/icons/sound2.gif) | SnoopDog.mp3 | 2022-07-10 13:36 | 10M | |
![[SND]](/icons/sound2.gif) | Dr. Dre feat. Snoop Dogg - Still D.R.E..mp3 | 2022-06-30 08:46 | 10M | |
![[SND]](/icons/sound2.gif) | Dr. Dre feat. Snoop Dogg - Still D.R.E. (1).mp3 | 2022-07-12 04:30 | 10M | |
![[SND]](/icons/sound2.gif) | mary-j-blige-family-affair.mp3 | 2022-06-30 16:31 | 10M | |
![[SND]](/icons/sound2.gif) | monyet4.mp3 | 2022-07-02 13:34 | 10M | |
![[SND]](/icons/sound2.gif) | D.K2.mp3 | 2022-07-12 13:37 | 10M | |
![[SND]](/icons/sound2.gif) | O re piya [Slowed+Reverb] [Lofi song] Lo-fi sounds 88.mp3 | 2022-07-06 07:53 | 10M | |
![[SND]](/icons/sound2.gif) | Dihpargoy1.mp3 | 2022-08-03 11:12 | 10M | |
![[SND]](/icons/sound2.gif) | Tujamo-Drop That Low -When I Dip--kissvk.com.mp3 | 2022-06-30 21:57 | 10M | |
![[SND]](/icons/sound2.gif) | 1982-09-XX_ 1st day at WNBC in New York .mp3 | 2022-07-05 06:40 | 10M | |
![[SND]](/icons/sound2.gif) | I will be here for you w_ lyrics - Michael Smith ft. Diane Warren (320 kbps).mp3 | 2022-07-13 11:32 | 10M | |
![[SND]](/icons/sound2.gif) | zali7.mp3 | 2022-07-16 04:15 | 10M | |
![[SND]](/icons/sound2.gif) | nonstop heartbreaking tagalog love songs.mp3 | 2022-07-13 07:13 | 10M | |
![[SND]](/icons/sound2.gif) | Cedric6.mp3 | 2022-07-13 07:22 | 10M | |
![[SND]](/icons/sound2.gif) | MengkaneGasi3.mp3 | 2022-06-30 00:09 | 10M | |
![[SND]](/icons/sound2.gif) | Сектор Газа - Ночь перед Рождеством.mp3 | 2022-07-06 17:56 | 10M | |
![[SND]](/icons/sound2.gif) | Snoop_Dogg_Dr_Dre_-_Still_DRE_47964903.mp3 | 2022-07-08 15:59 | 10M | |
![[SND]](/icons/sound2.gif) | Mascarpone - I Can't See It.mp3 | 2022-07-05 16:32 | 10M | |
![[SND]](/icons/sound2.gif) | gio1.mp3 | 2022-07-01 06:11 | 10M | |
![[SND]](/icons/sound2.gif) | war-soundtrack.mp3 | 2022-06-28 12:51 | 10M | |
![[SND]](/icons/sound2.gif) | nana15.mp3 | 2022-08-02 15:23 | 10M | |
![[SND]](/icons/sound2.gif) | helen18.mp3 | 2022-07-31 08:19 | 10M | |
![[SND]](/icons/sound2.gif) | sky11.mp3 | 2022-07-31 21:28 | 10M | |
![[SND]](/icons/sound2.gif) | byahe.mp3 | 2022-06-28 05:14 | 10M | |
![[SND]](/icons/sound2.gif) | Eminem - Venom (Music From The Motion Picture) (Music From The Motion Picture).mp3 | 2022-07-10 10:48 | 10M | |
![[SND]](/icons/sound2.gif) | Boney M. - Rasputin (Sopot Festival 1979) (VOD) (320 kbps).mp3 | 2022-06-30 10:30 | 10M | |
![[SND]](/icons/sound2.gif) | Taguan.mp3 | 2022-07-04 22:30 | 10M | |
![[SND]](/icons/sound2.gif) | KINO_-_Pachka_sigaret_(musmore.com).mp3 | 2022-06-29 08:37 | 10M | |
![[SND]](/icons/sound2.gif) | Angindalu.mp3 | 2022-06-27 23:34 | 10M | |
![[SND]](/icons/sound2.gif) | dvbbs.mp3 | 2022-07-15 14:10 | 10M | |
![[SND]](/icons/sound2.gif) | 2021.11.17_LiSA_-_Akeboshi_-Instrumental-_Akeboshi_Shirogane_(BiffHard.click).mp3 | 2022-08-08 18:59 | 10M | |
![[SND]](/icons/sound2.gif) | gio4.mp3 | 2022-07-01 06:39 | 10M | |
![[SND]](/icons/sound2.gif) | Кино - Пачка сигарет.mp3 | 2022-07-10 13:05 | 10M | |
![[SND]](/icons/sound2.gif) | Janet Jackson - That's The Way Love Goes.mp3 | 2022-07-04 00:58 | 10M | |
![[VID]](/icons/movie.gif) | y2mate.com - Dj peluk cium peluk cium bolak balik dj tiktok terbaru 2022 peluk cium peluk cium_v240P.mp4 | 2022-07-09 05:20 | 10M | |
![[SND]](/icons/sound2.gif) | themurder.mp3 | 2022-07-09 10:18 | 10M | |
![[SND]](/icons/sound2.gif) | kutukan.mp3 | 2022-07-25 10:59 | 10M | |
![[SND]](/icons/sound2.gif) | MengkaneGasi7.mp3 | 2022-06-30 00:13 | 10M | |
![[SND]](/icons/sound2.gif) | Slipknot_-_Dead_Memories_(musmore.com).mp3 | 2022-06-27 14:25 | 10M | |
![[SND]](/icons/sound2.gif) | rs16.mp3 | 2022-07-15 21:48 | 10M | |
![[SND]](/icons/sound2.gif) | SANTAI 1.mp3 | 2022-07-10 09:16 | 10M | |
![[SND]](/icons/sound2.gif) | fatur.mp3 | 2022-07-04 18:53 | 10M | |
![[SND]](/icons/sound2.gif) | Res.mp3 | 2022-07-04 20:32 | 10M | |
![[SND]](/icons/sound2.gif) | vedi59.mp3 | 2022-06-29 12:14 | 10M | |
![[SND]](/icons/sound2.gif) | rs6.mp3 | 2022-07-15 21:48 | 10M | |
![[SND]](/icons/sound2.gif) | Eminem - My Name Is.mp3 | 2022-07-04 21:29 | 10M | |
![[SND]](/icons/sound2.gif) | Elephant Kind - Oh Well (Prontaxan Exclusive Funky Kota Remix).mp3 | 2022-07-04 09:45 | 10M | |
![[SND]](/icons/sound2.gif) | Æther Realm - Death.mp3 | 2022-08-01 11:12 | 10M | |
![[SND]](/icons/sound2.gif) | 18. Bezan Baran - Habib.mp3 | 2022-06-28 13:53 | 10M | |
![[SND]](/icons/sound2.gif) | Kid Rock - Bawitdaba.mp3 | 2022-07-04 01:00 | 10M | |
![[SND]](/icons/sound2.gif) | Oxxxymiron_-_Gde_nas_net_47828363.mp3 | 2022-08-05 18:13 | 10M | |
![[SND]](/icons/sound2.gif) | acez.mp3 | 2022-07-05 05:14 | 10M | |
![[SND]](/icons/sound2.gif) | Fergie.mp3 | 2022-06-29 04:11 | 10M | |
![[SND]](/icons/sound2.gif) | ebanko-chernaya-pizda(mp3bit.cc).mp3 | 2022-07-11 09:08 | 10M | |
![[SND]](/icons/sound2.gif) | mud.mp3 | 2022-07-14 09:50 | 10M | |
![[SND]](/icons/sound2.gif) | dsc4.mp3 | 2022-07-20 11:08 | 10M | |
![[SND]](/icons/sound2.gif) | tulus13.mp3 | 2022-06-28 17:36 | 10M | |
![[SND]](/icons/sound2.gif) | Miyagi .mp3 | 2022-07-12 01:49 | 10M | |
![[SND]](/icons/sound2.gif) | MiyaGi & Эндшпиль feat. 9 Грамм - Рапапам ... [prod. StonHeng] [HAJIME].mp3 | 2022-07-11 20:12 | 10M | |
![[SND]](/icons/sound2.gif) | 20a.mp3 | 2022-07-05 22:24 | 10M | |
![[SND]](/icons/sound2.gif) | 5.19 Warmth Is Gone.mp3 | 2022-07-07 07:00 | 10M | |
![[SND]](/icons/sound2.gif) | Makins1.mp3 | 2022-06-29 14:46 | 10M | |
![[SND]](/icons/sound2.gif) | litvinenko_-_lyubit_huligana_(feat._archi)_muzati.net.mp3 | 2022-06-30 20:29 | 10M | |
![[SND]](/icons/sound2.gif) | Ferdi Yücel - Bulgarian.mp3 | 2022-07-10 10:48 | 10M | |
![[SND]](/icons/sound2.gif) | ace62.mp3 | 2022-07-05 07:42 | 10M | |
![[SND]](/icons/sound2.gif) | 50 Cent x Скриптонит x Andy Panda - Привычка (Kerim Remix)(MP3_320K).mp3 | 2022-07-25 18:48 | 10M | |
![[SND]](/icons/sound2.gif) | Шома тигр-Вот как то так(remix, prod.Black Hits).mp3 | 2022-07-15 22:51 | 10M | |
![[SND]](/icons/sound2.gif) | mobi39.mp3 | 2022-07-01 02:17 | 10M | |
![[SND]](/icons/sound2.gif) | 7B_-_Molodye_vetra_48191748.mp3 | 2022-08-05 08:27 | 10M | |
![[SND]](/icons/sound2.gif) | luv.mp3 | 2022-07-15 10:28 | 10M | |
![[SND]](/icons/sound2.gif) | BDZ.mp3 | 2022-07-05 22:54 | 10M | |
![[SND]](/icons/sound2.gif) | S7.mp3 | 2022-07-29 12:01 | 10M | |
![[SND]](/icons/sound2.gif) | Mascarpone - Graisse.mp3 | 2022-07-05 16:47 | 10M | |
![[SND]](/icons/sound2.gif) | kegelapan.mp3 | 2022-07-11 01:27 | 10M | |
![[SND]](/icons/sound2.gif) | Григорий Лепс - Заебавшие рожи.mp3 | 2022-07-10 22:08 | 10M | |
![[SND]](/icons/sound2.gif) | y2meta.com - Bruno Mars - It Will Rain (Official Music Video) (320 kbps).mp3 | 2022-07-05 10:04 | 10M | |
![[SND]](/icons/sound2.gif) | tm1.mp3 | 2022-08-07 15:32 | 10M | |
![[SND]](/icons/sound2.gif) | 03. Drei Wie Brüder.mp3 | 2022-07-06 17:33 | 10M | |
![[SND]](/icons/sound2.gif) | bb1.mp3 | 2022-07-09 16:39 | 10M | |
![[SND]](/icons/sound2.gif) | Asw9.mp3 | 2022-07-25 10:58 | 10M | |
![[SND]](/icons/sound2.gif) | lany.mp3 | 2022-07-05 12:44 | 10M | |
![[SND]](/icons/sound2.gif) | SK_AK.mp3 | 2022-07-02 02:33 | 10M | |
![[SND]](/icons/sound2.gif) | 002-AL-BAQARAH [075 TO 107].mp3 | 2022-08-08 10:37 | 10M | |
![[SND]](/icons/sound2.gif) | 7b-nashla-kosa-na-kamen-idet-vojna-na-pamyat-let.mp3 | 2022-06-27 14:15 | 10M | |
![[SND]](/icons/sound2.gif) | kaalantheri.mp3 | 2022-07-07 17:49 | 10M | |
![[SND]](/icons/sound2.gif) | Pitch Bend - Boombaya (PhaZed Remix).mp3 | 2022-07-13 04:26 | 10M | |
![[SND]](/icons/sound2.gif) | tiapmalem.mp3 | 2022-07-01 17:20 | 10M | |
![[SND]](/icons/sound2.gif) | slank.mp3 | 2022-07-20 16:17 | 10M | |
![[SND]](/icons/sound2.gif) | byob.mp3 | 2022-07-04 19:36 | 10M | |
![[SND]](/icons/sound2.gif) | Anto.mp3 | 2022-07-17 14:33 | 10M | |
![[SND]](/icons/sound2.gif) | Lana_Del_Rey_-_Summertime_Sadness_(musmore.com).mp3 | 2022-07-06 18:04 | 10M | |
![[SND]](/icons/sound2.gif) | lucaz14.mp3 | 2022-07-02 04:43 | 10M | |
![[SND]](/icons/sound2.gif) | 07. Brigade 66 - Tiger.mp3 | 2022-07-14 20:51 | 10M | |
![[SND]](/icons/sound2.gif) | carbonite.mp3 | 2022-07-15 16:28 | 10M | |
![[SND]](/icons/sound2.gif) | Raid.mp3 | 2022-06-27 16:53 | 10M | |
![[SND]](/icons/sound2.gif) | DjKane8.mp3 | 2022-06-29 06:23 | 10M | |
![[SND]](/icons/sound2.gif) | MoonDeity-NEON BLADE-kissvk.com.mp3 | 2022-07-08 20:39 | 10M | |
![[SND]](/icons/sound2.gif) | Мираж - Музыка нас связала.mp3 | 2022-07-05 07:37 | 10M | |
![[SND]](/icons/sound2.gif) | MengkaneGasi4.mp3 | 2022-06-30 00:13 | 10M | |
![[SND]](/icons/sound2.gif) | Romax - Батько Наш Бандера.mp3 | 2022-07-11 19:34 | 10M | |
![[SND]](/icons/sound2.gif) | ngab10.mp3 | 2022-07-15 11:14 | 10M | |
![[SND]](/icons/sound2.gif) | rafa1.mp3 | 2022-07-17 02:53 | 10M | |
![[SND]](/icons/sound2.gif) | alawnix1.mp3 | 2022-07-17 13:48 | 10M | |
![[SND]](/icons/sound2.gif) | Drilon.mp3 | 2022-06-27 15:28 | 10M | |
![[SND]](/icons/sound2.gif) | adrian.mp3 | 2022-06-27 17:56 | 10M | |
![[SND]](/icons/sound2.gif) | [muzmo.ru] Адыгэ Джэгу — Джэгу къафэ [muzmo.ru] (www.lightaudio.ru).mp3 | 2022-06-27 14:57 | 10M | |
![[SND]](/icons/sound2.gif) | 15. Zayandehrood - Shahrokh.mp3 | 2022-06-28 13:53 | 10M | |
![[SND]](/icons/sound2.gif) | AE16.mp3 | 2022-07-09 19:02 | 10M | |
![[SND]](/icons/sound2.gif) | lana-del-rey-the-blackest-day-turkce-ceviri.mp3 | 2022-07-01 22:37 | 10M | |
![[SND]](/icons/sound2.gif) | lana-del-rey-the-blackest-day-turkce-ceviri (2).mp3 | 2022-06-29 04:15 | 10M | |
![[SND]](/icons/sound2.gif) | lain3.mp3 | 2022-06-27 16:06 | 10M | |
![[SND]](/icons/sound2.gif) | gio2.mp3 | 2022-07-01 06:23 | 10M | |
![[SND]](/icons/sound2.gif) | Tan.mp3 | 2022-07-08 10:40 | 10M | |
![[SND]](/icons/sound2.gif) | vedi80.mp3 | 2022-06-29 12:19 | 10M | |
![[SND]](/icons/sound2.gif) | LUCAVEROS - Как же заебали слезы моих бывших сук -Zi-Zi remix- -NR-Слёзы -Zi-Zi remix--kissvk.com.mp3 | 2022-07-05 09:50 | 10M | |
![[SND]](/icons/sound2.gif) | bugoy8.mp3 | 2022-06-28 06:36 | 10M | |
![[SND]](/icons/sound2.gif) | Rudh2.mp3 | 2022-07-13 15:34 | 10M | |
![[SND]](/icons/sound2.gif) | ネジ巻き師と太虚鳥 lasah × sasakure.UK _ taixu (320 kbps).mp3 | 2022-06-30 17:57 | 10M | |
![[SND]](/icons/sound2.gif) | bugoy2.mp3 | 2022-06-28 06:35 | 10M | |
![[SND]](/icons/sound2.gif) | Initial D - Deja Vu.mp3 | 2022-07-04 17:15 | 10M | |
![[SND]](/icons/sound2.gif) | tungo.mp3 | 2022-07-15 10:33 | 10M | |
![[SND]](/icons/sound2.gif) | D.B.C There I Go (acapella).mp3 | 2022-07-10 14:24 | 10M | |
![[SND]](/icons/sound2.gif) | djbangjono.mp3 | 2022-07-07 21:15 | 10M | |
![[SND]](/icons/sound2.gif) | Greeco1.mp3 | 2022-07-06 14:58 | 10M | |
![[SND]](/icons/sound2.gif) | Miyagi_Kadi_-_Rodnaya_pojj_60277327.mp3 | 2022-06-27 18:28 | 10M | |
![[SND]](/icons/sound2.gif) | Ангелина Сафронова - Киран_(AndroSound.ru).mp3 | 2022-07-30 06:45 | 10M | |
![[SND]](/icons/sound2.gif) | MiyaGi & Andy Panda - Yamakasi.mp3 | 2022-06-28 17:02 | 10M | |
![[SND]](/icons/sound2.gif) | Ангелина Сафронова (Эвенкийская песня) - Ангелина Сафронова (Эвенкийская песня)_(audiohunter.ru).mp3 | 2022-07-06 06:36 | 10M | |
![[SND]](/icons/sound2.gif) | Me quedare solo - Amistades Peligrosas __LETRA__ (320 kbps).mp3 | 2022-07-01 01:06 | 10M | |
![[SND]](/icons/sound2.gif) | Бумер - В парках городских.mp3 | 2022-07-10 10:30 | 10M | |
![[SND]](/icons/sound2.gif) | Бумер - В парках городских (1).mp3 | 2022-07-11 12:22 | 10M | |
![[SND]](/icons/sound2.gif) | c4.mp3 | 2022-07-15 11:11 | 10M | |
![[SND]](/icons/sound2.gif) | G.S.5.mp3 | 2022-07-19 14:13 | 10M | |
![[SND]](/icons/sound2.gif) | Ed_Sheeran_-_Perfect_(7Join.com).mp3 | 2022-07-08 22:34 | 10M | |
![[SND]](/icons/sound2.gif) | DJ_TIKTOK_TERBARU🎶DJ_YANG_LAGI_VIRAL_DAN_DICARI_CARI_ORANG🔊(256k).mp3 | 2022-07-15 00:10 | 10M | |
![[SND]](/icons/sound2.gif) | miyagi-feat.-kadi-rodnaja-pojj.mp3 | 2022-07-07 08:13 | 10M | |
![[SND]](/icons/sound2.gif) | 01 Perfect Duet (with Beyoncé).mp3 | 2022-07-01 19:44 | 10M | |
![[SND]](/icons/sound2.gif) | Farizki_-_Heat_Waves_Slowed_Reverb_(musmore.com).mp3 | 2022-06-29 12:51 | 10M | |
![[SND]](/icons/sound2.gif) | mp3indirdur-maNga-Dunyanin-Sonuna-Dogmusum.mp3 | 2022-07-06 04:34 | 10M | |
![[SND]](/icons/sound2.gif) | Ng.mp3 | 2022-07-11 19:25 | 10M | |
![[SND]](/icons/sound2.gif) | Jhon11.mp3 | 2022-07-15 01:51 | 10M | |
![[SND]](/icons/sound2.gif) | zrkdjpompom.mp3 | 2022-06-29 07:43 | 10M | |
![[SND]](/icons/sound2.gif) | WOK_COMPANY.mp3 | 2022-07-06 15:57 | 10M | |
![[SND]](/icons/sound2.gif) | praulayar.mp3 | 2022-07-06 18:44 | 10M | |
![[SND]](/icons/sound2.gif) | mc2.mp3.mp3 | 2022-07-08 17:50 | 10M | |
![[SND]](/icons/sound2.gif) | holy.mp3 | 2022-07-13 10:03 | 10M | |
![[SND]](/icons/sound2.gif) | Arouf Gansta - PALALALALA (Masterclass remix).mp3 | 2022-07-14 16:12 | 10M | |
![[VID]](/icons/movie.gif) | Camera-Roll-17.mp4 | 2022-07-09 22:54 | 10M | |
![[SND]](/icons/sound2.gif) | Наталія Бунь - Ромашки білі.mp3 | 2022-07-10 10:29 | 10M | |
![[SND]](/icons/sound2.gif) | Blindinglights.mp3 | 2022-07-04 01:01 | 10M | |
![[SND]](/icons/sound2.gif) | 002-AL-BAQARAH [142 TO 176].mp3 | 2022-08-08 10:37 | 10M | |
![[SND]](/icons/sound2.gif) | Альбина Сексова - Ебусь с хачами.mp3 | 2022-07-08 06:41 | 10M | |
![[SND]](/icons/sound2.gif) | Best Friend.mp3 | 2022-06-30 04:02 | 10M | |
![[SND]](/icons/sound2.gif) | 002-AL-BAQARAH [047 TO 074].mp3 | 2022-08-08 10:37 | 10M | |
![[SND]](/icons/sound2.gif) | [files.cx]-[sakuraost]_customi_z_-_coolest.mp3 | 2022-07-08 22:56 | 10M | |
![[SND]](/icons/sound2.gif) | WakChak16.mp3 | 2022-07-07 21:37 | 10M | |
![[SND]](/icons/sound2.gif) | often.mp3 | 2022-07-06 15:35 | 10M | |
![[SND]](/icons/sound2.gif) | Мирас Жугунусов - UAQYT.mp3 | 2022-07-01 05:15 | 10M | |
![[SND]](/icons/sound2.gif) | Ming.mp3 | 2022-07-11 11:15 | 10M | |
![[SND]](/icons/sound2.gif) | Ragil4.mp3 | 2022-07-14 08:05 | 10M | |
![[SND]](/icons/sound2.gif) | 26. E-Type - Here I Go Again (Yastreb Remix).mp3 | 2022-07-15 19:43 | 10M | |
![[SND]](/icons/sound2.gif) | SPY x FAMILY Ending Full「Comedy」by Gen Hoshino Lyrics Subtitles.mp3 | 2022-06-28 03:13 | 10M | |
![[SND]](/icons/sound2.gif) | NeonGuts.mp3 | 2022-06-29 15:10 | 10M | |
![[SND]](/icons/sound2.gif) | Miyagi_KADI_-_Rodnaya_pojj_(musmore.com).mp3 | 2022-07-07 08:57 | 10M | |
![[SND]](/icons/sound2.gif) | beutifil.mp3 | 2022-07-07 14:26 | 10M | |
![[SND]](/icons/sound2.gif) | dvkl7.mp3 | 2022-08-04 11:14 | 10M | |
![[SND]](/icons/sound2.gif) | umaasa.mp3 | 2022-06-27 15:44 | 10M | |
![[SND]](/icons/sound2.gif) | Ice Cube - It Was A Good Day.mp3 | 2022-06-28 19:05 | 10M | |
![[SND]](/icons/sound2.gif) | Marvel1.mp3 | 2022-07-02 13:35 | 10M | |
![[SND]](/icons/sound2.gif) | Feel The Flava (Itz All Good) (DJJOhAL.Com).mp3 | 2022-07-13 03:19 | 10M | |
![[SND]](/icons/sound2.gif) | Mr_Kitty_-_After_Dark_61741935.mp3 | 2022-07-19 08:31 | 10M | |
![[SND]](/icons/sound2.gif) | kaalan4.mp3 | 2022-07-09 19:02 | 10M | |
![[SND]](/icons/sound2.gif) | Sektor_Gaza_-_Lirika_(musmore.com).mp3 | 2022-07-07 17:42 | 10M | |
![[SND]](/icons/sound2.gif) | dmusic.mp3 | 2022-07-10 13:36 | 10M | |
![[SND]](/icons/sound2.gif) | D12 - Fight Music.mp3 | 2022-06-30 08:46 | 10M | |
![[SND]](/icons/sound2.gif) | Dj Alex Spark - я твой наркотик ,твой никотин ))ехуу.mp3 | 2022-07-10 10:48 | 10M | |
![[SND]](/icons/sound2.gif) | tpxvshx - HalfTime.mp3 | 2022-07-02 19:23 | 10M | |
![[SND]](/icons/sound2.gif) | br2.mp3 | 2022-07-05 08:33 | 10M | |
![[SND]](/icons/sound2.gif) | Ask About Me (DJJOhAL.Com).mp3 | 2022-07-13 03:19 | 10M | |
![[SND]](/icons/sound2.gif) | Maybe Today.mp3 | 2022-07-23 00:09 | 10M | |
![[SND]](/icons/sound2.gif) | Инфинити - Где ты (feat. D.I.P. Project).mp3 | 2022-07-09 11:42 | 10M | |
![[SND]](/icons/sound2.gif) | mobi29.mp3 | 2022-06-30 04:58 | 10M | |
![[SND]](/icons/sound2.gif) | ookan34.mp3 | 2022-07-10 17:23 | 9.9M | |
![[SND]](/icons/sound2.gif) | Adamant - Станцуй мне стриптиз.mp3 | 2022-07-12 23:19 | 9.9M | |
![[SND]](/icons/sound2.gif) | Virtual to live.mp3 | 2022-06-30 19:34 | 9.9M | |
![[SND]](/icons/sound2.gif) | Hampa.mp3 | 2022-07-04 01:16 | 9.9M | |
![[SND]](/icons/sound2.gif) | Hymnfortheweekend.mp3 | 2022-07-04 01:18 | 9.9M | |
![[SND]](/icons/sound2.gif) | Кино - Когда твоя девушка больна.mp3 | 2022-07-10 13:05 | 9.9M | |
![[SND]](/icons/sound2.gif) | 12. King For A Day.mp3 | 2022-07-04 00:40 | 9.9M | |
![[SND]](/icons/sound2.gif) | Ka-Re - Половина.mp3 | 2022-07-15 11:28 | 9.9M | |
![[SND]](/icons/sound2.gif) | doom_eternal_22. The Only Thing They Fear Is You.mp3 | 2022-07-16 13:46 | 9.9M | |
![[SND]](/icons/sound2.gif) | LifePaps.mp3 | 2022-06-29 05:24 | 9.9M | |
![[SND]](/icons/sound2.gif) | tetris - Touch Her Ass.mp3 | 2022-07-13 18:27 | 9.9M | |
![[SND]](/icons/sound2.gif) | And1.mp3 | 2022-07-09 18:48 | 9.9M | |
![[SND]](/icons/sound2.gif) | fatur2.mp3 | 2022-07-04 20:22 | 9.9M | |
![[SND]](/icons/sound2.gif) | TOTTO39.mp3 | 2022-07-15 16:32 | 9.9M | |
![[SND]](/icons/sound2.gif) | djocoy1.mp3 | 2022-07-03 13:30 | 9.9M | |
![[SND]](/icons/sound2.gif) | Len1.mp3 | 2022-07-05 05:11 | 9.9M | |
![[SND]](/icons/sound2.gif) | mrv4.mp3 | 2022-06-27 15:55 | 9.9M | |
![[SND]](/icons/sound2.gif) | kimhue.mp3 | 2022-07-13 16:40 | 9.9M | |
![[SND]](/icons/sound2.gif) | Ryu6.mp3 | 2022-07-05 06:17 | 9.9M | |
![[SND]](/icons/sound2.gif) | Cok.mp3 | 2022-07-10 07:12 | 9.9M | |
![[SND]](/icons/sound2.gif) | SID - Sunset di Tanah Anarki (Lirik) (256 kbps).mp3 | 2022-07-15 13:27 | 9.9M | |
![[SND]](/icons/sound2.gif) | Arif1.mp3 | 2022-07-15 13:43 | 9.9M | |
![[SND]](/icons/sound2.gif) | dom95.mp3 | 2022-07-03 06:32 | 9.9M | |
![[SND]](/icons/sound2.gif) | 02 cardigan.mp3 | 2022-07-08 22:50 | 9.9M | |
![[SND]](/icons/sound2.gif) | Pentakill feat. Tre Watson, TELLE - Predator.mp3 | 2022-07-06 17:33 | 9.9M | |
![[SND]](/icons/sound2.gif) | Nick6.mp3 | 2022-06-30 11:08 | 9.9M | |
![[SND]](/icons/sound2.gif) | kissitb.mp3 | 2022-06-29 15:49 | 9.9M | |
![[SND]](/icons/sound2.gif) | Garbage - Stupid Girl.mp3 | 2022-07-04 00:55 | 9.9M | |
![[SND]](/icons/sound2.gif) | budott.mp3 | 2022-07-06 08:29 | 9.9M | |
![[SND]](/icons/sound2.gif) | zrknight.mp3 | 2022-06-29 07:47 | 9.9M | |
![[SND]](/icons/sound2.gif) | azaku.mp3 | 2022-06-27 21:03 | 9.9M | |
![[SND]](/icons/sound2.gif) | dumang.mp3 | 2022-07-08 14:38 | 9.9M | |
![[SND]](/icons/sound2.gif) | acho2.mp3 | 2022-06-29 05:58 | 9.9M | |
![[SND]](/icons/sound2.gif) | Michael Jackson - Thriller _ 8D Audio (256 kbps).mp3 | 2022-07-10 11:57 | 9.9M | |
![[SND]](/icons/sound2.gif) | sid6.mp3 | 2022-07-04 10:10 | 9.9M | |
![[SND]](/icons/sound2.gif) | bugoy5.mp3 | 2022-06-28 06:35 | 9.9M | |
![[SND]](/icons/sound2.gif) | lesha-svik-ja-hochu-tancevat-ramirez-remix(mp3name.co).mp3 | 2022-07-04 16:27 | 9.9M | |
![[SND]](/icons/sound2.gif) | Sadmo.mp3 | 2022-07-08 02:30 | 9.9M | |
![[SND]](/icons/sound2.gif) | fatur4.mp3 | 2022-07-05 11:04 | 9.9M | |
![[SND]](/icons/sound2.gif) | EdwardSad04.mp3 | 2022-07-10 12:21 | 9.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com-Autumn-Wind_320kbps.mp3.mp3 | 2022-07-04 19:03 | 9.9M | |
![[SND]](/icons/sound2.gif) | Kid Rock - Cowboy.mp3 | 2022-07-04 01:00 | 9.9M | |
![[SND]](/icons/sound2.gif) | hith.mp3 | 2022-07-16 10:34 | 9.9M | |
![[SND]](/icons/sound2.gif) | nana11.mp3 | 2022-06-28 16:02 | 9.9M | |
![[SND]](/icons/sound2.gif) | Валентин Стрыкало - Наше лето.mp3 | 2022-06-30 12:58 | 9.9M | |
![[SND]](/icons/sound2.gif) | LaguSadMox.mp3 | 2022-07-04 23:02 | 9.9M | |
![[SND]](/icons/sound2.gif) | vedi100.mp3 | 2022-06-29 12:08 | 9.9M | |
![[SND]](/icons/sound2.gif) | LilJon.mp3 | 2022-07-23 09:27 | 9.9M | |
![[SND]](/icons/sound2.gif) | Rudh3.mp3 | 2022-07-13 15:34 | 9.9M | |
![[SND]](/icons/sound2.gif) | mad2.mp3 | 2022-07-04 18:54 | 9.9M | |
![[SND]](/icons/sound2.gif) | Right_Version_Le_Gouchque_Gachi_Gachi_Right__.mp3 | 2022-07-14 17:50 | 9.9M | |
![[SND]](/icons/sound2.gif) | ♂Жанна♂ Фриске ♂Right Version♂ Гачер — Le Gouchque Gachi #Gachi #Right #Гачи #га.mp3 | 2022-07-13 13:21 | 9.9M | |
![[SND]](/icons/sound2.gif) | snuffer.mp3 | 2022-06-28 21:39 | 9.9M | |
![[SND]](/icons/sound2.gif) | REMIX3.mp3 | 2022-08-01 14:47 | 9.9M | |
![[VID]](/icons/movie.gif) | X2Download.com-ฉันคือดวงจันทร์ - MONICA [Official MV].mp4 | 2022-07-10 04:12 | 9.9M | |
![[SND]](/icons/sound2.gif) | lennoxsj2.mp3 | 2022-06-28 02:48 | 9.9M | |
![[SND]](/icons/sound2.gif) | IdEt.mp3 | 2022-07-02 01:38 | 9.9M | |
![[SND]](/icons/sound2.gif) | DJ Timeline ft. Pearl Miller - I Just Want To (Chuck Lepley Remix).mp3 | 2022-07-13 13:54 | 9.9M | |
![[SND]](/icons/sound2.gif) | June 19, 2022.mp3 | 2022-07-03 17:48 | 9.9M | |
![[SND]](/icons/sound2.gif) | hot25.mp3 | 2022-07-11 05:38 | 9.9M | |
![[SND]](/icons/sound2.gif) | flash2.mp3 | 2022-07-16 04:51 | 9.9M | |
![[SND]](/icons/sound2.gif) | vedi64.mp3 | 2022-06-29 12:15 | 9.9M | |
![[SND]](/icons/sound2.gif) | laguboombox-1.mp3 | 2022-07-11 06:13 | 9.8M | |
![[SND]](/icons/sound2.gif) | where-are-you-now-deluxe-mix-lost-frequencies-feat-calum-scott.mp3 | 2022-07-02 14:45 | 9.8M | |
![[VID]](/icons/movie.gif) | VID_20220620_143623_098.mp4 | 2022-06-28 16:58 | 9.8M | |
![[SND]](/icons/sound2.gif) | ᅠ - ох сюйгеним.mp3 | 2022-07-06 16:33 | 9.8M | |
![[SND]](/icons/sound2.gif) | Cyrus5.mp3 | 2022-07-12 21:10 | 9.8M | |
![[SND]](/icons/sound2.gif) | inumaga.mp3 | 2022-07-19 00:12 | 9.8M | |
![[SND]](/icons/sound2.gif) | Zmi.mp3 | 2022-06-28 08:42 | 9.8M | |
![[SND]](/icons/sound2.gif) | Drake-Best-I-Ever-Had-(HipHopKit.com).mp3 | 2022-07-04 11:56 | 9.8M | |
![[SND]](/icons/sound2.gif) | Denominator.mp3 | 2022-07-05 00:12 | 9.8M | |
![[SND]](/icons/sound2.gif) | PED5.mp3 | 2022-07-01 08:16 | 9.8M | |
![[SND]](/icons/sound2.gif) | Kavinsky - Нічний Дзвінок.mp3 | 2022-06-30 18:25 | 9.8M | |
![[SND]](/icons/sound2.gif) | farel.mp3 | 2022-08-04 15:03 | 9.8M | |
![[SND]](/icons/sound2.gif) | zack7.mp3 | 2022-06-28 06:40 | 9.8M | |
![[SND]](/icons/sound2.gif) | Saathi.mp3 | 2022-07-08 10:40 | 9.8M | |
![[SND]](/icons/sound2.gif) | 1594512302674_1594512302.mp3 | 2022-06-28 09:47 | 9.8M | |
![[SND]](/icons/sound2.gif) | Luna_-_Jukebox_(musmore.com).mp3 | 2022-07-06 18:04 | 9.8M | |
![[SND]](/icons/sound2.gif) | Rihanna -Pop De Replay -Ed Marquis Bootleg--kissvk.com.mp3 | 2022-06-30 12:04 | 9.8M | |
![[SND]](/icons/sound2.gif) | anto1.mp3 | 2022-07-06 07:34 | 9.8M | |
![[SND]](/icons/sound2.gif) | NGAJIBANG.mp3 | 2022-07-06 14:50 | 9.8M | |
![[SND]](/icons/sound2.gif) | Ultimate spider.mp3 | 2022-07-17 20:06 | 9.8M | |
![[SND]](/icons/sound2.gif) | Teriyaki_Boyz_-_Tokyo_Drift_Fast_Furious_48364314.mp3 | 2022-06-29 13:28 | 9.8M | |
![[SND]](/icons/sound2.gif) | vedi46.mp3 | 2022-06-29 12:11 | 9.8M | |
![[SND]](/icons/sound2.gif) | Billy Talent - Rusted form the Rain.mp3 | 2022-07-06 21:09 | 9.8M | |
![[SND]](/icons/sound2.gif) | Afterdark.mp3 | 2022-07-04 01:00 | 9.8M | |
![[SND]](/icons/sound2.gif) | 11. Koocheye Nastaran - Ebi.mp3 | 2022-06-28 13:53 | 9.8M | |
![[SND]](/icons/sound2.gif) | ANIKV feat. Saluki - Меня Не Будет.mp3 | 2022-07-01 19:48 | 9.8M | |
![[SND]](/icons/sound2.gif) | Counting.mp3 | 2022-07-01 11:53 | 9.8M | |
![[SND]](/icons/sound2.gif) | для мта 5 - соса соla_(EEMUSIC.ru) (1).mp3 | 2022-07-23 09:13 | 9.8M | |
![[SND]](/icons/sound2.gif) | rasheed2.mp3 | 2022-07-03 11:43 | 9.8M | |
![[SND]](/icons/sound2.gif) | Бутырка - Аттестат.mp3 | 2022-07-04 11:33 | 9.8M | |
![[SND]](/icons/sound2.gif) | tydrift.mp3 | 2022-07-16 01:57 | 9.8M | |
![[SND]](/icons/sound2.gif) | Joler1.mp3 | 2022-07-11 13:05 | 9.8M | |
![[SND]](/icons/sound2.gif) | Perlahan Tenang.mp3 | 2022-06-29 05:07 | 9.8M | |
![[SND]](/icons/sound2.gif) | PerlahanPaps.mp3 | 2022-06-29 05:13 | 9.8M | |
![[SND]](/icons/sound2.gif) | TheReason.mp3 | 2022-07-11 22:52 | 9.8M | |
![[SND]](/icons/sound2.gif) | AE4.mp3 | 2022-07-06 15:04 | 9.8M | |
![[SND]](/icons/sound2.gif) | Duran Duran - Come Undone.mp3 | 2022-07-12 23:51 | 9.8M | |
![[SND]](/icons/sound2.gif) | SK_KR.mp3 | 2022-07-02 02:41 | 9.8M | |
![[SND]](/icons/sound2.gif) | Titanic2.mp3 | 2022-07-04 01:33 | 9.8M | |
![[SND]](/icons/sound2.gif) | The_Avener_Ane_Brun_-_To_Let_Myself_Go_47896843.mp3 | 2022-07-15 12:48 | 9.8M | |
![[SND]](/icons/sound2.gif) | sws1.mp3 | 2022-07-06 00:17 | 9.8M | |
![[SND]](/icons/sound2.gif) | lmao.mp3 | 2022-07-20 14:58 | 9.8M | |
![[SND]](/icons/sound2.gif) | Never Fall In Love.mp3 | 2022-07-23 00:08 | 9.8M | |
![[SND]](/icons/sound2.gif) | Gangstaparadise.mp3 | 2022-07-04 01:16 | 9.8M | |
![[SND]](/icons/sound2.gif) | Surot1.mp3 | 2022-07-09 18:30 | 9.8M | |
![[SND]](/icons/sound2.gif) | 03. Grandma.mp3 | 2022-07-09 16:06 | 9.8M | |
![[SND]](/icons/sound2.gif) | zrkkatakansaja.mp3 | 2022-06-29 07:47 | 9.8M | |
![[SND]](/icons/sound2.gif) | vedi63.mp3 | 2022-06-29 12:15 | 9.8M | |
![[SND]](/icons/sound2.gif) | Pumpedupkicks.mp3 | 2022-07-04 01:29 | 9.8M | |
![[SND]](/icons/sound2.gif) | zrkdjangelbaby.mp3 | 2022-06-29 07:41 | 9.8M | |
![[SND]](/icons/sound2.gif) | X2Download.com - Wish You Were Here - Neck Deep (Lirik Lagu Terjemahan) (320 kbps).mp3 | 2022-06-27 20:35 | 9.8M | |
![[SND]](/icons/sound2.gif) | Oswine1.mp3 | 2022-07-13 23:17 | 9.8M | |
![[SND]](/icons/sound2.gif) | YUrijj_SHatunov_-_I_upav_na_koleni_(musmore.com).mp3 | 2022-06-29 08:39 | 9.8M | |
![[SND]](/icons/sound2.gif) | Penjagahati.mp3 | 2022-07-04 01:28 | 9.8M | |
![[SND]](/icons/sound2.gif) | Panalangin.mp3 | 2022-07-08 02:52 | 9.8M | |
![[SND]](/icons/sound2.gif) | 08. Lamse Piroozi - Rana Mansour.mp3 | 2022-06-28 13:53 | 9.8M | |
![[SND]](/icons/sound2.gif) | yurij-shatunov-kazhdomu-svoyo.mp3 | 2022-06-29 20:44 | 9.8M | |
![[SND]](/icons/sound2.gif) | yurij-shatunov-kazhdomu-svoyo (1).mp3 | 2022-06-29 20:44 | 9.8M | |
![[SND]](/icons/sound2.gif) | yurij-shatunov-kazhdomu-svoyo (2).mp3 | 2022-06-29 20:39 | 9.8M | |
![[SND]](/icons/sound2.gif) | 𝕧𝕖𝕣𝕤𝕒𝕔𝕙𝕖𝕧𝕤𝕜𝕚𝕖.𝕘𝕣 - джанго remix 🍇.mp3 | 2022-07-03 05:04 | 9.7M | |
![[SND]](/icons/sound2.gif) | Timecop1983_-_Tonight_Neutron_Drea_(getmp3.pro).mp3 | 2022-07-02 22:57 | 9.7M | |
![[SND]](/icons/sound2.gif) | 09. Golazin-Betras-Az-Man.mp3 | 2022-06-28 13:52 | 9.7M | |
![[SND]](/icons/sound2.gif) | Wakno22.mp3 | 2022-07-05 07:17 | 9.7M | |
![[SND]](/icons/sound2.gif) | dana tunes - nege sezbedim [slowed + reverb by zendex] (t9music.ru).mp3 | 2022-07-30 23:07 | 9.7M | |
![[SND]](/icons/sound2.gif) | ookan25.mp3 | 2022-07-09 16:20 | 9.7M | |
![[SND]](/icons/sound2.gif) | rafi1.mp3 | 2022-06-28 23:38 | 9.7M | |
![[SND]](/icons/sound2.gif) | DG3.mp3 | 2022-07-04 02:16 | 9.7M | |
![[SND]](/icons/sound2.gif) | unravel.mp3 | 2022-07-15 16:56 | 9.7M | |
![[SND]](/icons/sound2.gif) | Rfriend.mp3 | 2022-07-08 07:14 | 9.7M | |
![[SND]](/icons/sound2.gif) | dukacampuran.mp3 | 2022-07-05 22:57 | 9.7M | |
![[SND]](/icons/sound2.gif) | duka campuran.mp3 | 2022-07-05 22:04 | 9.7M | |
![[SND]](/icons/sound2.gif) | Tu Kya Janay.mp3 | 2022-07-15 20:12 | 9.7M | |
![[SND]](/icons/sound2.gif) | Голая_нравится_мне_когда_ты_голая_по_квартире_ходишь_KD_D.mp3 | 2022-07-10 22:02 | 9.7M | |
![[SND]](/icons/sound2.gif) | Bh.mp3 | 2022-07-11 19:54 | 9.7M | |
![[SND]](/icons/sound2.gif) | pandaG.mp3 | 2022-07-01 08:59 | 9.7M | |
![[SND]](/icons/sound2.gif) | 4_4_4_4_MTS_2020.mp3 | 2022-07-19 05:17 | 9.7M | |
![[SND]](/icons/sound2.gif) | mood.mp3 | 2022-07-01 20:42 | 9.7M | |
![[SND]](/icons/sound2.gif) | AgaLe8.mp3 | 2022-07-31 14:03 | 9.7M | |
![[SND]](/icons/sound2.gif) | danilo_-_ja_seksu_seksu_hochu_ja_tobi_shepochu_(z2.fm).mp3 | 2022-07-10 03:03 | 9.7M | |
![[SND]](/icons/sound2.gif) | ndxAKAmoveonkuk.mp3 | 2022-07-14 17:14 | 9.7M | |
![[SND]](/icons/sound2.gif) | Джон Уильямс, London Symphony Orchestra - Duel of the Fates.mp3 | 2022-07-06 22:11 | 9.7M | |
![[SND]](/icons/sound2.gif) | sinabmarin.mp3 | 2022-07-08 18:27 | 9.7M | |
![[SND]](/icons/sound2.gif) | zrkmelepaslajang.mp3 | 2022-06-29 07:47 | 9.7M | |
![[SND]](/icons/sound2.gif) | Wakno14.mp3 | 2022-07-04 22:42 | 9.7M | |
![[SND]](/icons/sound2.gif) | eros25.mp3 | 2022-07-14 17:12 | 9.7M | |
![[SND]](/icons/sound2.gif) | fukpop.mp3 | 2022-07-15 05:51 | 9.7M | |
![[VID]](/icons/movie.gif) | MODERN RP - Prod By. MANGBORIS (Official Audio).mp4 | 2022-07-06 14:42 | 9.7M | |
![[SND]](/icons/sound2.gif) | Nick5.mp3 | 2022-06-29 15:55 | 9.7M | |
![[SND]](/icons/sound2.gif) | Melnica_-_Tjomnye_zemli_(musmore.com).mp3 | 2022-06-30 17:07 | 9.7M | |
![[SND]](/icons/sound2.gif) | ookan8.mp3 | 2022-07-05 10:47 | 9.7M | |
![[SND]](/icons/sound2.gif) | escmiracle.mp3 | 2022-07-05 04:11 | 9.7M | |
![[SND]](/icons/sound2.gif) | 505 articmonkey.mp3 | 2022-07-04 14:05 | 9.7M | |
![[SND]](/icons/sound2.gif) | catriona.mp3 | 2022-07-08 04:03 | 9.7M | |
![[SND]](/icons/sound2.gif) | taras-obnazhennyjj-kajjf.mp3 | 2022-07-03 01:33 | 9.7M | |
![[SND]](/icons/sound2.gif) | joyji.mp3 | 2022-06-30 11:18 | 9.7M | |
![[SND]](/icons/sound2.gif) | jojiremix.mp3 | 2022-07-07 12:44 | 9.7M | |
![[SND]](/icons/sound2.gif) | Asw10.mp3 | 2022-07-25 10:58 | 9.7M | |
![[SND]](/icons/sound2.gif) | Юрий Шатунов - Каждому своё.mp3 | 2022-06-29 20:43 | 9.7M | |
![[SND]](/icons/sound2.gif) | T-Fest - Бедолага.mp3 | 2022-07-09 10:20 | 9.7M | |
![[SND]](/icons/sound2.gif) | Toomaj - Noghte Koor.mp3 | 2022-06-28 13:54 | 9.7M | |
![[SND]](/icons/sound2.gif) | Sunda.mp3 | 2022-08-04 09:40 | 9.7M | |
![[SND]](/icons/sound2.gif) | MENGKANE 1.mp3 | 2022-07-10 09:16 | 9.7M | |
![[SND]](/icons/sound2.gif) | Gani.mp3 | 2022-06-27 14:27 | 9.7M | |
![[SND]](/icons/sound2.gif) | ph.ylyonI.mp3 | 2022-07-12 04:11 | 9.7M | |
![[SND]](/icons/sound2.gif) | TOTTO68.mp3 | 2022-07-15 16:31 | 9.7M | |
![[SND]](/icons/sound2.gif) | zrksisarasa.mp3 | 2022-06-29 07:51 | 9.7M | |
![[SND]](/icons/sound2.gif) | 13. DEAD MAN WALKING.mp3 | 2022-07-06 08:26 | 9.7M | |
![[SND]](/icons/sound2.gif) | statue.mp3 | 2022-06-27 16:25 | 9.7M | |
![[SND]](/icons/sound2.gif) | cahaya.mp3 | 2022-07-11 01:18 | 9.7M | |
![[SND]](/icons/sound2.gif) | 2517_-_A_golova_chto_by_dumat_nogi_chtoby_khodit_62681671.mp3 | 2022-06-29 12:26 | 9.7M | |
![[SND]](/icons/sound2.gif) | Statue .mp3 | 2022-07-08 04:31 | 9.7M | |
![[SND]](/icons/sound2.gif) | ceramah.mp3 | 2022-07-06 14:18 | 9.7M | |
![[SND]](/icons/sound2.gif) | NDX1.mp3 | 2022-07-12 09:58 | 9.7M | |
![[SND]](/icons/sound2.gif) | gio8.mp3 | 2022-07-03 02:52 | 9.6M | |
![[SND]](/icons/sound2.gif) | lemon-demon-touch-tone-telephone.mp3 | 2022-07-10 19:06 | 9.6M | |
![[SND]](/icons/sound2.gif) | ourstory.mp3 | 2022-07-02 01:36 | 9.6M | |
![[SND]](/icons/sound2.gif) | Basta-Urban.mp3 | 2022-07-13 09:54 | 9.6M | |
![[SND]](/icons/sound2.gif) | Баста-Урбан-kissvk.com.mp3 | 2022-06-30 21:57 | 9.6M | |
![[SND]](/icons/sound2.gif) | babyfamilly.mp3 | 2022-06-28 16:31 | 9.6M | |
![[SND]](/icons/sound2.gif) | Miyagi_JEndshpil_-_Moya_banda_68978113.mp3 | 2022-07-05 16:05 | 9.6M | |
![[SND]](/icons/sound2.gif) | Stay Inside Me - Geometry Dash Version (10 min).mp3 | 2022-07-05 19:22 | 9.6M | |
![[SND]](/icons/sound2.gif) | scs.mp3 | 2022-07-10 09:39 | 9.6M | |
![[SND]](/icons/sound2.gif) | JEduard_KHusnutdinov_-_Otogreetsya_dusha_59964757.mp3 | 2022-07-31 08:58 | 9.6M | |
![[SND]](/icons/sound2.gif) | Qimzy8.mp3 | 2022-06-29 01:33 | 9.6M | |
![[SND]](/icons/sound2.gif) | Dr_Dre_ft_Snoop_Dogg_Anderson_Paak_-_ETA_TRENDYLOADED.COM.mp3 | 2022-07-09 11:59 | 9.6M | |
![[SND]](/icons/sound2.gif) | joosoo.mp3 | 2022-07-14 20:50 | 9.6M | |
![[SND]](/icons/sound2.gif) | bkk.mp3 | 2022-06-28 03:38 | 9.6M | |
![[SND]](/icons/sound2.gif) | Mania_-_razami_k_tebe_47966662.mp3 | 2022-06-27 18:22 | 9.6M | |
![[SND]](/icons/sound2.gif) | esckane.mp3 | 2022-07-05 04:10 | 9.6M | |
![[SND]](/icons/sound2.gif) | KECE23.mp3 | 2022-07-04 12:06 | 9.6M | |
![[SND]](/icons/sound2.gif) | Ненси - Девушка мечты.mp3 | 2022-07-06 19:55 | 9.6M | |
![[SND]](/icons/sound2.gif) | lion.mp3 | 2022-07-23 23:53 | 9.6M | |
![[SND]](/icons/sound2.gif) | Tiara.mp3 | 2022-07-04 16:08 | 9.6M | |
![[SND]](/icons/sound2.gif) | toxic39.mp3 | 2022-07-04 12:17 | 9.6M | |
![[SND]](/icons/sound2.gif) | fixyou.mp3 | 2022-07-02 02:54 | 9.6M | |
![[SND]](/icons/sound2.gif) | Wakno9.mp3 | 2022-07-04 21:58 | 9.6M | |
![[SND]](/icons/sound2.gif) | Akuyangtersakiti.mp3 | 2022-07-04 01:00 | 9.6M | |
![[SND]](/icons/sound2.gif) | Sueta - Fine I'll do it myself - Danza Kuduro.mp3 | 2022-07-12 04:48 | 9.6M | |
![[SND]](/icons/sound2.gif) | Rivermaya - Elesi.mp3 | 2022-07-09 10:07 | 9.6M | |
![[SND]](/icons/sound2.gif) | nana4.mp3 | 2022-06-28 16:02 | 9.6M | |
![[SND]](/icons/sound2.gif) | vedi6.mp3 | 2022-06-29 12:25 | 9.6M | |
![[SND]](/icons/sound2.gif) | Cintainimembunuhku.mp3 | 2022-07-04 01:01 | 9.6M | |
![[SND]](/icons/sound2.gif) | inbound8853776060074434213.mp3 | 2022-07-02 08:33 | 9.6M | |
![[SND]](/icons/sound2.gif) | inbound136725603557568811.mp3 | 2022-07-02 08:34 | 9.6M | |
![[SND]](/icons/sound2.gif) | Kev.mp3 | 2022-07-01 23:20 | 9.6M | |
![[SND]](/icons/sound2.gif) | mobi17.mp3 | 2022-06-30 04:48 | 9.6M | |
![[SND]](/icons/sound2.gif) | 13. Fekr Kon Besham Reis Jomhoor - Yaser Binam.mp3 | 2022-06-28 13:53 | 9.6M | |
![[SND]](/icons/sound2.gif) | Pi8.mp3 | 2022-06-28 01:46 | 9.6M | |
![[SND]](/icons/sound2.gif) | 1632715922903_1632027148_russian-rap-feat-andre-apostol-g-kak-ya-rad-ya-priehal-v-volgograd.mp3 | 2022-06-27 12:37 | 9.6M | |
![[SND]](/icons/sound2.gif) | playingtheangel_-_ABYUZER_62322033.mp3 | 2022-07-07 15:54 | 9.6M | |
![[SND]](/icons/sound2.gif) | Lagi.mp3 | 2022-07-02 00:44 | 9.6M | |
![[SND]](/icons/sound2.gif) | Cocteau_Twins_Heaven_Or_Las_Vegas_(getmp3.pro).mp3 | 2022-06-27 13:55 | 9.6M | |
![[SND]](/icons/sound2.gif) | ta.mp3 | 2022-07-08 23:48 | 9.6M | |
![[SND]](/icons/sound2.gif) | Cedric3.mp3 | 2022-07-13 07:22 | 9.6M | |
![[SND]](/icons/sound2.gif) | Wish You Were Here(MP3_320K).mp3 | 2022-07-25 08:51 | 9.6M | |
![[SND]](/icons/sound2.gif) | hills.mp3 | 2022-07-06 15:38 | 9.6M | |
![[SND]](/icons/sound2.gif) | Mikhail_Krug_-_Zolotye_kupola_63900263.mp3 | 2022-07-10 21:44 | 9.6M | |
![[SND]](/icons/sound2.gif) | Патриотичная - Гимн России (минус)(уши).mp3 | 2022-07-11 17:11 | 9.6M | |
![[SND]](/icons/sound2.gif) | ALEKS_ATAMAN_Dubrovsky_-_Na_jetom_vsjo_72974529 (1).mp3 | 2022-07-06 20:03 | 9.6M | |
![[SND]](/icons/sound2.gif) | AWS in 10 Minutes .mp3 | 2022-07-16 12:47 | 9.6M | |
![[SND]](/icons/sound2.gif) | SHamil_Kasheshov_-_Potomu_chto_ya_vlyublen_56539297.mp3 | 2022-07-06 09:09 | 9.6M | |
![[SND]](/icons/sound2.gif) | shit.mp3 | 2022-07-02 02:38 | 9.6M | |
![[SND]](/icons/sound2.gif) | bugoy1.mp3 | 2022-06-28 06:34 | 9.6M | |
![[SND]](/icons/sound2.gif) | wolfgang.mp3 | 2022-06-29 06:13 | 9.6M | |
![[SND]](/icons/sound2.gif) | ingatt.mp3 | 2022-06-29 04:11 | 9.6M | |
![[SND]](/icons/sound2.gif) | INI_YANG_KALIAN_CARI!!!_YANG_MINTA_FULLNYA_NI_SOUND_JJ_ZERZ’SOFTBOY_X_Ijul_RMX(256k).mp3 | 2022-06-27 19:34 | 9.6M | |
![[SND]](/icons/sound2.gif) | Har4.mp3 | 2022-07-08 13:07 | 9.6M | |
![[SND]](/icons/sound2.gif) | 05-Slainte-Britches-Full-of-Stitches.-Munster-Bank.-Bill-Sullivans-The-A-Polkas.mp3 | 2022-07-06 08:26 | 9.6M | |
![[SND]](/icons/sound2.gif) | Eminem feat. Rihanna - The Monster.mp3 | 2022-07-10 10:48 | 9.6M | |
![[SND]](/icons/sound2.gif) | Usher feat. Lil Jon, Ludacris - Yeah!.mp3 | 2022-07-16 23:29 | 9.6M | |
![[SND]](/icons/sound2.gif) | SLW.mp3 | 2022-07-03 13:20 | 9.6M | |
![[SND]](/icons/sound2.gif) | vedi61.mp3 | 2022-06-29 12:14 | 9.6M | |
![[SND]](/icons/sound2.gif) | My Way Home Pt.2.mp3 | 2022-07-04 06:54 | 9.6M | |
![[SND]](/icons/sound2.gif) | Захар Май 20191103-170500-RU081-program_hq.mp3 | 2022-07-17 16:38 | 9.6M | |
![[SND]](/icons/sound2.gif) | toxic11.mp3 | 2022-07-04 06:46 | 9.5M | |
![[SND]](/icons/sound2.gif) | 1man.mp3 | 2022-07-15 10:22 | 9.5M | |
![[SND]](/icons/sound2.gif) | Nourish Meditation.m4a | 2022-08-04 00:42 | 9.5M | |
![[SND]](/icons/sound2.gif) | tyson-yen-vs-samuel-rodriguez-the-only-thing-i-know-for-real-maniac-ag.mp3 | 2022-07-28 20:29 | 9.5M | |
![[VID]](/icons/movie.gif) | bagasz.mp4 | 2022-07-17 06:50 | 9.5M | |
![[SND]](/icons/sound2.gif) | Pentakill feat. TELLE, Tre Watson - Conqueror.mp3 | 2022-07-06 16:50 | 9.5M | |
![[SND]](/icons/sound2.gif) | DUDE3.mp3 | 2022-08-07 14:54 | 9.5M | |
![[SND]](/icons/sound2.gif) | ✞︎ʙᴀᴢ•2114✞︎ - ᴄᴀᴘᴛᴀɪɴ «ʀᴍx».mp3 | 2022-07-10 05:53 | 9.5M | |
![[SND]](/icons/sound2.gif) | XIII feat. Sensimilla - Квартал не выросших крыльев.mp3 | 2022-07-09 09:58 | 9.5M | |
![[SND]](/icons/sound2.gif) | Mascarpone - Suicide.mp3 | 2022-07-07 16:46 | 9.5M | |
![[SND]](/icons/sound2.gif) | toxic37.mp3 | 2022-07-04 12:17 | 9.5M | |
![[SND]](/icons/sound2.gif) | ugun7.mp3 | 2022-07-02 03:58 | 9.5M | |
![[SND]](/icons/sound2.gif) | SATRU2.mp3 | 2022-07-30 06:40 | 9.5M | |
![[VID]](/icons/movie.gif) | German Soldier's Song - _Erika_ (with English Subtitles).mp4 | 2022-07-06 21:42 | 9.5M | |
![[VID]](/icons/movie.gif) | German Soldier's Song - _Erika_ (with English Subtitles) (1).mp4 | 2022-07-09 10:22 | 9.5M | |
![[SND]](/icons/sound2.gif) | 10. Vatan - Dariush.mp3 | 2022-06-28 13:53 | 9.5M | |
![[SND]](/icons/sound2.gif) | stoneisland.mp3 | 2022-07-05 13:14 | 9.5M | |
![[SND]](/icons/sound2.gif) | Rhey43.mp3 | 2022-06-29 11:09 | 9.5M | |
![[SND]](/icons/sound2.gif) | 31. Ice MC - Think About The Way (Axel Paerel 2k20 Remix).mp3 | 2022-07-15 19:43 | 9.5M | |
![[SND]](/icons/sound2.gif) | zack6.mp3 | 2022-06-28 06:40 | 9.5M | |
![[SND]](/icons/sound2.gif) | Adik1.mp3 | 2022-07-11 19:07 | 9.5M | |
![[SND]](/icons/sound2.gif) | iroo.mp3 | 2022-08-04 09:40 | 9.5M | |
![[SND]](/icons/sound2.gif) | Abll8.mp3 | 2022-07-15 15:52 | 9.5M | |
![[SND]](/icons/sound2.gif) | Ebanko_-_Parablyader_bassbusted_67039942.mp3 | 2022-06-28 17:43 | 9.5M | |
![[SND]](/icons/sound2.gif) | WakChak19.mp3 | 2022-07-07 21:39 | 9.5M | |
![[SND]](/icons/sound2.gif) | zrkdjmama.mp3 | 2022-06-29 07:43 | 9.5M | |
![[SND]](/icons/sound2.gif) | zali9.mp3 | 2022-07-16 04:15 | 9.5M | |
![[SND]](/icons/sound2.gif) | bounce.mp3 | 2022-07-14 17:20 | 9.5M | |
![[SND]](/icons/sound2.gif) | Zamina.mp3 | 2022-07-04 01:33 | 9.5M | |
![[SND]](/icons/sound2.gif) | 幸福研究所_對的人篇_如何辨識渣男?.m4a | 2022-07-06 04:28 | 9.5M | |
![[SND]](/icons/sound2.gif) | magenta_BEST_ALBUM_I_ver_(getmp3.pro).mp3 | 2022-07-11 22:04 | 9.5M | |
![[SND]](/icons/sound2.gif) | monster.mp3 | 2022-06-28 08:08 | 9.5M | |
![[SND]](/icons/sound2.gif) | vedi56.mp3 | 2022-06-29 12:13 | 9.5M | |
![[SND]](/icons/sound2.gif) | nico-vinz-am-i-wrong.mp3 | 2022-07-02 10:42 | 9.5M | |
![[SND]](/icons/sound2.gif) | 27. Eurythmics - Sweet Dreams (Tony Forby Extended Remix).mp3 | 2022-07-15 19:43 | 9.5M | |
![[SND]](/icons/sound2.gif) | russkiTRAP.mp3 | 2022-07-12 15:49 | 9.5M | |
![[SND]](/icons/sound2.gif) | АК-47 - Русский TRAP (feat. DJ Mixoid).mp3 | 2022-07-12 14:14 | 9.5M | |
![[SND]](/icons/sound2.gif) | kue.mp3 | 2022-06-30 05:27 | 9.5M | |
![[SND]](/icons/sound2.gif) | Miyagi.mp3 | 2022-07-15 15:21 | 9.5M | |
![[SND]](/icons/sound2.gif) | 👑azelo👑 - Потому что я влюблен😍😍.mp3 | 2022-07-15 15:05 | 9.5M | |
![[SND]](/icons/sound2.gif) | sadvibes3(1).mp3 | 2022-06-28 00:25 | 9.5M | |
![[SND]](/icons/sound2.gif) | ANYING3.mp3 | 2022-06-28 06:08 | 9.5M | |
![[SND]](/icons/sound2.gif) | ANYING3(1).mp3 | 2022-06-28 06:07 | 9.5M | |
![[SND]](/icons/sound2.gif) | pb3.mp3 | 2022-06-28 16:08 | 9.5M | |
![[SND]](/icons/sound2.gif) | Coolio — Gangster's Paradise (www.lightaudio.ru).mp3 | 2022-07-15 19:59 | 9.5M | |
![[SND]](/icons/sound2.gif) | lk3.mp3 | 2022-06-30 17:50 | 9.5M | |
![[SND]](/icons/sound2.gif) | WishYouWereHere.mp3 | 2022-07-12 06:08 | 9.5M | |
![[SND]](/icons/sound2.gif) | ffdp.mp3 | 2022-07-11 17:20 | 9.5M | |
![[SND]](/icons/sound2.gif) | andre.mp3 | 2022-08-06 17:11 | 9.5M | |
![[SND]](/icons/sound2.gif) | rem-losing-my-religion-official-music-video.mp3 | 2022-06-29 07:31 | 9.5M | |
![[SND]](/icons/sound2.gif) | promise.mp3 | 2022-07-15 10:29 | 9.5M | |
![[SND]](/icons/sound2.gif) | Rhey15.mp3 | 2022-06-28 12:00 | 9.5M | |
![[SND]](/icons/sound2.gif) | premium.mp3 | 2022-06-28 16:31 | 9.5M | |
![[SND]](/icons/sound2.gif) | [YT2mp3.info] - ฉลามชอบงับคุณ - Bonnadol Feat IIVY B [Official MV] (320kbps).mp3 | 2022-08-03 17:28 | 9.5M | |
![[SND]](/icons/sound2.gif) | Dhijaibinatng.mp3 | 2022-07-07 08:14 | 9.5M | |
![[SND]](/icons/sound2.gif) | pit.mp3 | 2022-07-02 01:42 | 9.5M | |
![[SND]](/icons/sound2.gif) | Би-2 - Счастье.mp3 | 2022-07-02 12:32 | 9.5M | |
![[SND]](/icons/sound2.gif) | Getlucky.mp3 | 2022-07-04 01:16 | 9.5M | |
![[SND]](/icons/sound2.gif) | Anotherlove.mp3 | 2022-07-04 01:00 | 9.5M | |
![[SND]](/icons/sound2.gif) | miki-feat-esoreni-secret-love.mp3 | 2022-07-14 23:34 | 9.5M | |
![[SND]](/icons/sound2.gif) | KZRG.mp3 | 2022-07-08 01:30 | 9.5M | |
![[SND]](/icons/sound2.gif) | Hugo_Loud_OFFMi_-_GTA_(slowed_reverb).mp3 | 2022-07-18 15:58 | 9.5M | |
![[SND]](/icons/sound2.gif) | Chic - Everybody Dance.mp3 | 2022-07-10 17:19 | 9.4M | |
![[SND]](/icons/sound2.gif) | plj21.mp3 | 2022-07-04 00:02 | 9.4M | |
![[SND]](/icons/sound2.gif) | zrkapakabar.mp3 | 2022-06-29 07:52 | 9.4M | |
![[SND]](/icons/sound2.gif) | OxxxymironGopodo.mp3 | 2022-07-09 10:36 | 9.4M | |
![[SND]](/icons/sound2.gif) | AAL12.mp3 | 2022-07-01 09:24 | 9.4M | |
![[SND]](/icons/sound2.gif) | cong.mp3 | 2022-06-30 06:43 | 9.4M | |
![[SND]](/icons/sound2.gif) | Jawson.mp3 | 2022-07-02 01:48 | 9.4M | |
![[SND]](/icons/sound2.gif) | vedi57.mp3 | 2022-06-29 12:13 | 9.4M | |
![[SND]](/icons/sound2.gif) | djmeneketehe.mp3 | 2022-06-30 10:22 | 9.4M | |
![[SND]](/icons/sound2.gif) | DjKane10.mp3 | 2022-06-29 06:23 | 9.4M | |
![[SND]](/icons/sound2.gif) | Oooo;.mp3 | 2022-07-06 16:33 | 9.4M | |
![[SND]](/icons/sound2.gif) | 𝟙_𝔼𝕊𝔸𝔼𝕍 - Oooo🤤.mp3 | 2022-07-06 16:26 | 9.4M | |
![[SND]](/icons/sound2.gif) | InMyHeart.mp3 | 2022-06-29 04:07 | 9.4M | |
![[SND]](/icons/sound2.gif) | Yo2.mp3 | 2022-07-05 06:39 | 9.4M | |
![[SND]](/icons/sound2.gif) | toxic14.mp3 | 2022-07-04 09:03 | 9.4M | |
![[SND]](/icons/sound2.gif) | Laguenak.mp3 | 2022-07-04 03:43 | 9.4M | |
![[SND]](/icons/sound2.gif) | Len4.mp3 | 2022-07-05 05:52 | 9.4M | |
![[SND]](/icons/sound2.gif) | zali10.mp3 | 2022-07-16 04:15 | 9.4M | |
![[SND]](/icons/sound2.gif) | Shakira.mp3 | 2022-06-29 04:12 | 9.4M | |
![[SND]](/icons/sound2.gif) | Grigorijj_Leps_Irina_Allegrova_-_YA_tebe_ne_veryu_60640118.mp3 | 2022-07-05 14:21 | 9.4M | |
![[SND]](/icons/sound2.gif) | cupak.mp3 | 2022-07-16 12:05 | 9.4M | |
![[SND]](/icons/sound2.gif) | nhugiacchiembao.mp3 | 2022-07-15 17:50 | 9.4M | |
![[SND]](/icons/sound2.gif) | Here & There (DJJOhAL.Com).mp3 | 2022-07-13 03:19 | 9.4M | |
![[SND]](/icons/sound2.gif) | Married2God.mp3 | 2022-07-11 20:08 | 9.4M | |
![[SND]](/icons/sound2.gif) | ar.mp3 | 2022-07-24 02:29 | 9.4M | |
![[SND]](/icons/sound2.gif) | TOTTO16.mp3 | 2022-07-15 16:37 | 9.4M | |
![[SND]](/icons/sound2.gif) | 80 Degrees Ft. Amaal (DJJOhAL.Com).mp3 | 2022-07-13 03:19 | 9.4M | |
![[SND]](/icons/sound2.gif) | BCnik.mp3 | 2022-06-29 14:39 | 9.4M | |
![[SND]](/icons/sound2.gif) | Serjoga_-_CHjornyjj_bumer_62989690.mp3 | 2022-07-05 18:11 | 9.4M | |
![[SND]](/icons/sound2.gif) | xwan18.mp3 | 2022-06-29 06:29 | 9.4M | |
![[SND]](/icons/sound2.gif) | r3.mp3 | 2022-07-13 11:27 | 9.4M | |
![[SND]](/icons/sound2.gif) | WakChak12.mp3 | 2022-07-07 21:36 | 9.4M | |
![[SND]](/icons/sound2.gif) | Len5.mp3 | 2022-07-05 05:09 | 9.4M | |
![[SND]](/icons/sound2.gif) | Starred - _LA Drugs_ (Official Music Video).mp3 | 2022-07-06 11:53 | 9.4M | |
![[SND]](/icons/sound2.gif) | Sevenrose - Белые тюльпаны.mp3 | 2022-08-01 19:09 | 9.4M | |
![[SND]](/icons/sound2.gif) | mad4.mp3 | 2022-07-04 18:54 | 9.4M | |
![[SND]](/icons/sound2.gif) | ugun2.mp3 | 2022-07-02 03:55 | 9.4M | |
![[SND]](/icons/sound2.gif) | To.mp3 | 2022-07-10 19:49 | 9.4M | |
![[SND]](/icons/sound2.gif) | Anuel AA - Keii.mp3 | 2022-07-08 07:26 | 9.4M | |
![[SND]](/icons/sound2.gif) | Metal Gear Rising_ Revengeance OST - A Stranger I Remain Extended.mp3 | 2022-07-05 19:44 | 9.4M | |
![[SND]](/icons/sound2.gif) | Громкий фронт_IFRONT31--3-kissvk.com.mp3 | 2022-07-12 21:22 | 9.4M | |
![[SND]](/icons/sound2.gif) | [286] Chamillionaire featuring Sway - Ridin' (feat. Sway) [U.K. Remix].mp3 | 2022-07-12 23:51 | 9.4M | |
![[SND]](/icons/sound2.gif) | Rustam_Nakhushev_-_Cyganochka_(musmore.com).mp3 | 2022-07-07 06:50 | 9.4M | |
![[SND]](/icons/sound2.gif) | dsc5.mp3 | 2022-07-19 18:46 | 9.4M | |
![[SND]](/icons/sound2.gif) | lagu8.mp3 | 2022-07-13 06:32 | 9.4M | |
![[SND]](/icons/sound2.gif) | GlimpseOfUs.mp3 | 2022-06-29 11:10 | 9.4M | |
![[SND]](/icons/sound2.gif) | djgg.mp3 | 2022-07-30 05:09 | 9.4M | |
![[SND]](/icons/sound2.gif) | toxic27.mp3 | 2022-07-04 09:47 | 9.4M | |
![[SND]](/icons/sound2.gif) | LINE_WITH.mp3 | 2022-06-28 17:19 | 9.4M | |
![[SND]](/icons/sound2.gif) | Miyagi_-_Marlboro_65373356.mp3 | 2022-07-20 14:22 | 9.4M | |
![[SND]](/icons/sound2.gif) | Big Baby Tape - Broke Day.mp3 | 2022-07-12 14:11 | 9.4M | |
![[SND]](/icons/sound2.gif) | Yasudahlah.mp3 | 2022-07-04 01:33 | 9.4M | |
![[SND]](/icons/sound2.gif) | Rhey5.mp3 | 2022-06-28 11:57 | 9.4M | |
![[SND]](/icons/sound2.gif) | Сектор Газа - Грязная кровь.mp3 | 2022-07-18 18:09 | 9.4M | |
![[SND]](/icons/sound2.gif) | Agata_Kristi_-_Kak_na_vojjne_(musmore.com).mp3 | 2022-06-29 08:38 | 9.4M | |
![[SND]](/icons/sound2.gif) | Эльбрус Джанмирзоев feat. Alexandros Tsopozidis - Бродяга (feat. Alexandros Tsop.mp3 | 2022-07-14 16:32 | 9.4M | |
![[SND]](/icons/sound2.gif) | Rhey27.mp3 | 2022-06-28 12:02 | 9.4M | |
![[SND]](/icons/sound2.gif) | Mầu thời gian-Thơ Đoàn Phú Tứ-1.mp3 | 2022-07-13 00:29 | 9.4M | |
![[SND]](/icons/sound2.gif) | anto12.mp3 | 2022-07-12 12:44 | 9.4M | |
![[SND]](/icons/sound2.gif) | malsub.mp3 | 2022-07-08 11:42 | 9.4M | |
![[SND]](/icons/sound2.gif) | Takbr.mp3 | 2022-07-08 08:16 | 9.4M | |
![[SND]](/icons/sound2.gif) | nofal2.mp3 | 2022-06-29 19:40 | 9.4M | |
![[SND]](/icons/sound2.gif) | Alan Walker & Ava Max - Alone, Pt. II.mp3 | 2022-07-13 17:51 | 9.4M | |
![[SND]](/icons/sound2.gif) | ERA - Ameno.mp3 | 2022-07-05 09:11 | 9.4M | |
![[SND]](/icons/sound2.gif) | kal5.mp3 | 2022-07-16 16:06 | 9.4M | |
![[SND]](/icons/sound2.gif) | kabar.mp3 | 2022-06-29 09:25 | 9.3M | |
![[SND]](/icons/sound2.gif) | 03. Heaven.mp3 | 2022-07-16 08:22 | 9.3M | |
![[SND]](/icons/sound2.gif) | mihail_shufutinskij_-_murka_(z2.fm).mp3 | 2022-07-05 20:18 | 9.3M | |
![[SND]](/icons/sound2.gif) | Агата Кристи - Как на войне.mp3 | 2022-07-02 12:17 | 9.3M | |
![[SND]](/icons/sound2.gif) | Bryan Adams - Heaven.mp3 | 2022-07-04 00:50 | 9.3M | |
![[SND]](/icons/sound2.gif) | bugoy11.mp3 | 2022-06-28 06:34 | 9.3M | |
![[SND]](/icons/sound2.gif) | Tom_Odell_-_Another_Love_(musmore.com).mp3 | 2022-07-06 08:35 | 9.3M | |
![[SND]](/icons/sound2.gif) | hanz7.mp3 | 2022-07-06 11:45 | 9.3M | |
![[SND]](/icons/sound2.gif) | GlimpseofUsJoji.mp3 | 2022-06-29 11:10 | 9.3M | |
![[SND]](/icons/sound2.gif) | Glimpse of Us Joji.mp3 | 2022-06-29 09:53 | 9.3M | |
![[SND]](/icons/sound2.gif) | jon3.mp3 | 2022-06-28 00:40 | 9.3M | |
![[SND]](/icons/sound2.gif) | zali8.mp3 | 2022-07-16 08:09 | 9.3M | |
![[SND]](/icons/sound2.gif) | Duck_Sauce_-_Barbra_Streisand_Orig_(getmp3.pro).mp3 | 2022-07-14 17:06 | 9.3M | |
![[SND]](/icons/sound2.gif) | Allj (1).mp3 | 2022-07-26 14:13 | 9.3M | |
![[SND]](/icons/sound2.gif) | WakChak8.mp3 | 2022-07-07 21:33 | 9.3M | |
![[SND]](/icons/sound2.gif) | good person.mp3 | 2022-07-12 02:15 | 9.3M | |
![[SND]](/icons/sound2.gif) | Серёга - Чёрный бумер.mp3 | 2022-07-05 19:45 | 9.3M | |
![[SND]](/icons/sound2.gif) | Серга_-_Чрный_бумер.mp3.mp3 | 2022-06-28 10:38 | 9.3M | |
![[SND]](/icons/sound2.gif) | Pentakill feat. Noora Louhimo - Stormrazor.mp3 | 2022-07-06 18:51 | 9.3M | |
![[SND]](/icons/sound2.gif) | SQUARE ENIX - Final Fantasy Crystal Chronicles Echoes of Time Disc 1 (54).mp3 | 2022-07-10 13:43 | 9.3M | |
![[SND]](/icons/sound2.gif) | Demetori - Touhou Judgement in the Sixtieth Year ~ Fate of Sixty Years.mp3 | 2022-07-09 11:14 | 9.3M | |
![[SND]](/icons/sound2.gif) | WUYU.mp3 | 2022-07-31 17:29 | 9.3M | |
![[SND]](/icons/sound2.gif) | Lady Gaga feat. Colby O'Donis - Just Dance.mp3 | 2022-07-10 10:48 | 9.3M | |
![[SND]](/icons/sound2.gif) | Anuel-AA-Myke-Towers-Jhay-Cortez-Subelo.mp3 | 2022-07-09 07:47 | 9.3M | |
![[SND]](/icons/sound2.gif) | lana-del-rey-doin-time-official-music-video.mp3 | 2022-07-01 22:12 | 9.3M | |
![[SND]](/icons/sound2.gif) | DJGASOLINA.mp3 | 2022-07-07 19:57 | 9.3M | |
![[SND]](/icons/sound2.gif) | toxic33.mp3 | 2022-07-04 11:21 | 9.3M | |
![[SND]](/icons/sound2.gif) | Coolio feat LV - Gangsta's Paradise.mp3 | 2022-07-12 08:17 | 9.3M | |
![[SND]](/icons/sound2.gif) | Kaun.mp3 | 2022-07-08 10:40 | 9.3M | |
![[SND]](/icons/sound2.gif) | Cyrus3.mp3 | 2022-07-12 21:17 | 9.3M | |
![[SND]](/icons/sound2.gif) | Har2.mp3 | 2022-07-08 13:06 | 9.3M | |
![[SND]](/icons/sound2.gif) | Subway Surfers OST Extended.mp3 | 2022-07-18 16:14 | 9.3M | |
![[SND]](/icons/sound2.gif) | TOTTO2.mp3 | 2022-07-15 16:38 | 9.3M | |
![[SND]](/icons/sound2.gif) | Addi Sunni (DJJOhAL.Com).mp3 | 2022-07-13 03:19 | 9.3M | |
![[SND]](/icons/sound2.gif) | Wendy.mp3 | 2022-07-07 23:29 | 9.3M | |
![[SND]](/icons/sound2.gif) | zrkdjbody.mp3 | 2022-06-29 07:54 | 9.3M | |
![[SND]](/icons/sound2.gif) | muslum-gurses-ft-canbay-wolker-ben-aglarim-ikimizin-yerine.mp3 | 2022-07-06 20:44 | 9.3M | |
![[SND]](/icons/sound2.gif) | Miyagi - Marlboro.mp3 | 2022-07-10 19:42 | 9.3M | |
![[SND]](/icons/sound2.gif) | pamstribute pianino montage.mp3 | 2022-07-04 23:40 | 9.3M | |
![[SND]](/icons/sound2.gif) | 5LaguSad.mp3 | 2022-06-29 22:21 | 9.3M | |
![[SND]](/icons/sound2.gif) | DezzDKRN.mp3 | 2022-07-08 11:15 | 9.3M | |
![[SND]](/icons/sound2.gif) | seijuro5.mp3 | 2022-06-27 20:01 | 9.3M | |
![[SND]](/icons/sound2.gif) | anggihdj6.mp3 | 2022-06-29 04:50 | 9.3M | |
![[SND]](/icons/sound2.gif) | (28 Hz) Night Lovell - Fukk!! CodeRED (feat. Lil West) [Low Bass By Lebed🍇].mp3 | 2022-07-12 23:27 | 9.3M | |
![[SND]](/icons/sound2.gif) | Dr_Alban_-_Its_My_Life_47995646.mp3 | 2022-07-10 13:08 | 9.3M | |
![[SND]](/icons/sound2.gif) | jankoo2.mp3 | 2022-07-11 18:35 | 9.3M | |
![[SND]](/icons/sound2.gif) | vivienne_mort_-_persefona_muzati.net.mp3 | 2022-07-04 17:11 | 9.3M | |
![[SND]](/icons/sound2.gif) | 14. Get That Love.mp3 | 2022-07-04 00:40 | 9.3M | |
![[SND]](/icons/sound2.gif) | turu4.mp3 | 2022-07-21 07:19 | 9.3M | |
![[SND]](/icons/sound2.gif) | Terdj2.mp3 | 2022-07-01 10:31 | 9.3M | |
![[SND]](/icons/sound2.gif) | NeverPaps.mp3 | 2022-06-29 05:33 | 9.3M | |
![[SND]](/icons/sound2.gif) | 2pac3.mp3 | 2022-07-15 13:55 | 9.3M | |
![[SND]](/icons/sound2.gif) | fakyu.mp3 | 2022-06-30 10:48 | 9.3M | |
![[SND]](/icons/sound2.gif) | dlndj0.mp3 | 2022-07-04 03:38 | 9.3M | |
![[SND]](/icons/sound2.gif) | Professor_Lebedinskijj_Dmitrijj_Nagiev_Viktor_Bondaryuk_-_YA_ejo_khojj_YA_tancuyu_pyanyjj_na_stole_(musmore.com).mp3 | 2022-07-09 11:08 | 9.3M | |
![[SND]](/icons/sound2.gif) | Nothinggonnachangemyloveforyou.mp3 | 2022-07-04 01:27 | 9.3M | |
![[SND]](/icons/sound2.gif) | Lana_Del_Rey_-_Love_Official_Audio_(getmp3.pro).mp3 | 2022-06-28 01:46 | 9.3M | |
![[SND]](/icons/sound2.gif) | vedi74.mp3 | 2022-06-29 12:17 | 9.3M | |
![[SND]](/icons/sound2.gif) | vedi20.mp3 | 2022-06-29 12:27 | 9.3M | |
![[SND]](/icons/sound2.gif) | c7.mp3 | 2022-07-15 11:16 | 9.3M | |
![[SND]](/icons/sound2.gif) | Rudh4.mp3 | 2022-07-13 15:34 | 9.3M | |
![[SND]](/icons/sound2.gif) | bugoy14.mp3 | 2022-06-28 06:35 | 9.3M | |
![[SND]](/icons/sound2.gif) | TOTTO24.mp3 | 2022-07-15 16:32 | 9.3M | |
![[SND]](/icons/sound2.gif) | Kagome1.mp3 | 2022-07-09 05:12 | 9.3M | |
![[SND]](/icons/sound2.gif) | Abll7.mp3 | 2022-07-15 15:52 | 9.2M | |
![[SND]](/icons/sound2.gif) | Shouse - Cum Tonight (Tomat edit).mp3 | 2022-07-05 00:28 | 9.2M | |
![[SND]](/icons/sound2.gif) | DIARY.mp3 | 2022-07-13 08:56 | 9.2M | |
![[SND]](/icons/sound2.gif) | boombox5.mp3 | 2022-06-28 15:50 | 9.2M | |
![[SND]](/icons/sound2.gif) | halik.mp3 | 2022-06-28 06:37 | 9.2M | |
![[SND]](/icons/sound2.gif) | Cbl.mp3 | 2022-07-03 06:21 | 9.2M | |
![[SND]](/icons/sound2.gif) | vedi7.mp3 | 2022-06-29 12:25 | 9.2M | |
![[SND]](/icons/sound2.gif) | rockstar.mp3 | 2022-07-06 08:02 | 9.2M | |
![[SND]](/icons/sound2.gif) | apaelotega.mp3 | 2022-07-19 01:39 | 9.2M | |
![[SND]](/icons/sound2.gif) | 2Pac — If I Die 2Nite (www.lightaudio.ru).mp3 | 2022-07-15 19:51 | 9.2M | |
![[SND]](/icons/sound2.gif) | o32.mp3 | 2022-07-08 12:41 | 9.2M | |
![[SND]](/icons/sound2.gif) | Nikuya_no_You_ni_~肉屋のように~_Yapoos_456240574.mp3 | 2022-06-29 19:00 | 9.2M | |
![[SND]](/icons/sound2.gif) | Baby Mish_I love.mp3 | 2022-07-03 18:59 | 9.2M | |
![[SND]](/icons/sound2.gif) | tayc.mp3 | 2022-07-06 19:38 | 9.2M | |
![[SND]](/icons/sound2.gif) | m8.mp3 | 2022-07-12 12:37 | 9.2M | |
![[SND]](/icons/sound2.gif) | jika cinta dia.mp3 | 2022-07-03 09:35 | 9.2M | |
![[SND]](/icons/sound2.gif) | dia.mp3 | 2022-07-03 09:22 | 9.2M | |
![[SND]](/icons/sound2.gif) | cinta1.mp3 | 2022-07-08 12:03 | 9.2M | |
![[SND]](/icons/sound2.gif) | bugoy3.mp3 | 2022-06-28 06:35 | 9.2M | |
![[SND]](/icons/sound2.gif) | rahgozar by ramin hosseinpour.mp3 | 2022-07-10 06:22 | 9.2M | |
![[SND]](/icons/sound2.gif) | Lagu Jepang _ YOASOBI - Ano Yume wo Nazotte (lirik dan terjemahan indonesia).mp3 | 2022-07-10 06:19 | 9.2M | |
![[SND]](/icons/sound2.gif) | Ano Yume.mp3 | 2022-07-11 00:59 | 9.2M | |
![[SND]](/icons/sound2.gif) | bugoy13.mp3 | 2022-06-28 06:34 | 9.2M | |
![[SND]](/icons/sound2.gif) | Jump.mp3 | 2022-07-04 01:18 | 9.2M | |
![[SND]](/icons/sound2.gif) | La Coka Nostra - Get You By.mp3 | 2022-06-30 08:46 | 9.2M | |
![[SND]](/icons/sound2.gif) | LaCocaNosa.mp3 | 2022-07-10 13:36 | 9.2M | |
![[SND]](/icons/sound2.gif) | Arman.mp3 | 2022-07-01 13:25 | 9.2M | |
![[SND]](/icons/sound2.gif) | bugoy12.mp3 | 2022-06-28 06:34 | 9.2M | |
![[SND]](/icons/sound2.gif) | Blabbermouth prod Bailbeats (CDQ).mp3 | 2022-06-30 01:50 | 9.2M | |
![[SND]](/icons/sound2.gif) | 24. Erik Lieders - You're My Heart, You're My Soul.mp3 | 2022-07-15 19:43 | 9.2M | |
![[SND]](/icons/sound2.gif) | Miyagi__Endshpil_Polovina_moya.mp3 | 2022-07-14 15:34 | 9.2M | |
![[SND]](/icons/sound2.gif) | Jhon02.mp3 | 2022-07-05 00:06 | 9.2M | |
![[SND]](/icons/sound2.gif) | 26. Khoon Bazi - Dariush.mp3 | 2022-06-28 13:54 | 9.2M | |
![[SND]](/icons/sound2.gif) | zrkbertahanterluka.mp3 | 2022-06-29 07:45 | 9.2M | |
![[SND]](/icons/sound2.gif) | Dede.mp3 | 2022-06-27 18:13 | 9.2M | |
![[SND]](/icons/sound2.gif) | bugoy9.mp3 | 2022-06-28 06:36 | 9.2M | |
![[SND]](/icons/sound2.gif) | dor1.mp3 | 2022-06-30 15:34 | 9.2M | |
![[SND]](/icons/sound2.gif) | nana3.mp3 | 2022-06-28 16:01 | 9.2M | |
![[SND]](/icons/sound2.gif) | MiyaGi & Эндшпиль - Бада-бум (Frost & Robby Mond Remix).mp3 | 2022-06-28 17:02 | 9.2M | |
![[SND]](/icons/sound2.gif) | сабвей саферс.mp3 | 2022-07-05 20:57 | 9.2M | |
![[SND]](/icons/sound2.gif) | 02. Azadi - Rana Mansour.mp3 | 2022-06-28 13:52 | 9.2M | |
![[SND]](/icons/sound2.gif) | Motionless_In_White_-_Untouchable_51286826.mp3 | 2022-06-27 20:46 | 9.2M | |
![[SND]](/icons/sound2.gif) | sadturner20.mp3 | 2022-07-01 03:25 | 9.2M | |
![[SND]](/icons/sound2.gif) | Qimzy11.mp3 | 2022-07-04 08:18 | 9.2M | |
![[SND]](/icons/sound2.gif) | Виктор Цой - Группа крови.mp3 | 2022-07-16 09:24 | 9.2M | |
![[SND]](/icons/sound2.gif) | f5.mp3 | 2022-07-02 11:10 | 9.2M | |
![[SND]](/icons/sound2.gif) | hadi1.mp3 | 2022-06-30 03:50 | 9.2M | |
![[SND]](/icons/sound2.gif) | Isaac2.mp3 | 2022-07-07 06:21 | 9.2M | |
![[SND]](/icons/sound2.gif) | msudv.mp3 | 2022-07-14 06:50 | 9.2M | |
![[SND]](/icons/sound2.gif) | Inhlambuluko Pt3.mp3 | 2022-07-13 21:53 | 9.2M | |
![[SND]](/icons/sound2.gif) | yg-go-loko-ft-tyga-jon-z.mp3 | 2022-07-01 13:08 | 9.2M | |
![[SND]](/icons/sound2.gif) | DragonForce.mp3 | 2022-07-11 11:44 | 9.2M | |
![[SND]](/icons/sound2.gif) | Pentakill - Deathfire Grasp.mp3 | 2022-07-06 16:50 | 9.2M | |
![[SND]](/icons/sound2.gif) | dije12.mp3 | 2022-07-01 14:42 | 9.2M | |
![[SND]](/icons/sound2.gif) | чин чан чон чи - чича чочи.mp3 | 2022-07-11 22:52 | 9.2M | |
![[SND]](/icons/sound2.gif) | DJ SARI ROTI SARI ROTI X GOYANG SAMPE BAWAH __ SOUND MUNGIL VIRAL TIKTOK YANG KALIAN CARI (1).mp3 | 2022-07-14 05:14 | 9.2M | |
![[SND]](/icons/sound2.gif) | Raffa Affar - Tiara (Cover) Lirik Lagu _ Jika kau bertemu aku begini, berlumpur tubuh dan....mp3 | 2022-06-27 18:30 | 9.2M | |
![[SND]](/icons/sound2.gif) | smpebwah.mp3 | 2022-06-27 18:12 | 9.2M | |
![[SND]](/icons/sound2.gif) | Iyhp51.mp3 | 2022-07-16 01:26 | 9.2M | |
![[SND]](/icons/sound2.gif) | LOFIN.mp3 | 2022-06-29 14:15 | 9.2M | |
![[SND]](/icons/sound2.gif) | listen.mp3 | 2022-07-02 22:21 | 9.2M | |
![[SND]](/icons/sound2.gif) | ciki.mp3 | 2022-06-27 18:21 | 9.2M | |
![[SND]](/icons/sound2.gif) | diyo7.mp3 | 2022-07-02 01:49 | 9.2M | |
![[SND]](/icons/sound2.gif) | zrkdjsampebawah.mp3 | 2022-06-29 07:39 | 9.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ SARI ROTI SARI ROTI X GOYANG SAMPE BAWAH SOUND MUNGIL VIRAL TIKTOK YANG KALIAN CARI .mp3 | 2022-06-28 08:05 | 9.2M | |
![[SND]](/icons/sound2.gif) | sampebawah.mp3 | 2022-07-15 16:38 | 9.2M | |
![[SND]](/icons/sound2.gif) | sampe276.mp3 | 2022-07-11 03:46 | 9.2M | |
![[SND]](/icons/sound2.gif) | lagu kane.mp3 | 2022-06-28 08:06 | 9.2M | |
![[SND]](/icons/sound2.gif) | darkd.mp3 | 2022-07-10 10:04 | 9.2M | |
![[SND]](/icons/sound2.gif) | botsurpdj7.mp3 | 2022-07-04 08:42 | 9.2M | |
![[SND]](/icons/sound2.gif) | Tiktok6.mp3 | 2022-06-29 01:04 | 9.2M | |
![[SND]](/icons/sound2.gif) | ROTI.mp3 | 2022-07-04 18:52 | 9.2M | |
![[SND]](/icons/sound2.gif) | Bekbekbek.mp3 | 2022-07-02 21:23 | 9.2M | |
![[SND]](/icons/sound2.gif) | ANNA_ASTI_-_Po_baram_74376135.mp3 | 2022-07-02 10:56 | 9.2M | |
![[SND]](/icons/sound2.gif) | hayalim-almonim-anthem-of-the-lehi-mirror.mp3 | 2022-07-07 20:34 | 9.2M | |
![[VID]](/icons/movie.gif) | UBA Album -العائلة الكبرى- Titre 2_ Haz l'cachecol.mp4 | 2022-07-03 03:42 | 9.2M | |
![[VID]](/icons/movie.gif) | UBA.mp4 | 2022-07-03 03:50 | 9.2M | |
![[SND]](/icons/sound2.gif) | IMG_8256.MOV.mp3 | 2022-07-08 06:05 | 9.2M | |
![[SND]](/icons/sound2.gif) | cirnos.mp3 | 2022-07-06 19:29 | 9.2M | |
![[SND]](/icons/sound2.gif) | dkl12.mp3 | 2022-07-15 02:27 | 9.2M | |
![[SND]](/icons/sound2.gif) | Кино - Группа крови.mp3 | 2022-07-10 13:05 | 9.1M | |
![[SND]](/icons/sound2.gif) | vipf.mp3 | 2022-06-27 12:24 | 9.1M | |
![[SND]](/icons/sound2.gif) | TOTTO7.mp3 | 2022-07-15 18:06 | 9.1M | |
![[SND]](/icons/sound2.gif) | TOTTO7(1).mp3 | 2022-07-16 08:06 | 9.1M | |
![[SND]](/icons/sound2.gif) | rusuhdong2.mp3 | 2022-07-06 00:17 | 9.1M | |
![[SND]](/icons/sound2.gif) | dsc1.mp3 | 2022-07-19 18:45 | 9.1M | |
![[SND]](/icons/sound2.gif) | gruppa_kino_gruppa_krovi.mp3 | 2022-06-28 22:04 | 9.1M | |
![[SND]](/icons/sound2.gif) | PD54.mp3 | 2022-07-01 04:05 | 9.1M | |
![[SND]](/icons/sound2.gif) | losin.mp3 | 2022-07-04 12:55 | 9.1M | |
![[SND]](/icons/sound2.gif) | The Next episode.mp3 | 2022-07-05 22:50 | 9.1M | |
![[SND]](/icons/sound2.gif) | The Next Episode.mp3 | 2022-07-05 11:53 | 9.1M | |
![[SND]](/icons/sound2.gif) | The Next Episode OG.mp3 | 2022-07-01 22:24 | 9.1M | |
![[SND]](/icons/sound2.gif) | Nebezao_-_Black_Panther_58348769.mp3 | 2022-06-28 08:24 | 9.1M | |
![[SND]](/icons/sound2.gif) | FlowgSei.mp3 | 2022-07-01 12:29 | 9.1M | |
![[SND]](/icons/sound2.gif) | Sony.mp3 | 2022-07-12 08:44 | 9.1M | |
![[SND]](/icons/sound2.gif) | dom113.mp3 | 2022-07-03 06:24 | 9.1M | |
![[SND]](/icons/sound2.gif) | STARSET-Satellite-kissvk.com.mp3 | 2022-07-14 10:19 | 9.1M | |
![[SND]](/icons/sound2.gif) | Цинк Уродов-NE MANDI-kissvk.com.mp3 | 2022-07-13 18:02 | 9.1M | |
![[SND]](/icons/sound2.gif) | Dawn.mp3 | 2022-07-01 11:53 | 9.1M | |
![[SND]](/icons/sound2.gif) | Oy.mp3 | 2022-07-12 16:45 | 9.1M | |
![[SND]](/icons/sound2.gif) | Bow Wow ft. Omarion - Let Me Hold You(MP3_320K).mp3 | 2022-07-13 00:13 | 9.1M | |
![[SND]](/icons/sound2.gif) | Mascarpone - Faceless (1).mp3 | 2022-07-05 16:32 | 9.1M | |
![[SND]](/icons/sound2.gif) | ookan1.mp3 | 2022-07-05 03:22 | 9.1M | |
![[SND]](/icons/sound2.gif) | ✵MUZ_RUS✵₃₈ ོ - Дикий караван (remix).mp3 | 2022-07-14 12:05 | 9.1M | |
![[SND]](/icons/sound2.gif) | SnoopDoog.mp3 | 2022-07-10 13:36 | 9.1M | |
![[SND]](/icons/sound2.gif) | Snoop Dogg feat. Dr. Dre - Nuthin But A G'Thang.mp3 | 2022-06-30 08:46 | 9.1M | |
![[SND]](/icons/sound2.gif) | 14. Last Name.mp3 | 2022-06-30 01:09 | 9.1M | |
![[SND]](/icons/sound2.gif) | adha.mp3 | 2022-07-09 12:42 | 9.1M | |
![[SND]](/icons/sound2.gif) | toxic9.mp3 | 2022-07-04 06:40 | 9.1M | |
![[SND]](/icons/sound2.gif) | ov0.mp3 | 2022-07-04 20:10 | 9.1M | |
![[SND]](/icons/sound2.gif) | DN13.mp3 | 2022-07-06 21:39 | 9.1M | |
![[SND]](/icons/sound2.gif) | WakChak1.mp3 | 2022-07-07 21:31 | 9.1M | |
![[SND]](/icons/sound2.gif) | Anim.mp3 | 2022-07-13 02:41 | 9.1M | |
![[SND]](/icons/sound2.gif) | brutto-garri.mp3 | 2022-07-10 03:16 | 9.1M | |
![[SND]](/icons/sound2.gif) | Basta_-_Mama_61892961.mp3 | 2022-07-19 16:18 | 9.1M | |
![[SND]](/icons/sound2.gif) | c6.mp3 | 2022-07-15 11:15 | 9.1M | |
![[SND]](/icons/sound2.gif) | 24. Normal - Toomaj .mp3 | 2022-06-28 13:54 | 9.1M | |
![[SND]](/icons/sound2.gif) | DJ mix june 28.mp3 | 2022-06-28 19:17 | 9.1M | |
![[SND]](/icons/sound2.gif) | I WIll Not Be Broken.mp3 | 2022-07-15 20:15 | 9.1M | |
![[SND]](/icons/sound2.gif) | Nick10.mp3 | 2022-06-30 17:35 | 9.1M | |
![[SND]](/icons/sound2.gif) | Milfy_-_Angin_Malam_(Lagu_Minang_Populer)(256k).mp3 | 2022-07-07 07:07 | 9.1M | |
![[SND]](/icons/sound2.gif) | ClayCia1.mp3 | 2022-06-30 00:19 | 9.1M | |
![[SND]](/icons/sound2.gif) | 15. Lucky Day.mp3 | 2022-07-04 00:40 | 9.1M | |
![[SND]](/icons/sound2.gif) | Mr. Bond - Holding Out For A Tarrant.mp3 | 2022-07-01 19:08 | 9.1M | |
![[SND]](/icons/sound2.gif) | I Will Not Be Broken.mp3 | 2022-07-23 00:08 | 9.1M | |
![[SND]](/icons/sound2.gif) | Ария - Беспечный ангел.mp3 | 2022-07-02 21:36 | 9.1M | |
![[SND]](/icons/sound2.gif) | Infinty.mp3 | 2022-06-27 23:23 | 9.1M | |
![[VID]](/icons/movie.gif) | ThomasSlebew.mp4 | 2022-07-14 10:18 | 9.1M | |
![[SND]](/icons/sound2.gif) | vedi86.mp3 | 2022-06-29 12:20 | 9.1M | |
![[SND]](/icons/sound2.gif) | Pi7.mp3 | 2022-06-28 01:40 | 9.1M | |
![[SND]](/icons/sound2.gif) | mrv7.mp3 | 2022-07-01 06:01 | 9.1M | |
![[SND]](/icons/sound2.gif) | Nyusha-Выше-kissvk.com.mp3 | 2022-07-06 01:28 | 9.1M | |
![[SND]](/icons/sound2.gif) | Aron1.mp3 | 2022-07-06 04:31 | 9.1M | |
![[SND]](/icons/sound2.gif) | Rizky_Febian_-_Seperti_Kisah_[Official_Lyric_Video](256k).mp3 | 2022-07-07 15:47 | 9.1M | |
![[SND]](/icons/sound2.gif) | kgfsulthann.mp3 | 2022-06-29 12:47 | 9.1M | |
![[SND]](/icons/sound2.gif) | lucaz15.mp3 | 2022-07-02 10:19 | 9.1M | |
![[SND]](/icons/sound2.gif) | anto20.mp3 | 2022-07-16 08:16 | 9.1M | |
![[SND]](/icons/sound2.gif) | nana14.mp3 | 2022-06-28 16:02 | 9.1M | |
![[SND]](/icons/sound2.gif) | In Hame Khoshi - Mosayeb Sarshakh.mp3 | 2022-06-28 13:54 | 9.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ TIBAN BAHANA PUI REMIX TERBARU FULL BASS.mp3 | 2022-07-04 15:09 | 9.1M | |
![[SND]](/icons/sound2.gif) | GP01.mp3 | 2022-07-06 04:58 | 9.1M | |
![[SND]](/icons/sound2.gif) | GANG.mp3 | 2022-07-08 12:04 | 9.1M | |
![[SND]](/icons/sound2.gif) | Push.mp3 | 2022-07-08 10:40 | 9.1M | |
![[SND]](/icons/sound2.gif) | Arthur_Nery_-_Pagsamo_(Lyrics)(256k).mp3 | 2022-07-17 02:51 | 9.1M | |
![[SND]](/icons/sound2.gif) | Luna_-_Spyashhaya_krasavica_(musmore.com).mp3 | 2022-07-06 18:12 | 9.1M | |
![[SND]](/icons/sound2.gif) | Just The Two Of Us - Bill Withers_ Grove (2).mp3 | 2022-06-30 04:13 | 9.1M | |
![[SND]](/icons/sound2.gif) | Зомб - В черном панамера.mp3 | 2022-07-09 11:42 | 9.1M | |
![[SND]](/icons/sound2.gif) | TrippieRedd.mp3 | 2022-07-04 21:30 | 9.1M | |
![[SND]](/icons/sound2.gif) | Trippie Redd.mp3 | 2022-07-04 21:30 | 9.1M | |
![[SND]](/icons/sound2.gif) | Seeyouagain.mp3 | 2022-07-04 01:30 | 9.1M | |
![[SND]](/icons/sound2.gif) | Justthetwoofus.mp3 | 2022-07-04 01:18 | 9.1M | |
![[SND]](/icons/sound2.gif) | Txrbo - uy.mp3 | 2022-07-01 14:03 | 9.1M | |
![[SND]](/icons/sound2.gif) | Kanjo2.mp3 | 2022-07-04 09:15 | 9.1M | |
![[SND]](/icons/sound2.gif) | Vizar2.mp3 | 2022-07-16 04:01 | 9.1M | |
![[SND]](/icons/sound2.gif) | Dr Dre - Ain't Nuttin Nut a G Thang (427).mp3 | 2022-07-12 04:39 | 9.1M | |
![[SND]](/icons/sound2.gif) | Applause - Applause.mp3 | 2022-07-12 23:51 | 9.1M | |
![[SND]](/icons/sound2.gif) | potion.mp3 | 2022-07-16 01:51 | 9.1M | |
![[SND]](/icons/sound2.gif) | solo.mp3 | 2022-07-08 04:07 | 9.0M | |
![[SND]](/icons/sound2.gif) | miyagi-dumal-kopal-kopal-kuda-podevalsya-napalm-napalm.mp3 | 2022-08-01 17:14 | 9.0M | |
![[SND]](/icons/sound2.gif) | AK-47_-_Krugom_tonirovan_70551218.mp3 | 2022-07-06 22:21 | 9.0M | |
![[SND]](/icons/sound2.gif) | vedi45.mp3 | 2022-06-29 12:11 | 9.0M | |
![[SND]](/icons/sound2.gif) | gira1.mp3 | 2022-06-29 19:12 | 9.0M | |
![[SND]](/icons/sound2.gif) | Eрболат Жұмабаев - Модный қыз.mp3 | 2022-07-01 05:13 | 9.0M | |
![[SND]](/icons/sound2.gif) | club.mp3 | 2022-07-15 10:25 | 9.0M | |
![[SND]](/icons/sound2.gif) | Beatles4.mp3 | 2022-07-13 09:31 | 9.0M | |
![[SND]](/icons/sound2.gif) | AUD-20220625-WA0064.mp3 | 2022-07-01 17:48 | 9.0M | |
![[SND]](/icons/sound2.gif) | X2Download.com - Dragon Age_ Inquisition - Main Theme [Extended] (128 kbps).mp3 | 2022-07-10 22:07 | 9.0M | |
![[SND]](/icons/sound2.gif) | Xanadu 400 unison.mp3 | 2022-06-30 04:25 | 9.0M | |
![[SND]](/icons/sound2.gif) | zakaganteng4.mp3 | 2022-07-04 19:09 | 9.0M | |
![[SND]](/icons/sound2.gif) | dream.mp3 | 2022-07-15 10:26 | 9.0M | |
![[SND]](/icons/sound2.gif) | Zeeus5.mp3 | 2022-07-26 01:45 | 9.0M | |
![[SND]](/icons/sound2.gif) | Wait Forever.mp3 | 2022-07-23 00:11 | 9.0M | |
![[SND]](/icons/sound2.gif) | Xanadu low db.mp3 | 2022-06-29 22:05 | 9.0M | |
![[SND]](/icons/sound2.gif) | mobi64.mp3 | 2022-07-06 05:28 | 9.0M | |
![[SND]](/icons/sound2.gif) | Grace Jones - La Vie En Rose (Disco Syndicate Mix)(2).mp3 | 2022-07-11 20:43 | 9.0M | |
![[SND]](/icons/sound2.gif) | aikaw12.mp3 | 2022-07-17 13:48 | 9.0M | |
![[SND]](/icons/sound2.gif) | ugun5.mp3 | 2022-07-02 03:57 | 9.0M | |
![[SND]](/icons/sound2.gif) | simple.mp3 | 2022-07-16 01:58 | 9.0M | |
![[SND]](/icons/sound2.gif) | Агата Кристи - Чёрная луна.mp3 | 2022-07-14 17:11 | 9.0M | |
![[SND]](/icons/sound2.gif) | TAKBIRAN.mp3 | 2022-07-09 11:59 | 9.0M | |
![[SND]](/icons/sound2.gif) | TOTTO28.mp3 | 2022-07-15 16:32 | 9.0M | |
![[SND]](/icons/sound2.gif) | djalex11.mp3 | 2022-07-09 19:15 | 9.0M | |
![[SND]](/icons/sound2.gif) | Slipknot - Eyeless.mp3 | 2022-07-14 10:25 | 9.0M | |
![[SND]](/icons/sound2.gif) | TOUCH_BY_TOUCH-by-Joywlyricscrea_(getmp3.pro).mp3 | 2022-07-09 16:53 | 9.0M | |
![[SND]](/icons/sound2.gif) | O3.mp3 | 2022-07-05 20:44 | 9.0M | |
![[SND]](/icons/sound2.gif) | Monsters - Katie Sky (Lirik Lagu Terjemahan) - TikTok I see your monsters I see your pain(MP3_320K).mp3 | 2022-06-29 07:03 | 9.0M | |
![[SND]](/icons/sound2.gif) | Sektor_Gaza_-_Demobilizaciya_48202414.mp3 | 2022-07-05 08:46 | 9.0M | |
![[SND]](/icons/sound2.gif) | [OSTnime]_AAA_-_Wake_up!.mp3 | 2022-06-30 20:04 | 9.0M | |
![[SND]](/icons/sound2.gif) | Relaxing_music_-_Obijmy_Remix_(musmore.com).mp3 | 2022-06-28 10:08 | 9.0M | |
![[SND]](/icons/sound2.gif) | Comedoz_-_Tjotya_zina_-_tjotya_zina_60687968.mp3 | 2022-07-09 10:07 | 9.0M | |
![[SND]](/icons/sound2.gif) | zrkdawinslow.mp3 | 2022-06-29 07:48 | 9.0M | |
![[SND]](/icons/sound2.gif) | Cyrus6.mp3 | 2022-07-12 21:17 | 9.0M | |
![[SND]](/icons/sound2.gif) | mountains.mp3 | 2022-08-01 22:59 | 9.0M | |
![[SND]](/icons/sound2.gif) | grandson, Jessie Reyez - Rain.mp3 | 2022-07-04 21:16 | 9.0M | |
![[SND]](/icons/sound2.gif) | Miyagi_Net_Vojne.mp3 | 2022-07-02 13:07 | 9.0M | |
![[SND]](/icons/sound2.gif) | Sofia Reyes - 1, 2, 3 (feat. Jason Derulo & De La Ghetto) [Official Video].mp3 | 2022-07-02 19:16 | 9.0M | |
![[SND]](/icons/sound2.gif) | vedi93.mp3 | 2022-06-29 12:22 | 9.0M | |
![[SND]](/icons/sound2.gif) | NoGGano_-_Mama-ama_kriminal_66942703.mp3 | 2022-07-12 07:14 | 9.0M | |
![[SND]](/icons/sound2.gif) | Gorgonox - Whore of Babylon.mp3 | 2022-07-01 01:25 | 9.0M | |
![[SND]](/icons/sound2.gif) | малинновыйрассвет.mp3 | 2022-07-14 09:44 | 9.0M | |
![[SND]](/icons/sound2.gif) | JEndshpil_-_Malinovyjj_Rassvet_64629386.mp3 | 2022-07-09 00:57 | 9.0M | |
![[SND]](/icons/sound2.gif) | Macklemore- Ryan Lewis feat. Wanz-Thrift Shop -feat. Wanz--kissvk.com.mp3 | 2022-06-30 21:57 | 9.0M | |
![[SND]](/icons/sound2.gif) | X2Download.com - Light of the Seven (128 kbps).mp3 | 2022-07-10 22:07 | 9.0M | |
![[SND]](/icons/sound2.gif) | drfting.mp3 | 2022-07-05 16:26 | 9.0M | |
![[SND]](/icons/sound2.gif) | Джоззи - Дыши.mp3 | 2022-07-09 10:34 | 9.0M | |
![[SND]](/icons/sound2.gif) | key.mp3 | 2022-07-14 20:15 | 9.0M | |
![[SND]](/icons/sound2.gif) | hahaha.mp3 | 2022-06-28 03:38 | 9.0M | |
![[SND]](/icons/sound2.gif) | Nick1.mp3 | 2022-06-29 15:54 | 9.0M | |
![[SND]](/icons/sound2.gif) | BATU.mp3 | 2022-07-13 08:54 | 9.0M | |
![[SND]](/icons/sound2.gif) | Оксана Почепа (Акула) - Кислотный DJ.mp3 | 2022-07-04 11:52 | 9.0M | |
![[SND]](/icons/sound2.gif) | BAGAYTAYO.mp3 | 2022-07-01 10:45 | 9.0M | |
![[SND]](/icons/sound2.gif) | krk1.mp3 | 2022-07-13 11:24 | 9.0M | |
![[SND]](/icons/sound2.gif) | BOL.mp3 | 2022-07-15 04:51 | 9.0M | |
![[SND]](/icons/sound2.gif) | chase7.mp3 | 2022-06-29 03:39 | 9.0M | |
![[SND]](/icons/sound2.gif) | ACHRAF.mp3 | 2022-07-08 11:51 | 9.0M | |
![[SND]](/icons/sound2.gif) | Heatwaves.mp3 | 2022-07-04 01:18 | 9.0M | |
![[SND]](/icons/sound2.gif) | Piste 22.mp3 | 2022-07-05 12:50 | 9.0M | |
![[SND]](/icons/sound2.gif) | djalex1.mp3 | 2022-07-03 10:42 | 9.0M | |
![[SND]](/icons/sound2.gif) | АК-47 - мусора.mp3 | 2022-07-05 19:30 | 9.0M | |
![[SND]](/icons/sound2.gif) | АК-47 - Кругом тонирован.mp3 | 2022-07-26 05:52 | 9.0M | |
![[SND]](/icons/sound2.gif) | Adit.mp3 | 2022-07-12 02:17 | 9.0M | |
![[SND]](/icons/sound2.gif) | zrkbernafas.mp3 | 2022-06-29 07:51 | 9.0M | |
![[SND]](/icons/sound2.gif) | KRUGOMtonirovan.mp3 | 2022-07-12 15:49 | 9.0M | |
![[SND]](/icons/sound2.gif) | 50 Cent x Скриптонит х Andy Panda - Привычка (Kerim Remix).mp3 | 2022-07-15 22:58 | 9.0M | |
![[SND]](/icons/sound2.gif) | AUDIO MOTIVACIÓN I.mp3 | 2022-07-01 01:19 | 9.0M | |
![[SND]](/icons/sound2.gif) | Rhey19.mp3 | 2022-06-28 12:00 | 9.0M | |
![[SND]](/icons/sound2.gif) | vedi88.mp3 | 2022-06-29 12:21 | 9.0M | |
![[SND]](/icons/sound2.gif) | dom121.mp3 | 2022-07-03 06:54 | 9.0M | |
![[SND]](/icons/sound2.gif) | indian.mp3 | 2022-07-11 19:12 | 9.0M | |
![[SND]](/icons/sound2.gif) | Bryan Adams - Run To You.mp3 | 2022-07-04 00:50 | 9.0M | |
![[SND]](/icons/sound2.gif) | 77 - prostoooooooo raznosss.mp3 | 2022-07-06 16:33 | 9.0M | |
![[SND]](/icons/sound2.gif) | Kristofer Maddigan - Clip Joint Calamity.mp3 | 2022-07-06 22:12 | 9.0M | |
![[SND]](/icons/sound2.gif) | Luna_-_Grustnyjj_djens_(musmore.com).mp3 | 2022-07-06 18:04 | 9.0M | |
![[SND]](/icons/sound2.gif) | vend6.mp3 | 2022-07-10 14:25 | 9.0M | |
![[SND]](/icons/sound2.gif) | super-instrumental-lezginka.mp3 | 2022-07-15 18:16 | 8.9M | |
![[SND]](/icons/sound2.gif) | desolation.mp3 | 2022-07-08 15:26 | 8.9M | |
![[SND]](/icons/sound2.gif) | escspeed.mp3 | 2022-07-05 04:15 | 8.9M | |
![[SND]](/icons/sound2.gif) | Луна - Грустный Дэнс.mp3 | 2022-07-04 21:19 | 8.9M | |
![[SND]](/icons/sound2.gif) | Владимир Курский-Донбасс-kissvk.com.mp3 | 2022-07-01 12:34 | 8.9M | |
![[SND]](/icons/sound2.gif) | Тетрадь смерти - Тетрадь смерти (1 опенинг) - полная версия.mp3 | 2022-06-30 19:11 | 8.9M | |
![[SND]](/icons/sound2.gif) | PD63.mp3 | 2022-07-01 13:07 | 8.9M | |
![[SND]](/icons/sound2.gif) | sunshinelove.mp3 | 2022-06-29 05:02 | 8.9M | |
![[SND]](/icons/sound2.gif) | br3.mp3 | 2022-07-05 08:33 | 8.9M | |
![[SND]](/icons/sound2.gif) | Дана Соколова feat. Скруджи - Индиго.mp3 | 2022-07-01 09:22 | 8.9M | |
![[SND]](/icons/sound2.gif) | dom98.mp3 | 2022-07-03 06:29 | 8.9M | |
![[SND]](/icons/sound2.gif) | Glimpse of Us - Joji.mp3 | 2022-07-10 17:08 | 8.9M | |
![[SND]](/icons/sound2.gif) | Miyagi_JEndshpil_-_Malinovyjj_rassvet_(musmore.com).mp3 | 2022-06-30 17:44 | 8.9M | |
![[SND]](/icons/sound2.gif) | ALEX SI LIVIU.mp3 | 2022-07-12 10:54 | 8.9M | |
![[SND]](/icons/sound2.gif) | TOTTO35.mp3 | 2022-07-15 16:32 | 8.9M | |
![[SND]](/icons/sound2.gif) | JojiGlimpseOfUs(320K).mp3 | 2022-06-29 03:41 | 8.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Joji Glimpse Of Us_320kbps.mp3 | 2022-07-09 14:37 | 8.9M | |
![[SND]](/icons/sound2.gif) | Asketa & Natan Chaim, Requenze, M.I.M.E - Warriors.mp3 | 2022-07-12 12:31 | 8.9M | |
![[SND]](/icons/sound2.gif) | breakbeat.mp3 | 2022-07-01 09:41 | 8.9M | |
![[SND]](/icons/sound2.gif) | MiyaGi ft. Эндшпиль - Малиновый рассвет.mp3 | 2022-06-28 17:01 | 8.9M | |
![[SND]](/icons/sound2.gif) | MiyaGi_malinoviy_rosvet.mp3 | 2022-07-05 16:34 | 8.9M | |
![[SND]](/icons/sound2.gif) | comedoz-yamaika.mp3 | 2022-06-29 08:41 | 8.9M | |
![[SND]](/icons/sound2.gif) | helen3.mp3 | 2022-06-30 16:29 | 8.9M | |
![[SND]](/icons/sound2.gif) | Can_You_Feel_My_Heart_(getmp3.pro).mp3 | 2022-07-12 00:34 | 8.9M | |
![[SND]](/icons/sound2.gif) | GAYAZOV BROTHER - Пьяный туман.mp3 | 2022-07-12 23:51 | 8.9M | |
![[SND]](/icons/sound2.gif) | Ragil3.mp3 | 2022-07-14 07:56 | 8.9M | |
![[SND]](/icons/sound2.gif) | Penantian.mp3 | 2022-06-28 17:26 | 8.9M | |
![[SND]](/icons/sound2.gif) | [YT2mp3.info] - Joji - Glimpse of Us (320kbps).mp3 | 2022-06-28 18:53 | 8.9M | |
![[SND]](/icons/sound2.gif) | AdheraCo.mp3 | 2022-07-13 12:47 | 8.9M | |
![[SND]](/icons/sound2.gif) | Major Lazer feat. Pusha T- Travi- Scott- 2 Chainz- Mad Cobra-Night Riders -feat. Travi- Scott- 2 Chainz- Pusha T - Mad Cobra--kissvk.com.mp3 | 2022-07-14 09:15 | 8.9M | |
![[SND]](/icons/sound2.gif) | Haddaway-What Is Love-kissvk.com.mp3 | 2022-07-06 01:28 | 8.9M | |
![[SND]](/icons/sound2.gif) | ugun10.mp3 | 2022-07-02 04:00 | 8.9M | |
![[SND]](/icons/sound2.gif) | WakChak7.mp3 | 2022-07-07 21:33 | 8.9M | |
![[SND]](/icons/sound2.gif) | WakChak5.mp3 | 2022-07-07 21:33 | 8.9M | |
![[SND]](/icons/sound2.gif) | Homie_-_Bezumno_mozhno_byt_pervym_(musmore.com).mp3 | 2022-06-29 08:29 | 8.9M | |
![[SND]](/icons/sound2.gif) | vedi97.mp3 | 2022-06-29 12:24 | 8.9M | |
![[SND]](/icons/sound2.gif) | Rhey31.mp3 | 2022-06-28 12:03 | 8.9M | |
![[SND]](/icons/sound2.gif) | Серёга - Черный бумер (Phonk remix) .mp3 | 2022-07-12 11:10 | 8.9M | |
![[SND]](/icons/sound2.gif) | Shiddat.mp3 | 2022-07-08 10:41 | 8.9M | |
![[SND]](/icons/sound2.gif) | burrythelight.mp3 | 2022-06-29 15:56 | 8.9M | |
![[SND]](/icons/sound2.gif) | zerelli2.mp3 | 2022-07-10 10:16 | 8.9M | |
![[SND]](/icons/sound2.gif) | Veyil_Chilla_Song_Zachariahyayude_Garbinikal_Malayalam_95MWODYwULI.mp3 | 2022-06-27 16:14 | 8.9M | |
![[SND]](/icons/sound2.gif) | Ice Cube - You Know How We Do It.mp3 | 2022-06-28 19:29 | 8.9M | |
![[SND]](/icons/sound2.gif) | twenty-one-pilots-fake-you-out.mp3 | 2022-06-27 19:52 | 8.9M | |
![[SND]](/icons/sound2.gif) | MiyaGi ft. Эндшпиль - Бадабум.mp3 | 2022-07-20 13:17 | 8.9M | |
![[SND]](/icons/sound2.gif) | RAMMSTAIN - MANN GAGEN MANN.mp3 | 2022-07-04 17:26 | 8.9M | |
![[SND]](/icons/sound2.gif) | TOTTO38.mp3 | 2022-07-15 16:32 | 8.9M | |
![[SND]](/icons/sound2.gif) | Matt10.mp3 | 2022-07-12 05:51 | 8.9M | |
![[SND]](/icons/sound2.gif) | jurijj-shatunov-rozovyjj-vecher-ural-djs-remix.mp3 | 2022-07-05 12:43 | 8.9M | |
![[SND]](/icons/sound2.gif) | rs15.mp3 | 2022-07-15 21:48 | 8.9M | |
![[SND]](/icons/sound2.gif) | hippie-sabotage-devil-eyes-mp3.mp3 | 2022-06-27 20:45 | 8.9M | |
![[SND]](/icons/sound2.gif) | Джизус - РАССВЕТ.mp3 | 2022-07-06 15:18 | 8.9M | |
![[SND]](/icons/sound2.gif) | HA1.mp3 | 2022-07-13 07:45 | 8.9M | |
![[SND]](/icons/sound2.gif) | tcuy1.mp3 | 2022-06-28 12:04 | 8.9M | |
![[SND]](/icons/sound2.gif) | Ivan_Dorn_Stycamen_Speed_Up_Tik_Tok.mp3 | 2022-07-16 16:16 | 8.9M | |
![[SND]](/icons/sound2.gif) | kopdang.mp3 | 2022-06-28 15:48 | 8.9M | |
![[SND]](/icons/sound2.gif) | 02. LOOSE CHANGE.mp3 | 2022-07-06 08:26 | 8.9M | |
![[SND]](/icons/sound2.gif) | Elyanna_Enta_Eh_Hijazi_Remix.mp3 | 2022-07-05 22:36 | 8.9M | |
![[SND]](/icons/sound2.gif) | Rein1.mp3 | 2022-07-02 09:48 | 8.9M | |
![[SND]](/icons/sound2.gif) | Isaac1.mp3 | 2022-07-06 08:00 | 8.9M | |
![[SND]](/icons/sound2.gif) | Mentol13.mp3 | 2022-06-29 01:38 | 8.9M | |
![[SND]](/icons/sound2.gif) | prm2.mp3 | 2022-07-03 04:37 | 8.9M | |
![[SND]](/icons/sound2.gif) | Skillet_-_Resistance(playmus.cc).mp3 | 2022-07-07 11:20 | 8.9M | |
![[SND]](/icons/sound2.gif) | 01. In The Name Of Love.mp3 | 2022-07-04 00:40 | 8.9M | |
![[SND]](/icons/sound2.gif) | apocalypse.mp3 | 2022-07-13 01:58 | 8.9M | |
![[SND]](/icons/sound2.gif) | Jko.mp3 | 2022-07-04 16:30 | 8.9M | |
![[SND]](/icons/sound2.gif) | Иван Дорн - Стыцамэн (speed up).mp3 | 2022-07-08 06:40 | 8.9M | |
![[SND]](/icons/sound2.gif) | YK1.mp3 | 2022-07-30 06:44 | 8.9M | |
![[SND]](/icons/sound2.gif) | Fighting_Gold.mp3 | 2022-07-03 08:23 | 8.9M | |
![[SND]](/icons/sound2.gif) | Ratta.mp3 | 2022-07-08 10:40 | 8.8M | |
![[SND]](/icons/sound2.gif) | crazy.mp3 | 2022-06-29 03:01 | 8.8M | |
![[SND]](/icons/sound2.gif) | Xanadu 200.mp3 | 2022-06-29 22:10 | 8.8M | |
![[SND]](/icons/sound2.gif) | jms5.mp3 | 2022-07-07 16:14 | 8.8M | |
![[SND]](/icons/sound2.gif) | Grigorijj_Leps_-_YA_podnimayu_ruki_48214031.mp3 | 2022-07-02 15:10 | 8.8M | |
![[SND]](/icons/sound2.gif) | Mac DeMarco - Chamber Of Reflection (Salad Days).mp3 | 2022-07-08 09:29 | 8.8M | |
![[SND]](/icons/sound2.gif) | mobi33.mp3 | 2022-06-30 05:05 | 8.8M | |
![[SND]](/icons/sound2.gif) | Дельфин - Ретро (OST Закон Каменных Джунглей).mp3 | 2022-07-13 02:12 | 8.8M | |
![[SND]](/icons/sound2.gif) | SCIENTIST.mp3 | 2022-06-27 15:21 | 8.8M | |
![[SND]](/icons/sound2.gif) | telape.mp3 | 2022-06-27 19:00 | 8.8M | |
![[SND]](/icons/sound2.gif) | Скриптонит, Райда - Baby mama.mp3 | 2022-07-20 06:04 | 8.8M | |
![[SND]](/icons/sound2.gif) | Toomaj - Nadidi 2.mp3 | 2022-06-28 13:54 | 8.8M | |
![[SND]](/icons/sound2.gif) | 32133.mp3 | 2022-06-28 09:40 | 8.8M | |
![[SND]](/icons/sound2.gif) | Скриптонит - Райда.-Baby mama.-kissvk.com.mp3 | 2022-06-29 06:07 | 8.8M | |
![[SND]](/icons/sound2.gif) | Ba.mp3 | 2022-07-20 16:11 | 8.8M | |
![[SND]](/icons/sound2.gif) | toxic10.mp3 | 2022-07-04 06:42 | 8.8M | |
![[SND]](/icons/sound2.gif) | BR2.mp3 | 2022-07-12 02:59 | 8.8M | |
![[SND]](/icons/sound2.gif) | dkl18.mp3 | 2022-07-15 02:08 | 8.8M | |
![[SND]](/icons/sound2.gif) | jamaika.mp3 | 2022-07-01 03:48 | 8.8M | |
![[SND]](/icons/sound2.gif) | ComedoZ - Ямайка (feat. Денис Гущин).mp3 | 2022-07-06 15:15 | 8.8M | |
![[SND]](/icons/sound2.gif) | DJ_RINDU_SEMALAM_KUTAHAN_KUTAHAN_SEMALAM_TIKTOK_SLOW_REMIX_FULL.mp3 | 2022-06-30 11:55 | 8.8M | |
![[SND]](/icons/sound2.gif) | allt är ok.mp3 | 2022-07-13 11:59 | 8.8M | |
![[SND]](/icons/sound2.gif) | Allex G - Si politia sa vina.mp3 | 2022-07-12 10:54 | 8.8M | |
![[SND]](/icons/sound2.gif) | D City Rock feat. Debra Zeer.mp3 | 2022-07-09 11:11 | 8.8M | |
![[SND]](/icons/sound2.gif) | kgfmb.mp3 | 2022-07-11 18:59 | 8.8M | |
![[SND]](/icons/sound2.gif) | Goodlife.mp3 | 2022-07-05 09:42 | 8.8M | |
![[SND]](/icons/sound2.gif) | zayah.mp3 | 2022-07-27 16:07 | 8.8M | |
![[SND]](/icons/sound2.gif) | tropa.mp3 | 2022-07-04 08:29 | 8.8M | |
![[SND]](/icons/sound2.gif) | DUMATING.mp3 | 2022-07-01 10:46 | 8.8M | |
![[SND]](/icons/sound2.gif) | zack9.mp3 | 2022-06-28 06:40 | 8.8M | |
![[SND]](/icons/sound2.gif) | toxic28.mp3 | 2022-07-04 09:47 | 8.8M | |
![[SND]](/icons/sound2.gif) | ookan20.mp3 | 2022-07-09 06:02 | 8.8M | |
![[SND]](/icons/sound2.gif) | Prophecy.mp3 | 2022-07-04 04:32 | 8.8M | |
![[SND]](/icons/sound2.gif) | badromancee.mp3 | 2022-07-07 16:21 | 8.8M | |
![[SND]](/icons/sound2.gif) | Cyrus7.mp3 | 2022-07-15 17:47 | 8.8M | |
![[SND]](/icons/sound2.gif) | noiz 4.mp3 | 2022-07-14 23:09 | 8.8M | |
![[SND]](/icons/sound2.gif) | Terraria Calamity Mod Music - _1NF3S+@+!0N_ - Theme of Crabulon.mp3 | 2022-07-05 02:47 | 8.8M | |
![[SND]](/icons/sound2.gif) | another-love-tom-odell-slowed-n-reverb.mp3 | 2022-06-29 03:54 | 8.8M | |
![[SND]](/icons/sound2.gif) | Rhey20.mp3 | 2022-06-28 12:01 | 8.8M | |
![[SND]](/icons/sound2.gif) | Yeat feat. Young Thug - Outsidë.mp3 | 2022-07-15 18:35 | 8.8M | |
![[SND]](/icons/sound2.gif) | Artur Lev-Под луной мы с тобой назвала любовь игрой -Shamuz.net--kissvk.com.mp3 | 2022-07-05 12:58 | 8.8M | |
![[SND]](/icons/sound2.gif) | Valentin_Strykalo_-_92_(musmore.com).mp3 | 2022-07-07 19:22 | 8.8M | |
![[SND]](/icons/sound2.gif) | tm4.mp3 | 2022-08-07 15:32 | 8.8M | |
![[SND]](/icons/sound2.gif) | ssd1.mp3 | 2022-07-06 18:54 | 8.8M | |
![[SND]](/icons/sound2.gif) | kaalan3.mp3 | 2022-07-09 18:57 | 8.8M | |
![[SND]](/icons/sound2.gif) | awatbokaniamshaw.mp3 | 2022-07-13 17:41 | 8.8M | |
![[SND]](/icons/sound2.gif) | zrkdeadtome.mp3 | 2022-06-29 07:49 | 8.8M | |
![[SND]](/icons/sound2.gif) | arga4.mp3 | 2022-06-28 02:55 | 8.8M | |
![[SND]](/icons/sound2.gif) | Катя Чехова - Крылья (DFM Mix).mp3 | 2022-07-01 01:29 | 8.8M | |
![[SND]](/icons/sound2.gif) | Bring_Me_The_Horizon_Capital_Voices_Choir_-_Can_You_Feel_My_Heart_47954522.mp3 | 2022-07-17 14:44 | 8.8M | |
![[SND]](/icons/sound2.gif) | Minang.mp3 | 2022-06-27 20:28 | 8.8M | |
![[SND]](/icons/sound2.gif) | vedi22.mp3 | 2022-06-29 12:27 | 8.8M | |
![[SND]](/icons/sound2.gif) | PD56.mp3 | 2022-07-01 13:07 | 8.8M | |
![[SND]](/icons/sound2.gif) | ЗАЯВКАDr_Dre_–_Still_D_R_E_feat_.mp3 | 2022-06-28 10:40 | 8.8M | |
![[SND]](/icons/sound2.gif) | Sab.mp3 | 2022-07-08 10:40 | 8.8M | |
![[SND]](/icons/sound2.gif) | WakChak2.mp3 | 2022-07-07 21:32 | 8.8M | |
![[SND]](/icons/sound2.gif) | aggra.mp3 | 2022-07-11 07:42 | 8.8M | |
![[SND]](/icons/sound2.gif) | DJ_ENAKEUNN_V4_x_MAMA_BALE_BALE_VINKY_YT_VIRAL_TIK.mp3 | 2022-07-18 18:08 | 8.8M | |
![[SND]](/icons/sound2.gif) | Yhwh1.mp3 | 2022-06-27 14:24 | 8.8M | |
![[SND]](/icons/sound2.gif) | DK27.mp3 | 2022-06-27 22:48 | 8.8M | |
![[SND]](/icons/sound2.gif) | D.K10.mp3 | 2022-07-12 14:19 | 8.8M | |
![[SND]](/icons/sound2.gif) | heroin-lana-del-rey.mp3 | 2022-06-29 04:08 | 8.8M | |
![[SND]](/icons/sound2.gif) | Mascarpone - Bis Zum Ende.mp3 | 2022-07-05 16:47 | 8.8M | |
![[SND]](/icons/sound2.gif) | ELD.mp3 | 2022-07-14 13:26 | 8.8M | |
![[SND]](/icons/sound2.gif) | Hang Loose Baby.mp3 | 2022-06-29 05:05 | 8.8M | |
![[SND]](/icons/sound2.gif) | BabyPaps.mp3 | 2022-06-29 05:12 | 8.8M | |
![[SND]](/icons/sound2.gif) | DJ BAMBAM Sampler.mp3 | 2022-07-11 04:00 | 8.8M | |
![[SND]](/icons/sound2.gif) | Сергей Лазарев - Идеальный мир.mp3 | 2022-07-09 11:42 | 8.8M | |
![[SND]](/icons/sound2.gif) | panget.mp3 | 2022-07-11 21:15 | 8.8M | |
![[SND]](/icons/sound2.gif) | 32. Inna Malikova & New Gems - Venus.mp3 | 2022-07-15 19:43 | 8.8M | |
![[SND]](/icons/sound2.gif) | mad3.mp3 | 2022-07-04 18:55 | 8.8M | |
![[SND]](/icons/sound2.gif) | anto10.mp3 | 2022-07-12 12:32 | 8.8M | |
![[SND]](/icons/sound2.gif) | Руки Вверх--Выпускной-kissvk.com.mp3 | 2022-07-06 01:28 | 8.8M | |
![[SND]](/icons/sound2.gif) | ginto.mp3 | 2022-07-04 13:18 | 8.8M | |
![[SND]](/icons/sound2.gif) | anto7.mp3 | 2022-07-10 14:06 | 8.8M | |
![[SND]](/icons/sound2.gif) | eluselus.mp3 | 2022-06-27 19:09 | 8.8M | |
![[SND]](/icons/sound2.gif) | sektorjazza x c6rvette - ultrawide coco jambo.mp3 | 2022-07-06 09:03 | 8.8M | |
![[SND]](/icons/sound2.gif) | The Pretty Reckless Going To Hell Official Music Video_NYASdSYGMmq10Ki.mp3 | 2022-07-02 16:04 | 8.8M | |
![[SND]](/icons/sound2.gif) | badut00.mp3 | 2022-06-28 02:40 | 8.8M | |
![[SND]](/icons/sound2.gif) | TOTTO70.mp3 | 2022-07-15 16:31 | 8.8M | |
![[SND]](/icons/sound2.gif) | Mahikadi.mp3 | 2022-06-29 14:56 | 8.8M | |
![[SND]](/icons/sound2.gif) | TOTTO26.mp3 | 2022-07-15 16:32 | 8.7M | |
![[SND]](/icons/sound2.gif) | Wakno17.mp3 | 2022-07-07 21:39 | 8.7M | |
![[SND]](/icons/sound2.gif) | mrv3.mp3 | 2022-06-27 15:55 | 8.7M | |
![[SND]](/icons/sound2.gif) | Za.mp3 | 2022-07-11 19:26 | 8.7M | |
![[SND]](/icons/sound2.gif) | 08. 50 Cent - Candy Shop (Stanislav Shik & Sad Panda Working Tool).mp3 | 2022-07-15 19:42 | 8.7M | |
![[SND]](/icons/sound2.gif) | ZHuki_-_Batarejjka_47951478.mp3 | 2022-07-05 18:32 | 8.7M | |
![[SND]](/icons/sound2.gif) | Wrong Turn (Tman Vox).mp3 | 2022-06-27 13:54 | 8.7M | |
![[SND]](/icons/sound2.gif) | Каспийский Груз feat. Словетский - Ой, мороз.mp3 | 2022-07-03 09:15 | 8.7M | |
![[SND]](/icons/sound2.gif) | Miyagi-&-EHndshpil-BadaBum(soundbass.net).mp3 | 2022-07-05 17:17 | 8.7M | |
![[SND]](/icons/sound2.gif) | pong12.mp3 | 2022-07-17 15:26 | 8.7M | |
![[SND]](/icons/sound2.gif) | One19.mp3 | 2022-07-16 12:16 | 8.7M | |
![[SND]](/icons/sound2.gif) | lugo.mp3 | 2022-07-06 02:25 | 8.7M | |
![[SND]](/icons/sound2.gif) | Nad.mp3 | 2022-07-11 19:38 | 8.7M | |
![[SND]](/icons/sound2.gif) | Celtic Music - Sirens Cove.mp3 | 2022-07-08 10:42 | 8.7M | |
![[SND]](/icons/sound2.gif) | 🔊⚠СУКА ДАЙ СЮДА АUX⚠🔊 - 😈🔥БадаБум🔥😈[Bass.Prod. by #Daniallo].mp3 | 2022-07-15 22:45 | 8.7M | |
![[SND]](/icons/sound2.gif) | The Binding of Isaac - Enmity of the Dark Lord Recreated.mp3 | 2022-07-05 02:57 | 8.7M | |
![[SND]](/icons/sound2.gif) | Haghame - Golazin.mp3 | 2022-06-28 13:54 | 8.7M | |
![[SND]](/icons/sound2.gif) | Sri.mp3 | 2022-07-08 10:41 | 8.7M | |
![[SND]](/icons/sound2.gif) | THRILL_PILL_Egor_Krid_MORGENSHTERN_-_Grustnaya_Pesnya_67147398.mp3 | 2022-07-13 16:29 | 8.7M | |
![[SND]](/icons/sound2.gif) | miyagi-endshpil-badabum_(tetamix.org).mp3 | 2022-06-29 12:24 | 8.7M | |
![[SND]](/icons/sound2.gif) | miyagi-bada-bum(mp3name.co).mp3 | 2022-08-02 17:20 | 8.7M | |
![[SND]](/icons/sound2.gif) | Wakno23.mp3 | 2022-07-05 07:17 | 8.7M | |
![[SND]](/icons/sound2.gif) | SK_RA.mp3 | 2022-07-02 02:47 | 8.7M | |
![[SND]](/icons/sound2.gif) | Splin_-_Vykhoda_net_(musmore.com).mp3 | 2022-06-29 08:36 | 8.7M | |
![[SND]](/icons/sound2.gif) | Vizar3.mp3 | 2022-07-16 04:02 | 8.7M | |
![[SND]](/icons/sound2.gif) | Nick12.mp3 | 2022-06-30 18:14 | 8.7M | |
![[SND]](/icons/sound2.gif) | Deib9.mp3 | 2022-06-28 18:00 | 8.7M | |
![[SND]](/icons/sound2.gif) | Wakno5.mp3 | 2022-07-04 21:57 | 8.7M | |
![[SND]](/icons/sound2.gif) | Виталя Джа - Похуй молодой.mp3 | 2022-07-05 19:36 | 8.7M | |
![[SND]](/icons/sound2.gif) | light-club-blizzard.mp3 | 2022-07-16 13:47 | 8.7M | |
![[SND]](/icons/sound2.gif) | vedi16.mp3 | 2022-06-29 12:27 | 8.7M | |
![[SND]](/icons/sound2.gif) | sws2.mp3 | 2022-07-06 00:17 | 8.7M | |
![[SND]](/icons/sound2.gif) | TOTTO44.mp3 | 2022-07-15 16:32 | 8.7M | |
![[SND]](/icons/sound2.gif) | Allex G - Ti-am permis.mp3 | 2022-07-12 10:54 | 8.7M | |
![[SND]](/icons/sound2.gif) | Маракеш, TRUEтень, Мафик - Вслепую (Adam Maniac Remix).mp3 | 2022-07-05 10:30 | 8.7M | |
![[SND]](/icons/sound2.gif) | Can You Feel My Heart - Bring Me The Horizon.mp3 | 2022-07-06 15:24 | 8.7M | |
![[SND]](/icons/sound2.gif) | lucaz11.mp3 | 2022-06-29 08:53 | 8.7M | |
![[SND]](/icons/sound2.gif) | ookan10.mp3 | 2022-07-07 07:16 | 8.7M | |
![[SND]](/icons/sound2.gif) | zrkdjkomangghost.mp3 | 2022-06-29 07:49 | 8.7M | |
![[SND]](/icons/sound2.gif) | Hi.mp3 | 2022-07-26 02:03 | 8.7M | |
![[SND]](/icons/sound2.gif) | zrkmerasaindah.mp3 | 2022-06-29 07:47 | 8.7M | |
![[SND]](/icons/sound2.gif) | NIRVANA2.MP.mp3 | 2022-08-08 01:26 | 8.7M | |
![[SND]](/icons/sound2.gif) | antava.mp3 | 2022-06-30 18:16 | 8.7M | |
![[SND]](/icons/sound2.gif) | tidakbersyukur.mp3 | 2022-07-21 12:05 | 8.7M | |
![[SND]](/icons/sound2.gif) | Au Revoir Simone - Tell Me (clock opera remix)_(Mp3Bullet.ru).mp3 | 2022-07-01 18:49 | 8.7M | |
![[SND]](/icons/sound2.gif) | dom99.mp3 | 2022-07-03 06:29 | 8.7M | |
![[SND]](/icons/sound2.gif) | nor.mp3 | 2022-06-28 16:32 | 8.7M | |
![[SND]](/icons/sound2.gif) | WakChak15.mp3 | 2022-07-07 21:37 | 8.7M | |
![[SND]](/icons/sound2.gif) | rs5.mp3 | 2022-07-15 21:47 | 8.7M | |
![[SND]](/icons/sound2.gif) | Hollywood Undead - Medicine (mp3store.cc).mp3 | 2022-07-05 18:21 | 8.7M | |
![[SND]](/icons/sound2.gif) | Ban.mp3 | 2022-07-08 10:40 | 8.7M | |
![[SND]](/icons/sound2.gif) | kasipaham.mp3 | 2022-07-15 09:18 | 8.7M | |
![[SND]](/icons/sound2.gif) | SampeManaNgabJacky_.mp3 | 2022-07-04 20:58 | 8.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Quando Quando Quando with Nelly Furtado_256kbps.mp3 | 2022-07-03 11:14 | 8.7M | |
![[SND]](/icons/sound2.gif) | quando.mp3.mp3 | 2022-07-06 05:18 | 8.7M | |
![[SND]](/icons/sound2.gif) | quando.mp3 | 2022-07-09 11:09 | 8.7M | |
![[SND]](/icons/sound2.gif) | Show You.mp3 | 2022-07-23 00:07 | 8.7M | |
![[SND]](/icons/sound2.gif) | CoChacYeuLaDay-SonTung.mp3 | 2022-07-14 03:17 | 8.7M | |
![[SND]](/icons/sound2.gif) | vedi14.mp3 | 2022-06-29 12:26 | 8.7M | |
![[SND]](/icons/sound2.gif) | pac.mp3 | 2022-07-27 12:11 | 8.7M | |
![[SND]](/icons/sound2.gif) | NatemanV.mp3 | 2022-07-01 08:38 | 8.7M | |
![[SND]](/icons/sound2.gif) | 2pac - Menace II Society.mp3 | 2022-06-30 08:46 | 8.7M | |
![[SND]](/icons/sound2.gif) | ALN.mp3 | 2022-07-03 13:18 | 8.7M | |
![[SND]](/icons/sound2.gif) | nofal1.mp3 | 2022-06-29 19:40 | 8.7M | |
![[SND]](/icons/sound2.gif) | YUrijj_SHatunov_-_Detstvo_50310017.mp3 | 2022-07-13 16:23 | 8.7M | |
![[SND]](/icons/sound2.gif) | YUrijj_SHatunov_-_Detstvo_49909525.mp3 | 2022-07-01 14:28 | 8.7M | |
![[SND]](/icons/sound2.gif) | JoJos_Bizarre_Adventure_Im_in_Control.mp3 | 2022-07-03 22:53 | 8.7M | |
![[SND]](/icons/sound2.gif) | batubacan.mp3 | 2022-07-10 04:31 | 8.7M | |
![[SND]](/icons/sound2.gif) | thrill-pill-egor-krid-morgenshtern-grustnaya-pesnya-mp3.mp3 | 2022-07-03 21:14 | 8.7M | |
![[SND]](/icons/sound2.gif) | 21. Jorm - Hamed Fard.mp3 | 2022-06-28 13:53 | 8.7M | |
![[SND]](/icons/sound2.gif) | Gira.mp3 | 2022-06-29 18:44 | 8.7M | |
![[SND]](/icons/sound2.gif) | 2002.mp3 | 2022-08-02 08:28 | 8.7M | |
![[SND]](/icons/sound2.gif) | tiusai.mp3 | 2022-06-27 18:58 | 8.7M | |
![[SND]](/icons/sound2.gif) | Rudh6.mp3 | 2022-07-13 15:34 | 8.7M | |
![[SND]](/icons/sound2.gif) | Marvel2.mp3 | 2022-07-05 15:39 | 8.7M | |
![[VID]](/icons/movie.gif) | ASW.mp4 | 2022-07-19 06:02 | 8.7M | |
![[SND]](/icons/sound2.gif) | tqx2.mp3 | 2022-06-28 14:42 | 8.7M | |
![[SND]](/icons/sound2.gif) | katon.mp3 | 2022-07-02 01:37 | 8.7M | |
![[SND]](/icons/sound2.gif) | Badut - Raavfy (Official Lyric Video).mp3 | 2022-07-06 06:43 | 8.7M | |
![[SND]](/icons/sound2.gif) | congratulations.mp3 | 2022-07-06 07:31 | 8.7M | |
![[SND]](/icons/sound2.gif) | OCI4.mp3 | 2022-06-29 16:43 | 8.7M | |
![[SND]](/icons/sound2.gif) | BDO.mp3 | 2022-06-27 17:00 | 8.7M | |
![[SND]](/icons/sound2.gif) | temKTOsNAMI.mp3 | 2022-07-12 15:49 | 8.7M | |
![[SND]](/icons/sound2.gif) | АК-47 - Тем кто с нами (ft Guf, Ноггано).mp3 | 2022-07-12 14:14 | 8.7M | |
![[SND]](/icons/sound2.gif) | Manila_Killa_-_Everyday_Everyday__(getmp3.pro).mp3 | 2022-07-15 00:05 | 8.7M | |
![[SND]](/icons/sound2.gif) | Darari korea.mp3 | 2022-07-03 15:06 | 8.6M | |
![[SND]](/icons/sound2.gif) | _ KENAPA KO YG GAS - ( MR. EWIK X MARTHYN CRIZTYAN X SELVY MBAU _ RIZKY HAGA )(MP3_160K).mp3 | 2022-07-07 04:29 | 8.6M | |
![[SND]](/icons/sound2.gif) | 1-12 Ray Shields - How About a Hug.mp3 | 2022-07-12 13:02 | 8.6M | |
![[SND]](/icons/sound2.gif) | Сергей Лазарев - Снег в океане.mp3 | 2022-06-30 11:56 | 8.6M | |
![[SND]](/icons/sound2.gif) | Jhon01.mp3 | 2022-07-05 00:05 | 8.6M | |
![[SND]](/icons/sound2.gif) | Oswine2.mp3 | 2022-07-13 23:18 | 8.6M | |
![[SND]](/icons/sound2.gif) | Альянс - На Заре (Phonk edition by yungpiece).mp3 | 2022-07-09 08:24 | 8.6M | |
![[SND]](/icons/sound2.gif) | 25. Darde Mano To - Leila Forouhar.mp3 | 2022-06-28 13:54 | 8.6M | |
![[SND]](/icons/sound2.gif) | Luxor_feat._Люся_Чеботина_-_No_cry.mp3.mp3 | 2022-06-28 15:35 | 8.6M | |
![[SND]](/icons/sound2.gif) | Gang2.mp3 | 2022-07-04 04:17 | 8.6M | |
![[SND]](/icons/sound2.gif) | Drive Forever - Kingmichaelbeats.mp3 | 2022-07-06 15:25 | 8.6M | |
![[SND]](/icons/sound2.gif) | 01 Streets Of LA.mp3 | 2022-06-28 08:01 | 8.6M | |
![[SND]](/icons/sound2.gif) | a7x.mp3 | 2022-07-23 09:10 | 8.6M | |
![[SND]](/icons/sound2.gif) | zack5.mp3 | 2022-06-28 06:39 | 8.6M | |
![[SND]](/icons/sound2.gif) | circles.mp3 | 2022-07-06 08:07 | 8.6M | |
![[SND]](/icons/sound2.gif) | BASTA_-_YA_podnimayus_nad_zemljojj_48319574.mp3 | 2022-07-15 19:36 | 8.6M | |
![[SND]](/icons/sound2.gif) | Eazy1.mp3 | 2022-07-09 19:14 | 8.6M | |
![[SND]](/icons/sound2.gif) | Jah_Khalib_-_Ty_slovno_celaya_vselennaya_48847170.mp3 | 2022-06-29 12:14 | 8.6M | |
![[SND]](/icons/sound2.gif) | rt13.mp3 | 2022-07-05 08:00 | 8.6M | |
![[SND]](/icons/sound2.gif) | В. Бутусов и Ю-Питер - Тема дороги.mp3 | 2022-07-07 07:56 | 8.6M | |
![[SND]](/icons/sound2.gif) | DJ Chechen — Лезгинка свадебная (www.lightaudio.ru).mp3 | 2022-07-02 13:42 | 8.6M | |
![[SND]](/icons/sound2.gif) | DJ Chechen - Лезгинка свадебная.mp3 | 2022-07-09 18:05 | 8.6M | |
![[SND]](/icons/sound2.gif) | All for nothing demo Ray.mp3 | 2022-07-15 16:26 | 8.6M | |
![[SND]](/icons/sound2.gif) | 56 - Gouyuu no Shi.mp3 | 2022-07-13 15:12 | 8.6M | |
![[SND]](/icons/sound2.gif) | Arabick.mp3 | 2022-07-13 12:08 | 8.6M | |
![[SND]](/icons/sound2.gif) | The Binding of Isaac - My Innermost Apocalypse Recreated.mp3 | 2022-07-05 02:25 | 8.6M | |
![[SND]](/icons/sound2.gif) | Lida, Слава КПСС - Панки Хой, Горшок Живой.mp3 | 2022-07-08 18:52 | 8.6M | |
![[SND]](/icons/sound2.gif) | Mr.Bullet - UZ MUS IR JUS (feat. Makejevas).mp3 | 2022-07-12 04:11 | 8.6M | |
![[SND]](/icons/sound2.gif) | ТГК - Гелик (mp3store.cc).mp3 | 2022-07-14 16:11 | 8.6M | |
![[SND]](/icons/sound2.gif) | fever69.mp3 | 2022-06-28 12:32 | 8.6M | |
![[SND]](/icons/sound2.gif) | Группа крови.mp3 | 2022-07-04 05:38 | 8.6M | |
![[SND]](/icons/sound2.gif) | Vp55.mp3 | 2022-07-09 15:56 | 8.6M | |
![[SND]](/icons/sound2.gif) | zrkcloudbread.mp3 | 2022-06-29 07:52 | 8.6M | |
![[SND]](/icons/sound2.gif) | pepe.mp3 | 2022-07-15 08:04 | 8.6M | |
![[SND]](/icons/sound2.gif) | jhanco.mp3 | 2022-07-15 15:01 | 8.6M | |
![[SND]](/icons/sound2.gif) | fireset12.mp3 | 2022-07-17 13:50 | 8.6M | |
![[SND]](/icons/sound2.gif) | Dragon soul full english lyrics.mp3 | 2022-07-10 17:20 | 8.6M | |
![[SND]](/icons/sound2.gif) | vedi44.mp3 | 2022-06-29 12:11 | 8.6M | |
![[SND]](/icons/sound2.gif) | toxic12.mp3 | 2022-07-04 08:58 | 8.6M | |
![[SND]](/icons/sound2.gif) | jurijj-shatunov-glupye-snezhinki-versija-2011.mp3 | 2022-07-05 12:45 | 8.6M | |
![[SND]](/icons/sound2.gif) | Backstreet Boys Everybody (Backstreet's Back).mp3 | 2022-06-30 12:19 | 8.6M | |
![[SND]](/icons/sound2.gif) | dulu.mp3 | 2022-06-30 15:35 | 8.6M | |
![[SND]](/icons/sound2.gif) | snte8.mp3 | 2022-06-28 16:09 | 8.6M | |
![[SND]](/icons/sound2.gif) | yuriy_shatunov_-_sedaya_noch__(ivan_art_remix)_muzati.net.mp3 | 2022-07-03 17:08 | 8.6M | |
![[SND]](/icons/sound2.gif) | miyagi-andy-panda-patron-mp3.mp3 | 2022-08-08 05:30 | 8.6M | |
![[SND]](/icons/sound2.gif) | miyagi-andy-panda-patron-mp3 (1).mp3 | 2022-07-14 15:34 | 8.6M | |
![[SND]](/icons/sound2.gif) | Itsmylife1.mp3 | 2022-07-04 01:18 | 8.6M | |
![[SND]](/icons/sound2.gif) | 19. ANGEL.mp3 | 2022-07-06 08:26 | 8.6M | |
![[SND]](/icons/sound2.gif) | rude.mp3 | 2022-06-30 15:57 | 8.6M | |
![[SND]](/icons/sound2.gif) | MAGIC123.mp3 | 2022-06-30 18:17 | 8.6M | |
![[SND]](/icons/sound2.gif) | Lida, DK - Анапа.mp3 | 2022-07-08 18:54 | 8.6M | |
![[SND]](/icons/sound2.gif) | toxic55.mp3 | 2022-07-09 05:17 | 8.6M | |
![[SND]](/icons/sound2.gif) | СЛОТ - 2 Войны.mp3 | 2022-07-09 11:42 | 8.6M | |
![[SND]](/icons/sound2.gif) | Adele_-_Send_My_Love_To_Your_New_Lover_47835133.mp3 | 2022-07-10 12:54 | 8.6M | |
![[SND]](/icons/sound2.gif) | lil-nas-x-jack-harlow-industry-baby-official-video.mp3 | 2022-07-01 12:46 | 8.6M | |
![[SND]](/icons/sound2.gif) | industry_baby.mp3 | 2022-07-01 12:59 | 8.6M | |
![[SND]](/icons/sound2.gif) | eye-of-the-tiger.mp3 | 2022-07-14 15:29 | 8.6M | |
![[SND]](/icons/sound2.gif) | mobi55.mp3 | 2022-07-03 13:59 | 8.6M | |
![[SND]](/icons/sound2.gif) | Imamade.mp3 | 2022-06-27 12:28 | 8.6M | |
![[SND]](/icons/sound2.gif) | Halsey_-_Nightmare_(getmp3.pro).mp3 | 2022-07-03 02:36 | 8.6M | |
![[SND]](/icons/sound2.gif) | mobi16.mp3 | 2022-06-30 04:44 | 8.6M | |
![[SND]](/icons/sound2.gif) | Laskarpelangi.mp3 | 2022-07-04 01:18 | 8.6M | |
![[SND]](/icons/sound2.gif) | Twisted Sister - We're Not Gonna Take It (1).mp3 | 2022-07-01 09:32 | 8.6M | |
![[SND]](/icons/sound2.gif) | Verka_Serdyuchka_-_Vse_budet_khorosho_52011172.mp3 | 2022-07-31 12:39 | 8.6M | |
![[SND]](/icons/sound2.gif) | ls69.mp3 | 2022-06-28 10:10 | 8.6M | |
![[SND]](/icons/sound2.gif) | vedi43.mp3 | 2022-06-29 12:10 | 8.6M | |
![[SND]](/icons/sound2.gif) | Rhey35.mp3 | 2022-06-28 12:19 | 8.6M | |
![[SND]](/icons/sound2.gif) | Dun.mp3 | 2022-07-08 10:40 | 8.6M | |
![[SND]](/icons/sound2.gif) | Nati.mp3 | 2022-07-13 03:31 | 8.6M | |
![[SND]](/icons/sound2.gif) | Kaadhal_En_Kaviye__Tamil____SALMON_3D___Sid_Sriram___Vijay_Yesudas___Shalil_Kallur___Sreejith(256k).mp3 | 2022-07-07 07:26 | 8.6M | |
![[SND]](/icons/sound2.gif) | [YT2mp3.info] - Pujiono - Manisnya Negeriku [Official Video Clip] (320kbps).mp3 | 2022-06-28 18:24 | 8.6M | |
![[SND]](/icons/sound2.gif) | Say_Anything_-_Alive_With_The_Glory_(getmp3.pro).mp3 | 2022-07-03 03:40 | 8.6M | |
![[SND]](/icons/sound2.gif) | Wavinflag.mp3 | 2022-07-04 01:33 | 8.6M | |
![[SND]](/icons/sound2.gif) | ookan17.mp3 | 2022-07-09 05:32 | 8.6M | |
![[SND]](/icons/sound2.gif) | 11. Just Can't Get Enough.mp3 | 2022-07-16 09:50 | 8.6M | |
![[SND]](/icons/sound2.gif) | Deneme.mp3 | 2022-07-17 21:30 | 8.6M | |
![[SND]](/icons/sound2.gif) | Сектор Газа - Туман.mp3 | 2022-07-06 17:57 | 8.6M | |
![[SND]](/icons/sound2.gif) | cuki5.mp3 | 2022-06-28 16:06 | 8.6M | |
![[SND]](/icons/sound2.gif) | acho10.mp3 | 2022-06-29 06:00 | 8.6M | |
![[SND]](/icons/sound2.gif) | animedley.mp3 | 2022-07-03 10:04 | 8.6M | |
![[SND]](/icons/sound2.gif) | 01-disturbed-land_of_confusion.mp3 | 2022-07-04 00:49 | 8.6M | |
![[SND]](/icons/sound2.gif) | RC0.mp3 | 2022-07-01 15:19 | 8.6M | |
![[SND]](/icons/sound2.gif) | Andrea B - Para Mi Hermosissima Princesa.mp3 | 2022-07-12 00:43 | 8.6M | |
![[SND]](/icons/sound2.gif) | Maria124.mp3 | 2022-07-09 19:18 | 8.6M | |
![[SND]](/icons/sound2.gif) | zrkdjbilangmantu.mp3 | 2022-06-29 07:54 | 8.6M | |
![[SND]](/icons/sound2.gif) | 09. Ayur Tsyrenov - Beautiful Life (Ace Of Base Cover).mp3 | 2022-07-15 19:42 | 8.6M | |
![[SND]](/icons/sound2.gif) | Korn - Hey Daddy.mp3 | 2022-06-30 23:47 | 8.6M | |
![[SND]](/icons/sound2.gif) | Alexis6.mp3 | 2022-07-12 01:12 | 8.6M | |
![[SND]](/icons/sound2.gif) | heat waves.mp3 | 2022-07-17 05:36 | 8.6M | |
![[SND]](/icons/sound2.gif) | zrkajarkan.mp3 | 2022-06-29 07:51 | 8.6M | |
![[SND]](/icons/sound2.gif) | Imagine Dragons - Believer-(BassBoosted)(HD).mp3 | 2022-06-29 20:58 | 8.6M | |
![[SND]](/icons/sound2.gif) | post-malone-feat.-21-savage-rockstar.mp3 | 2022-07-11 18:49 | 8.6M | |
![[SND]](/icons/sound2.gif) | burut.mp3 | 2022-06-30 12:32 | 8.6M | |
![[SND]](/icons/sound2.gif) | Ayeo12.mp3 | 2022-06-29 15:06 | 8.6M | |
![[SND]](/icons/sound2.gif) | damma.mp3 | 2022-07-20 05:22 | 8.6M | |
![[SND]](/icons/sound2.gif) | 🇺🇸USA.mp3 | 2022-07-08 19:57 | 8.6M | |
![[SND]](/icons/sound2.gif) | Sahara.mp3 | 2022-07-04 01:30 | 8.6M | |
![[SND]](/icons/sound2.gif) | pungay.mp3 | 2022-07-04 08:30 | 8.6M | |
![[SND]](/icons/sound2.gif) | Бодя Мир642, Dewensoon - Meloman.mp3 | 2022-07-02 10:12 | 8.6M | |
![[SND]](/icons/sound2.gif) | Gangsta P..mp3 | 2022-07-02 21:17 | 8.6M | |
![[SND]](/icons/sound2.gif) | tai9.mp3 | 2022-06-28 01:25 | 8.5M | |
![[SND]](/icons/sound2.gif) | Allex G - Toata gasca mea.mp3 | 2022-07-12 10:54 | 8.5M | |
![[SND]](/icons/sound2.gif) | SJP.mp3 | 2022-07-13 08:48 | 8.5M | |
![[SND]](/icons/sound2.gif) | Oberhofer_-_oOoO_61819148.mp3 | 2022-07-01 18:49 | 8.5M | |
![[SND]](/icons/sound2.gif) | grandson - Despicable.mp3 | 2022-07-04 21:22 | 8.5M | |
![[SND]](/icons/sound2.gif) | Teguh_Sanjaya.mp3 | 2022-07-02 16:21 | 8.5M | |
![[SND]](/icons/sound2.gif) | Rhey11.mp3 | 2022-06-28 11:58 | 8.5M | |
![[SND]](/icons/sound2.gif) | mobi1.mp3 | 2022-06-30 04:39 | 8.5M | |
![[SND]](/icons/sound2.gif) | don3.mp3 | 2022-07-14 16:25 | 8.5M | |
![[SND]](/icons/sound2.gif) | Miyu Tomita, Mariya Ise - Deep in Abyss [Made in Abyss OP].mp3 | 2022-07-09 19:41 | 8.5M | |
![[SND]](/icons/sound2.gif) | zrkdjocopakele.mp3 | 2022-06-29 07:43 | 8.5M | |
![[SND]](/icons/sound2.gif) | Myboo.mp3 | 2022-07-05 00:13 | 8.5M | |
![[SND]](/icons/sound2.gif) | TARAS_Cvetok_sredi_moego_hlama_REMIX_2020.mp3 | 2022-07-05 10:20 | 8.5M | |
![[SND]](/icons/sound2.gif) | bg.mp3 | 2022-07-21 07:16 | 8.5M | |
![[SND]](/icons/sound2.gif) | GTA2.mp3 | 2022-06-27 17:11 | 8.5M | |
![[SND]](/icons/sound2.gif) | empi12.mp3 | 2022-07-17 00:20 | 8.5M | |
![[SND]](/icons/sound2.gif) | X2Download.com - KU TAK BISA - SLANK COVER BY REGITA (320 kbps).mp3 | 2022-07-30 18:16 | 8.5M | |
![[SND]](/icons/sound2.gif) | Hasan_udin.mp3 | 2022-07-01 15:53 | 8.5M | |
![[SND]](/icons/sound2.gif) | pengamen1.mp3 | 2022-07-12 23:44 | 8.5M | |
![[SND]](/icons/sound2.gif) | dara.mp3 | 2022-07-15 10:26 | 8.5M | |
![[SND]](/icons/sound2.gif) | ugun4.mp3 | 2022-07-02 03:57 | 8.5M | |
![[SND]](/icons/sound2.gif) | ookan15.mp3 | 2022-07-08 09:23 | 8.5M | |
![[SND]](/icons/sound2.gif) | allnightlong.mp3 | 2022-07-09 00:34 | 8.5M | |
![[SND]](/icons/sound2.gif) | AUDIO MOTIVACION II.mp3 | 2022-07-01 01:22 | 8.5M | |
![[SND]](/icons/sound2.gif) | YK16.mp3 | 2022-06-30 16:16 | 8.5M | |
![[SND]](/icons/sound2.gif) | NOIZY - OTR ME ZEMËR ( Official Video 4K ).mp3 | 2022-07-04 18:12 | 8.5M | |
![[SND]](/icons/sound2.gif) | The_Birthday_Massacre_-_Red_Stars_64602524.mp3 | 2022-07-12 23:52 | 8.5M | |
![[SND]](/icons/sound2.gif) | mobi53.mp3 | 2022-07-03 13:58 | 8.5M | |
![[SND]](/icons/sound2.gif) | Zeeus6.mp3 | 2022-07-26 01:45 | 8.5M | |
![[SND]](/icons/sound2.gif) | gibbon-ai-2-feat-jaspa-vol-dadi-stayami.mp3 | 2022-07-29 17:50 | 8.5M | |
![[SND]](/icons/sound2.gif) | Unknown artist - 50 Cent & Gurcan Erdem - Amusement Park (DJ Hammerhead New Eurodance Mix).mp3 | 2022-07-23 17:38 | 8.5M | |
![[SND]](/icons/sound2.gif) | Snoop_Dogg_&_Wiz_Khalifa_-_Young,_Wild_and_Free_ft._Bruno_Mars__Official_Vid.mp3 | 2022-07-06 18:56 | 8.5M | |
![[SND]](/icons/sound2.gif) | Martyr.mp3 | 2022-07-23 00:09 | 8.5M | |
![[SND]](/icons/sound2.gif) | Перемотка - Твоего балкона свет.mp3 | 2022-06-29 18:43 | 8.5M | |
![[SND]](/icons/sound2.gif) | dre1.mp3 | 2022-07-31 09:07 | 8.5M | |
![[SND]](/icons/sound2.gif) | V $ X V PRiNCE - Каждому своё.mp3 | 2022-07-09 09:21 | 8.5M | |
![[SND]](/icons/sound2.gif) | plenka - this feeling.mp3 | 2022-07-06 15:25 | 8.5M | |
![[SND]](/icons/sound2.gif) | vedi87.mp3 | 2022-06-29 12:20 | 8.5M | |
![[SND]](/icons/sound2.gif) | Origins.mp3 | 2022-06-29 23:16 | 8.5M | |
![[SND]](/icons/sound2.gif) | JEGO_-_Moya_khuliganka_65472130.mp3 | 2022-07-05 18:35 | 8.5M | |
![[SND]](/icons/sound2.gif) | lana-del-rey-california-turkce-ceviri.mp3 | 2022-07-01 22:00 | 8.5M | |
![[VID]](/icons/movie.gif) | tcha.mp4 | 2022-07-03 10:56 | 8.5M | |
![[VID]](/icons/movie.gif) | TCha.mp4 | 2022-07-03 10:15 | 8.5M | |
![[SND]](/icons/sound2.gif) | hanz1.mp3 | 2022-07-06 05:41 | 8.5M | |
![[SND]](/icons/sound2.gif) | Walk___Your_Head_High.mp3 | 2022-07-08 09:40 | 8.5M | |
![[SND]](/icons/sound2.gif) | Sadh.mp3 | 2022-07-15 02:36 | 8.5M | |
![[SND]](/icons/sound2.gif) | Calvin Harris - Summer.mp3 | 2022-06-29 18:14 | 8.5M | |
![[SND]](/icons/sound2.gif) | purge2.mp3 | 2022-07-12 01:47 | 8.5M | |
![[SND]](/icons/sound2.gif) | Hanzz2.mp3 | 2022-07-15 08:15 | 8.5M | |
![[SND]](/icons/sound2.gif) | Miyagi_Andy_Panda_Mav-d_-_Marmalade_73347913.mp3 | 2022-07-04 11:18 | 8.5M | |
![[SND]](/icons/sound2.gif) | 21 Savage - Bank Account (Official Audio)(MP3_320K).mp3 | 2022-07-11 19:23 | 8.5M | |
![[SND]](/icons/sound2.gif) | SadJason.mp3 | 2022-07-08 11:52 | 8.5M | |
![[SND]](/icons/sound2.gif) | seks_u_nashomu_seli_-_gop_ca_-ca__hochu_kozhnu_nichku_chiki-driki_garnu_molodichku_(z2.fm).mp3 | 2022-07-04 20:00 | 8.5M | |
![[SND]](/icons/sound2.gif) | سكنتم فؤادي لـ سلمان الملا.mp3 | 2022-07-09 19:36 | 8.5M | |
![[SND]](/icons/sound2.gif) | Ona_eshyo_sovsem_glupyshka_no_ne_nazvat_eyo_pustyshkoj_Cheba_Tik_tok.mp3 | 2022-07-07 11:00 | 8.5M | |
![[SND]](/icons/sound2.gif) | (31-33-35Hz) PHARAOH - Дико, например (remix by NID) (Low Bass by Lovell).mp3 | 2022-07-12 23:25 | 8.5M | |
![[SND]](/icons/sound2.gif) | o30.mp3 | 2022-07-07 22:08 | 8.5M | |
![[SND]](/icons/sound2.gif) | o18.mp3 | 2022-07-07 22:04 | 8.5M | |
![[SND]](/icons/sound2.gif) | 06. ALL MINE.mp3 | 2022-07-06 08:26 | 8.5M | |
![[SND]](/icons/sound2.gif) | yo-voy-feat-daddy-yankee.mp3 | 2022-06-30 09:20 | 8.5M | |
![[SND]](/icons/sound2.gif) | FOLKPRO MUSIQUE-ЛЮБЛЮ-kissvk.com.mp3 | 2022-07-10 12:36 | 8.5M | |
![[SND]](/icons/sound2.gif) | Mr.Bullet - Pragaras 3.0 mp3.mp3 | 2022-07-12 06:10 | 8.5M | |
![[SND]](/icons/sound2.gif) | dandelios.mp3 | 2022-06-28 15:18 | 8.5M | |
![[SND]](/icons/sound2.gif) | rs4.mp3 | 2022-07-15 21:48 | 8.5M | |
![[SND]](/icons/sound2.gif) | RS4.mp3 | 2022-07-11 21:50 | 8.5M | |
![[SND]](/icons/sound2.gif) | 02. Akcent - Kylie (Dmitriy Rs & DJ Cheeful Remix) (Radio Ver).mp3 | 2022-07-15 19:42 | 8.5M | |
![[SND]](/icons/sound2.gif) | 7ORANGE.mp3 | 2022-06-29 14:15 | 8.5M | |
![[SND]](/icons/sound2.gif) | Naruto - wind (mp3store.cc).mp3 | 2022-06-27 18:37 | 8.5M | |
![[SND]](/icons/sound2.gif) | dsjJzFi3.mp3 | 2022-07-03 08:50 | 8.5M | |
![[SND]](/icons/sound2.gif) | Zeeus3.mp3 | 2022-07-06 06:41 | 8.5M | |
![[SND]](/icons/sound2.gif) | -Onsa Media- m19- Sabi-tyan-Shoujo Ningyou no Mita Yume-kissvk.com.mp3 | 2022-07-08 09:37 | 8.5M | |
![[SND]](/icons/sound2.gif) | SIROP.mp3 | 2022-07-03 17:49 | 8.5M | |
![[SND]](/icons/sound2.gif) | Кино - Звезда по имени солнце.mp3 | 2022-07-21 10:24 | 8.5M | |
![[SND]](/icons/sound2.gif) | o27.mp3 | 2022-07-07 22:08 | 8.5M | |
![[SND]](/icons/sound2.gif) | Madonna - La Isla Bonita, Lyrics In Video (320 kbps).mp3 | 2022-06-30 01:43 | 8.5M | |
![[SND]](/icons/sound2.gif) | 02-boston-peace_of_mind.mp3 | 2022-07-04 00:48 | 8.5M | |
![[SND]](/icons/sound2.gif) | praning.mp3 | 2022-06-28 06:38 | 8.5M | |
![[SND]](/icons/sound2.gif) | rumahkerumah.mp3 | 2022-07-09 00:33 | 8.5M | |
![[SND]](/icons/sound2.gif) | Phil.mp3 | 2022-07-11 11:04 | 8.5M | |
![[SND]](/icons/sound2.gif) | D.K8.mp3 | 2022-07-12 14:19 | 8.5M | |
![[SND]](/icons/sound2.gif) | zrkpercayalah.mp3 | 2022-06-29 07:51 | 8.5M | |
![[SND]](/icons/sound2.gif) | muzlome_Lucaveros_-_Virazhi_64375758.mp3 | 2022-07-07 18:35 | 8.5M | |
![[SND]](/icons/sound2.gif) | Z29.mp3 | 2022-07-10 21:52 | 8.5M | |
![[SND]](/icons/sound2.gif) | Emi1.mp3 | 2022-07-23 15:34 | 8.5M | |
![[SND]](/icons/sound2.gif) | kal2.mp3 | 2022-07-16 16:06 | 8.5M | |
![[SND]](/icons/sound2.gif) | kosandra-moya-dikaya-kasandra-miyagi.mp3 | 2022-06-30 17:41 | 8.5M | |
![[SND]](/icons/sound2.gif) | zrkxdadari.mp3 | 2022-06-29 07:44 | 8.5M | |
![[SND]](/icons/sound2.gif) | vedi89.mp3 | 2022-06-29 12:21 | 8.5M | |
![[SND]](/icons/sound2.gif) | Ебанько - 18 мне уже.mp3 | 2022-06-28 08:59 | 8.5M | |
![[SND]](/icons/sound2.gif) | More_YAsnosti_-_Korabl_v_butylke_(musmore.com).mp3 | 2022-07-01 15:02 | 8.5M | |
![[SND]](/icons/sound2.gif) | не хватит богатства оценить меня пупсик - MINISTERSTVO BESPREDELA.mp3 | 2022-07-13 15:34 | 8.5M | |
![[SND]](/icons/sound2.gif) | muzlome_Imagine_Dragons_-_Birds_60254037.mp3 | 2022-07-11 10:56 | 8.5M | |
![[SND]](/icons/sound2.gif) | Tampo.mp3 | 2022-06-27 15:29 | 8.5M | |
![[SND]](/icons/sound2.gif) | Kanjo1.mp3 | 2022-07-04 09:14 | 8.5M | |
![[SND]](/icons/sound2.gif) | GTA1.mp3 | 2022-06-27 17:00 | 8.5M | |
![[SND]](/icons/sound2.gif) | Artur_Pirozhkov_-_Zacepila_62633997.mp3 | 2022-07-08 05:45 | 8.5M | |
![[SND]](/icons/sound2.gif) | zrkangelbaby.mp3 | 2022-06-29 07:42 | 8.5M | |
![[SND]](/icons/sound2.gif) | muslum-gurses-affet.mp3 | 2022-07-12 18:19 | 8.4M | |
![[SND]](/icons/sound2.gif) | Itz A Hustle (DJJOhAL.Com).mp3 | 2022-07-13 03:19 | 8.4M | |
![[SND]](/icons/sound2.gif) | 🌴ᴠ.ᴏ.ʟ.ᴋ.ɪ.ɴ.ᴏ.ᴠ🌴 - 𝙺𝚢𝚗𝚒𝚝 𝚋 𝙹𝚎𝚎𝚙.mp3 | 2022-07-13 03:18 | 8.4M | |
![[SND]](/icons/sound2.gif) | Madness 4 - Cheshyre.mp3 | 2022-07-05 02:25 | 8.4M | |
![[VID]](/icons/movie.gif) | RRAFIZZ-Stay Halal Brother(480P).mp4 | 2022-07-31 08:20 | 8.4M | |
![[SND]](/icons/sound2.gif) | 夜に駆ける - YOASOBI (Piano Cover) Yoru ni kakeru-YOASOBI.mp3 | 2022-07-03 06:30 | 8.4M | |
![[SND]](/icons/sound2.gif) | Batrai - Украду.mp3 | 2022-07-12 23:51 | 8.4M | |
![[SND]](/icons/sound2.gif) | Bajingan.mp3 | 2022-07-06 10:07 | 8.4M | |
![[SND]](/icons/sound2.gif) | 03. GRAVITY (feat. Tyler, The Creator).mp3 | 2022-07-06 08:26 | 8.4M | |
![[SND]](/icons/sound2.gif) | toxic20.mp3 | 2022-07-04 09:24 | 8.4M | |
![[SND]](/icons/sound2.gif) | Danza.mp3 | 2022-07-15 14:07 | 8.4M | |
![[SND]](/icons/sound2.gif) | Peremotka_-_Kak_tebya_pokorit_71440874.mp3 | 2022-07-14 18:38 | 8.4M | |
![[SND]](/icons/sound2.gif) | feels69.mp3 | 2022-06-28 12:33 | 8.4M | |
![[SND]](/icons/sound2.gif) | Mascarpone - Dr. 1885.mp3 | 2022-07-05 16:32 | 8.4M | |
![[SND]](/icons/sound2.gif) | Nirvana_-_Come_As_You_Are_(musmore.com).mp3 | 2022-07-13 19:43 | 8.4M | |
![[SND]](/icons/sound2.gif) | Parachute.mp3 | 2022-07-12 06:10 | 8.4M | |
![[SND]](/icons/sound2.gif) | ayidinovskie.82 - Ай Лето Лето «slow».mp3 | 2022-07-04 09:19 | 8.4M | |
![[SND]](/icons/sound2.gif) | crowd1.mp3 | 2022-07-12 18:35 | 8.4M | |
![[SND]](/icons/sound2.gif) | vedi30.mp3 | 2022-06-29 12:29 | 8.4M | |
![[SND]](/icons/sound2.gif) | House_Of_Metal_-_Chelsea_Wolfe_Lyr_(getmp3.pro).mp3 | 2022-07-14 17:51 | 8.4M | |
![[SND]](/icons/sound2.gif) | mijagi-andy-panda-marmelad(mp3gid.me).mp3 | 2022-06-28 17:02 | 8.4M | |
![[SND]](/icons/sound2.gif) | mobi28.mp3 | 2022-06-30 04:58 | 8.4M | |
![[SND]](/icons/sound2.gif) | Бутырка - За Ростовскую Братву (Памяти Евгения Попова).mp3 | 2022-07-08 18:53 | 8.4M | |
![[SND]](/icons/sound2.gif) | Бутырка - За Ростовскую братву.mp3 | 2022-07-04 11:32 | 8.4M | |
![[SND]](/icons/sound2.gif) | ЛАУД feat. Boulevard Depo, I61 - My Life My Rules.mp3 | 2022-07-12 18:13 | 8.4M | |
![[SND]](/icons/sound2.gif) | 01. Ajayeb Shahr - Hamid Sefat.mp3 | 2022-06-28 09:07 | 8.4M | |
![[SND]](/icons/sound2.gif) | Miyagi & Andy Panda feat. Mav-d - Marmalade.mp3 | 2022-06-30 15:46 | 8.4M | |
![[SND]](/icons/sound2.gif) | SK_SH.mp3 | 2022-07-10 03:10 | 8.4M | |
![[SND]](/icons/sound2.gif) | Vikram (Title Track)(MP3_320K).mp3 | 2022-07-09 16:50 | 8.4M | |
![[SND]](/icons/sound2.gif) | 21 Savage - Bank Account.mp3 | 2022-07-06 15:24 | 8.4M | |
![[SND]](/icons/sound2.gif) | BORIS REDWALL x SODA LUV - HOTBOX OFF ALONE (2007 CLUB HITS REMIX).mp3 | 2022-07-14 01:06 | 8.4M | |
![[SND]](/icons/sound2.gif) | Bone Thugz N Harmony - Lets Ride.mp3 | 2022-07-24 02:07 | 8.4M | |
![[SND]](/icons/sound2.gif) | Bad_Wolves_-_Heaven_So_Heartless_68286647.mp3 | 2022-07-08 12:31 | 8.4M | |
![[SND]](/icons/sound2.gif) | nolie.mp3 | 2022-06-30 12:09 | 8.4M | |
![[SND]](/icons/sound2.gif) | Ekspektasi.mp3 | 2022-07-04 01:08 | 8.4M | |
![[SND]](/icons/sound2.gif) | oni.mp3 | 2022-07-02 05:52 | 8.4M | |
![[SND]](/icons/sound2.gif) | zackin.mp3 | 2022-06-27 15:32 | 8.4M | |
![[SND]](/icons/sound2.gif) | Dy9.mp3 | 2022-07-04 17:14 | 8.4M | |
![[SND]](/icons/sound2.gif) | Saad Lamjarred & Zouhair Bahaoui - Lewjah Tani ! 2021 ! سعد لمجرد و زهير بهاوي - لوجه التاني.mp3 | 2022-07-23 13:04 | 8.4M | |
![[SND]](/icons/sound2.gif) | Ирина Аллегрова - Императрица.mp3 | 2022-07-09 09:32 | 8.4M | |
![[SND]](/icons/sound2.gif) | Jhon06.mp3 | 2022-07-15 01:53 | 8.4M | |
![[SND]](/icons/sound2.gif) | Terraria Calamity Mod Music - _Guardian of The Former Seas_ - Theme of Desert Scourge.mp3 | 2022-07-05 02:57 | 8.4M | |
![[SND]](/icons/sound2.gif) | COMEDOZ - Ямайка (Remix).mp3 | 2022-07-08 09:32 | 8.4M | |
![[SND]](/icons/sound2.gif) | dabro-junost.mp3 | 2022-07-03 09:47 | 8.4M | |
![[SND]](/icons/sound2.gif) | COMEDOZ — Ямайка (Remix) (www.lightaudio.ru).mp3 | 2022-06-28 11:46 | 8.4M | |
![[SND]](/icons/sound2.gif) | Star_Wars_x_Attack_on_Titan_EPIC_MA_(getmp3.pro).mp3 | 2022-07-10 02:49 | 8.4M | |
![[SND]](/icons/sound2.gif) | Донбасс -Вставай Рабочий класс-kissvk.com.mp3 | 2022-07-10 15:44 | 8.4M | |
![[SND]](/icons/sound2.gif) | Ardito.mp3 | 2022-07-15 02:42 | 8.4M | |
![[SND]](/icons/sound2.gif) | Swinging At Shadows.mp3 | 2022-07-23 00:11 | 8.4M | |
![[SND]](/icons/sound2.gif) | WakChak11.mp3 | 2022-07-07 21:35 | 8.4M | |
![[SND]](/icons/sound2.gif) | Dr. Dre ft. Snoop Dogg - Still D.R.E..mp3 | 2022-07-28 17:01 | 8.4M | |
![[SND]](/icons/sound2.gif) | MiyaGi_JEndshpil_-_Fire_Man_57475564.mp3 | 2022-07-05 16:34 | 8.4M | |
![[SND]](/icons/sound2.gif) | Aleksandr_Rybak_-_Kotik_64518075.mp3 | 2022-07-06 12:44 | 8.4M | |
![[SND]](/icons/sound2.gif) | telahepa.mp3 | 2022-07-08 15:59 | 8.4M | |
![[SND]](/icons/sound2.gif) | Леша Свик-Дым-kissvk.com.mp3 | 2022-07-06 03:44 | 8.4M | |
![[SND]](/icons/sound2.gif) | Miyagi_JEndshpil_-_Tam_gde_rassvet_61231581.mp3 | 2022-07-12 14:57 | 8.4M | |
![[SND]](/icons/sound2.gif) | ЗАМАЙ feat. Второй Ка - Гибли (feat. Второй Ка).mp3 | 2022-07-02 19:58 | 8.4M | |
![[SND]](/icons/sound2.gif) | 05. Love On Your Side [7' Version].mp3 | 2022-07-04 00:39 | 8.4M | |
![[SND]](/icons/sound2.gif) | per.mp3 | 2022-07-14 09:50 | 8.4M | |
![[SND]](/icons/sound2.gif) | closetoyou.mp3 | 2022-06-29 05:01 | 8.4M | |
![[SND]](/icons/sound2.gif) | Mindless Self Indulgence — Bring The Pain (www.lightaudio.ru) (1).mp3 | 2022-07-04 06:55 | 8.4M | |
![[SND]](/icons/sound2.gif) | doll69.mp3 | 2022-06-29 13:33 | 8.4M | |
![[SND]](/icons/sound2.gif) | Singing Every Song.mp3 | 2022-07-23 00:11 | 8.4M | |
![[SND]](/icons/sound2.gif) | Hood.mp3 | 2022-07-25 20:18 | 8.4M | |
![[SND]](/icons/sound2.gif) | snte11.mp3 | 2022-06-28 16:09 | 8.4M | |
![[SND]](/icons/sound2.gif) | Compton's Most Wanted - Hood Took Me Under.mp3 | 2022-06-30 08:46 | 8.4M | |
![[SND]](/icons/sound2.gif) | youtubeGcopytight.mp3 | 2022-07-10 14:47 | 8.4M | |
![[SND]](/icons/sound2.gif) | banansok.mp3 | 2022-07-11 13:54 | 8.4M | |
![[SND]](/icons/sound2.gif) | Lag.mp3 | 2022-07-08 10:40 | 8.4M | |
![[SND]](/icons/sound2.gif) | monyet5.mp3 | 2022-07-02 13:34 | 8.4M | |
![[SND]](/icons/sound2.gif) | D.K3.mp3 | 2022-07-12 13:37 | 8.4M | |
![[SND]](/icons/sound2.gif) | Wakno19.mp3 | 2022-07-05 06:43 | 8.4M | |
![[SND]](/icons/sound2.gif) | Akeboshi_-_Wind_(musmore.com).mp3 | 2022-07-02 16:42 | 8.4M | |
![[SND]](/icons/sound2.gif) | Magamet_Dzybov_-_Pikovaya_dama_(musmore.com).mp3 | 2022-07-07 06:47 | 8.4M | |
![[SND]](/icons/sound2.gif) | pespiL3.mp3 | 2022-06-29 03:53 | 8.4M | |
![[SND]](/icons/sound2.gif) | chico29.mp3 | 2022-07-07 08:30 | 8.4M | |
![[SND]](/icons/sound2.gif) | oleg17.mp3 | 2022-07-13 20:35 | 8.4M | |
![[VID]](/icons/movie.gif) | MusiquesClips et Vous - JUL - La Miss Facebook B.mp4 | 2022-07-11 08:55 | 8.4M | |
![[SND]](/icons/sound2.gif) | Xassa_-_Malyutka_64406673.mp3 | 2022-06-28 08:56 | 8.4M | |
![[SND]](/icons/sound2.gif) | Шизомодерн - Zick, Zack, Breathe.mp3 | 2022-07-06 09:03 | 8.4M | |
![[SND]](/icons/sound2.gif) | dj jomblo berkualitqss.mp3 | 2022-07-18 18:25 | 8.4M | |
![[SND]](/icons/sound2.gif) | Menyesal.mp3 | 2022-06-28 19:03 | 8.4M | |
![[SND]](/icons/sound2.gif) | Sonne Hagal - Ragnaroek (radio.lol).mp3 | 2022-07-11 11:22 | 8.4M | |
![[SND]](/icons/sound2.gif) | JElektroforez_Molchat_Doma_-_Mjortv_vnutri_(musmore.com).mp3 | 2022-07-12 05:47 | 8.4M | |
![[SND]](/icons/sound2.gif) | lupai.mp3 | 2022-06-27 18:01 | 8.3M | |
![[SND]](/icons/sound2.gif) | Keru.mp3 | 2022-07-07 18:30 | 8.3M | |
![[SND]](/icons/sound2.gif) | Kraftschlag - Rechtsrock.mp3 | 2022-07-15 17:14 | 8.3M | |
![[SND]](/icons/sound2.gif) | Kkn1.mp3 | 2022-06-28 03:51 | 8.3M | |
![[SND]](/icons/sound2.gif) | TRITICUM - Petrunko (Radio Record).mp3 | 2022-07-16 12:18 | 8.3M | |
![[SND]](/icons/sound2.gif) | MattMalteseAstheWorldCavesIn_(ComedySong.ru).mp3 | 2022-07-04 11:51 | 8.3M | |
![[SND]](/icons/sound2.gif) | Kenz.mp3 | 2022-07-14 06:00 | 8.3M | |
![[SND]](/icons/sound2.gif) | Cradles.mp3 | 2022-07-04 01:02 | 8.3M | |
![[SND]](/icons/sound2.gif) | MiyaGi feat. TumaniYO & Kadi - Bismarck.mp3 | 2022-06-28 17:01 | 8.3M | |
![[SND]](/icons/sound2.gif) | life-is-killing-me_H2oVOrWT.m4a | 2022-06-29 16:24 | 8.3M | |
![[SND]](/icons/sound2.gif) | pndo14.mp3 | 2022-06-28 16:05 | 8.3M | |
![[SND]](/icons/sound2.gif) | pb1.mp3 | 2022-06-28 16:08 | 8.3M | |
![[SND]](/icons/sound2.gif) | HAYAANMOSILA.mp3 | 2022-07-01 10:46 | 8.3M | |
![[SND]](/icons/sound2.gif) | Mr_President_-_Coco_Jamboo_48704880 (1).mp3 | 2022-07-07 19:35 | 8.3M | |
![[SND]](/icons/sound2.gif) | Jujutsu Kaisen _ Eve - Kaikai Kitan (OP).mp3 | 2022-07-09 19:30 | 8.3M | |
![[SND]](/icons/sound2.gif) | KM.mp3 | 2022-08-09 01:47 | 8.3M | |
![[SND]](/icons/sound2.gif) | bugoy4.mp3 | 2022-06-28 06:35 | 8.3M | |
![[SND]](/icons/sound2.gif) | o33.mp3 | 2022-07-08 17:13 | 8.3M | |
![[SND]](/icons/sound2.gif) | Vitya_Matanga_-_Kak_ona_menya_vynosit_64323643.mp3 | 2022-07-12 08:40 | 8.3M | |
![[SND]](/icons/sound2.gif) | helen1.mp3 | 2022-06-28 08:32 | 8.3M | |
![[SND]](/icons/sound2.gif) | dsc3.mp3 | 2022-07-19 18:45 | 8.3M | |
![[SND]](/icons/sound2.gif) | Big_Baby_Tape_Molodojj_Platon_-_VLYUBILAS_73591536.mp3 | 2022-07-06 16:58 | 8.3M | |
![[SND]](/icons/sound2.gif) | Rammstein - Eifersucht(RD).mp3 | 2022-07-09 11:42 | 8.3M | |
![[SND]](/icons/sound2.gif) | Wakno6.mp3 | 2022-07-04 21:57 | 8.3M | |
![[SND]](/icons/sound2.gif) | lil-wayne-im-me-screwed-and-chopped.mp3 | 2022-07-06 18:14 | 8.3M | |
![[SND]](/icons/sound2.gif) | Arthur_Nery_-_Isa_Lang_Lyrics(256k).mp3 | 2022-07-17 02:50 | 8.3M | |
![[SND]](/icons/sound2.gif) | DCYxPHONK.mp3 | 2022-07-10 01:31 | 8.3M | |
![[SND]](/icons/sound2.gif) | toxic54.mp3 | 2022-07-09 05:14 | 8.3M | |
![[SND]](/icons/sound2.gif) | Дюна - Страна Лимония.mp3 | 2022-07-05 06:14 | 8.3M | |
![[SND]](/icons/sound2.gif) | MATRANG_-_Zamanchivaya_73089995.mp3 | 2022-07-11 20:01 | 8.3M | |
![[SND]](/icons/sound2.gif) | otherside.mp3 | 2022-07-11 17:27 | 8.3M | |
![[SND]](/icons/sound2.gif) | Ching.mp3 | 2022-07-04 21:27 | 8.3M | |
![[SND]](/icons/sound2.gif) | V $ X V PRiNCE - На лету (ONE & Neqdope Remix).mp3 | 2022-07-09 08:05 | 8.3M | |
![[SND]](/icons/sound2.gif) | Ленинград - В Питере — пить.mp3 | 2022-07-09 09:09 | 8.3M | |
![[SND]](/icons/sound2.gif) | Gone_Fludd_Kuryu_dermo_eto_sochnaya_sativa.mp3 | 2022-06-27 21:19 | 8.3M | |
![[SND]](/icons/sound2.gif) | 𝙨𝙡𝙤𝙬 𝙧𝙢𝙭 🖤 - Больше чем у вас_ (slow) (www.hotplayer.ru).mp3 | 2022-06-28 18:04 | 8.3M | |
![[SND]](/icons/sound2.gif) | Kravc_Gio_Pika_-_Opyat_dozhdi_73486233.mp3 | 2022-06-28 08:24 | 8.3M | |
![[SND]](/icons/sound2.gif) | pagmama1.mp3 | 2022-07-08 04:12 | 8.3M | |
![[SND]](/icons/sound2.gif) | Gunja6.mp3 | 2022-07-15 17:38 | 8.3M | |
![[SND]](/icons/sound2.gif) | Fire_Man_Miyagi__Эндшпиль_456239215.mp3 | 2022-07-14 22:11 | 8.3M | |
![[SND]](/icons/sound2.gif) | Miyagi & Эндшпиль - Fire Man.mp3 | 2022-07-03 05:04 | 8.3M | |
![[SND]](/icons/sound2.gif) | Sharab Ft. Harjit Harman (DJJOhAL.Com).mp3 | 2022-07-13 03:19 | 8.3M | |
![[SND]](/icons/sound2.gif) | filatov-karas-viktor-coy_-_ostatsya-s-toboy.mp3 | 2022-07-09 18:23 | 8.3M | |
![[SND]](/icons/sound2.gif) | hex4.mp3 | 2022-07-13 11:46 | 8.3M | |
![[SND]](/icons/sound2.gif) | Aphex Twin - Vordhosbn.mp3 | 2022-07-10 19:03 | 8.3M | |
![[SND]](/icons/sound2.gif) | Jennifer.mp3 | 2022-07-04 09:50 | 8.3M | |
![[SND]](/icons/sound2.gif) | Dark Souls Soundtrack. - Gwyn, Lord of Cinder.mp3 | 2022-07-09 19:01 | 8.3M | |
![[SND]](/icons/sound2.gif) | oplosan.mp3 | 2022-07-18 12:07 | 8.3M | |
![[SND]](/icons/sound2.gif) | Late Night Thoughts.mp3 | 2022-07-04 06:54 | 8.3M | |
![[SND]](/icons/sound2.gif) | 07. Cash to Burn.mp3 | 2022-06-30 01:12 | 8.3M | |
![[SND]](/icons/sound2.gif) | freebird.mp3 | 2022-07-03 03:06 | 8.3M | |
![[SND]](/icons/sound2.gif) | TOTTO59.mp3 | 2022-07-15 16:31 | 8.3M | |
![[SND]](/icons/sound2.gif) | Paul McCartney - Coming Up (320 kbps).mp3 | 2022-06-29 02:18 | 8.3M | |
![[SND]](/icons/sound2.gif) | Jhef Gheto é o Breque.mp3 | 2022-07-10 13:28 | 8.3M | |
![[SND]](/icons/sound2.gif) | MENGKANE 2.mp3 | 2022-07-10 09:16 | 8.3M | |
![[SND]](/icons/sound2.gif) | Xiaoyen1.mp3 | 2022-07-10 12:58 | 8.3M | |
![[SND]](/icons/sound2.gif) | vedi26.mp3 | 2022-06-29 12:28 | 8.3M | |
![[SND]](/icons/sound2.gif) | 23. Nashegi - Golazin.mp3 | 2022-06-28 13:54 | 8.3M | |
![[SND]](/icons/sound2.gif) | Эрика Лундмоен - Яд .mp3 | 2022-07-09 10:34 | 8.3M | |
![[SND]](/icons/sound2.gif) | restyourloveonme.mp3 | 2022-06-29 05:01 | 8.3M | |
![[SND]](/icons/sound2.gif) | PD75.mp3 | 2022-07-01 13:08 | 8.3M | |
![[SND]](/icons/sound2.gif) | D.K.mp3 | 2022-07-12 13:37 | 8.3M | |
![[SND]](/icons/sound2.gif) | Cyborg 2.mp3 | 2022-07-08 17:29 | 8.3M | |
![[SND]](/icons/sound2.gif) | Turn.mp3 | 2022-07-12 15:15 | 8.3M | |
![[SND]](/icons/sound2.gif) | sal.mp3 | 2022-07-04 09:45 | 8.3M | |
![[SND]](/icons/sound2.gif) | О.Пономарьов, М.Хома - Украина Переможе.mp3 | 2022-07-08 17:25 | 8.3M | |
![[SND]](/icons/sound2.gif) | Hopm.mp3.mp3 | 2022-07-06 14:26 | 8.3M | |
![[SND]](/icons/sound2.gif) | vedi48.mp3 | 2022-06-29 12:12 | 8.3M | |
![[SND]](/icons/sound2.gif) | Vanessa Mae - Reflection.mp3 | 2022-07-15 22:02 | 8.3M | |
![[SND]](/icons/sound2.gif) | GejolakCinta.mp3 | 2022-07-06 00:41 | 8.3M | |
![[SND]](/icons/sound2.gif) | kurtlar-vadisi-pusu-ibrahim-omer-remix-operasyon-muzigi.mp3 | 2022-07-09 01:23 | 8.3M | |
![[SND]](/icons/sound2.gif) | NAO - Bad Blood (Lyrics).mp3 | 2022-07-09 14:59 | 8.3M | |
![[SND]](/icons/sound2.gif) | Hell to pay.mp3 | 2022-07-09 09:17 | 8.3M | |
![[SND]](/icons/sound2.gif) | vedi52.mp3 | 2022-06-29 12:12 | 8.3M | |
![[SND]](/icons/sound2.gif) | nurminskij-kupit-by-dzhip.mp3 | 2022-07-06 20:01 | 8.3M | |
![[VID]](/icons/movie.gif) | Bloc.mp4 | 2022-07-08 19:04 | 8.3M | |
![[SND]](/icons/sound2.gif) | Pyrokinesis_-_Kak_Saturn_pozhiraet_svoikh_detejj_66120260.mp3 | 2022-06-29 11:53 | 8.3M | |
![[SND]](/icons/sound2.gif) | AAD.mp3 | 2022-07-13 08:55 | 8.3M | |
![[SND]](/icons/sound2.gif) | mix.mp3 | 2022-08-06 12:16 | 8.3M | |
![[SND]](/icons/sound2.gif) | zali3.mp3 | 2022-07-15 17:12 | 8.3M | |
![[SND]](/icons/sound2.gif) | Mr. Mister - Kyrie.mp3 | 2022-07-04 01:11 | 8.3M | |
![[SND]](/icons/sound2.gif) | Oswine3.mp3 | 2022-07-13 23:18 | 8.3M | |
![[SND]](/icons/sound2.gif) | hanz4.mp3 | 2022-07-06 05:59 | 8.3M | |
![[SND]](/icons/sound2.gif) | SEEMEE_SODA_LUV_Kashin_Golodnyi_pyos_Remix.mp3 | 2022-06-30 08:58 | 8.3M | |
![[SND]](/icons/sound2.gif) | shans.mp3 | 2022-06-27 15:16 | 8.3M | |
![[SND]](/icons/sound2.gif) | шанс.mp3 | 2022-06-27 14:47 | 8.3M | |
![[SND]](/icons/sound2.gif) | miyagi_-_captain_muzati.net.mp3 | 2022-07-21 15:01 | 8.2M | |
![[SND]](/icons/sound2.gif) | Welcome To Vegas Baby (I Wanna Ride) Yeni TikTok Akımı.mp3 | 2022-07-05 23:51 | 8.2M | |
![[SND]](/icons/sound2.gif) | abba.mp3 | 2022-07-01 21:49 | 8.2M | |
![[SND]](/icons/sound2.gif) | jon2.mp3 | 2022-06-28 00:38 | 8.2M | |
![[SND]](/icons/sound2.gif) | Akale.mp3 | 2022-07-14 11:33 | 8.2M | |
![[SND]](/icons/sound2.gif) | (NLP) (31-35Hz) Big Baby Tape, Молодой Платон - ВЛЮБИЛАСЬ (lb by sunrise).mp3 | 2022-07-12 23:23 | 8.2M | |
![[SND]](/icons/sound2.gif) | tATu_-_All_The_Things_She_Said_47837674.mp3 | 2022-06-30 09:32 | 8.2M | |
![[SND]](/icons/sound2.gif) | Rudh5.mp3 | 2022-07-13 15:34 | 8.2M | |
![[SND]](/icons/sound2.gif) | Oceans.mp3 | 2022-07-09 09:41 | 8.2M | |
![[SND]](/icons/sound2.gif) | It Aint Legal Ft. Gurlej Akhtar (DJJOhAL.Com).mp3 | 2022-07-13 03:19 | 8.2M | |
![[SND]](/icons/sound2.gif) | dkl16.mp3 | 2022-07-15 02:31 | 8.2M | |
![[SND]](/icons/sound2.gif) | grandson - Identity.mp3 | 2022-07-04 21:26 | 8.2M | |
![[SND]](/icons/sound2.gif) | Mertmiş - Bosnian Folk Song - Bosanska Artiljerija.mp3 | 2022-07-09 10:26 | 8.2M | |
![[SND]](/icons/sound2.gif) | Dijeh4.mp3 | 2022-07-07 06:32 | 8.2M | |
![[SND]](/icons/sound2.gif) | Leon7.mp3 | 2022-07-15 11:35 | 8.2M | |
![[SND]](/icons/sound2.gif) | rs17.mp3 | 2022-07-15 21:48 | 8.2M | |
![[SND]](/icons/sound2.gif) | mertmi351-bosnian-folk-song-bosanska-artiljerija_456657343.mp3 | 2022-07-03 20:59 | 8.2M | |
![[SND]](/icons/sound2.gif) | Sadboi1.mp3 | 2022-07-07 08:18 | 8.2M | |
![[SND]](/icons/sound2.gif) | Rhey14.mp3 | 2022-06-28 11:59 | 8.2M | |
![[SND]](/icons/sound2.gif) | Sempurna_-_Andra_And_The_Backbone_(instrumental_guitar_cover)_by_Albayments(256k).mp3 | 2022-07-13 15:10 | 8.2M | |
![[SND]](/icons/sound2.gif) | Har7.mp3 | 2022-07-10 01:39 | 8.2M | |
![[SND]](/icons/sound2.gif) | LugowoDangdut.mp3 | 2022-07-10 10:28 | 8.2M | |
![[SND]](/icons/sound2.gif) | kejujoget.mp3 | 2022-07-13 20:35 | 8.2M | |
![[SND]](/icons/sound2.gif) | QUEEN.mp3 | 2022-06-27 15:21 | 8.2M | |
![[SND]](/icons/sound2.gif) | The Weeknd - Save Your Tears.mp3 | 2022-07-03 19:16 | 8.2M | |
![[SND]](/icons/sound2.gif) | MengkaneGasi5.mp3 | 2022-06-30 00:12 | 8.2M | |
![[SND]](/icons/sound2.gif) | oneRightNow.mp3 | 2022-07-06 08:08 | 8.2M | |
![[SND]](/icons/sound2.gif) | SANTAI.mp3 | 2022-07-10 09:16 | 8.2M | |
![[SND]](/icons/sound2.gif) | Har8.mp3 | 2022-07-10 01:39 | 8.2M | |
![[SND]](/icons/sound2.gif) | 2000400220_456244386.mp3 | 2022-07-01 01:56 | 8.2M | |
![[SND]](/icons/sound2.gif) | ras.mp3 | 2022-07-14 02:51 | 8.2M | |
![[SND]](/icons/sound2.gif) | man.mp3 | 2022-08-08 09:18 | 8.2M | |
![[SND]](/icons/sound2.gif) | DEAD_BLONDE_-_Мальчик_на_девятке.mp3.mp3 | 2022-06-28 10:33 | 8.2M | |
![[SND]](/icons/sound2.gif) | DEAD BLONDE - Мальчик на девятке.mp3 | 2022-07-12 23:51 | 8.2M | |
![[SND]](/icons/sound2.gif) | zrkcomet.mp3 | 2022-06-29 07:45 | 8.2M | |
![[SND]](/icons/sound2.gif) | RS10.mp3 | 2022-07-03 16:52 | 8.2M | |
![[SND]](/icons/sound2.gif) | Akon_-_Smack_That_48195356.mp3 | 2022-06-27 19:22 | 8.2M | |
![[SND]](/icons/sound2.gif) | oleg20.mp3 | 2022-07-13 20:35 | 8.2M | |
![[SND]](/icons/sound2.gif) | BINALEWALA.mp3 | 2022-07-01 10:45 | 8.2M | |
![[SND]](/icons/sound2.gif) | Z20.mp3 | 2022-07-10 21:11 | 8.2M | |
![[SND]](/icons/sound2.gif) | PATAWAD.mp3 | 2022-07-01 10:49 | 8.2M | |
![[SND]](/icons/sound2.gif) | GAYAZOVBROTHERMALINOVAYALADA.mp3 | 2022-06-30 13:23 | 8.2M | |
![[SND]](/icons/sound2.gif) | Wakno21.mp3 | 2022-07-05 06:43 | 8.2M | |
![[SND]](/icons/sound2.gif) | Юрий Шатунов - Детство.mp3 | 2022-07-03 17:28 | 8.2M | |
![[SND]](/icons/sound2.gif) | best.mp3 | 2022-06-30 15:28 | 8.2M | |
![[SND]](/icons/sound2.gif) | jon1.mp3 | 2022-06-28 00:36 | 8.2M | |
![[SND]](/icons/sound2.gif) | anuintro210.mp3 | 2022-07-09 05:50 | 8.2M | |
![[SND]](/icons/sound2.gif) | anuintro100.mp3 | 2022-07-09 04:50 | 8.2M | |
![[SND]](/icons/sound2.gif) | vedi36.mp3 | 2022-06-29 12:30 | 8.2M | |
![[SND]](/icons/sound2.gif) | bugoy15.mp3 | 2022-06-28 06:35 | 8.2M | |
![[SND]](/icons/sound2.gif) | ASTRONAMENT -ɴᴀ ꜱᴛᴇᴋʟᴀʜ-kissvk.com.mp3 | 2022-07-16 05:51 | 8.2M | |
![[SND]](/icons/sound2.gif) | AUD-20211017-WA0039.mp3 | 2022-07-08 00:41 | 8.2M | |
![[SND]](/icons/sound2.gif) | DjKane4.mp3 | 2022-06-29 05:34 | 8.2M | |
![[SND]](/icons/sound2.gif) | friday-night-plans-plastic-love-cover-version-original-song-by-mariya-takeuchi.mp3 | 2022-07-06 10:40 | 8.2M | |
![[SND]](/icons/sound2.gif) | tulus5.mp3 | 2022-06-28 17:36 | 8.2M | |
![[SND]](/icons/sound2.gif) | paper-route-american-clouds.mp3 | 2022-07-01 18:49 | 8.2M | |
![[SND]](/icons/sound2.gif) | 13. Nothing In Common.mp3 | 2022-07-04 00:39 | 8.2M | |
![[SND]](/icons/sound2.gif) | dora_MJEJJBI_BJEJJBI_-_Ne_ispravlyus_(musmore.com).mp3 | 2022-07-07 10:26 | 8.2M | |
![[SND]](/icons/sound2.gif) | ookan40.mp3 | 2022-07-10 18:16 | 8.2M | |
![[SND]](/icons/sound2.gif) | SCIRENA-Название (2).mp3 | 2022-06-29 17:18 | 8.2M | |
![[SND]](/icons/sound2.gif) | Erlan1.mp3 | 2022-07-09 08:49 | 8.2M | |
![[SND]](/icons/sound2.gif) | Erlan.mp3 | 2022-07-07 18:22 | 8.2M | |
![[SND]](/icons/sound2.gif) | Miyagi_-_Captain_(musmore.com).mp3 | 2022-06-29 08:42 | 8.2M | |
![[SND]](/icons/sound2.gif) | Talking.mp3 | 2022-07-03 05:14 | 8.2M | |
![[SND]](/icons/sound2.gif) | mrrap.mp3 | 2022-07-04 09:01 | 8.2M | |
![[SND]](/icons/sound2.gif) | jms9.mp3 | 2022-07-07 16:22 | 8.2M | |
![[SND]](/icons/sound2.gif) | lana-del-rey-salvatore-turkce-ceviri.mp3 | 2022-07-01 22:12 | 8.2M | |
![[SND]](/icons/sound2.gif) | vedi75.mp3 | 2022-06-29 12:17 | 8.2M | |
![[SND]](/icons/sound2.gif) | Мирас Жугунусов - Зымыран.mp3 | 2022-07-01 05:16 | 8.2M | |
![[SND]](/icons/sound2.gif) | B E S P R E D E L - Tanir Tyomcha - DA DA DA.mp3 | 2022-07-12 23:51 | 8.2M | |
![[SND]](/icons/sound2.gif) | grind.mp3 | 2022-07-05 13:48 | 8.2M | |
![[SND]](/icons/sound2.gif) | Miyagi - Captain.mp3 | 2022-07-06 23:22 | 8.2M | |
![[SND]](/icons/sound2.gif) | Miyagi - Captain (1).mp3 | 2022-07-06 23:22 | 8.2M | |
![[SND]](/icons/sound2.gif) | mfLg.mp3 | 2022-08-05 14:35 | 8.2M | |
![[SND]](/icons/sound2.gif) | mad69.mp3 | 2022-06-28 15:38 | 8.2M | |
![[SND]](/icons/sound2.gif) | SabiDanLulu.mp3 | 2022-06-29 05:39 | 8.2M | |
![[SND]](/icons/sound2.gif) | right69.mp3 | 2022-06-29 13:33 | 8.2M | |
![[SND]](/icons/sound2.gif) | Rick_Astley_-_Never_Gonna_Give_You_Up_(musmore.com).mp3 | 2022-07-04 20:11 | 8.2M | |
![[SND]](/icons/sound2.gif) | Rick_Astley_-_Never_Gonna_Give_You_Up_(musmore.com) (1).mp3 | 2022-07-04 20:11 | 8.2M | |
![[SND]](/icons/sound2.gif) | SK_UT.mp3 | 2022-07-02 02:46 | 8.2M | |
![[SND]](/icons/sound2.gif) | boombox2.mp3 | 2022-06-28 11:08 | 8.2M | |
![[SND]](/icons/sound2.gif) | OptikPaps.mp3 | 2022-06-29 05:34 | 8.2M | |
![[SND]](/icons/sound2.gif) | acho4.mp3 | 2022-06-29 05:59 | 8.2M | |
![[SND]](/icons/sound2.gif) | anuintro203.mp3 | 2022-07-09 05:49 | 8.2M | |
![[SND]](/icons/sound2.gif) | anuintro93.mp3 | 2022-07-09 04:49 | 8.2M | |
![[SND]](/icons/sound2.gif) | Kadebostany - I Can See The Sky (mp3store.cc).mp3 | 2022-07-03 17:12 | 8.2M | |
![[SND]](/icons/sound2.gif) | Brennan Savage - Look At Me Now (Gabidulin Remix) (1).mp3 | 2022-07-12 23:51 | 8.2M | |
![[SND]](/icons/sound2.gif) | Jerryxdj7.mp3 | 2022-07-05 20:07 | 8.2M | |
![[SND]](/icons/sound2.gif) | Die Antwoord - Ugly Boy.mp3 | 2022-07-08 04:10 | 8.2M | |
![[SND]](/icons/sound2.gif) | TOTTO23.mp3 | 2022-07-15 16:37 | 8.2M | |
![[SND]](/icons/sound2.gif) | tara202-magistrali-(muzbom.ru).mp3 | 2022-07-12 02:00 | 8.2M | |
![[SND]](/icons/sound2.gif) | Archi - Вера внутри.mp3 | 2022-07-05 07:59 | 8.2M | |
![[SND]](/icons/sound2.gif) | GAYAZOV$ BROTHER$ - МАЛИНОВАЯ ЛАДА.mp3 | 2022-07-07 15:27 | 8.2M | |
![[SND]](/icons/sound2.gif) | Yo1.mp3 | 2022-08-08 09:14 | 8.2M | |
![[SND]](/icons/sound2.gif) | bilaaa6.mp3 | 2022-07-09 02:06 | 8.2M | |
![[SND]](/icons/sound2.gif) | dj masih ganteng1.mp3 | 2022-07-03 05:44 | 8.2M | |
![[SND]](/icons/sound2.gif) | dhije5.mp3 | 2022-07-03 06:09 | 8.2M | |
![[SND]](/icons/sound2.gif) | Юлианна Караулова - Градусы.mp3 | 2022-07-05 14:25 | 8.1M | |
![[SND]](/icons/sound2.gif) | binks.mp3 | 2022-07-07 06:19 | 8.1M | |
![[SND]](/icons/sound2.gif) | TOTTO17.mp3 | 2022-07-15 16:37 | 8.1M | |
![[SND]](/icons/sound2.gif) | DJ-Ku-menangis-Membayangkan-Hati-Yang-Kau-Sakiti-Remix-Viral-Tiktok-2020_IDm498-l4cI.mp3 | 2022-07-09 01:40 | 8.1M | |
![[SND]](/icons/sound2.gif) | 1573279989_nurminskiy_duxom_ne_upast.mp3 | 2022-06-27 14:45 | 8.1M | |
![[SND]](/icons/sound2.gif) | ace63.mp3 | 2022-07-05 07:43 | 8.1M | |
![[SND]](/icons/sound2.gif) | ZennBoombox.mp3 | 2022-07-03 05:13 | 8.1M | |
![[SND]](/icons/sound2.gif) | Zeeus7.mp3 | 2022-07-26 01:45 | 8.1M | |
![[SND]](/icons/sound2.gif) | zrkdjinoma.mp3 | 2022-06-29 07:43 | 8.1M | |
![[SND]](/icons/sound2.gif) | toxic47.mp3 | 2022-07-04 12:30 | 8.1M | |
![[SND]](/icons/sound2.gif) | helen15.mp3 | 2022-07-16 08:01 | 8.1M | |
![[SND]](/icons/sound2.gif) | zrkintentions.mp3 | 2022-06-29 07:41 | 8.1M | |
![[SND]](/icons/sound2.gif) | SHamkhan_Daldaev_-_Kavkaz_(musmore.com).mp3 | 2022-07-07 06:50 | 8.1M | |
![[SND]](/icons/sound2.gif) | Eminem_Juice_WRLD_-_Godzilla_68101411.mp3 | 2022-06-27 15:01 | 8.1M | |
![[SND]](/icons/sound2.gif) | hamza2.mp3 | 2022-07-06 22:56 | 8.1M | |
![[SND]](/icons/sound2.gif) | dande.mp3 | 2022-06-29 21:35 | 8.1M | |
![[SND]](/icons/sound2.gif) | dido.mp3 | 2022-07-07 02:18 | 8.1M | |
![[SND]](/icons/sound2.gif) | dido(1).mp3 | 2022-06-28 05:49 | 8.1M | |
![[SND]](/icons/sound2.gif) | Dido.mp3 | 2022-07-23 16:03 | 8.1M | |
![[SND]](/icons/sound2.gif) | Aaronsleys9.mp3 | 2022-07-08 03:53 | 8.1M | |
![[SND]](/icons/sound2.gif) | ANYING.mp3 | 2022-06-28 06:07 | 8.1M | |
![[SND]](/icons/sound2.gif) | notsobad.mp3 | 2022-07-08 15:12 | 8.1M | |
![[SND]](/icons/sound2.gif) | 1551208742.mp3 | 2022-07-01 07:12 | 8.1M | |
![[SND]](/icons/sound2.gif) | anto8.mp3 | 2022-07-12 04:15 | 8.1M | |
![[SND]](/icons/sound2.gif) | Industrybaby.mp3 | 2022-07-04 01:18 | 8.1M | |
![[SND]](/icons/sound2.gif) | Phao, Kaiz remix - 2 Phut Hon.mp3 | 2022-07-09 20:49 | 8.1M | |
![[SND]](/icons/sound2.gif) | ZhAm6.mp3 | 2022-07-02 15:26 | 8.1M | |
![[SND]](/icons/sound2.gif) | zrkitsyou.mp3 | 2022-06-29 07:48 | 8.1M | |
![[SND]](/icons/sound2.gif) | By Your Side.mp3 | 2022-07-23 00:09 | 8.1M | |
![[SND]](/icons/sound2.gif) | Ранетки - Чемпионы любви.mp3 | 2022-07-06 14:45 | 8.1M | |
![[SND]](/icons/sound2.gif) | SRN.mp3 | 2022-07-13 08:58 | 8.1M | |
![[SND]](/icons/sound2.gif) | Элджей feat. Kemel-Fontan - Kemel- batya Remix--kissvk.com (1).mp3 | 2022-07-13 13:30 | 8.1M | |
![[SND]](/icons/sound2.gif) | Koka_kola.mp3 | 2022-07-25 17:46 | 8.1M | |
![[SND]](/icons/sound2.gif) | smurfhop.mp3 | 2022-07-11 02:36 | 8.1M | |
![[SND]](/icons/sound2.gif) | doiwannaknow.mp3 | 2022-07-13 01:58 | 8.1M | |
![[SND]](/icons/sound2.gif) | flmala.mp3 | 2022-07-15 13:44 | 8.1M | |
![[SND]](/icons/sound2.gif) | KANNOONJAL_-_Tamil_Album___Sreejith_Edavana___Ramya_Jayaraj(256k).mp3 | 2022-07-07 07:25 | 8.1M | |
![[SND]](/icons/sound2.gif) | TOTTO13.mp3 | 2022-07-15 16:37 | 8.1M | |
![[SND]](/icons/sound2.gif) | Miyagi Эндшпиль - DLBM (1).mp3 | 2022-07-10 10:48 | 8.1M | |
![[SND]](/icons/sound2.gif) | staplegun - BONKERS.mp3 | 2022-07-30 18:14 | 8.1M | |
![[SND]](/icons/sound2.gif) | Вальс смерти.mp3 | 2022-07-01 16:23 | 8.1M | |
![[SND]](/icons/sound2.gif) | sadvibes2.mp3 | 2022-06-27 23:39 | 8.1M | |
![[SND]](/icons/sound2.gif) | tsunami3.mp3 | 2022-06-29 15:30 | 8.1M | |
![[SND]](/icons/sound2.gif) | cc11.mp3 | 2022-06-29 23:59 | 8.1M | |
![[SND]](/icons/sound2.gif) | virgoun.mp3 | 2022-07-01 17:26 | 8.1M | |
![[SND]](/icons/sound2.gif) | zrkragu.mp3 | 2022-06-29 07:52 | 8.1M | |
![[SND]](/icons/sound2.gif) | Rickroll.mp3 | 2022-07-04 01:29 | 8.1M | |
![[SND]](/icons/sound2.gif) | Stahlmann - Tanzmaschine (1).mp3 | 2022-07-12 23:52 | 8.1M | |
![[SND]](/icons/sound2.gif) | 5sta Family - Зачем.mp3 | 2022-07-12 23:51 | 8.1M | |
![[SND]](/icons/sound2.gif) | LoUreNskiy.mp3 | 2022-07-14 15:04 | 8.1M | |
![[SND]](/icons/sound2.gif) | Chernikovskaya Hata-Нажми на кнопку-kissvk.com.mp3 | 2022-07-13 18:02 | 8.1M | |
![[SND]](/icons/sound2.gif) | Исполнитель_ Суеты - SkodaStreetRacing.mp3 | 2022-07-06 04:30 | 8.1M | |
![[SND]](/icons/sound2.gif) | Dream_It_Possible.mp3 | 2022-07-19 08:22 | 8.1M | |
![[SND]](/icons/sound2.gif) | miyagi_-_govori_mne_(feat._andy_panda)_muzati.net.mp3 | 2022-07-14 15:33 | 8.1M | |
![[SND]](/icons/sound2.gif) | nathan-whitehead-days-gone-from-days-gone-original-motion-picture-soundtrack.mp3 | 2022-06-27 13:15 | 8.1M | |
![[SND]](/icons/sound2.gif) | Armyanchik_Opa_opa_Amerika_Evropa_Aziya_Evraziya.mp3 | 2022-07-01 20:39 | 8.1M | |
![[SND]](/icons/sound2.gif) | Armyanchik - Опа опа Америка Европа Азия Евразия.mp3 | 2022-07-07 23:51 | 8.1M | |
![[SND]](/icons/sound2.gif) | Кино - Проснись.mp3 | 2022-06-29 18:25 | 8.1M | |
![[SND]](/icons/sound2.gif) | there.mp3 | 2022-07-06 15:31 | 8.1M | |
![[SND]](/icons/sound2.gif) | Set_It_Off_Ash_Costello_-_Partners_in_Crime_Ash_Costello_(musmore.com).mp3 | 2022-07-20 16:50 | 8.1M | |
![[SND]](/icons/sound2.gif) | Enjelbabi.mp3 | 2022-06-27 14:27 | 8.1M | |
![[SND]](/icons/sound2.gif) | лучшийдрилл.mp3 | 2022-06-27 14:47 | 8.1M | |
![[SND]](/icons/sound2.gif) | medina.mp3 | 2022-07-08 18:27 | 8.1M | |
![[SND]](/icons/sound2.gif) | smile2.mp3 | 2022-07-03 05:56 | 8.1M | |
![[SND]](/icons/sound2.gif) | Николай Гнатюк - Ой, смереко (megapesni.fm).mp3 | 2022-07-05 19:06 | 8.1M | |
![[SND]](/icons/sound2.gif) | kendrick2.mp3 | 2022-07-16 01:31 | 8.1M | |
![[SND]](/icons/sound2.gif) | 002-AL-BAQARAH (030 TO 046).mp3 | 2022-08-08 10:37 | 8.1M | |
![[SND]](/icons/sound2.gif) | Tones_and_I_-_Dance_Monkey_66175914.mp3 | 2022-07-05 18:07 | 8.1M | |
![[SND]](/icons/sound2.gif) | lk1.mp3 | 2022-06-28 16:03 | 8.1M | |
![[SND]](/icons/sound2.gif) | toxic46.mp3 | 2022-07-04 12:30 | 8.1M | |
![[SND]](/icons/sound2.gif) | Шизомодерн_Я_убил_себя_в_государстве.mp3 | 2022-07-06 09:03 | 8.1M | |
![[SND]](/icons/sound2.gif) | Шизомодерн_Я_убил_себя_в_государстве (1).mp3 | 2022-07-06 09:03 | 8.1M | |
![[SND]](/icons/sound2.gif) | topremix-net_gazirovka_-_black_jvstin_remix__456239213169246089.mp3 | 2022-07-07 11:09 | 8.1M | |
![[SND]](/icons/sound2.gif) | TOTTO11.mp3 | 2022-07-15 16:37 | 8.1M | |
![[SND]](/icons/sound2.gif) | T_Fest_Uleti.mp3 | 2022-08-01 08:07 | 8.1M | |
![[SND]](/icons/sound2.gif) | T-Fest_-_Uleti_47828757.mp3 | 2022-06-28 18:58 | 8.1M | |
![[SND]](/icons/sound2.gif) | MiyaGi - Texture (Remastered Wooden Production).mp3 | 2022-07-05 14:27 | 8.1M | |
![[SND]](/icons/sound2.gif) | plenka - Nostalgia.mp3 | 2022-07-06 15:25 | 8.1M | |
![[SND]](/icons/sound2.gif) | Макс Корж - Малолетка.mp3 | 2022-07-13 10:41 | 8.1M | |
![[SND]](/icons/sound2.gif) | Hehe.mp3 | 2022-06-30 14:54 | 8.1M | |
![[SND]](/icons/sound2.gif) | Rer.mp3 | 2022-06-28 01:12 | 8.1M | |
![[SND]](/icons/sound2.gif) | 50_Cent_Olivia_-_Candy_Shop_47965590.mp3 | 2022-07-01 05:47 | 8.1M | |
![[SND]](/icons/sound2.gif) | vedi58.mp3 | 2022-06-29 12:14 | 8.1M | |
![[SND]](/icons/sound2.gif) | 03 Weekend (Featuring Miguel).mp3 | 2022-06-30 08:03 | 8.1M | |
![[SND]](/icons/sound2.gif) | zrkdjcallme.mp3 | 2022-06-29 07:44 | 8.1M | |
![[SND]](/icons/sound2.gif) | kamalayaan.mp3 | 2022-07-04 13:16 | 8.1M | |
![[SND]](/icons/sound2.gif) | Сектор Газа - Вой На Луну.mp3 | 2022-06-29 08:38 | 8.1M | |
![[SND]](/icons/sound2.gif) | Pesnya_Da_da_da_eto_Kavkaz.mp3 | 2022-07-11 16:11 | 8.1M | |
![[SND]](/icons/sound2.gif) | Песня - Да да да это Кавказ.mp3 | 2022-07-07 06:52 | 8.1M | |
![[VID]](/icons/movie.gif) | Joji - Glimpse of Us (1).mp4 | 2022-07-05 06:49 | 8.1M | |
![[SND]](/icons/sound2.gif) | toxic36.mp3 | 2022-07-04 12:17 | 8.1M | |
![[SND]](/icons/sound2.gif) | [MP3DOWNLOAD.TO] Billy Idol - White Wedding Pt 1 (Official Music Video)-320k.mp3 | 2022-07-14 15:24 | 8.1M | |
![[SND]](/icons/sound2.gif) | 2Scratch - SuperLIFE.mp3 | 2022-07-12 23:51 | 8.0M | |
![[SND]](/icons/sound2.gif) | 10. Don't Mess With Doctor Dream.mp3 | 2022-07-04 00:39 | 8.0M | |
![[SND]](/icons/sound2.gif) | Gio_PiKa_-_ontanchik_s_delfinom_68075189.mp3 | 2022-07-31 08:58 | 8.0M | |
![[SND]](/icons/sound2.gif) | james13.mp3 | 2022-07-15 04:23 | 8.0M | |
![[SND]](/icons/sound2.gif) | aap-rocky-aap-forever-official-video-ft-moby.mp3 | 2022-07-02 00:42 | 8.0M | |
![[SND]](/icons/sound2.gif) | nisan.mp3 | 2022-07-05 22:56 | 8.0M | |
![[SND]](/icons/sound2.gif) | batu nisan.mp3 | 2022-07-05 22:05 | 8.0M | |
![[SND]](/icons/sound2.gif) | CahayaBidadari.mp3 | 2022-07-02 06:21 | 8.0M | |
![[SND]](/icons/sound2.gif) | Batu1.mp3 | 2022-08-06 00:56 | 8.0M | |
![[SND]](/icons/sound2.gif) | Batu-Nisan-Cahaya-Bidadari_n4SXte6Qjik.mp3 | 2022-07-05 10:09 | 8.0M | |
![[SND]](/icons/sound2.gif) | lil-homies.mp3 | 2022-07-09 17:02 | 8.0M | |
![[SND]](/icons/sound2.gif) | dom116.mp3 | 2022-07-03 06:24 | 8.0M | |
![[SND]](/icons/sound2.gif) | Linkin Park - Crawling.mp3 | 2022-07-10 10:48 | 8.0M | |
![[SND]](/icons/sound2.gif) | lagu10.mp3 | 2022-07-13 06:32 | 8.0M | |
![[SND]](/icons/sound2.gif) | goodbyetoaworld.mp3 | 2022-06-29 22:05 | 8.0M | |
![[SND]](/icons/sound2.gif) | o28.mp3 | 2022-07-07 22:13 | 8.0M | |
![[SND]](/icons/sound2.gif) | PD59.mp3 | 2022-07-01 13:06 | 8.0M | |
![[SND]](/icons/sound2.gif) | 001_ace_of_base_-_all_that_she_wants_.mp3 | 2022-07-05 14:23 | 8.0M | |
![[SND]](/icons/sound2.gif) | Lx24 - Уголёк.mp3 | 2022-07-01 10:09 | 8.0M | |
![[SND]](/icons/sound2.gif) | maksim-dozhd_5480234.mp3 | 2022-07-03 19:15 | 8.0M | |
![[SND]](/icons/sound2.gif) | Santiz - Унесёт.mp3 | 2022-06-29 21:02 | 8.0M | |
![[SND]](/icons/sound2.gif) | ahncl.mp3 | 2022-07-05 18:31 | 8.0M | |
![[SND]](/icons/sound2.gif) | Zedd_ Elley Duhé - Happy Now (Official Music Video)(MP3_320K).mp3 | 2022-07-05 18:05 | 8.0M | |
![[SND]](/icons/sound2.gif) | Ahn4215.mp3 | 2022-07-05 18:09 | 8.0M | |
![[SND]](/icons/sound2.gif) | AUD-20220703-WA0059.mp3 | 2022-07-05 20:30 | 8.0M | |
![[SND]](/icons/sound2.gif) | Лизгинка - Чеченская дагестанская.mp3 | 2022-07-05 07:01 | 8.0M | |
![[SND]](/icons/sound2.gif) | mobi34.mp3 | 2022-06-30 05:05 | 8.0M | |
![[SND]](/icons/sound2.gif) | han1.mp3 | 2022-07-08 07:02 | 8.0M | |
![[SND]](/icons/sound2.gif) | Pentakill feat. Tre Watson - Aftershock.mp3 | 2022-07-06 16:50 | 8.0M | |
![[SND]](/icons/sound2.gif) | MiyaGi_JEndshpil_-_Kolizejj_57475559.mp3 | 2022-08-04 16:39 | 8.0M | |
![[SND]](/icons/sound2.gif) | Герр Антон - Одинокий мужчина.mp3 | 2022-07-09 09:54 | 8.0M | |
![[SND]](/icons/sound2.gif) | zbida6.mp3 | 2022-07-08 11:25 | 8.0M | |
![[SND]](/icons/sound2.gif) | OKS.mp3 | 2022-07-01 10:50 | 8.0M | |
![[SND]](/icons/sound2.gif) | yan6.mp3 | 2022-07-14 15:33 | 8.0M | |
![[SND]](/icons/sound2.gif) | sadtrs2.mp3 | 2022-06-30 12:28 | 8.0M | |
![[SND]](/icons/sound2.gif) | Ilkay Sencan - Do It.mp3 | 2022-07-10 11:52 | 8.0M | |
![[SND]](/icons/sound2.gif) | Spy.mp3 | 2022-07-11 11:45 | 8.0M | |
![[SND]](/icons/sound2.gif) | TOTTO27.mp3 | 2022-07-15 16:32 | 8.0M | |
![[SND]](/icons/sound2.gif) | А. Губин-Такие девушки как звезды-kissvk.com.mp3 | 2022-07-06 01:28 | 8.0M | |
![[SND]](/icons/sound2.gif) | KLUTUK.mp3 | 2022-06-30 04:24 | 8.0M | |
![[SND]](/icons/sound2.gif) | TOTO.mp3 | 2022-07-05 01:33 | 8.0M | |
![[SND]](/icons/sound2.gif) | vedi11.mp3 | 2022-06-29 12:26 | 8.0M | |
![[SND]](/icons/sound2.gif) | djpompom.mp3 | 2022-07-07 21:09 | 8.0M | |
![[SND]](/icons/sound2.gif) | Sara Smile HALL AND OATES - 3:18:22, 2.49 PM.mp3 | 2022-07-14 01:47 | 8.0M | |
![[SND]](/icons/sound2.gif) | Lupin III - Planet O - Sigla Completa 550 [Stereo] con Download!.mp3 | 2022-06-30 19:00 | 8.0M | |
![[SND]](/icons/sound2.gif) | friend.mp3 | 2022-07-01 19:32 | 8.0M | |
![[SND]](/icons/sound2.gif) | nana13.mp3 | 2022-06-28 16:02 | 8.0M | |
![[SND]](/icons/sound2.gif) | D.K9.mp3 | 2022-07-12 14:19 | 8.0M | |
![[SND]](/icons/sound2.gif) | ФСБ ᵁᶠᴬ🇷🇺 - marlboro.mp3 | 2022-07-10 06:21 | 8.0M | |
![[SND]](/icons/sound2.gif) | Ford (Loud AF) (DJJOhAL.Com).mp3 | 2022-07-13 03:19 | 8.0M | |
![[SND]](/icons/sound2.gif) | zbida8.mp3 | 2022-07-08 11:25 | 8.0M | |
![[SND]](/icons/sound2.gif) | Cradles - Sub Urban.mp3 | 2022-07-06 15:24 | 8.0M | |
![[SND]](/icons/sound2.gif) | Yjst.mp3 | 2022-07-12 18:45 | 8.0M | |
![[SND]](/icons/sound2.gif) | Alone _ Aman Sotal _ Latest punjabi songs 2022 _ Joban beats music(MP3_320K).mp3 | 2022-07-07 15:17 | 8.0M | |
![[SND]](/icons/sound2.gif) | Rick4.mp3 | 2022-07-09 07:19 | 8.0M | |
![[SND]](/icons/sound2.gif) | rnr10.mp3 | 2022-07-02 10:56 | 8.0M | |
![[SND]](/icons/sound2.gif) | solo1.mp3 | 2022-07-06 16:51 | 8.0M | |
![[SND]](/icons/sound2.gif) | slowdj.mp3 | 2022-07-05 04:04 | 8.0M | |
![[SND]](/icons/sound2.gif) | НЕ.KURILI - Обитаем.mp3 | 2022-07-16 12:19 | 8.0M | |
![[SND]](/icons/sound2.gif) | Maine.mp3 | 2022-07-08 10:40 | 8.0M | |
![[SND]](/icons/sound2.gif) | JoJo's OST - Bloody Stream.mp3 | 2022-06-30 21:12 | 8.0M | |
![[SND]](/icons/sound2.gif) | Jinne_SaahFul_Song_-_Ninja_-_Jaid_(getmp3.pro).mp3 | 2022-07-14 15:14 | 8.0M | |
![[SND]](/icons/sound2.gif) | YNNV.mp3 | 2022-07-01 03:47 | 8.0M | |
![[SND]](/icons/sound2.gif) | vedi92.mp3 | 2022-06-29 12:22 | 8.0M | |
![[SND]](/icons/sound2.gif) | Tri_dnya_dozhdya_-_Otpuskajj_74140607.mp3 | 2022-07-13 14:22 | 8.0M | |
![[SND]](/icons/sound2.gif) | acdc_-_guns_for_hire_(z2.fm).mp3 | 2022-07-04 19:58 | 8.0M | |
![[SND]](/icons/sound2.gif) | mihail-grebenshikov-grustnye-noty.mp3 | 2022-07-30 18:22 | 8.0M | |
![[SND]](/icons/sound2.gif) | MiyaGi feat. Andy Panda - Utopia.mp3 | 2022-06-28 17:02 | 8.0M | |
![[SND]](/icons/sound2.gif) | Thomas.mp3 | 2022-06-27 13:20 | 8.0M | |
![[SND]](/icons/sound2.gif) | Jay Rock — Hood Gone Love It (Ft. Kendrick Lemar) (www.lightaudio.ru).mp3 | 2022-07-15 20:04 | 8.0M | |
![[SND]](/icons/sound2.gif) | zhanulka - ты похож на кота (yottvmottv remix).mp3 | 2022-07-08 19:02 | 8.0M | |
![[SND]](/icons/sound2.gif) | boom.mp3 | 2022-07-10 14:35 | 8.0M | |
![[SND]](/icons/sound2.gif) | Boom_Tarat_Tarat_-_Wilie_Revilliame_(getmp3.pro).mp3 | 2022-07-10 14:34 | 8.0M | |
![[SND]](/icons/sound2.gif) | NJ5.mp3 | 2022-07-02 05:30 | 8.0M | |
![[SND]](/icons/sound2.gif) | cartel-de-santa-mi-chiquita-video.mp3 | 2022-07-04 20:45 | 8.0M | |
![[SND]](/icons/sound2.gif) | envy69.mp3 | 2022-06-28 09:35 | 8.0M | |
![[SND]](/icons/sound2.gif) | bini.mp3 | 2022-07-21 12:03 | 8.0M | |
![[SND]](/icons/sound2.gif) | Cake - Short Skirt Long Jacket.mp3 | 2022-07-04 00:50 | 8.0M | |
![[SND]](/icons/sound2.gif) | Abel.mp3 | 2022-07-16 05:25 | 8.0M | |
![[SND]](/icons/sound2.gif) | EXTREME DECAF BASS TEST (BASS BOOSTED 30 HZ).mp3 | 2022-06-28 16:48 | 8.0M | |
![[SND]](/icons/sound2.gif) | vedi42.mp3 | 2022-06-29 12:31 | 8.0M | |
![[SND]](/icons/sound2.gif) | Пика - Фантанчик с чёрным дельфином.mp3 | 2022-06-29 15:51 | 8.0M | |
![[SND]](/icons/sound2.gif) | soap.mp3 | 2022-07-16 01:56 | 8.0M | |
![[SND]](/icons/sound2.gif) | PAUWINAKO.mp3 | 2022-06-27 15:13 | 8.0M | |
![[SND]](/icons/sound2.gif) | Vp14.mp3 | 2022-07-24 06:04 | 8.0M | |
![[SND]](/icons/sound2.gif) | hendy2.mp3 | 2022-07-12 04:51 | 8.0M | |
![[SND]](/icons/sound2.gif) | Pami1.mp3 | 2022-07-01 02:20 | 8.0M | |
![[SND]](/icons/sound2.gif) | DJ CAMPURAN .mp3 | 2022-07-11 16:30 | 8.0M | |
![[SND]](/icons/sound2.gif) | Anas1.mp3 | 2022-07-15 23:38 | 8.0M | |
![[SND]](/icons/sound2.gif) | Adik4.mp3 | 2022-07-11 19:07 | 8.0M | |
![[SND]](/icons/sound2.gif) | MiyaGi_Marlboro_Remix_by_Qwesty.mp3 | 2022-07-16 07:18 | 8.0M | |
![[SND]](/icons/sound2.gif) | Rhey9.mp3 | 2022-06-28 11:58 | 8.0M | |
![[SND]](/icons/sound2.gif) | Moonnik.mp3 | 2022-07-01 08:53 | 8.0M | |
![[SND]](/icons/sound2.gif) | msc1.mp3 | 2022-06-28 07:13 | 8.0M | |
![[SND]](/icons/sound2.gif) | FACE ft. Metrik - ПОДРУГА ПОДРУГ DnB Remix Prod.TripSauce.mp3 | 2022-07-08 07:14 | 8.0M | |
![[SND]](/icons/sound2.gif) | imagine-dragons-believer.mp3 | 2022-07-13 16:54 | 8.0M | |
![[VID]](/icons/movie.gif) | Record_2022-07-23-21-28-24.mp4 | 2022-07-25 17:34 | 7.9M | |
![[SND]](/icons/sound2.gif) | LXST_CXNTURY_-_DEEP_FUSION_74343457.mp3 | 2022-06-29 18:21 | 7.9M | |
![[SND]](/icons/sound2.gif) | ES_Perdidos (Cushy And Ballpoint Remix) - Cushy.mp3 | 2022-07-15 13:35 | 7.9M | |
![[SND]](/icons/sound2.gif) | Srp6.mp3 | 2022-07-04 16:49 | 7.9M | |
![[SND]](/icons/sound2.gif) | Skillet_-_Finish_Line_65833903.mp3 | 2022-07-08 11:25 | 7.9M | |
![[SND]](/icons/sound2.gif) | ookan16.mp3 | 2022-07-08 09:23 | 7.9M | |
![[SND]](/icons/sound2.gif) | don7.mp3 | 2022-07-17 03:05 | 7.9M | |
![[SND]](/icons/sound2.gif) | zrkdjslebew.mp3 | 2022-06-29 07:43 | 7.9M | |
![[SND]](/icons/sound2.gif) | Let Me Down Slowly x Ek Tarfa x Parshawan x Mann Mera (ACV Mashup) - Alec Benjamin, Darshan Raval.mp3 | 2022-07-06 08:06 | 7.9M | |
![[SND]](/icons/sound2.gif) | mobi43.mp3 | 2022-07-01 02:17 | 7.9M | |
![[SND]](/icons/sound2.gif) | nana7.mp3 | 2022-06-28 16:01 | 7.9M | |
![[SND]](/icons/sound2.gif) | 503731_F-777---Deadlocked-Full.mp3 | 2022-07-01 07:37 | 7.9M | |
![[SND]](/icons/sound2.gif) | aglass12.mp3 | 2022-07-17 13:48 | 7.9M | |
![[SND]](/icons/sound2.gif) | cuki7.mp3 | 2022-06-28 16:06 | 7.9M | |
![[SND]](/icons/sound2.gif) | Аукцыон - Дорога.mp3 | 2022-07-07 08:17 | 7.9M | |
![[SND]](/icons/sound2.gif) | ZNN.mp3 | 2022-07-13 08:54 | 7.9M | |
![[SND]](/icons/sound2.gif) | BantalGuling2.mp3 | 2022-06-28 06:48 | 7.9M | |
![[SND]](/icons/sound2.gif) | sampe.bawah🥶.mp3 | 2022-07-02 03:53 | 7.9M | |
![[SND]](/icons/sound2.gif) | sws3.mp3 | 2022-07-06 00:17 | 7.9M | |
![[SND]](/icons/sound2.gif) | 1barzanja3far.mp3 | 2022-07-12 15:19 | 7.9M | |
![[SND]](/icons/sound2.gif) | vedi47.mp3 | 2022-06-29 12:11 | 7.9M | |
![[SND]](/icons/sound2.gif) | MAHIKA - Adie,Janine Berdin (lyrics) (320K).mp3 | 2022-07-01 08:13 | 7.9M | |
![[SND]](/icons/sound2.gif) | zrkhere.mp3 | 2022-06-29 07:49 | 7.9M | |
![[SND]](/icons/sound2.gif) | dln10.mp3 | 2022-06-28 06:34 | 7.9M | |
![[SND]](/icons/sound2.gif) | Boundless2.mp3 | 2022-07-06 21:37 | 7.9M | |
![[SND]](/icons/sound2.gif) | ugun13.mp3 | 2022-07-11 17:42 | 7.9M | |
![[SND]](/icons/sound2.gif) | neongutsuzi.mp3 | 2022-07-08 18:53 | 7.9M | |
![[SND]](/icons/sound2.gif) | My Lady Of Water And Fire.mp3 | 2022-07-23 00:10 | 7.9M | |
![[SND]](/icons/sound2.gif) | vasco1.mp3 | 2022-07-07 06:07 | 7.9M | |
![[SND]](/icons/sound2.gif) | Макс Корж - Малый повзрослел.mp3 | 2022-07-01 10:45 | 7.9M | |
![[SND]](/icons/sound2.gif) | rs.mp3 | 2022-07-15 21:48 | 7.9M | |
![[SND]](/icons/sound2.gif) | Gruppa_Stasa_Namina_Cvety_-_Pust_budet_tak_1981_63875743.mp3 | 2022-07-05 08:25 | 7.9M | |
![[SND]](/icons/sound2.gif) | vedi21.mp3 | 2022-06-29 12:27 | 7.9M | |
![[SND]](/icons/sound2.gif) | lagu11.mp3 | 2022-07-13 06:32 | 7.9M | |
![[SND]](/icons/sound2.gif) | HareYaFlower.mp3 | 2022-06-29 11:10 | 7.9M | |
![[SND]](/icons/sound2.gif) | Hare Ya Flower.mp3 | 2022-06-29 09:53 | 7.9M | |
![[SND]](/icons/sound2.gif) | jedarjeder.mp3 | 2022-07-11 21:29 | 7.9M | |
![[SND]](/icons/sound2.gif) | sunroof123.mp3 | 2022-06-29 15:52 | 7.9M | |
![[SND]](/icons/sound2.gif) | Градусы - Научиться Бы Не Париться.mp3 | 2022-07-01 09:55 | 7.9M | |
![[SND]](/icons/sound2.gif) | yan22.mp3 | 2022-07-14 15:32 | 7.9M | |
![[SND]](/icons/sound2.gif) | rs20.mp3 | 2022-07-15 21:48 | 7.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Neto Peña Cholo En Un Low Video Oficial_320kbps.mp3 | 2022-06-30 08:26 | 7.9M | |
![[SND]](/icons/sound2.gif) | Alexis.mp3 | 2022-07-12 00:03 | 7.9M | |
![[SND]](/icons/sound2.gif) | JEndshpil_feat_TumaniYO_-_Its_my_life_54595531.mp3 | 2022-06-27 19:00 | 7.9M | |
![[SND]](/icons/sound2.gif) | Сектор Газа - Life.mp3 | 2022-07-06 17:57 | 7.9M | |
![[SND]](/icons/sound2.gif) | 👑.T.I.C.H.O.N.O.W.👑-караван плана-kissvk.com.mp3 | 2022-07-07 13:43 | 7.9M | |
![[SND]](/icons/sound2.gif) | TOTTO8.mp3 | 2022-07-15 16:38 | 7.9M | |
![[SND]](/icons/sound2.gif) | pndo10.mp3 | 2022-06-28 16:05 | 7.9M | |
![[SND]](/icons/sound2.gif) | vedi72.mp3 | 2022-06-29 12:17 | 7.9M | |
![[SND]](/icons/sound2.gif) | Duke Dumont - Ocean Drive (megasongs.me).mp3 | 2022-07-07 10:10 | 7.9M | |
![[SND]](/icons/sound2.gif) | Mr.NЁMA, гр. Домбай - Приора (Remix).mp3 | 2022-07-05 12:46 | 7.9M | |
![[SND]](/icons/sound2.gif) | MiyaGi_JEndshpil_-_Listen_to_Your_Heart_57475568.mp3 | 2022-07-02 15:18 | 7.9M | |
![[SND]](/icons/sound2.gif) | 80 BPM POP structure three - 6:23:21, 9.57 PM.mp3 | 2022-07-14 01:56 | 7.9M | |
![[SND]](/icons/sound2.gif) | BadCurt_Kyort_ya_tebya_lyublyu.mp3 | 2022-07-06 21:12 | 7.9M | |
![[SND]](/icons/sound2.gif) | The Promised Neverland OST - Isabella’s Lullaby.mp3 | 2022-07-22 02:26 | 7.9M | |
![[SND]](/icons/sound2.gif) | zbida4.mp3 | 2022-07-08 01:28 | 7.9M | |
![[SND]](/icons/sound2.gif) | JAY1.mp3 | 2022-07-13 09:08 | 7.9M | |
![[SND]](/icons/sound2.gif) | Miley_Cyrus_-_Sweet_Jane_MTV_Unplu_(getmp3.pro).mp3 | 2022-07-06 23:42 | 7.9M | |
![[SND]](/icons/sound2.gif) | Nurminskiy_-_Vezi_menya_beliiy_500.mp3 | 2022-07-06 11:08 | 7.9M | |
![[SND]](/icons/sound2.gif) | MIA_-_Paper_Planes_47896849.mp3 | 2022-07-05 17:40 | 7.9M | |
![[SND]](/icons/sound2.gif) | sugdad.mp3 | 2022-06-27 17:19 | 7.9M | |
![[SND]](/icons/sound2.gif) | Lyudmila_Zykina_E.Kolmanovskij-E.Evtushenko_-_Bezhit_reka_(Gybka.com).mp3 | 2022-07-12 06:16 | 7.9M | |
![[SND]](/icons/sound2.gif) | aarda.mp3 | 2022-07-14 14:17 | 7.9M | |
![[SND]](/icons/sound2.gif) | vedi2.mp3 | 2022-06-29 12:24 | 7.9M | |
![[SND]](/icons/sound2.gif) | merry.mp3 | 2022-07-04 03:34 | 7.9M | |
![[SND]](/icons/sound2.gif) | magic1.mp3 | 2022-07-02 02:02 | 7.9M | |
![[SND]](/icons/sound2.gif) | HA2.mp3 | 2022-07-13 07:45 | 7.9M | |
![[SND]](/icons/sound2.gif) | glass-animals-heat-waves-slowed-mp3.mp3 | 2022-06-29 12:36 | 7.9M | |
![[SND]](/icons/sound2.gif) | GTA4.mp3 | 2022-06-27 17:16 | 7.9M | |
![[SND]](/icons/sound2.gif) | mad8.mp3 | 2022-07-06 12:53 | 7.9M | |
![[SND]](/icons/sound2.gif) | pb7.mp3 | 2022-06-28 16:08 | 7.9M | |
![[SND]](/icons/sound2.gif) | toxic31.mp3 | 2022-07-04 11:04 | 7.9M | |
![[VID]](/icons/movie.gif) | Westlife - Beautiful in white (Lyrics) (1).mp4 | 2022-07-02 14:10 | 7.9M | |
![[SND]](/icons/sound2.gif) | Лигали - Джаная(rmx slow).mp3 | 2022-07-01 09:11 | 7.9M | |
![[SND]](/icons/sound2.gif) | Kayapala.mp3 | 2022-06-29 04:09 | 7.9M | |
![[SND]](/icons/sound2.gif) | chinatown.mp3 | 2022-07-02 13:57 | 7.9M | |
![[SND]](/icons/sound2.gif) | Ind4.mp3 | 2022-07-01 02:14 | 7.9M | |
![[SND]](/icons/sound2.gif) | Crazyfrog.mp3 | 2022-07-04 01:02 | 7.9M | |
![[VID]](/icons/movie.gif) | tt_200001tzKx.mp4 | 2022-07-30 05:16 | 7.9M | |
![[SND]](/icons/sound2.gif) | korolishyt.mp3 | 2022-06-28 15:13 | 7.9M | |
![[SND]](/icons/sound2.gif) | Test_mixdown.mp3 | 2022-07-14 03:51 | 7.9M | |
![[SND]](/icons/sound2.gif) | bijar.mp3 | 2022-08-01 05:35 | 7.9M | |
![[SND]](/icons/sound2.gif) | PD51.mp3 | 2022-06-30 20:50 | 7.9M | |
![[SND]](/icons/sound2.gif) | prikolnoezv.mp3 | 2022-07-21 09:57 | 7.9M | |
![[SND]](/icons/sound2.gif) | Bare_Jams_-_Cold_Treats_64375405.mp3 | 2022-07-23 14:39 | 7.9M | |
![[SND]](/icons/sound2.gif) | Master Of Puppets.mp3 | 2022-07-09 06:46 | 7.9M | |
![[SND]](/icons/sound2.gif) | Vp555.mp3 | 2022-07-09 16:04 | 7.9M | |
![[SND]](/icons/sound2.gif) | Олег Газманов - РОССИЯ, Вперёд!!!!.mp3 | 2022-07-05 08:04 | 7.9M | |
![[SND]](/icons/sound2.gif) | Conjunto de Fiesta - USRR - Gimn Sovyetskogo Soyuza - 1977-1991 (Himno nacional .mp3 | 2022-07-09 10:26 | 7.9M | |
![[SND]](/icons/sound2.gif) | rbt.mp3 | 2022-07-02 20:45 | 7.9M | |
![[SND]](/icons/sound2.gif) | Оксана Ковалевская - Он не знает ничего.mp3 | 2022-07-06 14:58 | 7.9M | |
![[SND]](/icons/sound2.gif) | o13.mp3 | 2022-07-07 22:05 | 7.9M | |
![[SND]](/icons/sound2.gif) | djocoy3.mp3 | 2022-07-03 13:33 | 7.9M | |
![[SND]](/icons/sound2.gif) | Just A Lil Bit.mp3 | 2022-07-17 19:26 | 7.9M | |
![[SND]](/icons/sound2.gif) | zrkheat.mp3 | 2022-06-29 07:49 | 7.9M | |
![[SND]](/icons/sound2.gif) | Rhey23.mp3 | 2022-06-28 12:01 | 7.9M | |
![[SND]](/icons/sound2.gif) | ckydg.mp3 | 2022-07-15 18:42 | 7.9M | |
![[SND]](/icons/sound2.gif) | Vuska Zippo - Друзья рядом,душа кайфует.mp3 | 2022-07-06 23:08 | 7.9M | |
![[SND]](/icons/sound2.gif) | Mars_-_Tancujj_63123166.mp3 | |